/*!
FullCalendar Premium Bundle v6.0.2
Docs & License: https://fullcalendar.io/docs/initialize-globals
(c) 2022 Adam Shaw
*/
var FullCalendar = (function (exports) {
    'use strict';

    var n,l$1,u$1,i$1,t,o,r$1,f$1={},e$1=[],c$1=/acit|ex(?:s|g|n|p|$)|rph|grid|ows|mnc|ntw|ine[ch]|zoo|^ord|itera/i;function s(n,l){for(var u in l)n[u]=l[u];return n}function a$1(n){var l=n.parentNode;l&&l.removeChild(n);}function h(l,u,i){var t,o,r,f={};for(r in u)"key"==r?t=u[r]:"ref"==r?o=u[r]:f[r]=u[r];if(arguments.length>2&&(f.children=arguments.length>3?n.call(arguments,2):i),"function"==typeof l&&null!=l.defaultProps)for(r in l.defaultProps)void 0===f[r]&&(f[r]=l.defaultProps[r]);return v$1(l,f,t,o,null)}function v$1(n,i,t,o,r){var f={type:n,props:i,key:t,ref:o,__k:null,__:null,__b:0,__e:null,__d:void 0,__c:null,__h:null,constructor:void 0,__v:null==r?++u$1:r};return null==r&&null!=l$1.vnode&&l$1.vnode(f),f}function y(){return {current:null}}function p(n){return n.children}function d(n,l){this.props=n,this.context=l;}function _(n,l){if(null==l)return n.__?_(n.__,n.__.__k.indexOf(n)+1):null;for(var u;l<n.__k.length;l++)if(null!=(u=n.__k[l])&&null!=u.__e)return u.__e;return "function"==typeof n.type?_(n):null}function k$1(n){var l,u;if(null!=(n=n.__)&&null!=n.__c){for(n.__e=n.__c.base=null,l=0;l<n.__k.length;l++)if(null!=(u=n.__k[l])&&null!=u.__e){n.__e=n.__c.base=u.__e;break}return k$1(n)}}function b$1(n){(!n.__d&&(n.__d=!0)&&t.push(n)&&!g$2.__r++||o!==l$1.debounceRendering)&&((o=l$1.debounceRendering)||setTimeout)(g$2);}function g$2(){for(var n;g$2.__r=t.length;)n=t.sort(function(n,l){return n.__v.__b-l.__v.__b}),t=[],n.some(function(n){var l,u,i,t,o,r;n.__d&&(o=(t=(l=n).__v).__e,(r=l.__P)&&(u=[],(i=s({},t)).__v=t.__v+1,j$2(r,t,i,l.__n,void 0!==r.ownerSVGElement,null!=t.__h?[o]:null,u,null==o?_(t):o,t.__h),z$1(u,t),t.__e!=o&&k$1(t)));});}function w$2(n,l,u,i,t,o,r,c,s,a){var h,y,d,k,b,g,w,x=i&&i.__k||e$1,C=x.length;for(u.__k=[],h=0;h<l.length;h++)if(null!=(k=u.__k[h]=null==(k=l[h])||"boolean"==typeof k?null:"string"==typeof k||"number"==typeof k||"bigint"==typeof k?v$1(null,k,null,null,k):Array.isArray(k)?v$1(p,{children:k},null,null,null):k.__b>0?v$1(k.type,k.props,k.key,k.ref?k.ref:null,k.__v):k)){if(k.__=u,k.__b=u.__b+1,null===(d=x[h])||d&&k.key==d.key&&k.type===d.type)x[h]=void 0;else for(y=0;y<C;y++){if((d=x[y])&&k.key==d.key&&k.type===d.type){x[y]=void 0;break}d=null;}j$2(n,k,d=d||f$1,t,o,r,c,s,a),b=k.__e,(y=k.ref)&&d.ref!=y&&(w||(w=[]),d.ref&&w.push(d.ref,null,k),w.push(y,k.__c||b,k)),null!=b?(null==g&&(g=b),"function"==typeof k.type&&k.__k===d.__k?k.__d=s=m$1(k,s,n):s=A(n,k,d,x,b,s),"function"==typeof u.type&&(u.__d=s)):s&&d.__e==s&&s.parentNode!=n&&(s=_(d));}for(u.__e=g,h=C;h--;)null!=x[h]&&N(x[h],x[h]);if(w)for(h=0;h<w.length;h++)M(w[h],w[++h],w[++h]);}function m$1(n,l,u){for(var i,t=n.__k,o=0;t&&o<t.length;o++)(i=t[o])&&(i.__=n,l="function"==typeof i.type?m$1(i,l,u):A(u,i,i,t,i.__e,l));return l}function x$1(n,l){return l=l||[],null==n||"boolean"==typeof n||(Array.isArray(n)?n.some(function(n){x$1(n,l);}):l.push(n)),l}function A(n,l,u,i,t,o){var r,f,e;if(void 0!==l.__d)r=l.__d,l.__d=void 0;else if(null==u||t!=o||null==t.parentNode)n:if(null==o||o.parentNode!==n)n.appendChild(t),r=null;else {for(f=o,e=0;(f=f.nextSibling)&&e<i.length;e+=1)if(f==t)break n;n.insertBefore(t,o),r=o;}return void 0!==r?r:t.nextSibling}function C$1(n,l,u,i,t){var o;for(o in u)"children"===o||"key"===o||o in l||H$1(n,o,null,u[o],i);for(o in l)t&&"function"!=typeof l[o]||"children"===o||"key"===o||"value"===o||"checked"===o||u[o]===l[o]||H$1(n,o,l[o],u[o],i);}function $$1(n,l,u){"-"===l[0]?n.setProperty(l,u):n[l]=null==u?"":"number"!=typeof u||c$1.test(l)?u:u+"px";}function H$1(n,l,u,i,t){var o;n:if("style"===l)if("string"==typeof u)n.style.cssText=u;else {if("string"==typeof i&&(n.style.cssText=i=""),i)for(l in i)u&&l in u||$$1(n.style,l,"");if(u)for(l in u)i&&u[l]===i[l]||$$1(n.style,l,u[l]);}else if("o"===l[0]&&"n"===l[1])o=l!==(l=l.replace(/Capture$/,"")),l=l.toLowerCase()in n?l.toLowerCase().slice(2):l.slice(2),n.l||(n.l={}),n.l[l+o]=u,u?i||n.addEventListener(l,o?T$1:I$1,o):n.removeEventListener(l,o?T$1:I$1,o);else if("dangerouslySetInnerHTML"!==l){if(t)l=l.replace(/xlink(H|:h)/,"h").replace(/sName$/,"s");else if("href"!==l&&"list"!==l&&"form"!==l&&"tabIndex"!==l&&"download"!==l&&l in n)try{n[l]=null==u?"":u;break n}catch(n){}"function"==typeof u||(null==u||!1===u&&-1==l.indexOf("-")?n.removeAttribute(l):n.setAttribute(l,u));}}function I$1(n){this.l[n.type+!1](l$1.event?l$1.event(n):n);}function T$1(n){this.l[n.type+!0](l$1.event?l$1.event(n):n);}function j$2(n,u,i,t,o,r,f,e,c){var a,h,v,y,_,k,b,g,m,x,A,C,$,H,I,T=u.type;if(void 0!==u.constructor)return null;null!=i.__h&&(c=i.__h,e=u.__e=i.__e,u.__h=null,r=[e]),(a=l$1.__b)&&a(u);try{n:if("function"==typeof T){if(g=u.props,m=(a=T.contextType)&&t[a.__c],x=a?m?m.props.value:a.__:t,i.__c?b=(h=u.__c=i.__c).__=h.__E:("prototype"in T&&T.prototype.render?u.__c=h=new T(g,x):(u.__c=h=new d(g,x),h.constructor=T,h.render=O),m&&m.sub(h),h.props=g,h.state||(h.state={}),h.context=x,h.__n=t,v=h.__d=!0,h.__h=[],h._sb=[]),null==h.__s&&(h.__s=h.state),null!=T.getDerivedStateFromProps&&(h.__s==h.state&&(h.__s=s({},h.__s)),s(h.__s,T.getDerivedStateFromProps(g,h.__s))),y=h.props,_=h.state,v)null==T.getDerivedStateFromProps&&null!=h.componentWillMount&&h.componentWillMount(),null!=h.componentDidMount&&h.__h.push(h.componentDidMount);else {if(null==T.getDerivedStateFromProps&&g!==y&&null!=h.componentWillReceiveProps&&h.componentWillReceiveProps(g,x),!h.__e&&null!=h.shouldComponentUpdate&&!1===h.shouldComponentUpdate(g,h.__s,x)||u.__v===i.__v){for(h.props=g,h.state=h.__s,u.__v!==i.__v&&(h.__d=!1),h.__v=u,u.__e=i.__e,u.__k=i.__k,u.__k.forEach(function(n){n&&(n.__=u);}),A=0;A<h._sb.length;A++)h.__h.push(h._sb[A]);h._sb=[],h.__h.length&&f.push(h);break n}null!=h.componentWillUpdate&&h.componentWillUpdate(g,h.__s,x),null!=h.componentDidUpdate&&h.__h.push(function(){h.componentDidUpdate(y,_,k);});}if(h.context=x,h.props=g,h.__v=u,h.__P=n,C=l$1.__r,$=0,"prototype"in T&&T.prototype.render){for(h.state=h.__s,h.__d=!1,C&&C(u),a=h.render(h.props,h.state,h.context),H=0;H<h._sb.length;H++)h.__h.push(h._sb[H]);h._sb=[];}else do{h.__d=!1,C&&C(u),a=h.render(h.props,h.state,h.context),h.state=h.__s;}while(h.__d&&++$<25);h.state=h.__s,null!=h.getChildContext&&(t=s(s({},t),h.getChildContext())),v||null==h.getSnapshotBeforeUpdate||(k=h.getSnapshotBeforeUpdate(y,_)),I=null!=a&&a.type===p&&null==a.key?a.props.children:a,w$2(n,Array.isArray(I)?I:[I],u,i,t,o,r,f,e,c),h.base=u.__e,u.__h=null,h.__h.length&&f.push(h),b&&(h.__E=h.__=null),h.__e=!1;}else null==r&&u.__v===i.__v?(u.__k=i.__k,u.__e=i.__e):u.__e=L$1(i.__e,u,i,t,o,r,f,c);(a=l$1.diffed)&&a(u);}catch(n){u.__v=null,(c||null!=r)&&(u.__e=e,u.__h=!!c,r[r.indexOf(e)]=null),l$1.__e(n,u,i);}}function z$1(n,u){l$1.__c&&l$1.__c(u,n),n.some(function(u){try{n=u.__h,u.__h=[],n.some(function(n){n.call(u);});}catch(n){l$1.__e(n,u.__v);}});}function L$1(l,u,i,t,o,r,e,c){var s,h,v,y=i.props,p=u.props,d=u.type,k=0;if("svg"===d&&(o=!0),null!=r)for(;k<r.length;k++)if((s=r[k])&&"setAttribute"in s==!!d&&(d?s.localName===d:3===s.nodeType)){l=s,r[k]=null;break}if(null==l){if(null===d)return document.createTextNode(p);l=o?document.createElementNS("http://www.w3.org/2000/svg",d):document.createElement(d,p.is&&p),r=null,c=!1;}if(null===d)y===p||c&&l.data===p||(l.data=p);else {if(r=r&&n.call(l.childNodes),h=(y=i.props||f$1).dangerouslySetInnerHTML,v=p.dangerouslySetInnerHTML,!c){if(null!=r)for(y={},k=0;k<l.attributes.length;k++)y[l.attributes[k].name]=l.attributes[k].value;(v||h)&&(v&&(h&&v.__html==h.__html||v.__html===l.innerHTML)||(l.innerHTML=v&&v.__html||""));}if(C$1(l,p,y,o,c),v)u.__k=[];else if(k=u.props.children,w$2(l,Array.isArray(k)?k:[k],u,i,t,o&&"foreignObject"!==d,r,e,r?r[0]:i.__k&&_(i,0),c),null!=r)for(k=r.length;k--;)null!=r[k]&&a$1(r[k]);c||("value"in p&&void 0!==(k=p.value)&&(k!==l.value||"progress"===d&&!k||"option"===d&&k!==y.value)&&H$1(l,"value",k,y.value,!1),"checked"in p&&void 0!==(k=p.checked)&&k!==l.checked&&H$1(l,"checked",k,y.checked,!1));}return l}function M(n,u,i){try{"function"==typeof n?n(u):n.current=u;}catch(n){l$1.__e(n,i);}}function N(n,u,i){var t,o;if(l$1.unmount&&l$1.unmount(n),(t=n.ref)&&(t.current&&t.current!==n.__e||M(t,null,u)),null!=(t=n.__c)){if(t.componentWillUnmount)try{t.componentWillUnmount();}catch(n){l$1.__e(n,u);}t.base=t.__P=null,n.__c=void 0;}if(t=n.__k)for(o=0;o<t.length;o++)t[o]&&N(t[o],u,i||"function"!=typeof n.type);i||null==n.__e||a$1(n.__e),n.__=n.__e=n.__d=void 0;}function O(n,l,u){return this.constructor(n,u)}function P$1(u,i,t){var o,r,e;l$1.__&&l$1.__(u,i),r=(o="function"==typeof t)?null:t&&t.__k||i.__k,e=[],j$2(i,u=(!o&&t||i).__k=h(p,null,[u]),r||f$1,f$1,void 0!==i.ownerSVGElement,!o&&t?[t]:r?null:i.firstChild?n.call(i.childNodes):null,e,!o&&t?t:r?r.__e:i.firstChild,o),z$1(e,u);}function B$1(n,l){var u={__c:l="__cC"+r$1++,__:n,Consumer:function(n,l){return n.children(l)},Provider:function(n){var u,i;return this.getChildContext||(u=[],(i={})[l]=this,this.getChildContext=function(){return i},this.shouldComponentUpdate=function(n){this.props.value!==n.value&&u.some(b$1);},this.sub=function(n){u.push(n);var l=n.componentWillUnmount;n.componentWillUnmount=function(){u.splice(u.indexOf(n),1),l&&l.call(n);};}),n.children}};return u.Provider.__=u.Consumer.contextType=u}n=e$1.slice,l$1={__e:function(n,l,u,i){for(var t,o,r;l=l.__;)if((t=l.__c)&&!t.__)try{if((o=t.constructor)&&null!=o.getDerivedStateFromError&&(t.setState(o.getDerivedStateFromError(n)),r=t.__d),null!=t.componentDidCatch&&(t.componentDidCatch(n,i||{}),r=t.__d),r)return t.__E=t}catch(l){n=l;}throw n}},u$1=0,i$1=function(n){return null!=n&&void 0===n.constructor},d.prototype.setState=function(n,l){var u;u=null!=this.__s&&this.__s!==this.state?this.__s:this.__s=s({},this.state),"function"==typeof n&&(n=n(s({},u),this.props)),n&&s(u,n),null!=n&&this.__v&&(l&&this._sb.push(l),b$1(this));},d.prototype.forceUpdate=function(n){this.__v&&(this.__e=!0,n&&this.__h.push(n),b$1(this));},d.prototype.render=p,t=[],g$2.__r=0,r$1=0;

    var r,u,i,f=[],c=[],e=l$1.__b,a=l$1.__r,v=l$1.diffed,l=l$1.__c,m=l$1.unmount;function b(){for(var t;t=f.shift();)if(t.__P&&t.__H)try{t.__H.__h.forEach(k),t.__H.__h.forEach(w$1),t.__H.__h=[];}catch(r){t.__H.__h=[],l$1.__e(r,t.__v);}}l$1.__b=function(n){r=null,e&&e(n);},l$1.__r=function(n){a&&a(n);var i=(r=n.__c).__H;i&&(u===r?(i.__h=[],r.__h=[],i.__.forEach(function(n){n.__N&&(n.__=n.__N),n.__V=c,n.__N=n.i=void 0;})):(i.__h.forEach(k),i.__h.forEach(w$1),i.__h=[])),u=r;},l$1.diffed=function(t){v&&v(t);var o=t.__c;o&&o.__H&&(o.__H.__h.length&&(1!==f.push(o)&&i===l$1.requestAnimationFrame||((i=l$1.requestAnimationFrame)||j$1)(b)),o.__H.__.forEach(function(n){n.i&&(n.__H=n.i),n.__V!==c&&(n.__=n.__V),n.i=void 0,n.__V=c;})),u=r=null;},l$1.__c=function(t,r){r.some(function(t){try{t.__h.forEach(k),t.__h=t.__h.filter(function(n){return !n.__||w$1(n)});}catch(u){r.some(function(n){n.__h&&(n.__h=[]);}),r=[],l$1.__e(u,t.__v);}}),l&&l(t,r);},l$1.unmount=function(t){m&&m(t);var r,u=t.__c;u&&u.__H&&(u.__H.__.forEach(function(n){try{k(n);}catch(n){r=n;}}),u.__H=void 0,r&&l$1.__e(r,u.__v));};var g$1="function"==typeof requestAnimationFrame;function j$1(n){var t,r=function(){clearTimeout(u),g$1&&cancelAnimationFrame(t),setTimeout(n);},u=setTimeout(r,100);g$1&&(t=requestAnimationFrame(r));}function k(n){var t=r,u=n.__c;"function"==typeof u&&(n.__c=void 0,u()),r=t;}function w$1(n){var t=r;n.__c=n.__(),r=t;}

    function g(n,t){for(var e in t)n[e]=t[e];return n}function C(n,t){for(var e in n)if("__source"!==e&&!(e in t))return !0;for(var r in t)if("__source"!==r&&n[r]!==t[r])return !0;return !1}function w(n){this.props=n;}(w.prototype=new d).isPureReactComponent=!0,w.prototype.shouldComponentUpdate=function(n,t){return C(this.props,n)||C(this.state,t)};var x=l$1.__b;l$1.__b=function(n){n.type&&n.type.__f&&n.ref&&(n.props.ref=n.ref,n.ref=null),x&&x(n);};var T=l$1.__e;l$1.__e=function(n,t,e,r){if(n.then)for(var u,o=t;o=o.__;)if((u=o.__c)&&u.__c)return null==t.__e&&(t.__e=e.__e,t.__k=e.__k),u.__c(n,t);T(n,t,e,r);};var I=l$1.unmount;function L(n,t,e){return n&&(n.__c&&n.__c.__H&&(n.__c.__H.__.forEach(function(n){"function"==typeof n.__c&&n.__c();}),n.__c.__H=null),null!=(n=g({},n)).__c&&(n.__c.__P===e&&(n.__c.__P=t),n.__c=null),n.__k=n.__k&&n.__k.map(function(n){return L(n,t,e)})),n}function U(n,t,e){return n&&(n.__v=null,n.__k=n.__k&&n.__k.map(function(n){return U(n,t,e)}),n.__c&&n.__c.__P===t&&(n.__e&&e.insertBefore(n.__e,n.__d),n.__c.__e=!0,n.__c.__P=e)),n}function D(){this.__u=0,this.t=null,this.__b=null;}function F(n){var t=n.__.__c;return t&&t.__a&&t.__a(n)}function V(){this.u=null,this.o=null;}l$1.unmount=function(n){var t=n.__c;t&&t.__R&&t.__R(),t&&!0===n.__h&&(n.type=null),I&&I(n);},(D.prototype=new d).__c=function(n,t){var e=t.__c,r=this;null==r.t&&(r.t=[]),r.t.push(e);var u=F(r.__v),o=!1,i=function(){o||(o=!0,e.__R=null,u?u(l):l());};e.__R=i;var l=function(){if(!--r.__u){if(r.state.__a){var n=r.state.__a;r.__v.__k[0]=U(n,n.__c.__P,n.__c.__O);}var t;for(r.setState({__a:r.__b=null});t=r.t.pop();)t.forceUpdate();}},c=!0===t.__h;r.__u++||c||r.setState({__a:r.__b=r.__v.__k[0]}),n.then(i,i);},D.prototype.componentWillUnmount=function(){this.t=[];},D.prototype.render=function(n,e){if(this.__b){if(this.__v.__k){var r=document.createElement("div"),o=this.__v.__k[0].__c;this.__v.__k[0]=L(this.__b,r,o.__O=o.__P);}this.__b=null;}var i=e.__a&&h(p,null,n.fallback);return i&&(i.__h=null),[h(p,null,e.__a?null:n.children),i]};var W=function(n,t,e){if(++e[1]===e[0]&&n.o.delete(t),n.props.revealOrder&&("t"!==n.props.revealOrder[0]||!n.o.size))for(e=n.u;e;){for(;e.length>3;)e.pop()();if(e[1]<e[0])break;n.u=e=e[2];}};function P(n){return this.getChildContext=function(){return n.context},n.children}function $(n){var e=this,r=n.i;e.componentWillUnmount=function(){P$1(null,e.l),e.l=null,e.i=null;},e.i&&e.i!==r&&e.componentWillUnmount(),n.__v?(e.l||(e.i=r,e.l={nodeType:1,parentNode:r,childNodes:[],appendChild:function(n){this.childNodes.push(n),e.i.appendChild(n);},insertBefore:function(n,t){this.childNodes.push(n),e.i.appendChild(n);},removeChild:function(n){this.childNodes.splice(this.childNodes.indexOf(n)>>>1,1),e.i.removeChild(n);}}),P$1(h(P,{context:e.context},n.__v),e.l)):e.l&&e.componentWillUnmount();}function j(n,e){var r=h($,{__v:n,i:e});return r.containerInfo=e,r}(V.prototype=new d).__a=function(n){var t=this,e=F(t.__v),r=t.o.get(n);return r[0]++,function(u){var o=function(){t.props.revealOrder?(r.push(u),W(t,n,r)):u();};e?e(o):o();}},V.prototype.render=function(n){this.u=null,this.o=new Map;var t=x$1(n.children);n.revealOrder&&"b"===n.revealOrder[0]&&t.reverse();for(var e=t.length;e--;)this.o.set(t[e],this.u=[1,0,this.u]);return n.children},V.prototype.componentDidUpdate=V.prototype.componentDidMount=function(){var n=this;this.o.forEach(function(t,e){W(n,e,t);});};var z="undefined"!=typeof Symbol&&Symbol.for&&Symbol.for("react.element")||60103,B=/^(?:accent|alignment|arabic|baseline|cap|clip(?!PathU)|color|dominant|fill|flood|font|glyph(?!R)|horiz|image|letter|lighting|marker(?!H|W|U)|overline|paint|pointer|shape|stop|strikethrough|stroke|text(?!L)|transform|underline|unicode|units|v|vector|vert|word|writing|x(?!C))[A-Z]/,H="undefined"!=typeof document,Z=function(n){return ("undefined"!=typeof Symbol&&"symbol"==typeof Symbol()?/fil|che|rad/i:/fil|che|ra/i).test(n)};d.prototype.isReactComponent={},["componentWillMount","componentWillReceiveProps","componentWillUpdate"].forEach(function(t){Object.defineProperty(d.prototype,t,{configurable:!0,get:function(){return this["UNSAFE_"+t]},set:function(n){Object.defineProperty(this,t,{configurable:!0,writable:!0,value:n});}});});var G=l$1.event;function J(){}function K(){return this.cancelBubble}function Q(){return this.defaultPrevented}l$1.event=function(n){return G&&(n=G(n)),n.persist=J,n.isPropagationStopped=K,n.isDefaultPrevented=Q,n.nativeEvent=n};var nn={configurable:!0,get:function(){return this.class}},tn=l$1.vnode;l$1.vnode=function(n){var t=n.type,e=n.props,u=e;if("string"==typeof t){var o=-1===t.indexOf("-");for(var i in u={},e){var l=e[i];H&&"children"===i&&"noscript"===t||"value"===i&&"defaultValue"in e&&null==l||("defaultValue"===i&&"value"in e&&null==e.value?i="value":"download"===i&&!0===l?l="":/ondoubleclick/i.test(i)?i="ondblclick":/^onchange(textarea|input)/i.test(i+t)&&!Z(e.type)?i="oninput":/^onfocus$/i.test(i)?i="onfocusin":/^onblur$/i.test(i)?i="onfocusout":/^on(Ani|Tra|Tou|BeforeInp|Compo)/.test(i)?i=i.toLowerCase():o&&B.test(i)?i=i.replace(/[A-Z0-9]/g,"-$&").toLowerCase():null===l&&(l=void 0),/^oninput$/i.test(i)&&(i=i.toLowerCase(),u[i]&&(i="oninputCapture")),u[i]=l);}"select"==t&&u.multiple&&Array.isArray(u.value)&&(u.value=x$1(e.children).forEach(function(n){n.props.selected=-1!=u.value.indexOf(n.props.value);})),"select"==t&&null!=u.defaultValue&&(u.value=x$1(e.children).forEach(function(n){n.props.selected=u.multiple?-1!=u.defaultValue.indexOf(n.props.value):u.defaultValue==n.props.value;})),n.props=u,e.class!=e.className&&(nn.enumerable="className"in e,null!=e.className&&(u.class=e.className),Object.defineProperty(u,"className",nn));}n.$$typeof=z,tn&&tn(n);};var en=l$1.__r;l$1.__r=function(n){en&&en(n),n.__c;};

    function injectStyles(css) {
        if (!css || typeof document === 'undefined') {
            return;
        }
        const head = document.head || document.getElementsByTagName('head')[0];
        const style = document.createElement('style');
        style.type = 'text/css';
        head.appendChild(style);
        if (style.styleSheet) {
            style.styleSheet.cssText = css;
        }
        else {
            style.appendChild(document.createTextNode(css));
        }
    }

    class DelayedRunner {
        constructor(drainedOption) {
            this.drainedOption = drainedOption;
            this.isRunning = false;
            this.isDirty = false;
            this.pauseDepths = {};
            this.timeoutId = 0;
        }
        request(delay) {
            this.isDirty = true;
            if (!this.isPaused()) {
                this.clearTimeout();
                if (delay == null) {
                    this.tryDrain();
                }
                else {
                    this.timeoutId = setTimeout(// NOT OPTIMAL! TODO: look at debounce
                    this.tryDrain.bind(this), delay);
                }
            }
        }
        pause(scope = '') {
            let { pauseDepths } = this;
            pauseDepths[scope] = (pauseDepths[scope] || 0) + 1;
            this.clearTimeout();
        }
        resume(scope = '', force) {
            let { pauseDepths } = this;
            if (scope in pauseDepths) {
                if (force) {
                    delete pauseDepths[scope];
                }
                else {
                    pauseDepths[scope] -= 1;
                    let depth = pauseDepths[scope];
                    if (depth <= 0) {
                        delete pauseDepths[scope];
                    }
                }
                this.tryDrain();
            }
        }
        isPaused() {
            return Object.keys(this.pauseDepths).length;
        }
        tryDrain() {
            if (!this.isRunning && !this.isPaused()) {
                this.isRunning = true;
                while (this.isDirty) {
                    this.isDirty = false;
                    this.drained(); // might set isDirty to true again
                }
                this.isRunning = false;
            }
        }
        clear() {
            this.clearTimeout();
            this.isDirty = false;
            this.pauseDepths = {};
        }
        clearTimeout() {
            if (this.timeoutId) {
                clearTimeout(this.timeoutId);
                this.timeoutId = 0;
            }
        }
        drained() {
            if (this.drainedOption) {
                this.drainedOption();
            }
        }
    }

    const { hasOwnProperty } = Object.prototype;
    // Merges an array of objects into a single object.
    // The second argument allows for an array of property names who's object values will be merged together.
    function mergeProps(propObjs, complexPropsMap) {
        let dest = {};
        if (complexPropsMap) {
            for (let name in complexPropsMap) {
                let complexObjs = [];
                // collect the trailing object values, stopping when a non-object is discovered
                for (let i = propObjs.length - 1; i >= 0; i -= 1) {
                    let val = propObjs[i][name];
                    if (typeof val === 'object' && val) { // non-null object
                        complexObjs.unshift(val);
                    }
                    else if (val !== undefined) {
                        dest[name] = val; // if there were no objects, this value will be used
                        break;
                    }
                }
                // if the trailing values were objects, use the merged value
                if (complexObjs.length) {
                    dest[name] = mergeProps(complexObjs);
                }
            }
        }
        // copy values into the destination, going from last to first
        for (let i = propObjs.length - 1; i >= 0; i -= 1) {
            let props = propObjs[i];
            for (let name in props) {
                if (!(name in dest)) { // if already assigned by previous props or complex props, don't reassign
                    dest[name] = props[name];
                }
            }
        }
        return dest;
    }
    function filterHash(hash, func) {
        let filtered = {};
        for (let key in hash) {
            if (func(hash[key], key)) {
                filtered[key] = hash[key];
            }
        }
        return filtered;
    }
    function mapHash(hash, func) {
        let newHash = {};
        for (let key in hash) {
            newHash[key] = func(hash[key], key);
        }
        return newHash;
    }
    function arrayToHash(a) {
        let hash = {};
        for (let item of a) {
            hash[item] = true;
        }
        return hash;
    }
    // TODO: reassess browser support
    // https://caniuse.com/?search=object.values
    function hashValuesToArray(obj) {
        let a = [];
        for (let key in obj) {
            a.push(obj[key]);
        }
        return a;
    }
    function isPropsEqual(obj0, obj1) {
        if (obj0 === obj1) {
            return true;
        }
        for (let key in obj0) {
            if (hasOwnProperty.call(obj0, key)) {
                if (!(key in obj1)) {
                    return false;
                }
            }
        }
        for (let key in obj1) {
            if (hasOwnProperty.call(obj1, key)) {
                if (obj0[key] !== obj1[key]) {
                    return false;
                }
            }
        }
        return true;
    }
    const HANDLER_RE = /^on[A-Z]/;
    function isNonHandlerPropsEqual(obj0, obj1) {
        const keys = getUnequalProps(obj0, obj1);
        for (let key of keys) {
            if (!HANDLER_RE.test(key)) {
                return false;
            }
        }
        return true;
    }
    function getUnequalProps(obj0, obj1) {
        let keys = [];
        for (let key in obj0) {
            if (hasOwnProperty.call(obj0, key)) {
                if (!(key in obj1)) {
                    keys.push(key);
                }
            }
        }
        for (let key in obj1) {
            if (hasOwnProperty.call(obj1, key)) {
                if (obj0[key] !== obj1[key]) {
                    keys.push(key);
                }
            }
        }
        return keys;
    }
    function compareObjs(oldProps, newProps, equalityFuncs = {}) {
        if (oldProps === newProps) {
            return true;
        }
        for (let key in newProps) {
            if (key in oldProps && isObjValsEqual(oldProps[key], newProps[key], equalityFuncs[key])) ;
            else {
                return false;
            }
        }
        // check for props that were omitted in the new
        for (let key in oldProps) {
            if (!(key in newProps)) {
                return false;
            }
        }
        return true;
    }
    /*
    assumed "true" equality for handler names like "onReceiveSomething"
    */
    function isObjValsEqual(val0, val1, comparator) {
        if (val0 === val1 || comparator === true) {
            return true;
        }
        if (comparator) {
            return comparator(val0, val1);
        }
        return false;
    }
    function collectFromHash(hash, startIndex = 0, endIndex, step = 1) {
        let res = [];
        if (endIndex == null) {
            endIndex = Object.keys(hash).length;
        }
        for (let i = startIndex; i < endIndex; i += step) {
            let val = hash[i];
            if (val !== undefined) { // will disregard undefined for sparse arrays
                res.push(val);
            }
        }
        return res;
    }

    // TODO: new util arrayify?
    function removeExact(array, exactVal) {
        let removeCnt = 0;
        let i = 0;
        while (i < array.length) {
            if (array[i] === exactVal) {
                array.splice(i, 1);
                removeCnt += 1;
            }
            else {
                i += 1;
            }
        }
        return removeCnt;
    }
    function isArraysEqual(a0, a1, equalityFunc) {
        if (a0 === a1) {
            return true;
        }
        let len = a0.length;
        let i;
        if (len !== a1.length) { // not array? or not same length?
            return false;
        }
        for (i = 0; i < len; i += 1) {
            if (!(equalityFunc ? equalityFunc(a0[i], a1[i]) : a0[i] === a1[i])) {
                return false;
            }
        }
        return true;
    }

    function memoize(workerFunc, resEquality, teardownFunc) {
        let currentArgs;
        let currentRes;
        return function (...newArgs) {
            if (!currentArgs) {
                currentRes = workerFunc.apply(this, newArgs);
            }
            else if (!isArraysEqual(currentArgs, newArgs)) {
                if (teardownFunc) {
                    teardownFunc(currentRes);
                }
                let res = workerFunc.apply(this, newArgs);
                if (!resEquality || !resEquality(res, currentRes)) {
                    currentRes = res;
                }
            }
            currentArgs = newArgs;
            return currentRes;
        };
    }
    function memoizeObjArg(workerFunc, resEquality, teardownFunc) {
        let currentArg;
        let currentRes;
        return (newArg) => {
            if (!currentArg) {
                currentRes = workerFunc.call(this, newArg);
            }
            else if (!isPropsEqual(currentArg, newArg)) {
                if (teardownFunc) {
                    teardownFunc(currentRes);
                }
                let res = workerFunc.call(this, newArg);
                if (!resEquality || !resEquality(res, currentRes)) {
                    currentRes = res;
                }
            }
            currentArg = newArg;
            return currentRes;
        };
    }
    function memoizeArraylike(// used at all?
    workerFunc, resEquality, teardownFunc) {
        let currentArgSets = [];
        let currentResults = [];
        return (newArgSets) => {
            let currentLen = currentArgSets.length;
            let newLen = newArgSets.length;
            let i = 0;
            for (; i < currentLen; i += 1) {
                if (!newArgSets[i]) { // one of the old sets no longer exists
                    if (teardownFunc) {
                        teardownFunc(currentResults[i]);
                    }
                }
                else if (!isArraysEqual(currentArgSets[i], newArgSets[i])) {
                    if (teardownFunc) {
                        teardownFunc(currentResults[i]);
                    }
                    let res = workerFunc.apply(this, newArgSets[i]);
                    if (!resEquality || !resEquality(res, currentResults[i])) {
                        currentResults[i] = res;
                    }
                }
            }
            for (; i < newLen; i += 1) {
                currentResults[i] = workerFunc.apply(this, newArgSets[i]);
            }
            currentArgSets = newArgSets;
            currentResults.splice(newLen); // remove excess
            return currentResults;
        };
    }
    function memoizeHashlike(workerFunc, resEquality, teardownFunc) {
        let currentArgHash = {};
        let currentResHash = {};
        return (newArgHash) => {
            let newResHash = {};
            for (let key in newArgHash) {
                if (!currentResHash[key]) {
                    newResHash[key] = workerFunc.apply(this, newArgHash[key]);
                }
                else if (!isArraysEqual(currentArgHash[key], newArgHash[key])) {
                    if (teardownFunc) {
                        teardownFunc(currentResHash[key]);
                    }
                    let res = workerFunc.apply(this, newArgHash[key]);
                    newResHash[key] = (resEquality && resEquality(res, currentResHash[key]))
                        ? currentResHash[key]
                        : res;
                }
                else {
                    newResHash[key] = currentResHash[key];
                }
            }
            currentArgHash = newArgHash;
            currentResHash = newResHash;
            return newResHash;
        };
    }

    function removeElement(el) {
        if (el.parentNode) {
            el.parentNode.removeChild(el);
        }
    }
    // Querying
    // ----------------------------------------------------------------------------------------------------------------
    function elementClosest(el, selector) {
        if (el.closest) {
            return el.closest(selector);
            // really bad fallback for IE
            // from https://developer.mozilla.org/en-US/docs/Web/API/Element/closest
        }
        if (!document.documentElement.contains(el)) {
            return null;
        }
        do {
            if (elementMatches(el, selector)) {
                return el;
            }
            el = (el.parentElement || el.parentNode);
        } while (el !== null && el.nodeType === 1);
        return null;
    }
    function elementMatches(el, selector) {
        let method = el.matches || el.matchesSelector || el.msMatchesSelector;
        return method.call(el, selector);
    }
    // accepts multiple subject els
    // returns a real array. good for methods like forEach
    // TODO: accept the document
    function findElements(container, selector) {
        let containers = container instanceof HTMLElement ? [container] : container;
        let allMatches = [];
        for (let i = 0; i < containers.length; i += 1) {
            let matches = containers[i].querySelectorAll(selector);
            for (let j = 0; j < matches.length; j += 1) {
                allMatches.push(matches[j]);
            }
        }
        return allMatches;
    }
    // accepts multiple subject els
    // only queries direct child elements // TODO: rename to findDirectChildren!
    function findDirectChildren(parent, selector) {
        let parents = parent instanceof HTMLElement ? [parent] : parent;
        let allMatches = [];
        for (let i = 0; i < parents.length; i += 1) {
            let childNodes = parents[i].children; // only ever elements
            for (let j = 0; j < childNodes.length; j += 1) {
                let childNode = childNodes[j];
                if (!selector || elementMatches(childNode, selector)) {
                    allMatches.push(childNode);
                }
            }
        }
        return allMatches;
    }
    // Style
    // ----------------------------------------------------------------------------------------------------------------
    const PIXEL_PROP_RE = /(top|left|right|bottom|width|height)$/i;
    function applyStyle(el, props) {
        for (let propName in props) {
            applyStyleProp(el, propName, props[propName]);
        }
    }
    function applyStyleProp(el, name, val) {
        if (val == null) {
            el.style[name] = '';
        }
        else if (typeof val === 'number' && PIXEL_PROP_RE.test(name)) {
            el.style[name] = `${val}px`;
        }
        else {
            el.style[name] = val;
        }
    }
    // Event Handling
    // ----------------------------------------------------------------------------------------------------------------
    // if intercepting bubbled events at the document/window/body level,
    // and want to see originating element (the 'target'), use this util instead
    // of `ev.target` because it goes within web-component boundaries.
    function getEventTargetViaRoot(ev) {
        var _a, _b;
        return (_b = (_a = ev.composedPath) === null || _a === void 0 ? void 0 : _a.call(ev)[0]) !== null && _b !== void 0 ? _b : ev.target;
    }
    // Shadow DOM consuderations
    // ----------------------------------------------------------------------------------------------------------------
    function getElRoot(el) {
        return el.getRootNode ? el.getRootNode() : document;
    }
    // Unique ID for DOM attribute
    let guid$1 = 0;
    function getUniqueDomId() {
        guid$1 += 1;
        return 'fc-dom-' + guid$1;
    }

    // Stops a mouse/touch event from doing it's native browser action
    function preventDefault(ev) {
        ev.preventDefault();
    }
    // Event Delegation
    // ----------------------------------------------------------------------------------------------------------------
    function buildDelegationHandler(selector, handler) {
        return (ev) => {
            let matchedChild = elementClosest(ev.target, selector);
            if (matchedChild) {
                handler.call(matchedChild, ev, matchedChild);
            }
        };
    }
    function listenBySelector(container, eventType, selector, handler) {
        let attachedHandler = buildDelegationHandler(selector, handler);
        container.addEventListener(eventType, attachedHandler);
        return () => {
            container.removeEventListener(eventType, attachedHandler);
        };
    }
    function listenToHoverBySelector(container, selector, onMouseEnter, onMouseLeave) {
        let currentMatchedChild;
        return listenBySelector(container, 'mouseover', selector, (mouseOverEv, matchedChild) => {
            if (matchedChild !== currentMatchedChild) {
                currentMatchedChild = matchedChild;
                onMouseEnter(mouseOverEv, matchedChild);
                let realOnMouseLeave = (mouseLeaveEv) => {
                    currentMatchedChild = null;
                    onMouseLeave(mouseLeaveEv, matchedChild);
                    matchedChild.removeEventListener('mouseleave', realOnMouseLeave);
                };
                // listen to the next mouseleave, and then unattach
                matchedChild.addEventListener('mouseleave', realOnMouseLeave);
            }
        });
    }
    // Animation
    // ----------------------------------------------------------------------------------------------------------------
    const transitionEventNames = [
        'webkitTransitionEnd',
        'otransitionend',
        'oTransitionEnd',
        'msTransitionEnd',
        'transitionend',
    ];
    // triggered only when the next single subsequent transition finishes
    function whenTransitionDone(el, callback) {
        let realCallback = (ev) => {
            callback(ev);
            transitionEventNames.forEach((eventName) => {
                el.removeEventListener(eventName, realCallback);
            });
        };
        transitionEventNames.forEach((eventName) => {
            el.addEventListener(eventName, realCallback); // cross-browser way to determine when the transition finishes
        });
    }
    // ARIA workarounds
    // ----------------------------------------------------------------------------------------------------------------
    function createAriaClickAttrs(handler) {
        return Object.assign({ onClick: handler }, createAriaKeyboardAttrs(handler));
    }
    function createAriaKeyboardAttrs(handler) {
        return {
            tabIndex: 0,
            onKeyDown(ev) {
                if (ev.key === 'Enter' || ev.key === ' ') {
                    handler(ev);
                    ev.preventDefault(); // if space, don't scroll down page
                }
            },
        };
    }

    let guidNumber = 0;
    function guid() {
        guidNumber += 1;
        return String(guidNumber);
    }
    /* FullCalendar-specific DOM Utilities
    ----------------------------------------------------------------------------------------------------------------------*/
    // Make the mouse cursor express that an event is not allowed in the current area
    function disableCursor() {
        document.body.classList.add('fc-not-allowed');
    }
    // Returns the mouse cursor to its original look
    function enableCursor() {
        document.body.classList.remove('fc-not-allowed');
    }
    /* Selection
    ----------------------------------------------------------------------------------------------------------------------*/
    function preventSelection(el) {
        el.classList.add('fc-unselectable');
        el.addEventListener('selectstart', preventDefault);
    }
    function allowSelection(el) {
        el.classList.remove('fc-unselectable');
        el.removeEventListener('selectstart', preventDefault);
    }
    /* Context Menu
    ----------------------------------------------------------------------------------------------------------------------*/
    function preventContextMenu(el) {
        el.addEventListener('contextmenu', preventDefault);
    }
    function allowContextMenu(el) {
        el.removeEventListener('contextmenu', preventDefault);
    }
    function parseFieldSpecs(input) {
        let specs = [];
        let tokens = [];
        let i;
        let token;
        if (typeof input === 'string') {
            tokens = input.split(/\s*,\s*/);
        }
        else if (typeof input === 'function') {
            tokens = [input];
        }
        else if (Array.isArray(input)) {
            tokens = input;
        }
        for (i = 0; i < tokens.length; i += 1) {
            token = tokens[i];
            if (typeof token === 'string') {
                specs.push(token.charAt(0) === '-' ?
                    { field: token.substring(1), order: -1 } :
                    { field: token, order: 1 });
            }
            else if (typeof token === 'function') {
                specs.push({ func: token });
            }
        }
        return specs;
    }
    function compareByFieldSpecs(obj0, obj1, fieldSpecs) {
        let i;
        let cmp;
        for (i = 0; i < fieldSpecs.length; i += 1) {
            cmp = compareByFieldSpec(obj0, obj1, fieldSpecs[i]);
            if (cmp) {
                return cmp;
            }
        }
        return 0;
    }
    function compareByFieldSpec(obj0, obj1, fieldSpec) {
        if (fieldSpec.func) {
            return fieldSpec.func(obj0, obj1);
        }
        return flexibleCompare(obj0[fieldSpec.field], obj1[fieldSpec.field])
            * (fieldSpec.order || 1);
    }
    function flexibleCompare(a, b) {
        if (!a && !b) {
            return 0;
        }
        if (b == null) {
            return -1;
        }
        if (a == null) {
            return 1;
        }
        if (typeof a === 'string' || typeof b === 'string') {
            return String(a).localeCompare(String(b));
        }
        return a - b;
    }
    /* String Utilities
    ----------------------------------------------------------------------------------------------------------------------*/
    function padStart(val, len) {
        let s = String(val);
        return '000'.substr(0, len - s.length) + s;
    }
    function formatWithOrdinals(formatter, args, fallbackText) {
        if (typeof formatter === 'function') {
            return formatter(...args);
        }
        if (typeof formatter === 'string') { // non-blank string
            return args.reduce((str, arg, index) => (str.replace('$' + index, arg || '')), formatter);
        }
        return fallbackText;
    }
    /* Number Utilities
    ----------------------------------------------------------------------------------------------------------------------*/
    function compareNumbers(a, b) {
        return a - b;
    }
    function isInt(n) {
        return n % 1 === 0;
    }
    /* FC-specific DOM dimension stuff
    ----------------------------------------------------------------------------------------------------------------------*/
    function computeSmallestCellWidth(cellEl) {
        let allWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-frame');
        let contentWidthEl = cellEl.querySelector('.fc-scrollgrid-shrink-cushion');
        if (!allWidthEl) {
            throw new Error('needs fc-scrollgrid-shrink-frame className'); // TODO: use const
        }
        if (!contentWidthEl) {
            throw new Error('needs fc-scrollgrid-shrink-cushion className');
        }
        return cellEl.getBoundingClientRect().width - allWidthEl.getBoundingClientRect().width + // the cell padding+border
            contentWidthEl.getBoundingClientRect().width;
    }

    const DAY_IDS = ['sun', 'mon', 'tue', 'wed', 'thu', 'fri', 'sat'];
    // Adding
    function addWeeks(m, n) {
        let a = dateToUtcArray(m);
        a[2] += n * 7;
        return arrayToUtcDate(a);
    }
    function addDays(m, n) {
        let a = dateToUtcArray(m);
        a[2] += n;
        return arrayToUtcDate(a);
    }
    function addMs(m, n) {
        let a = dateToUtcArray(m);
        a[6] += n;
        return arrayToUtcDate(a);
    }
    // Diffing (all return floats)
    // TODO: why not use ranges?
    function diffWeeks(m0, m1) {
        return diffDays(m0, m1) / 7;
    }
    function diffDays(m0, m1) {
        return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60 * 24);
    }
    function diffHours(m0, m1) {
        return (m1.valueOf() - m0.valueOf()) / (1000 * 60 * 60);
    }
    function diffMinutes(m0, m1) {
        return (m1.valueOf() - m0.valueOf()) / (1000 * 60);
    }
    function diffSeconds(m0, m1) {
        return (m1.valueOf() - m0.valueOf()) / 1000;
    }
    function diffDayAndTime(m0, m1) {
        let m0day = startOfDay(m0);
        let m1day = startOfDay(m1);
        return {
            years: 0,
            months: 0,
            days: Math.round(diffDays(m0day, m1day)),
            milliseconds: (m1.valueOf() - m1day.valueOf()) - (m0.valueOf() - m0day.valueOf()),
        };
    }
    // Diffing Whole Units
    function diffWholeWeeks(m0, m1) {
        let d = diffWholeDays(m0, m1);
        if (d !== null && d % 7 === 0) {
            return d / 7;
        }
        return null;
    }
    function diffWholeDays(m0, m1) {
        if (timeAsMs(m0) === timeAsMs(m1)) {
            return Math.round(diffDays(m0, m1));
        }
        return null;
    }
    // Start-Of
    function startOfDay(m) {
        return arrayToUtcDate([
            m.getUTCFullYear(),
            m.getUTCMonth(),
            m.getUTCDate(),
        ]);
    }
    function startOfHour(m) {
        return arrayToUtcDate([
            m.getUTCFullYear(),
            m.getUTCMonth(),
            m.getUTCDate(),
            m.getUTCHours(),
        ]);
    }
    function startOfMinute(m) {
        return arrayToUtcDate([
            m.getUTCFullYear(),
            m.getUTCMonth(),
            m.getUTCDate(),
            m.getUTCHours(),
            m.getUTCMinutes(),
        ]);
    }
    function startOfSecond(m) {
        return arrayToUtcDate([
            m.getUTCFullYear(),
            m.getUTCMonth(),
            m.getUTCDate(),
            m.getUTCHours(),
            m.getUTCMinutes(),
            m.getUTCSeconds(),
        ]);
    }
    // Week Computation
    function weekOfYear(marker, dow, doy) {
        let y = marker.getUTCFullYear();
        let w = weekOfGivenYear(marker, y, dow, doy);
        if (w < 1) {
            return weekOfGivenYear(marker, y - 1, dow, doy);
        }
        let nextW = weekOfGivenYear(marker, y + 1, dow, doy);
        if (nextW >= 1) {
            return Math.min(w, nextW);
        }
        return w;
    }
    function weekOfGivenYear(marker, year, dow, doy) {
        let firstWeekStart = arrayToUtcDate([year, 0, 1 + firstWeekOffset(year, dow, doy)]);
        let dayStart = startOfDay(marker);
        let days = Math.round(diffDays(firstWeekStart, dayStart));
        return Math.floor(days / 7) + 1; // zero-indexed
    }
    // start-of-first-week - start-of-year
    function firstWeekOffset(year, dow, doy) {
        // first-week day -- which january is always in the first week (4 for iso, 1 for other)
        let fwd = 7 + dow - doy;
        // first-week day local weekday -- which local weekday is fwd
        let fwdlw = (7 + arrayToUtcDate([year, 0, fwd]).getUTCDay() - dow) % 7;
        return -fwdlw + fwd - 1;
    }
    // Array Conversion
    function dateToLocalArray(date) {
        return [
            date.getFullYear(),
            date.getMonth(),
            date.getDate(),
            date.getHours(),
            date.getMinutes(),
            date.getSeconds(),
            date.getMilliseconds(),
        ];
    }
    function arrayToLocalDate(a) {
        return new Date(a[0], a[1] || 0, a[2] == null ? 1 : a[2], // day of month
        a[3] || 0, a[4] || 0, a[5] || 0);
    }
    function dateToUtcArray(date) {
        return [
            date.getUTCFullYear(),
            date.getUTCMonth(),
            date.getUTCDate(),
            date.getUTCHours(),
            date.getUTCMinutes(),
            date.getUTCSeconds(),
            date.getUTCMilliseconds(),
        ];
    }
    function arrayToUtcDate(a) {
        // according to web standards (and Safari), a month index is required.
        // massage if only given a year.
        if (a.length === 1) {
            a = a.concat([0]);
        }
        return new Date(Date.UTC(...a));
    }
    // Other Utils
    function isValidDate$1(m) {
        return !isNaN(m.valueOf());
    }
    function timeAsMs(m) {
        return m.getUTCHours() * 1000 * 60 * 60 +
            m.getUTCMinutes() * 1000 * 60 +
            m.getUTCSeconds() * 1000 +
            m.getUTCMilliseconds();
    }

    let calendarSystemClassMap = {};
    function registerCalendarSystem(name, theClass) {
        calendarSystemClassMap[name] = theClass;
    }
    function createCalendarSystem(name) {
        return new calendarSystemClassMap[name]();
    }
    class GregorianCalendarSystem {
        getMarkerYear(d) {
            return d.getUTCFullYear();
        }
        getMarkerMonth(d) {
            return d.getUTCMonth();
        }
        getMarkerDay(d) {
            return d.getUTCDate();
        }
        arrayToMarker(arr) {
            return arrayToUtcDate(arr);
        }
        markerToArray(marker) {
            return dateToUtcArray(marker);
        }
    }
    registerCalendarSystem('gregory', GregorianCalendarSystem);

    const INTERNAL_UNITS = ['years', 'months', 'days', 'milliseconds'];
    const PARSE_RE = /^(-?)(?:(\d+)\.)?(\d+):(\d\d)(?::(\d\d)(?:\.(\d\d\d))?)?/;
    // Parsing and Creation
    function createDuration(input, unit) {
        if (typeof input === 'string') {
            return parseString(input);
        }
        if (typeof input === 'object' && input) { // non-null object
            return parseObject(input);
        }
        if (typeof input === 'number') {
            return parseObject({ [unit || 'milliseconds']: input });
        }
        return null;
    }
    function parseString(s) {
        let m = PARSE_RE.exec(s);
        if (m) {
            let sign = m[1] ? -1 : 1;
            return {
                years: 0,
                months: 0,
                days: sign * (m[2] ? parseInt(m[2], 10) : 0),
                milliseconds: sign * ((m[3] ? parseInt(m[3], 10) : 0) * 60 * 60 * 1000 + // hours
                    (m[4] ? parseInt(m[4], 10) : 0) * 60 * 1000 + // minutes
                    (m[5] ? parseInt(m[5], 10) : 0) * 1000 + // seconds
                    (m[6] ? parseInt(m[6], 10) : 0) // ms
                ),
            };
        }
        return null;
    }
    function parseObject(obj) {
        let duration = {
            years: obj.years || obj.year || 0,
            months: obj.months || obj.month || 0,
            days: obj.days || obj.day || 0,
            milliseconds: (obj.hours || obj.hour || 0) * 60 * 60 * 1000 + // hours
                (obj.minutes || obj.minute || 0) * 60 * 1000 + // minutes
                (obj.seconds || obj.second || 0) * 1000 + // seconds
                (obj.milliseconds || obj.millisecond || obj.ms || 0), // ms
        };
        let weeks = obj.weeks || obj.week;
        if (weeks) {
            duration.days += weeks * 7;
            duration.specifiedWeeks = true;
        }
        return duration;
    }
    // Equality
    function durationsEqual(d0, d1) {
        return d0.years === d1.years &&
            d0.months === d1.months &&
            d0.days === d1.days &&
            d0.milliseconds === d1.milliseconds;
    }
    function asCleanDays(dur) {
        if (!dur.years && !dur.months && !dur.milliseconds) {
            return dur.days;
        }
        return 0;
    }
    // Simple Math
    function addDurations(d0, d1) {
        return {
            years: d0.years + d1.years,
            months: d0.months + d1.months,
            days: d0.days + d1.days,
            milliseconds: d0.milliseconds + d1.milliseconds,
        };
    }
    function subtractDurations(d1, d0) {
        return {
            years: d1.years - d0.years,
            months: d1.months - d0.months,
            days: d1.days - d0.days,
            milliseconds: d1.milliseconds - d0.milliseconds,
        };
    }
    function multiplyDuration(d, n) {
        return {
            years: d.years * n,
            months: d.months * n,
            days: d.days * n,
            milliseconds: d.milliseconds * n,
        };
    }
    // Conversions
    // "Rough" because they are based on average-case Gregorian months/years
    function asRoughYears(dur) {
        return asRoughDays(dur) / 365;
    }
    function asRoughMonths(dur) {
        return asRoughDays(dur) / 30;
    }
    function asRoughDays(dur) {
        return asRoughMs(dur) / 864e5;
    }
    function asRoughMinutes(dur) {
        return asRoughMs(dur) / (1000 * 60);
    }
    function asRoughSeconds(dur) {
        return asRoughMs(dur) / 1000;
    }
    function asRoughMs(dur) {
        return dur.years * (365 * 864e5) +
            dur.months * (30 * 864e5) +
            dur.days * 864e5 +
            dur.milliseconds;
    }
    // Advanced Math
    function wholeDivideDurations(numerator, denominator) {
        let res = null;
        for (let i = 0; i < INTERNAL_UNITS.length; i += 1) {
            let unit = INTERNAL_UNITS[i];
            if (denominator[unit]) {
                let localRes = numerator[unit] / denominator[unit];
                if (!isInt(localRes) || (res !== null && res !== localRes)) {
                    return null;
                }
                res = localRes;
            }
            else if (numerator[unit]) {
                // needs to divide by something but can't!
                return null;
            }
        }
        return res;
    }
    function greatestDurationDenominator(dur) {
        let ms = dur.milliseconds;
        if (ms) {
            if (ms % 1000 !== 0) {
                return { unit: 'millisecond', value: ms };
            }
            if (ms % (1000 * 60) !== 0) {
                return { unit: 'second', value: ms / 1000 };
            }
            if (ms % (1000 * 60 * 60) !== 0) {
                return { unit: 'minute', value: ms / (1000 * 60) };
            }
            if (ms) {
                return { unit: 'hour', value: ms / (1000 * 60 * 60) };
            }
        }
        if (dur.days) {
            if (dur.specifiedWeeks && dur.days % 7 === 0) {
                return { unit: 'week', value: dur.days / 7 };
            }
            return { unit: 'day', value: dur.days };
        }
        if (dur.months) {
            return { unit: 'month', value: dur.months };
        }
        if (dur.years) {
            return { unit: 'year', value: dur.years };
        }
        return { unit: 'millisecond', value: 0 };
    }

    // timeZoneOffset is in minutes
    function buildIsoString(marker, timeZoneOffset, stripZeroTime = false) {
        let s = marker.toISOString();
        s = s.replace('.000', '');
        if (stripZeroTime) {
            s = s.replace('T00:00:00Z', '');
        }
        if (s.length > 10) { // time part wasn't stripped, can add timezone info
            if (timeZoneOffset == null) {
                s = s.replace('Z', '');
            }
            else if (timeZoneOffset !== 0) {
                s = s.replace('Z', formatTimeZoneOffset(timeZoneOffset, true));
            }
            // otherwise, its UTC-0 and we want to keep the Z
        }
        return s;
    }
    // formats the date, but with no time part
    // TODO: somehow merge with buildIsoString and stripZeroTime
    // TODO: rename. omit "string"
    function formatDayString(marker) {
        return marker.toISOString().replace(/T.*$/, '');
    }
    // TODO: use Date::toISOString and use everything after the T?
    function formatIsoTimeString(marker) {
        return padStart(marker.getUTCHours(), 2) + ':' +
            padStart(marker.getUTCMinutes(), 2) + ':' +
            padStart(marker.getUTCSeconds(), 2);
    }
    function formatTimeZoneOffset(minutes, doIso = false) {
        let sign = minutes < 0 ? '-' : '+';
        let abs = Math.abs(minutes);
        let hours = Math.floor(abs / 60);
        let mins = Math.round(abs % 60);
        if (doIso) {
            return `${sign + padStart(hours, 2)}:${padStart(mins, 2)}`;
        }
        return `GMT${sign}${hours}${mins ? `:${padStart(mins, 2)}` : ''}`;
    }

    const ISO_RE = /^\s*(\d{4})(-?(\d{2})(-?(\d{2})([T ](\d{2}):?(\d{2})(:?(\d{2})(\.(\d+))?)?(Z|(([-+])(\d{2})(:?(\d{2}))?))?)?)?)?$/;
    function parse(str) {
        let m = ISO_RE.exec(str);
        if (m) {
            let marker = new Date(Date.UTC(Number(m[1]), m[3] ? Number(m[3]) - 1 : 0, Number(m[5] || 1), Number(m[7] || 0), Number(m[8] || 0), Number(m[10] || 0), m[12] ? Number(`0.${m[12]}`) * 1000 : 0));
            if (isValidDate$1(marker)) {
                let timeZoneOffset = null;
                if (m[13]) {
                    timeZoneOffset = (m[15] === '-' ? -1 : 1) * (Number(m[16] || 0) * 60 +
                        Number(m[18] || 0));
                }
                return {
                    marker,
                    isTimeUnspecified: !m[6],
                    timeZoneOffset,
                };
            }
        }
        return null;
    }

    class DateEnv {
        constructor(settings) {
            let timeZone = this.timeZone = settings.timeZone;
            let isNamedTimeZone = timeZone !== 'local' && timeZone !== 'UTC';
            if (settings.namedTimeZoneImpl && isNamedTimeZone) {
                this.namedTimeZoneImpl = new settings.namedTimeZoneImpl(timeZone);
            }
            this.canComputeOffset = Boolean(!isNamedTimeZone || this.namedTimeZoneImpl);
            this.calendarSystem = createCalendarSystem(settings.calendarSystem);
            this.locale = settings.locale;
            this.weekDow = settings.locale.week.dow;
            this.weekDoy = settings.locale.week.doy;
            if (settings.weekNumberCalculation === 'ISO') {
                this.weekDow = 1;
                this.weekDoy = 4;
            }
            if (typeof settings.firstDay === 'number') {
                this.weekDow = settings.firstDay;
            }
            if (typeof settings.weekNumberCalculation === 'function') {
                this.weekNumberFunc = settings.weekNumberCalculation;
            }
            this.weekText = settings.weekText != null ? settings.weekText : settings.locale.options.weekText;
            this.weekTextLong = (settings.weekTextLong != null ? settings.weekTextLong : settings.locale.options.weekTextLong) || this.weekText;
            this.cmdFormatter = settings.cmdFormatter;
            this.defaultSeparator = settings.defaultSeparator;
        }
        // Creating / Parsing
        createMarker(input) {
            let meta = this.createMarkerMeta(input);
            if (meta === null) {
                return null;
            }
            return meta.marker;
        }
        createNowMarker() {
            if (this.canComputeOffset) {
                return this.timestampToMarker(new Date().valueOf());
            }
            // if we can't compute the current date val for a timezone,
            // better to give the current local date vals than UTC
            return arrayToUtcDate(dateToLocalArray(new Date()));
        }
        createMarkerMeta(input) {
            if (typeof input === 'string') {
                return this.parse(input);
            }
            let marker = null;
            if (typeof input === 'number') {
                marker = this.timestampToMarker(input);
            }
            else if (input instanceof Date) {
                input = input.valueOf();
                if (!isNaN(input)) {
                    marker = this.timestampToMarker(input);
                }
            }
            else if (Array.isArray(input)) {
                marker = arrayToUtcDate(input);
            }
            if (marker === null || !isValidDate$1(marker)) {
                return null;
            }
            return { marker, isTimeUnspecified: false, forcedTzo: null };
        }
        parse(s) {
            let parts = parse(s);
            if (parts === null) {
                return null;
            }
            let { marker } = parts;
            let forcedTzo = null;
            if (parts.timeZoneOffset !== null) {
                if (this.canComputeOffset) {
                    marker = this.timestampToMarker(marker.valueOf() - parts.timeZoneOffset * 60 * 1000);
                }
                else {
                    forcedTzo = parts.timeZoneOffset;
                }
            }
            return { marker, isTimeUnspecified: parts.isTimeUnspecified, forcedTzo };
        }
        // Accessors
        getYear(marker) {
            return this.calendarSystem.getMarkerYear(marker);
        }
        getMonth(marker) {
            return this.calendarSystem.getMarkerMonth(marker);
        }
        // Adding / Subtracting
        add(marker, dur) {
            let a = this.calendarSystem.markerToArray(marker);
            a[0] += dur.years;
            a[1] += dur.months;
            a[2] += dur.days;
            a[6] += dur.milliseconds;
            return this.calendarSystem.arrayToMarker(a);
        }
        subtract(marker, dur) {
            let a = this.calendarSystem.markerToArray(marker);
            a[0] -= dur.years;
            a[1] -= dur.months;
            a[2] -= dur.days;
            a[6] -= dur.milliseconds;
            return this.calendarSystem.arrayToMarker(a);
        }
        addYears(marker, n) {
            let a = this.calendarSystem.markerToArray(marker);
            a[0] += n;
            return this.calendarSystem.arrayToMarker(a);
        }
        addMonths(marker, n) {
            let a = this.calendarSystem.markerToArray(marker);
            a[1] += n;
            return this.calendarSystem.arrayToMarker(a);
        }
        // Diffing Whole Units
        diffWholeYears(m0, m1) {
            let { calendarSystem } = this;
            if (timeAsMs(m0) === timeAsMs(m1) &&
                calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1) &&
                calendarSystem.getMarkerMonth(m0) === calendarSystem.getMarkerMonth(m1)) {
                return calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0);
            }
            return null;
        }
        diffWholeMonths(m0, m1) {
            let { calendarSystem } = this;
            if (timeAsMs(m0) === timeAsMs(m1) &&
                calendarSystem.getMarkerDay(m0) === calendarSystem.getMarkerDay(m1)) {
                return (calendarSystem.getMarkerMonth(m1) - calendarSystem.getMarkerMonth(m0)) +
                    (calendarSystem.getMarkerYear(m1) - calendarSystem.getMarkerYear(m0)) * 12;
            }
            return null;
        }
        // Range / Duration
        greatestWholeUnit(m0, m1) {
            let n = this.diffWholeYears(m0, m1);
            if (n !== null) {
                return { unit: 'year', value: n };
            }
            n = this.diffWholeMonths(m0, m1);
            if (n !== null) {
                return { unit: 'month', value: n };
            }
            n = diffWholeWeeks(m0, m1);
            if (n !== null) {
                return { unit: 'week', value: n };
            }
            n = diffWholeDays(m0, m1);
            if (n !== null) {
                return { unit: 'day', value: n };
            }
            n = diffHours(m0, m1);
            if (isInt(n)) {
                return { unit: 'hour', value: n };
            }
            n = diffMinutes(m0, m1);
            if (isInt(n)) {
                return { unit: 'minute', value: n };
            }
            n = diffSeconds(m0, m1);
            if (isInt(n)) {
                return { unit: 'second', value: n };
            }
            return { unit: 'millisecond', value: m1.valueOf() - m0.valueOf() };
        }
        countDurationsBetween(m0, m1, d) {
            // TODO: can use greatestWholeUnit
            let diff;
            if (d.years) {
                diff = this.diffWholeYears(m0, m1);
                if (diff !== null) {
                    return diff / asRoughYears(d);
                }
            }
            if (d.months) {
                diff = this.diffWholeMonths(m0, m1);
                if (diff !== null) {
                    return diff / asRoughMonths(d);
                }
            }
            if (d.days) {
                diff = diffWholeDays(m0, m1);
                if (diff !== null) {
                    return diff / asRoughDays(d);
                }
            }
            return (m1.valueOf() - m0.valueOf()) / asRoughMs(d);
        }
        // Start-Of
        // these DON'T return zoned-dates. only UTC start-of dates
        startOf(m, unit) {
            if (unit === 'year') {
                return this.startOfYear(m);
            }
            if (unit === 'month') {
                return this.startOfMonth(m);
            }
            if (unit === 'week') {
                return this.startOfWeek(m);
            }
            if (unit === 'day') {
                return startOfDay(m);
            }
            if (unit === 'hour') {
                return startOfHour(m);
            }
            if (unit === 'minute') {
                return startOfMinute(m);
            }
            if (unit === 'second') {
                return startOfSecond(m);
            }
            return null;
        }
        startOfYear(m) {
            return this.calendarSystem.arrayToMarker([
                this.calendarSystem.getMarkerYear(m),
            ]);
        }
        startOfMonth(m) {
            return this.calendarSystem.arrayToMarker([
                this.calendarSystem.getMarkerYear(m),
                this.calendarSystem.getMarkerMonth(m),
            ]);
        }
        startOfWeek(m) {
            return this.calendarSystem.arrayToMarker([
                this.calendarSystem.getMarkerYear(m),
                this.calendarSystem.getMarkerMonth(m),
                m.getUTCDate() - ((m.getUTCDay() - this.weekDow + 7) % 7),
            ]);
        }
        // Week Number
        computeWeekNumber(marker) {
            if (this.weekNumberFunc) {
                return this.weekNumberFunc(this.toDate(marker));
            }
            return weekOfYear(marker, this.weekDow, this.weekDoy);
        }
        // TODO: choke on timeZoneName: long
        format(marker, formatter, dateOptions = {}) {
            return formatter.format({
                marker,
                timeZoneOffset: dateOptions.forcedTzo != null ?
                    dateOptions.forcedTzo :
                    this.offsetForMarker(marker),
            }, this);
        }
        formatRange(start, end, formatter, dateOptions = {}) {
            if (dateOptions.isEndExclusive) {
                end = addMs(end, -1);
            }
            return formatter.formatRange({
                marker: start,
                timeZoneOffset: dateOptions.forcedStartTzo != null ?
                    dateOptions.forcedStartTzo :
                    this.offsetForMarker(start),
            }, {
                marker: end,
                timeZoneOffset: dateOptions.forcedEndTzo != null ?
                    dateOptions.forcedEndTzo :
                    this.offsetForMarker(end),
            }, this, dateOptions.defaultSeparator);
        }
        /*
        DUMB: the omitTime arg is dumb. if we omit the time, we want to omit the timezone offset. and if we do that,
        might as well use buildIsoString or some other util directly
        */
        formatIso(marker, extraOptions = {}) {
            let timeZoneOffset = null;
            if (!extraOptions.omitTimeZoneOffset) {
                if (extraOptions.forcedTzo != null) {
                    timeZoneOffset = extraOptions.forcedTzo;
                }
                else {
                    timeZoneOffset = this.offsetForMarker(marker);
                }
            }
            return buildIsoString(marker, timeZoneOffset, extraOptions.omitTime);
        }
        // TimeZone
        timestampToMarker(ms) {
            if (this.timeZone === 'local') {
                return arrayToUtcDate(dateToLocalArray(new Date(ms)));
            }
            if (this.timeZone === 'UTC' || !this.namedTimeZoneImpl) {
                return new Date(ms);
            }
            return arrayToUtcDate(this.namedTimeZoneImpl.timestampToArray(ms));
        }
        offsetForMarker(m) {
            if (this.timeZone === 'local') {
                return -arrayToLocalDate(dateToUtcArray(m)).getTimezoneOffset(); // convert "inverse" offset to "normal" offset
            }
            if (this.timeZone === 'UTC') {
                return 0;
            }
            if (this.namedTimeZoneImpl) {
                return this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m));
            }
            return null;
        }
        // Conversion
        toDate(m, forcedTzo) {
            if (this.timeZone === 'local') {
                return arrayToLocalDate(dateToUtcArray(m));
            }
            if (this.timeZone === 'UTC') {
                return new Date(m.valueOf()); // make sure it's a copy
            }
            if (!this.namedTimeZoneImpl) {
                return new Date(m.valueOf() - (forcedTzo || 0));
            }
            return new Date(m.valueOf() -
                this.namedTimeZoneImpl.offsetForArray(dateToUtcArray(m)) * 1000 * 60);
        }
    }

    class Theme {
        constructor(calendarOptions) {
            if (this.iconOverrideOption) {
                this.setIconOverride(calendarOptions[this.iconOverrideOption]);
            }
        }
        setIconOverride(iconOverrideHash) {
            let iconClassesCopy;
            let buttonName;
            if (typeof iconOverrideHash === 'object' && iconOverrideHash) { // non-null object
                iconClassesCopy = Object.assign({}, this.iconClasses);
                for (buttonName in iconOverrideHash) {
                    iconClassesCopy[buttonName] = this.applyIconOverridePrefix(iconOverrideHash[buttonName]);
                }
                this.iconClasses = iconClassesCopy;
            }
            else if (iconOverrideHash === false) {
                this.iconClasses = {};
            }
        }
        applyIconOverridePrefix(className) {
            let prefix = this.iconOverridePrefix;
            if (prefix && className.indexOf(prefix) !== 0) { // if not already present
                className = prefix + className;
            }
            return className;
        }
        getClass(key) {
            return this.classes[key] || '';
        }
        getIconClass(buttonName, isRtl) {
            let className;
            if (isRtl && this.rtlIconClasses) {
                className = this.rtlIconClasses[buttonName] || this.iconClasses[buttonName];
            }
            else {
                className = this.iconClasses[buttonName];
            }
            if (className) {
                return `${this.baseIconClass} ${className}`;
            }
            return '';
        }
        getCustomButtonIconClass(customButtonProps) {
            let className;
            if (this.iconOverrideCustomButtonOption) {
                className = customButtonProps[this.iconOverrideCustomButtonOption];
                if (className) {
                    return `${this.baseIconClass} ${this.applyIconOverridePrefix(className)}`;
                }
            }
            return '';
        }
    }
    Theme.prototype.classes = {};
    Theme.prototype.iconClasses = {};
    Theme.prototype.baseIconClass = '';
    Theme.prototype.iconOverridePrefix = '';

    const EXTENDED_SETTINGS_AND_SEVERITIES = {
        week: 3,
        separator: 0,
        omitZeroMinute: 0,
        meridiem: 0,
        omitCommas: 0,
    };
    const STANDARD_DATE_PROP_SEVERITIES = {
        timeZoneName: 7,
        era: 6,
        year: 5,
        month: 4,
        day: 2,
        weekday: 2,
        hour: 1,
        minute: 1,
        second: 1,
    };
    const MERIDIEM_RE = /\s*([ap])\.?m\.?/i; // eats up leading spaces too
    const COMMA_RE = /,/g; // we need re for globalness
    const MULTI_SPACE_RE = /\s+/g;
    const LTR_RE = /\u200e/g; // control character
    const UTC_RE = /UTC|GMT/;
    class NativeFormatter {
        constructor(formatSettings) {
            let standardDateProps = {};
            let extendedSettings = {};
            let severity = 0;
            for (let name in formatSettings) {
                if (name in EXTENDED_SETTINGS_AND_SEVERITIES) {
                    extendedSettings[name] = formatSettings[name];
                    severity = Math.max(EXTENDED_SETTINGS_AND_SEVERITIES[name], severity);
                }
                else {
                    standardDateProps[name] = formatSettings[name];
                    if (name in STANDARD_DATE_PROP_SEVERITIES) { // TODO: what about hour12? no severity
                        severity = Math.max(STANDARD_DATE_PROP_SEVERITIES[name], severity);
                    }
                }
            }
            this.standardDateProps = standardDateProps;
            this.extendedSettings = extendedSettings;
            this.severity = severity;
            this.buildFormattingFunc = memoize(buildFormattingFunc);
        }
        format(date, context) {
            return this.buildFormattingFunc(this.standardDateProps, this.extendedSettings, context)(date);
        }
        formatRange(start, end, context, betterDefaultSeparator) {
            let { standardDateProps, extendedSettings } = this;
            let diffSeverity = computeMarkerDiffSeverity(start.marker, end.marker, context.calendarSystem);
            if (!diffSeverity) {
                return this.format(start, context);
            }
            let biggestUnitForPartial = diffSeverity;
            if (biggestUnitForPartial > 1 && // the two dates are different in a way that's larger scale than time
                (standardDateProps.year === 'numeric' || standardDateProps.year === '2-digit') &&
                (standardDateProps.month === 'numeric' || standardDateProps.month === '2-digit') &&
                (standardDateProps.day === 'numeric' || standardDateProps.day === '2-digit')) {
                biggestUnitForPartial = 1; // make it look like the dates are only different in terms of time
            }
            let full0 = this.format(start, context);
            let full1 = this.format(end, context);
            if (full0 === full1) {
                return full0;
            }
            let partialDateProps = computePartialFormattingOptions(standardDateProps, biggestUnitForPartial);
            let partialFormattingFunc = buildFormattingFunc(partialDateProps, extendedSettings, context);
            let partial0 = partialFormattingFunc(start);
            let partial1 = partialFormattingFunc(end);
            let insertion = findCommonInsertion(full0, partial0, full1, partial1);
            let separator = extendedSettings.separator || betterDefaultSeparator || context.defaultSeparator || '';
            if (insertion) {
                return insertion.before + partial0 + separator + partial1 + insertion.after;
            }
            return full0 + separator + full1;
        }
        getLargestUnit() {
            switch (this.severity) {
                case 7:
                case 6:
                case 5:
                    return 'year';
                case 4:
                    return 'month';
                case 3:
                    return 'week';
                case 2:
                    return 'day';
                default:
                    return 'time'; // really?
            }
        }
    }
    function buildFormattingFunc(standardDateProps, extendedSettings, context) {
        let standardDatePropCnt = Object.keys(standardDateProps).length;
        if (standardDatePropCnt === 1 && standardDateProps.timeZoneName === 'short') {
            return (date) => (formatTimeZoneOffset(date.timeZoneOffset));
        }
        if (standardDatePropCnt === 0 && extendedSettings.week) {
            return (date) => (formatWeekNumber(context.computeWeekNumber(date.marker), context.weekText, context.weekTextLong, context.locale, extendedSettings.week));
        }
        return buildNativeFormattingFunc(standardDateProps, extendedSettings, context);
    }
    function buildNativeFormattingFunc(standardDateProps, extendedSettings, context) {
        standardDateProps = Object.assign({}, standardDateProps); // copy
        extendedSettings = Object.assign({}, extendedSettings); // copy
        sanitizeSettings(standardDateProps, extendedSettings);
        standardDateProps.timeZone = 'UTC'; // we leverage the only guaranteed timeZone for our UTC markers
        let normalFormat = new Intl.DateTimeFormat(context.locale.codes, standardDateProps);
        let zeroFormat; // needed?
        if (extendedSettings.omitZeroMinute) {
            let zeroProps = Object.assign({}, standardDateProps);
            delete zeroProps.minute; // seconds and ms were already considered in sanitizeSettings
            zeroFormat = new Intl.DateTimeFormat(context.locale.codes, zeroProps);
        }
        return (date) => {
            let { marker } = date;
            let format;
            if (zeroFormat && !marker.getUTCMinutes()) {
                format = zeroFormat;
            }
            else {
                format = normalFormat;
            }
            let s = format.format(marker);
            return postProcess(s, date, standardDateProps, extendedSettings, context);
        };
    }
    function sanitizeSettings(standardDateProps, extendedSettings) {
        // deal with a browser inconsistency where formatting the timezone
        // requires that the hour/minute be present.
        if (standardDateProps.timeZoneName) {
            if (!standardDateProps.hour) {
                standardDateProps.hour = '2-digit';
            }
            if (!standardDateProps.minute) {
                standardDateProps.minute = '2-digit';
            }
        }
        // only support short timezone names
        if (standardDateProps.timeZoneName === 'long') {
            standardDateProps.timeZoneName = 'short';
        }
        // if requesting to display seconds, MUST display minutes
        if (extendedSettings.omitZeroMinute && (standardDateProps.second || standardDateProps.millisecond)) {
            delete extendedSettings.omitZeroMinute;
        }
    }
    function postProcess(s, date, standardDateProps, extendedSettings, context) {
        s = s.replace(LTR_RE, ''); // remove left-to-right control chars. do first. good for other regexes
        if (standardDateProps.timeZoneName === 'short') {
            s = injectTzoStr(s, (context.timeZone === 'UTC' || date.timeZoneOffset == null) ?
                'UTC' : // important to normalize for IE, which does "GMT"
                formatTimeZoneOffset(date.timeZoneOffset));
        }
        if (extendedSettings.omitCommas) {
            s = s.replace(COMMA_RE, '').trim();
        }
        if (extendedSettings.omitZeroMinute) {
            s = s.replace(':00', ''); // zeroFormat doesn't always achieve this
        }
        // ^ do anything that might create adjacent spaces before this point,
        // because MERIDIEM_RE likes to eat up loading spaces
        if (extendedSettings.meridiem === false) {
            s = s.replace(MERIDIEM_RE, '').trim();
        }
        else if (extendedSettings.meridiem === 'narrow') { // a/p
            s = s.replace(MERIDIEM_RE, (m0, m1) => m1.toLocaleLowerCase());
        }
        else if (extendedSettings.meridiem === 'short') { // am/pm
            s = s.replace(MERIDIEM_RE, (m0, m1) => `${m1.toLocaleLowerCase()}m`);
        }
        else if (extendedSettings.meridiem === 'lowercase') { // other meridiem transformers already converted to lowercase
            s = s.replace(MERIDIEM_RE, (m0) => m0.toLocaleLowerCase());
        }
        s = s.replace(MULTI_SPACE_RE, ' ');
        s = s.trim();
        return s;
    }
    function injectTzoStr(s, tzoStr) {
        let replaced = false;
        s = s.replace(UTC_RE, () => {
            replaced = true;
            return tzoStr;
        });
        // IE11 doesn't include UTC/GMT in the original string, so append to end
        if (!replaced) {
            s += ` ${tzoStr}`;
        }
        return s;
    }
    function formatWeekNumber(num, weekText, weekTextLong, locale, display) {
        let parts = [];
        if (display === 'long') {
            parts.push(weekTextLong);
        }
        else if (display === 'short' || display === 'narrow') {
            parts.push(weekText);
        }
        if (display === 'long' || display === 'short') {
            parts.push(' ');
        }
        parts.push(locale.simpleNumberFormat.format(num));
        if (locale.options.direction === 'rtl') { // TODO: use control characters instead?
            parts.reverse();
        }
        return parts.join('');
    }
    // Range Formatting Utils
    // 0 = exactly the same
    // 1 = different by time
    // and bigger
    function computeMarkerDiffSeverity(d0, d1, ca) {
        if (ca.getMarkerYear(d0) !== ca.getMarkerYear(d1)) {
            return 5;
        }
        if (ca.getMarkerMonth(d0) !== ca.getMarkerMonth(d1)) {
            return 4;
        }
        if (ca.getMarkerDay(d0) !== ca.getMarkerDay(d1)) {
            return 2;
        }
        if (timeAsMs(d0) !== timeAsMs(d1)) {
            return 1;
        }
        return 0;
    }
    function computePartialFormattingOptions(options, biggestUnit) {
        let partialOptions = {};
        for (let name in options) {
            if (!(name in STANDARD_DATE_PROP_SEVERITIES) || // not a date part prop (like timeZone)
                STANDARD_DATE_PROP_SEVERITIES[name] <= biggestUnit) {
                partialOptions[name] = options[name];
            }
        }
        return partialOptions;
    }
    function findCommonInsertion(full0, partial0, full1, partial1) {
        let i0 = 0;
        while (i0 < full0.length) {
            let found0 = full0.indexOf(partial0, i0);
            if (found0 === -1) {
                break;
            }
            let before0 = full0.substr(0, found0);
            i0 = found0 + partial0.length;
            let after0 = full0.substr(i0);
            let i1 = 0;
            while (i1 < full1.length) {
                let found1 = full1.indexOf(partial1, i1);
                if (found1 === -1) {
                    break;
                }
                let before1 = full1.substr(0, found1);
                i1 = found1 + partial1.length;
                let after1 = full1.substr(i1);
                if (before0 === before1 && after0 === after1) {
                    return {
                        before: before0,
                        after: after0,
                    };
                }
            }
        }
        return null;
    }

    function expandZonedMarker(dateInfo, calendarSystem) {
        let a = calendarSystem.markerToArray(dateInfo.marker);
        return {
            marker: dateInfo.marker,
            timeZoneOffset: dateInfo.timeZoneOffset,
            array: a,
            year: a[0],
            month: a[1],
            day: a[2],
            hour: a[3],
            minute: a[4],
            second: a[5],
            millisecond: a[6],
        };
    }

    function createVerboseFormattingArg(start, end, context, betterDefaultSeparator) {
        let startInfo = expandZonedMarker(start, context.calendarSystem);
        let endInfo = end ? expandZonedMarker(end, context.calendarSystem) : null;
        return {
            date: startInfo,
            start: startInfo,
            end: endInfo,
            timeZone: context.timeZone,
            localeCodes: context.locale.codes,
            defaultSeparator: betterDefaultSeparator || context.defaultSeparator,
        };
    }

    /*
    TODO: fix the terminology of "formatter" vs "formatting func"
    */
    /*
    At the time of instantiation, this object does not know which cmd-formatting system it will use.
    It receives this at the time of formatting, as a setting.
    */
    class CmdFormatter {
        constructor(cmdStr) {
            this.cmdStr = cmdStr;
        }
        format(date, context, betterDefaultSeparator) {
            return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
        }
        formatRange(start, end, context, betterDefaultSeparator) {
            return context.cmdFormatter(this.cmdStr, createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
        }
    }

    class FuncFormatter {
        constructor(func) {
            this.func = func;
        }
        format(date, context, betterDefaultSeparator) {
            return this.func(createVerboseFormattingArg(date, null, context, betterDefaultSeparator));
        }
        formatRange(start, end, context, betterDefaultSeparator) {
            return this.func(createVerboseFormattingArg(start, end, context, betterDefaultSeparator));
        }
    }

    function createFormatter(input) {
        if (typeof input === 'object' && input) { // non-null object
            return new NativeFormatter(input);
        }
        if (typeof input === 'string') {
            return new CmdFormatter(input);
        }
        if (typeof input === 'function') {
            return new FuncFormatter(input);
        }
        return null;
    }

    // base options
    // ------------
    const BASE_OPTION_REFINERS = {
        navLinkDayClick: identity,
        navLinkWeekClick: identity,
        duration: createDuration,
        bootstrapFontAwesome: identity,
        buttonIcons: identity,
        customButtons: identity,
        defaultAllDayEventDuration: createDuration,
        defaultTimedEventDuration: createDuration,
        nextDayThreshold: createDuration,
        scrollTime: createDuration,
        scrollTimeReset: Boolean,
        slotMinTime: createDuration,
        slotMaxTime: createDuration,
        dayPopoverFormat: createFormatter,
        slotDuration: createDuration,
        snapDuration: createDuration,
        headerToolbar: identity,
        footerToolbar: identity,
        defaultRangeSeparator: String,
        titleRangeSeparator: String,
        forceEventDuration: Boolean,
        dayHeaders: Boolean,
        dayHeaderFormat: createFormatter,
        dayHeaderClassNames: identity,
        dayHeaderContent: identity,
        dayHeaderDidMount: identity,
        dayHeaderWillUnmount: identity,
        dayCellClassNames: identity,
        dayCellContent: identity,
        dayCellDidMount: identity,
        dayCellWillUnmount: identity,
        initialView: String,
        aspectRatio: Number,
        weekends: Boolean,
        weekNumberCalculation: identity,
        weekNumbers: Boolean,
        weekNumberClassNames: identity,
        weekNumberContent: identity,
        weekNumberDidMount: identity,
        weekNumberWillUnmount: identity,
        editable: Boolean,
        viewClassNames: identity,
        viewDidMount: identity,
        viewWillUnmount: identity,
        nowIndicator: Boolean,
        nowIndicatorClassNames: identity,
        nowIndicatorContent: identity,
        nowIndicatorDidMount: identity,
        nowIndicatorWillUnmount: identity,
        showNonCurrentDates: Boolean,
        lazyFetching: Boolean,
        startParam: String,
        endParam: String,
        timeZoneParam: String,
        timeZone: String,
        locales: identity,
        locale: identity,
        themeSystem: String,
        dragRevertDuration: Number,
        dragScroll: Boolean,
        allDayMaintainDuration: Boolean,
        unselectAuto: Boolean,
        dropAccept: identity,
        eventOrder: parseFieldSpecs,
        eventOrderStrict: Boolean,
        handleWindowResize: Boolean,
        windowResizeDelay: Number,
        longPressDelay: Number,
        eventDragMinDistance: Number,
        expandRows: Boolean,
        height: identity,
        contentHeight: identity,
        direction: String,
        weekNumberFormat: createFormatter,
        eventResizableFromStart: Boolean,
        displayEventTime: Boolean,
        displayEventEnd: Boolean,
        weekText: String,
        weekTextLong: String,
        progressiveEventRendering: Boolean,
        businessHours: identity,
        initialDate: identity,
        now: identity,
        eventDataTransform: identity,
        stickyHeaderDates: identity,
        stickyFooterScrollbar: identity,
        viewHeight: identity,
        defaultAllDay: Boolean,
        eventSourceFailure: identity,
        eventSourceSuccess: identity,
        eventDisplay: String,
        eventStartEditable: Boolean,
        eventDurationEditable: Boolean,
        eventOverlap: identity,
        eventConstraint: identity,
        eventAllow: identity,
        eventBackgroundColor: String,
        eventBorderColor: String,
        eventTextColor: String,
        eventColor: String,
        eventClassNames: identity,
        eventContent: identity,
        eventDidMount: identity,
        eventWillUnmount: identity,
        selectConstraint: identity,
        selectOverlap: identity,
        selectAllow: identity,
        droppable: Boolean,
        unselectCancel: String,
        slotLabelFormat: identity,
        slotLaneClassNames: identity,
        slotLaneContent: identity,
        slotLaneDidMount: identity,
        slotLaneWillUnmount: identity,
        slotLabelClassNames: identity,
        slotLabelContent: identity,
        slotLabelDidMount: identity,
        slotLabelWillUnmount: identity,
        dayMaxEvents: identity,
        dayMaxEventRows: identity,
        dayMinWidth: Number,
        slotLabelInterval: createDuration,
        allDayText: String,
        allDayClassNames: identity,
        allDayContent: identity,
        allDayDidMount: identity,
        allDayWillUnmount: identity,
        slotMinWidth: Number,
        navLinks: Boolean,
        eventTimeFormat: createFormatter,
        rerenderDelay: Number,
        moreLinkText: identity,
        moreLinkHint: identity,
        selectMinDistance: Number,
        selectable: Boolean,
        selectLongPressDelay: Number,
        eventLongPressDelay: Number,
        selectMirror: Boolean,
        eventMaxStack: Number,
        eventMinHeight: Number,
        eventMinWidth: Number,
        eventShortHeight: Number,
        slotEventOverlap: Boolean,
        plugins: identity,
        firstDay: Number,
        dayCount: Number,
        dateAlignment: String,
        dateIncrement: createDuration,
        hiddenDays: identity,
        monthMode: Boolean,
        fixedWeekCount: Boolean,
        validRange: identity,
        visibleRange: identity,
        titleFormat: identity,
        eventInteractive: Boolean,
        // only used by list-view, but languages define the value, so we need it in base options
        noEventsText: String,
        viewHint: identity,
        navLinkHint: identity,
        closeHint: String,
        timeHint: String,
        eventHint: String,
        moreLinkClick: identity,
        moreLinkClassNames: identity,
        moreLinkContent: identity,
        moreLinkDidMount: identity,
        moreLinkWillUnmount: identity,
        // for connectors
        // (can't be part of plugin system b/c must be provided at runtime)
        handleCustomRendering: identity,
        customRenderingMetaMap: identity,
        customRenderingReplacesEl: Boolean,
    };
    // do NOT give a type here. need `typeof BASE_OPTION_DEFAULTS` to give real results.
    // raw values.
    const BASE_OPTION_DEFAULTS = {
        eventDisplay: 'auto',
        defaultRangeSeparator: ' - ',
        titleRangeSeparator: ' \u2013 ',
        defaultTimedEventDuration: '01:00:00',
        defaultAllDayEventDuration: { day: 1 },
        forceEventDuration: false,
        nextDayThreshold: '00:00:00',
        dayHeaders: true,
        initialView: '',
        aspectRatio: 1.35,
        headerToolbar: {
            start: 'title',
            center: '',
            end: 'today prev,next',
        },
        weekends: true,
        weekNumbers: false,
        weekNumberCalculation: 'local',
        editable: false,
        nowIndicator: false,
        scrollTime: '06:00:00',
        scrollTimeReset: true,
        slotMinTime: '00:00:00',
        slotMaxTime: '24:00:00',
        showNonCurrentDates: true,
        lazyFetching: true,
        startParam: 'start',
        endParam: 'end',
        timeZoneParam: 'timeZone',
        timeZone: 'local',
        locales: [],
        locale: '',
        themeSystem: 'standard',
        dragRevertDuration: 500,
        dragScroll: true,
        allDayMaintainDuration: false,
        unselectAuto: true,
        dropAccept: '*',
        eventOrder: 'start,-duration,allDay,title',
        dayPopoverFormat: { month: 'long', day: 'numeric', year: 'numeric' },
        handleWindowResize: true,
        windowResizeDelay: 100,
        longPressDelay: 1000,
        eventDragMinDistance: 5,
        expandRows: false,
        navLinks: false,
        selectable: false,
        eventMinHeight: 15,
        eventMinWidth: 30,
        eventShortHeight: 30,
    };
    // calendar listeners
    // ------------------
    const CALENDAR_LISTENER_REFINERS = {
        datesSet: identity,
        eventsSet: identity,
        eventAdd: identity,
        eventChange: identity,
        eventRemove: identity,
        windowResize: identity,
        eventClick: identity,
        eventMouseEnter: identity,
        eventMouseLeave: identity,
        select: identity,
        unselect: identity,
        loading: identity,
        // internal
        _unmount: identity,
        _beforeprint: identity,
        _afterprint: identity,
        _noEventDrop: identity,
        _noEventResize: identity,
        _resize: identity,
        _scrollRequest: identity,
    };
    // calendar-specific options
    // -------------------------
    const CALENDAR_OPTION_REFINERS = {
        buttonText: identity,
        buttonHints: identity,
        views: identity,
        plugins: identity,
        initialEvents: identity,
        events: identity,
        eventSources: identity,
    };
    const COMPLEX_OPTION_COMPARATORS = {
        headerToolbar: isMaybeObjectsEqual,
        footerToolbar: isMaybeObjectsEqual,
        buttonText: isMaybeObjectsEqual,
        buttonHints: isMaybeObjectsEqual,
        buttonIcons: isMaybeObjectsEqual,
        dateIncrement: isMaybeObjectsEqual,
    };
    function isMaybeObjectsEqual(a, b) {
        if (typeof a === 'object' && typeof b === 'object' && a && b) { // both non-null objects
            return isPropsEqual(a, b);
        }
        return a === b;
    }
    // view-specific options
    // ---------------------
    const VIEW_OPTION_REFINERS = {
        type: String,
        component: identity,
        buttonText: String,
        buttonTextKey: String,
        dateProfileGeneratorClass: identity,
        usesMinMaxTime: Boolean,
        classNames: identity,
        content: identity,
        didMount: identity,
        willUnmount: identity,
    };
    // util funcs
    // ----------------------------------------------------------------------------------------------------
    function mergeRawOptions(optionSets) {
        return mergeProps(optionSets, COMPLEX_OPTION_COMPARATORS);
    }
    function refineProps(input, refiners) {
        let refined = {};
        let extra = {};
        for (let propName in refiners) {
            if (propName in input) {
                refined[propName] = refiners[propName](input[propName]);
            }
        }
        for (let propName in input) {
            if (!(propName in refiners)) {
                extra[propName] = input[propName];
            }
        }
        return { refined, extra };
    }
    function identity(raw) {
        return raw;
    }

    /*
    NOTE: this can be a public API, especially createElement for hooks.
    See examples/typescript-scheduler/src/index.ts
    */
    function flushSync(runBeforeFlush) {
        runBeforeFlush();
        let oldDebounceRendering = l$1.debounceRendering; // orig
        let callbackQ = [];
        function execCallbackSync(callback) {
            callbackQ.push(callback);
        }
        l$1.debounceRendering = execCallbackSync;
        P$1(h(FakeComponent, {}), document.createElement('div'));
        while (callbackQ.length) {
            callbackQ.shift()();
        }
        l$1.debounceRendering = oldDebounceRendering;
    }
    class FakeComponent extends d {
        render() { return h('div', {}); }
        componentDidMount() { this.setState({}); }
    }
    // TODO: use preact/compat instead?
    function createContext(defaultValue) {
        let ContextType = B$1(defaultValue);
        let origProvider = ContextType.Provider;
        ContextType.Provider = function () {
            let isNew = !this.getChildContext;
            let children = origProvider.apply(this, arguments); // eslint-disable-line prefer-rest-params
            if (isNew) {
                let subs = [];
                this.shouldComponentUpdate = (_props) => {
                    if (this.props.value !== _props.value) {
                        subs.forEach((c) => {
                            c.context = _props.value;
                            c.forceUpdate();
                        });
                    }
                };
                this.sub = (c) => {
                    subs.push(c);
                    let old = c.componentWillUnmount;
                    c.componentWillUnmount = () => {
                        subs.splice(subs.indexOf(c), 1);
                        old && old.call(c);
                    };
                };
            }
            return children;
        };
        return ContextType;
    }

    class ScrollResponder {
        constructor(execFunc, emitter, scrollTime, scrollTimeReset) {
            this.execFunc = execFunc;
            this.emitter = emitter;
            this.scrollTime = scrollTime;
            this.scrollTimeReset = scrollTimeReset;
            this.handleScrollRequest = (request) => {
                this.queuedRequest = Object.assign({}, this.queuedRequest || {}, request);
                this.drain();
            };
            emitter.on('_scrollRequest', this.handleScrollRequest);
            this.fireInitialScroll();
        }
        detach() {
            this.emitter.off('_scrollRequest', this.handleScrollRequest);
        }
        update(isDatesNew) {
            if (isDatesNew && this.scrollTimeReset) {
                this.fireInitialScroll(); // will drain
            }
            else {
                this.drain();
            }
        }
        fireInitialScroll() {
            this.handleScrollRequest({
                time: this.scrollTime,
            });
        }
        drain() {
            if (this.queuedRequest && this.execFunc(this.queuedRequest)) {
                this.queuedRequest = null;
            }
        }
    }

    const ViewContextType = createContext({}); // for Components
    function buildViewContext(viewSpec, viewApi, viewOptions, dateProfileGenerator, dateEnv, theme, pluginHooks, dispatch, getCurrentData, emitter, calendarApi, registerInteractiveComponent, unregisterInteractiveComponent) {
        return {
            dateEnv,
            options: viewOptions,
            pluginHooks,
            emitter,
            dispatch,
            getCurrentData,
            calendarApi,
            viewSpec,
            viewApi,
            dateProfileGenerator,
            theme,
            isRtl: viewOptions.direction === 'rtl',
            addResizeHandler(handler) {
                emitter.on('_resize', handler);
            },
            removeResizeHandler(handler) {
                emitter.off('_resize', handler);
            },
            createScrollResponder(execFunc) {
                return new ScrollResponder(execFunc, emitter, createDuration(viewOptions.scrollTime), viewOptions.scrollTimeReset);
            },
            registerInteractiveComponent,
            unregisterInteractiveComponent,
        };
    }

    /* eslint max-classes-per-file: off */
    class PureComponent extends d {
        shouldComponentUpdate(nextProps, nextState) {
            if (this.debug) {
                // eslint-disable-next-line no-console
                console.log(getUnequalProps(nextProps, this.props), getUnequalProps(nextState, this.state));
            }
            return !compareObjs(this.props, nextProps, this.propEquality) ||
                !compareObjs(this.state, nextState, this.stateEquality);
        }
        // HACK for freakin' React StrictMode
        safeSetState(newState) {
            if (!compareObjs(this.state, Object.assign(Object.assign({}, this.state), newState), this.stateEquality)) {
                this.setState(newState);
            }
        }
    }
    PureComponent.addPropsEquality = addPropsEquality;
    PureComponent.addStateEquality = addStateEquality;
    PureComponent.contextType = ViewContextType;
    PureComponent.prototype.propEquality = {};
    PureComponent.prototype.stateEquality = {};
    class BaseComponent extends PureComponent {
    }
    BaseComponent.contextType = ViewContextType;
    function addPropsEquality(propEquality) {
        let hash = Object.create(this.prototype.propEquality);
        Object.assign(hash, propEquality);
        this.prototype.propEquality = hash;
    }
    function addStateEquality(stateEquality) {
        let hash = Object.create(this.prototype.stateEquality);
        Object.assign(hash, stateEquality);
        this.prototype.stateEquality = hash;
    }
    // use other one
    function setRef(ref, current) {
        if (typeof ref === 'function') {
            ref(current);
        }
        else if (ref) {
            // see https://github.com/facebook/react/issues/13029
            ref.current = current;
        }
    }

    class ContentInjector extends BaseComponent {
        constructor() {
            super(...arguments);
            this.id = guid();
            this.currentDomNodes = [];
            this.queuedDomNodes = [];
            this.handleEl = (el) => {
                if (this.props.elRef) {
                    setRef(this.props.elRef, el);
                }
            };
        }
        render() {
            const { props, context } = this;
            const { options } = context;
            const { generator, renderProps } = props;
            const attrs = buildElAttrs(props);
            let innerContent;
            let queuedDomNodes = [];
            if (hasCustomRenderingHandler(props.generatorName, options)) {
                if (options.customRenderingReplacesEl) {
                    delete attrs.elRef; // because handleEl will be used
                }
            }
            else {
                const customContent = typeof generator === 'function' ?
                    generator(renderProps, h) :
                    generator;
                if (typeof customContent === 'string' ||
                    i$1(customContent) ||
                    Array.isArray(customContent)) {
                    innerContent = customContent;
                }
                else if (typeof customContent === 'object') {
                    if ('html' in customContent) {
                        attrs.dangerouslySetInnerHTML = { __html: customContent.html };
                    }
                    else if ('domNodes' in customContent) {
                        queuedDomNodes = Array.prototype.slice.call(customContent.domNodes);
                    }
                }
            }
            this.queuedDomNodes = queuedDomNodes;
            return h(props.elTag, attrs, innerContent);
        }
        componentDidMount() {
            this.applyQueueudDomNodes();
            this.triggerCustomRendering(true);
        }
        componentDidUpdate() {
            this.applyQueueudDomNodes();
            this.triggerCustomRendering(true);
        }
        componentWillUnmount() {
            this.triggerCustomRendering(false); // TODO: different API for removal?
        }
        triggerCustomRendering(isActive) {
            const { props, context } = this;
            const { handleCustomRendering, customRenderingMetaMap } = context.options;
            if (handleCustomRendering) {
                const customRenderingMeta = customRenderingMetaMap === null || customRenderingMetaMap === void 0 ? void 0 : customRenderingMetaMap[props.generatorName];
                if (customRenderingMeta) {
                    handleCustomRendering(Object.assign({ id: this.id, isActive, containerEl: this.base, reportNewContainerEl: this.handleEl, generatorMeta: customRenderingMeta }, props));
                }
            }
        }
        applyQueueudDomNodes() {
            const { queuedDomNodes, currentDomNodes } = this;
            const el = this.base;
            if (!isArraysEqual(queuedDomNodes, currentDomNodes)) {
                currentDomNodes.forEach(removeElement);
                for (let newNode of queuedDomNodes) {
                    el.appendChild(newNode);
                }
                this.currentDomNodes = queuedDomNodes;
            }
        }
    }
    ContentInjector.addPropsEquality({
        elClasses: isArraysEqual,
        elStyle: isPropsEqual,
        elAttrs: isNonHandlerPropsEqual,
        renderProps: isPropsEqual,
    });
    // Util
    function hasCustomRenderingHandler(generatorName, options) {
        var _a;
        return Boolean(options.handleCustomRendering &&
            generatorName &&
            ((_a = options.customRenderingMetaMap) === null || _a === void 0 ? void 0 : _a[generatorName]));
    }
    function buildElAttrs(props, extraClassNames) {
        const attrs = Object.assign(Object.assign({}, props.elAttrs), { ref: props.elRef });
        if (props.elClasses || extraClassNames) {
            attrs.className = (props.elClasses || [])
                .concat(extraClassNames || [])
                .concat(attrs.className || [])
                .filter(Boolean)
                .join(' ');
        }
        if (props.elStyle) {
            attrs.style = props.elStyle;
        }
        return attrs;
    }

    const RenderId = createContext(0);

    class ContentContainer extends d {
        constructor() {
            super(...arguments);
            this.InnerContent = InnerContentInjector.bind(undefined, this);
        }
        render() {
            const { props } = this;
            const generatedClassNames = generateClassNames(props.classNameGenerator, props.renderProps);
            if (props.children) {
                const elAttrs = buildElAttrs(props, generatedClassNames);
                const children = props.children(this.InnerContent, props.renderProps, elAttrs);
                if (props.elTag) {
                    return h(props.elTag, elAttrs, children);
                }
                else {
                    return children;
                }
            }
            else {
                return h((ContentInjector), Object.assign(Object.assign({}, props), { elTag: props.elTag || 'div', elClasses: (props.elClasses || []).concat(generatedClassNames), renderId: this.context }));
            }
        }
        componentDidMount() {
            var _a, _b;
            (_b = (_a = this.props).didMount) === null || _b === void 0 ? void 0 : _b.call(_a, Object.assign(Object.assign({}, this.props.renderProps), { el: this.base }));
        }
        componentWillUnmount() {
            var _a, _b;
            (_b = (_a = this.props).willUnmount) === null || _b === void 0 ? void 0 : _b.call(_a, Object.assign(Object.assign({}, this.props.renderProps), { el: this.base }));
        }
    }
    ContentContainer.contextType = RenderId;
    function InnerContentInjector(containerComponent, props) {
        const parentProps = containerComponent.props;
        return h((ContentInjector), Object.assign({ renderProps: parentProps.renderProps, generatorName: parentProps.generatorName, generator: parentProps.generator, renderId: containerComponent.context }, props));
    }
    // Utils
    function generateClassNames(classNameGenerator, renderProps) {
        const classNames = typeof classNameGenerator === 'function' ?
            classNameGenerator(renderProps) :
            classNameGenerator || [];
        return typeof classNames === 'string' ? [classNames] : classNames;
    }

    class ViewContainer$1 extends BaseComponent {
        render() {
            let { props, context } = this;
            let { options } = context;
            let renderProps = { view: context.viewApi };
            return (h(ContentContainer, Object.assign({}, props, { elTag: props.elTag || 'div', elClasses: [
                    ...buildViewClassNames(props.viewSpec),
                    ...(props.elClasses || []),
                ], renderProps: renderProps, classNameGenerator: options.viewClassNames, generatorName: undefined, generator: undefined, didMount: options.viewDidMount, willUnmount: options.viewWillUnmount }), () => props.children));
        }
    }
    function buildViewClassNames(viewSpec) {
        return [
            `fc-${viewSpec.type}-view`,
            'fc-view',
        ];
    }

    function parseRange(input, dateEnv) {
        let start = null;
        let end = null;
        if (input.start) {
            start = dateEnv.createMarker(input.start);
        }
        if (input.end) {
            end = dateEnv.createMarker(input.end);
        }
        if (!start && !end) {
            return null;
        }
        if (start && end && end < start) {
            return null;
        }
        return { start, end };
    }
    // SIDE-EFFECT: will mutate ranges.
    // Will return a new array result.
    function invertRanges(ranges, constraintRange) {
        let invertedRanges = [];
        let { start } = constraintRange; // the end of the previous range. the start of the new range
        let i;
        let dateRange;
        // ranges need to be in order. required for our date-walking algorithm
        ranges.sort(compareRanges);
        for (i = 0; i < ranges.length; i += 1) {
            dateRange = ranges[i];
            // add the span of time before the event (if there is any)
            if (dateRange.start > start) { // compare millisecond time (skip any ambig logic)
                invertedRanges.push({ start, end: dateRange.start });
            }
            if (dateRange.end > start) {
                start = dateRange.end;
            }
        }
        // add the span of time after the last event (if there is any)
        if (start < constraintRange.end) { // compare millisecond time (skip any ambig logic)
            invertedRanges.push({ start, end: constraintRange.end });
        }
        return invertedRanges;
    }
    function compareRanges(range0, range1) {
        return range0.start.valueOf() - range1.start.valueOf(); // earlier ranges go first
    }
    function intersectRanges(range0, range1) {
        let { start, end } = range0;
        let newRange = null;
        if (range1.start !== null) {
            if (start === null) {
                start = range1.start;
            }
            else {
                start = new Date(Math.max(start.valueOf(), range1.start.valueOf()));
            }
        }
        if (range1.end != null) {
            if (end === null) {
                end = range1.end;
            }
            else {
                end = new Date(Math.min(end.valueOf(), range1.end.valueOf()));
            }
        }
        if (start === null || end === null || start < end) {
            newRange = { start, end };
        }
        return newRange;
    }
    function rangesEqual(range0, range1) {
        return (range0.start === null ? null : range0.start.valueOf()) === (range1.start === null ? null : range1.start.valueOf()) &&
            (range0.end === null ? null : range0.end.valueOf()) === (range1.end === null ? null : range1.end.valueOf());
    }
    function rangesIntersect(range0, range1) {
        return (range0.end === null || range1.start === null || range0.end > range1.start) &&
            (range0.start === null || range1.end === null || range0.start < range1.end);
    }
    function rangeContainsRange(outerRange, innerRange) {
        return (outerRange.start === null || (innerRange.start !== null && innerRange.start >= outerRange.start)) &&
            (outerRange.end === null || (innerRange.end !== null && innerRange.end <= outerRange.end));
    }
    function rangeContainsMarker(range, date) {
        return (range.start === null || date >= range.start) &&
            (range.end === null || date < range.end);
    }
    // If the given date is not within the given range, move it inside.
    // (If it's past the end, make it one millisecond before the end).
    function constrainMarkerToRange(date, range) {
        if (range.start != null && date < range.start) {
            return range.start;
        }
        if (range.end != null && date >= range.end) {
            return new Date(range.end.valueOf() - 1);
        }
        return date;
    }

    /* Date stuff that doesn't belong in datelib core
    ----------------------------------------------------------------------------------------------------------------------*/
    // given a timed range, computes an all-day range that has the same exact duration,
    // but whose start time is aligned with the start of the day.
    function computeAlignedDayRange(timedRange) {
        let dayCnt = Math.floor(diffDays(timedRange.start, timedRange.end)) || 1;
        let start = startOfDay(timedRange.start);
        let end = addDays(start, dayCnt);
        return { start, end };
    }
    // given a timed range, computes an all-day range based on how for the end date bleeds into the next day
    // TODO: give nextDayThreshold a default arg
    function computeVisibleDayRange(timedRange, nextDayThreshold = createDuration(0)) {
        let startDay = null;
        let endDay = null;
        if (timedRange.end) {
            endDay = startOfDay(timedRange.end);
            let endTimeMS = timedRange.end.valueOf() - endDay.valueOf(); // # of milliseconds into `endDay`
            // If the end time is actually inclusively part of the next day and is equal to or
            // beyond the next day threshold, adjust the end to be the exclusive end of `endDay`.
            // Otherwise, leaving it as inclusive will cause it to exclude `endDay`.
            if (endTimeMS && endTimeMS >= asRoughMs(nextDayThreshold)) {
                endDay = addDays(endDay, 1);
            }
        }
        if (timedRange.start) {
            startDay = startOfDay(timedRange.start); // the beginning of the day the range starts
            // If end is within `startDay` but not past nextDayThreshold, assign the default duration of one day.
            if (endDay && endDay <= startDay) {
                endDay = addDays(startDay, 1);
            }
        }
        return { start: startDay, end: endDay };
    }
    // spans from one day into another?
    function isMultiDayRange(range) {
        let visibleRange = computeVisibleDayRange(range);
        return diffDays(visibleRange.start, visibleRange.end) > 1;
    }
    function diffDates(date0, date1, dateEnv, largeUnit) {
        if (largeUnit === 'year') {
            return createDuration(dateEnv.diffWholeYears(date0, date1), 'year');
        }
        if (largeUnit === 'month') {
            return createDuration(dateEnv.diffWholeMonths(date0, date1), 'month');
        }
        return diffDayAndTime(date0, date1); // returns a duration
    }

    function reduceCurrentDate(currentDate, action) {
        switch (action.type) {
            case 'CHANGE_DATE':
                return action.dateMarker;
            default:
                return currentDate;
        }
    }
    function getInitialDate(options, dateEnv) {
        let initialDateInput = options.initialDate;
        // compute the initial ambig-timezone date
        if (initialDateInput != null) {
            return dateEnv.createMarker(initialDateInput);
        }
        return getNow(options.now, dateEnv); // getNow already returns unzoned
    }
    function getNow(nowInput, dateEnv) {
        if (typeof nowInput === 'function') {
            nowInput = nowInput();
        }
        if (nowInput == null) {
            return dateEnv.createNowMarker();
        }
        return dateEnv.createMarker(nowInput);
    }

    class DateProfileGenerator {
        constructor(props) {
            this.props = props;
            this.nowDate = getNow(props.nowInput, props.dateEnv);
            this.initHiddenDays();
        }
        /* Date Range Computation
        ------------------------------------------------------------------------------------------------------------------*/
        // Builds a structure with info about what the dates/ranges will be for the "prev" view.
        buildPrev(currentDateProfile, currentDate, forceToValid) {
            let { dateEnv } = this.props;
            let prevDate = dateEnv.subtract(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
            currentDateProfile.dateIncrement);
            return this.build(prevDate, -1, forceToValid);
        }
        // Builds a structure with info about what the dates/ranges will be for the "next" view.
        buildNext(currentDateProfile, currentDate, forceToValid) {
            let { dateEnv } = this.props;
            let nextDate = dateEnv.add(dateEnv.startOf(currentDate, currentDateProfile.currentRangeUnit), // important for start-of-month
            currentDateProfile.dateIncrement);
            return this.build(nextDate, 1, forceToValid);
        }
        // Builds a structure holding dates/ranges for rendering around the given date.
        // Optional direction param indicates whether the date is being incremented/decremented
        // from its previous value. decremented = -1, incremented = 1 (default).
        build(currentDate, direction, forceToValid = true) {
            let { props } = this;
            let validRange;
            let currentInfo;
            let isRangeAllDay;
            let renderRange;
            let activeRange;
            let isValid;
            validRange = this.buildValidRange();
            validRange = this.trimHiddenDays(validRange);
            if (forceToValid) {
                currentDate = constrainMarkerToRange(currentDate, validRange);
            }
            currentInfo = this.buildCurrentRangeInfo(currentDate, direction);
            isRangeAllDay = /^(year|month|week|day)$/.test(currentInfo.unit);
            renderRange = this.buildRenderRange(this.trimHiddenDays(currentInfo.range), currentInfo.unit, isRangeAllDay);
            renderRange = this.trimHiddenDays(renderRange);
            activeRange = renderRange;
            if (!props.showNonCurrentDates) {
                activeRange = intersectRanges(activeRange, currentInfo.range);
            }
            activeRange = this.adjustActiveRange(activeRange);
            activeRange = intersectRanges(activeRange, validRange); // might return null
            // it's invalid if the originally requested date is not contained,
            // or if the range is completely outside of the valid range.
            isValid = rangesIntersect(currentInfo.range, validRange);
            return {
                // constraint for where prev/next operations can go and where events can be dragged/resized to.
                // an object with optional start and end properties.
                validRange,
                // range the view is formally responsible for.
                // for example, a month view might have 1st-31st, excluding padded dates
                currentRange: currentInfo.range,
                // name of largest unit being displayed, like "month" or "week"
                currentRangeUnit: currentInfo.unit,
                isRangeAllDay,
                // dates that display events and accept drag-n-drop
                // will be `null` if no dates accept events
                activeRange,
                // date range with a rendered skeleton
                // includes not-active days that need some sort of DOM
                renderRange,
                // Duration object that denotes the first visible time of any given day
                slotMinTime: props.slotMinTime,
                // Duration object that denotes the exclusive visible end time of any given day
                slotMaxTime: props.slotMaxTime,
                isValid,
                // how far the current date will move for a prev/next operation
                dateIncrement: this.buildDateIncrement(currentInfo.duration),
                // pass a fallback (might be null) ^
            };
        }
        // Builds an object with optional start/end properties.
        // Indicates the minimum/maximum dates to display.
        // not responsible for trimming hidden days.
        buildValidRange() {
            let input = this.props.validRangeInput;
            let simpleInput = typeof input === 'function'
                ? input.call(this.props.calendarApi, this.nowDate)
                : input;
            return this.refineRange(simpleInput) ||
                { start: null, end: null }; // completely open-ended
        }
        // Builds a structure with info about the "current" range, the range that is
        // highlighted as being the current month for example.
        // See build() for a description of `direction`.
        // Guaranteed to have `range` and `unit` properties. `duration` is optional.
        buildCurrentRangeInfo(date, direction) {
            let { props } = this;
            let duration = null;
            let unit = null;
            let range = null;
            let dayCount;
            if (props.duration) {
                duration = props.duration;
                unit = props.durationUnit;
                range = this.buildRangeFromDuration(date, direction, duration, unit);
            }
            else if ((dayCount = this.props.dayCount)) {
                unit = 'day';
                range = this.buildRangeFromDayCount(date, direction, dayCount);
            }
            else if ((range = this.buildCustomVisibleRange(date))) {
                unit = props.dateEnv.greatestWholeUnit(range.start, range.end).unit;
            }
            else {
                duration = this.getFallbackDuration();
                unit = greatestDurationDenominator(duration).unit;
                range = this.buildRangeFromDuration(date, direction, duration, unit);
            }
            return { duration, unit, range };
        }
        getFallbackDuration() {
            return createDuration({ day: 1 });
        }
        // Returns a new activeRange to have time values (un-ambiguate)
        // slotMinTime or slotMaxTime causes the range to expand.
        adjustActiveRange(range) {
            let { dateEnv, usesMinMaxTime, slotMinTime, slotMaxTime } = this.props;
            let { start, end } = range;
            if (usesMinMaxTime) {
                // expand active range if slotMinTime is negative (why not when positive?)
                if (asRoughDays(slotMinTime) < 0) {
                    start = startOfDay(start); // necessary?
                    start = dateEnv.add(start, slotMinTime);
                }
                // expand active range if slotMaxTime is beyond one day (why not when negative?)
                if (asRoughDays(slotMaxTime) > 1) {
                    end = startOfDay(end); // necessary?
                    end = addDays(end, -1);
                    end = dateEnv.add(end, slotMaxTime);
                }
            }
            return { start, end };
        }
        // Builds the "current" range when it is specified as an explicit duration.
        // `unit` is the already-computed greatestDurationDenominator unit of duration.
        buildRangeFromDuration(date, direction, duration, unit) {
            let { dateEnv, dateAlignment } = this.props;
            let start;
            let end;
            let res;
            // compute what the alignment should be
            if (!dateAlignment) {
                let { dateIncrement } = this.props;
                if (dateIncrement) {
                    // use the smaller of the two units
                    if (asRoughMs(dateIncrement) < asRoughMs(duration)) {
                        dateAlignment = greatestDurationDenominator(dateIncrement).unit;
                    }
                    else {
                        dateAlignment = unit;
                    }
                }
                else {
                    dateAlignment = unit;
                }
            }
            // if the view displays a single day or smaller
            if (asRoughDays(duration) <= 1) {
                if (this.isHiddenDay(start)) {
                    start = this.skipHiddenDays(start, direction);
                    start = startOfDay(start);
                }
            }
            function computeRes() {
                start = dateEnv.startOf(date, dateAlignment);
                end = dateEnv.add(start, duration);
                res = { start, end };
            }
            computeRes();
            // if range is completely enveloped by hidden days, go past the hidden days
            if (!this.trimHiddenDays(res)) {
                date = this.skipHiddenDays(date, direction);
                computeRes();
            }
            return res;
        }
        // Builds the "current" range when a dayCount is specified.
        buildRangeFromDayCount(date, direction, dayCount) {
            let { dateEnv, dateAlignment } = this.props;
            let runningCount = 0;
            let start = date;
            let end;
            if (dateAlignment) {
                start = dateEnv.startOf(start, dateAlignment);
            }
            start = startOfDay(start);
            start = this.skipHiddenDays(start, direction);
            end = start;
            do {
                end = addDays(end, 1);
                if (!this.isHiddenDay(end)) {
                    runningCount += 1;
                }
            } while (runningCount < dayCount);
            return { start, end };
        }
        // Builds a normalized range object for the "visible" range,
        // which is a way to define the currentRange and activeRange at the same time.
        buildCustomVisibleRange(date) {
            let { props } = this;
            let input = props.visibleRangeInput;
            let simpleInput = typeof input === 'function'
                ? input.call(props.calendarApi, props.dateEnv.toDate(date))
                : input;
            let range = this.refineRange(simpleInput);
            if (range && (range.start == null || range.end == null)) {
                return null;
            }
            return range;
        }
        // Computes the range that will represent the element/cells for *rendering*,
        // but which may have voided days/times.
        // not responsible for trimming hidden days.
        buildRenderRange(currentRange, currentRangeUnit, isRangeAllDay) {
            return currentRange;
        }
        // Compute the duration value that should be added/substracted to the current date
        // when a prev/next operation happens.
        buildDateIncrement(fallback) {
            let { dateIncrement } = this.props;
            let customAlignment;
            if (dateIncrement) {
                return dateIncrement;
            }
            if ((customAlignment = this.props.dateAlignment)) {
                return createDuration(1, customAlignment);
            }
            if (fallback) {
                return fallback;
            }
            return createDuration({ days: 1 });
        }
        refineRange(rangeInput) {
            if (rangeInput) {
                let range = parseRange(rangeInput, this.props.dateEnv);
                if (range) {
                    range = computeVisibleDayRange(range);
                }
                return range;
            }
            return null;
        }
        /* Hidden Days
        ------------------------------------------------------------------------------------------------------------------*/
        // Initializes internal variables related to calculating hidden days-of-week
        initHiddenDays() {
            let hiddenDays = this.props.hiddenDays || []; // array of day-of-week indices that are hidden
            let isHiddenDayHash = []; // is the day-of-week hidden? (hash with day-of-week-index -> bool)
            let dayCnt = 0;
            let i;
            if (this.props.weekends === false) {
                hiddenDays.push(0, 6); // 0=sunday, 6=saturday
            }
            for (i = 0; i < 7; i += 1) {
                if (!(isHiddenDayHash[i] = hiddenDays.indexOf(i) !== -1)) {
                    dayCnt += 1;
                }
            }
            if (!dayCnt) {
                throw new Error('invalid hiddenDays'); // all days were hidden? bad.
            }
            this.isHiddenDayHash = isHiddenDayHash;
        }
        // Remove days from the beginning and end of the range that are computed as hidden.
        // If the whole range is trimmed off, returns null
        trimHiddenDays(range) {
            let { start, end } = range;
            if (start) {
                start = this.skipHiddenDays(start);
            }
            if (end) {
                end = this.skipHiddenDays(end, -1, true);
            }
            if (start == null || end == null || start < end) {
                return { start, end };
            }
            return null;
        }
        // Is the current day hidden?
        // `day` is a day-of-week index (0-6), or a Date (used for UTC)
        isHiddenDay(day) {
            if (day instanceof Date) {
                day = day.getUTCDay();
            }
            return this.isHiddenDayHash[day];
        }
        // Incrementing the current day until it is no longer a hidden day, returning a copy.
        // DOES NOT CONSIDER validRange!
        // If the initial value of `date` is not a hidden day, don't do anything.
        // Pass `isExclusive` as `true` if you are dealing with an end date.
        // `inc` defaults to `1` (increment one day forward each time)
        skipHiddenDays(date, inc = 1, isExclusive = false) {
            while (this.isHiddenDayHash[(date.getUTCDay() + (isExclusive ? inc : 0) + 7) % 7]) {
                date = addDays(date, inc);
            }
            return date;
        }
    }

    function createEventInstance(defId, range, forcedStartTzo, forcedEndTzo) {
        return {
            instanceId: guid(),
            defId,
            range,
            forcedStartTzo: forcedStartTzo == null ? null : forcedStartTzo,
            forcedEndTzo: forcedEndTzo == null ? null : forcedEndTzo,
        };
    }

    function parseRecurring(refined, defaultAllDay, dateEnv, recurringTypes) {
        for (let i = 0; i < recurringTypes.length; i += 1) {
            let parsed = recurringTypes[i].parse(refined, dateEnv);
            if (parsed) {
                let { allDay } = refined;
                if (allDay == null) {
                    allDay = defaultAllDay;
                    if (allDay == null) {
                        allDay = parsed.allDayGuess;
                        if (allDay == null) {
                            allDay = false;
                        }
                    }
                }
                return {
                    allDay,
                    duration: parsed.duration,
                    typeData: parsed.typeData,
                    typeId: i,
                };
            }
        }
        return null;
    }
    function expandRecurring(eventStore, framingRange, context) {
        let { dateEnv, pluginHooks, options } = context;
        let { defs, instances } = eventStore;
        // remove existing recurring instances
        // TODO: bad. always expand events as a second step
        instances = filterHash(instances, (instance) => !defs[instance.defId].recurringDef);
        for (let defId in defs) {
            let def = defs[defId];
            if (def.recurringDef) {
                let { duration } = def.recurringDef;
                if (!duration) {
                    duration = def.allDay ?
                        options.defaultAllDayEventDuration :
                        options.defaultTimedEventDuration;
                }
                let starts = expandRecurringRanges(def, duration, framingRange, dateEnv, pluginHooks.recurringTypes);
                for (let start of starts) {
                    let instance = createEventInstance(defId, {
                        start,
                        end: dateEnv.add(start, duration),
                    });
                    instances[instance.instanceId] = instance;
                }
            }
        }
        return { defs, instances };
    }
    /*
    Event MUST have a recurringDef
    */
    function expandRecurringRanges(eventDef, duration, framingRange, dateEnv, recurringTypes) {
        let typeDef = recurringTypes[eventDef.recurringDef.typeId];
        let markers = typeDef.expand(eventDef.recurringDef.typeData, {
            start: dateEnv.subtract(framingRange.start, duration),
            end: framingRange.end,
        }, dateEnv);
        // the recurrence plugins don't guarantee that all-day events are start-of-day, so we have to
        if (eventDef.allDay) {
            markers = markers.map(startOfDay);
        }
        return markers;
    }

    const EVENT_NON_DATE_REFINERS = {
        id: String,
        groupId: String,
        title: String,
        url: String,
        interactive: Boolean,
    };
    const EVENT_DATE_REFINERS = {
        start: identity,
        end: identity,
        date: identity,
        allDay: Boolean,
    };
    const EVENT_REFINERS$1 = Object.assign(Object.assign(Object.assign({}, EVENT_NON_DATE_REFINERS), EVENT_DATE_REFINERS), { extendedProps: identity });
    function parseEvent(raw, eventSource, context, allowOpenRange, refiners = buildEventRefiners(context)) {
        let { refined, extra } = refineEventDef(raw, context, refiners);
        let defaultAllDay = computeIsDefaultAllDay(eventSource, context);
        let recurringRes = parseRecurring(refined, defaultAllDay, context.dateEnv, context.pluginHooks.recurringTypes);
        if (recurringRes) {
            let def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', recurringRes.allDay, Boolean(recurringRes.duration), context);
            def.recurringDef = {
                typeId: recurringRes.typeId,
                typeData: recurringRes.typeData,
                duration: recurringRes.duration,
            };
            return { def, instance: null };
        }
        let singleRes = parseSingle(refined, defaultAllDay, context, allowOpenRange);
        if (singleRes) {
            let def = parseEventDef(refined, extra, eventSource ? eventSource.sourceId : '', singleRes.allDay, singleRes.hasEnd, context);
            let instance = createEventInstance(def.defId, singleRes.range, singleRes.forcedStartTzo, singleRes.forcedEndTzo);
            return { def, instance };
        }
        return null;
    }
    function refineEventDef(raw, context, refiners = buildEventRefiners(context)) {
        return refineProps(raw, refiners);
    }
    function buildEventRefiners(context) {
        return Object.assign(Object.assign(Object.assign({}, EVENT_UI_REFINERS), EVENT_REFINERS$1), context.pluginHooks.eventRefiners);
    }
    /*
    Will NOT populate extendedProps with the leftover properties.
    Will NOT populate date-related props.
    */
    function parseEventDef(refined, extra, sourceId, allDay, hasEnd, context) {
        let def = {
            title: refined.title || '',
            groupId: refined.groupId || '',
            publicId: refined.id || '',
            url: refined.url || '',
            recurringDef: null,
            defId: guid(),
            sourceId,
            allDay,
            hasEnd,
            interactive: refined.interactive,
            ui: createEventUi(refined, context),
            extendedProps: Object.assign(Object.assign({}, (refined.extendedProps || {})), extra),
        };
        for (let memberAdder of context.pluginHooks.eventDefMemberAdders) {
            Object.assign(def, memberAdder(refined));
        }
        // help out EventImpl from having user modify props
        Object.freeze(def.ui.classNames);
        Object.freeze(def.extendedProps);
        return def;
    }
    function parseSingle(refined, defaultAllDay, context, allowOpenRange) {
        let { allDay } = refined;
        let startMeta;
        let startMarker = null;
        let hasEnd = false;
        let endMeta;
        let endMarker = null;
        let startInput = refined.start != null ? refined.start : refined.date;
        startMeta = context.dateEnv.createMarkerMeta(startInput);
        if (startMeta) {
            startMarker = startMeta.marker;
        }
        else if (!allowOpenRange) {
            return null;
        }
        if (refined.end != null) {
            endMeta = context.dateEnv.createMarkerMeta(refined.end);
        }
        if (allDay == null) {
            if (defaultAllDay != null) {
                allDay = defaultAllDay;
            }
            else {
                // fall back to the date props LAST
                allDay = (!startMeta || startMeta.isTimeUnspecified) &&
                    (!endMeta || endMeta.isTimeUnspecified);
            }
        }
        if (allDay && startMarker) {
            startMarker = startOfDay(startMarker);
        }
        if (endMeta) {
            endMarker = endMeta.marker;
            if (allDay) {
                endMarker = startOfDay(endMarker);
            }
            if (startMarker && endMarker <= startMarker) {
                endMarker = null;
            }
        }
        if (endMarker) {
            hasEnd = true;
        }
        else if (!allowOpenRange) {
            hasEnd = context.options.forceEventDuration || false;
            endMarker = context.dateEnv.add(startMarker, allDay ?
                context.options.defaultAllDayEventDuration :
                context.options.defaultTimedEventDuration);
        }
        return {
            allDay,
            hasEnd,
            range: { start: startMarker, end: endMarker },
            forcedStartTzo: startMeta ? startMeta.forcedTzo : null,
            forcedEndTzo: endMeta ? endMeta.forcedTzo : null,
        };
    }
    function computeIsDefaultAllDay(eventSource, context) {
        let res = null;
        if (eventSource) {
            res = eventSource.defaultAllDay;
        }
        if (res == null) {
            res = context.options.defaultAllDay;
        }
        return res;
    }

    function parseEvents(rawEvents, eventSource, context, allowOpenRange) {
        let eventStore = createEmptyEventStore();
        let eventRefiners = buildEventRefiners(context);
        for (let rawEvent of rawEvents) {
            let tuple = parseEvent(rawEvent, eventSource, context, allowOpenRange, eventRefiners);
            if (tuple) {
                eventTupleToStore(tuple, eventStore);
            }
        }
        return eventStore;
    }
    function eventTupleToStore(tuple, eventStore = createEmptyEventStore()) {
        eventStore.defs[tuple.def.defId] = tuple.def;
        if (tuple.instance) {
            eventStore.instances[tuple.instance.instanceId] = tuple.instance;
        }
        return eventStore;
    }
    // retrieves events that have the same groupId as the instance specified by `instanceId`
    // or they are the same as the instance.
    // why might instanceId not be in the store? an event from another calendar?
    function getRelevantEvents(eventStore, instanceId) {
        let instance = eventStore.instances[instanceId];
        if (instance) {
            let def = eventStore.defs[instance.defId];
            // get events/instances with same group
            let newStore = filterEventStoreDefs(eventStore, (lookDef) => isEventDefsGrouped(def, lookDef));
            // add the original
            // TODO: wish we could use eventTupleToStore or something like it
            newStore.defs[def.defId] = def;
            newStore.instances[instance.instanceId] = instance;
            return newStore;
        }
        return createEmptyEventStore();
    }
    function isEventDefsGrouped(def0, def1) {
        return Boolean(def0.groupId && def0.groupId === def1.groupId);
    }
    function createEmptyEventStore() {
        return { defs: {}, instances: {} };
    }
    function mergeEventStores(store0, store1) {
        return {
            defs: Object.assign(Object.assign({}, store0.defs), store1.defs),
            instances: Object.assign(Object.assign({}, store0.instances), store1.instances),
        };
    }
    function filterEventStoreDefs(eventStore, filterFunc) {
        let defs = filterHash(eventStore.defs, filterFunc);
        let instances = filterHash(eventStore.instances, (instance) => (defs[instance.defId] // still exists?
        ));
        return { defs, instances };
    }
    function excludeSubEventStore(master, sub) {
        let { defs, instances } = master;
        let filteredDefs = {};
        let filteredInstances = {};
        for (let defId in defs) {
            if (!sub.defs[defId]) { // not explicitly excluded
                filteredDefs[defId] = defs[defId];
            }
        }
        for (let instanceId in instances) {
            if (!sub.instances[instanceId] && // not explicitly excluded
                filteredDefs[instances[instanceId].defId] // def wasn't filtered away
            ) {
                filteredInstances[instanceId] = instances[instanceId];
            }
        }
        return {
            defs: filteredDefs,
            instances: filteredInstances,
        };
    }

    function normalizeConstraint(input, context) {
        if (Array.isArray(input)) {
            return parseEvents(input, null, context, true); // allowOpenRange=true
        }
        if (typeof input === 'object' && input) { // non-null object
            return parseEvents([input], null, context, true); // allowOpenRange=true
        }
        if (input != null) {
            return String(input);
        }
        return null;
    }

    function parseClassNames(raw) {
        if (Array.isArray(raw)) {
            return raw;
        }
        if (typeof raw === 'string') {
            return raw.split(/\s+/);
        }
        return [];
    }

    // TODO: better called "EventSettings" or "EventConfig"
    // TODO: move this file into structs
    // TODO: separate constraint/overlap/allow, because selection uses only that, not other props
    const EVENT_UI_REFINERS = {
        display: String,
        editable: Boolean,
        startEditable: Boolean,
        durationEditable: Boolean,
        constraint: identity,
        overlap: identity,
        allow: identity,
        className: parseClassNames,
        classNames: parseClassNames,
        color: String,
        backgroundColor: String,
        borderColor: String,
        textColor: String,
    };
    const EMPTY_EVENT_UI = {
        display: null,
        startEditable: null,
        durationEditable: null,
        constraints: [],
        overlap: null,
        allows: [],
        backgroundColor: '',
        borderColor: '',
        textColor: '',
        classNames: [],
    };
    function createEventUi(refined, context) {
        let constraint = normalizeConstraint(refined.constraint, context);
        return {
            display: refined.display || null,
            startEditable: refined.startEditable != null ? refined.startEditable : refined.editable,
            durationEditable: refined.durationEditable != null ? refined.durationEditable : refined.editable,
            constraints: constraint != null ? [constraint] : [],
            overlap: refined.overlap != null ? refined.overlap : null,
            allows: refined.allow != null ? [refined.allow] : [],
            backgroundColor: refined.backgroundColor || refined.color || '',
            borderColor: refined.borderColor || refined.color || '',
            textColor: refined.textColor || '',
            classNames: (refined.className || []).concat(refined.classNames || []), // join singular and plural
        };
    }
    // TODO: prevent against problems with <2 args!
    function combineEventUis(uis) {
        return uis.reduce(combineTwoEventUis, EMPTY_EVENT_UI);
    }
    function combineTwoEventUis(item0, item1) {
        return {
            display: item1.display != null ? item1.display : item0.display,
            startEditable: item1.startEditable != null ? item1.startEditable : item0.startEditable,
            durationEditable: item1.durationEditable != null ? item1.durationEditable : item0.durationEditable,
            constraints: item0.constraints.concat(item1.constraints),
            overlap: typeof item1.overlap === 'boolean' ? item1.overlap : item0.overlap,
            allows: item0.allows.concat(item1.allows),
            backgroundColor: item1.backgroundColor || item0.backgroundColor,
            borderColor: item1.borderColor || item0.borderColor,
            textColor: item1.textColor || item0.textColor,
            classNames: item0.classNames.concat(item1.classNames),
        };
    }

    const EVENT_SOURCE_REFINERS = {
        id: String,
        defaultAllDay: Boolean,
        url: String,
        format: String,
        events: identity,
        eventDataTransform: identity,
        // for any network-related sources
        success: identity,
        failure: identity,
    };
    function parseEventSource(raw, context, refiners = buildEventSourceRefiners(context)) {
        let rawObj;
        if (typeof raw === 'string') {
            rawObj = { url: raw };
        }
        else if (typeof raw === 'function' || Array.isArray(raw)) {
            rawObj = { events: raw };
        }
        else if (typeof raw === 'object' && raw) { // not null
            rawObj = raw;
        }
        if (rawObj) {
            let { refined, extra } = refineProps(rawObj, refiners);
            let metaRes = buildEventSourceMeta(refined, context);
            if (metaRes) {
                return {
                    _raw: raw,
                    isFetching: false,
                    latestFetchId: '',
                    fetchRange: null,
                    defaultAllDay: refined.defaultAllDay,
                    eventDataTransform: refined.eventDataTransform,
                    success: refined.success,
                    failure: refined.failure,
                    publicId: refined.id || '',
                    sourceId: guid(),
                    sourceDefId: metaRes.sourceDefId,
                    meta: metaRes.meta,
                    ui: createEventUi(refined, context),
                    extendedProps: extra,
                };
            }
        }
        return null;
    }
    function buildEventSourceRefiners(context) {
        return Object.assign(Object.assign(Object.assign({}, EVENT_UI_REFINERS), EVENT_SOURCE_REFINERS), context.pluginHooks.eventSourceRefiners);
    }
    function buildEventSourceMeta(raw, context) {
        let defs = context.pluginHooks.eventSourceDefs;
        for (let i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
            let def = defs[i];
            let meta = def.parseMeta(raw);
            if (meta) {
                return { sourceDefId: i, meta };
            }
        }
        return null;
    }

    function reduceEventStore(eventStore, action, eventSources, dateProfile, context) {
        switch (action.type) {
            case 'RECEIVE_EVENTS': // raw
                return receiveRawEvents(eventStore, eventSources[action.sourceId], action.fetchId, action.fetchRange, action.rawEvents, context);
            case 'ADD_EVENTS': // already parsed, but not expanded
                return addEvent(eventStore, action.eventStore, // new ones
                dateProfile ? dateProfile.activeRange : null, context);
            case 'RESET_EVENTS':
                return action.eventStore;
            case 'MERGE_EVENTS': // already parsed and expanded
                return mergeEventStores(eventStore, action.eventStore);
            case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
            case 'NEXT':
            case 'CHANGE_DATE':
            case 'CHANGE_VIEW_TYPE':
                if (dateProfile) {
                    return expandRecurring(eventStore, dateProfile.activeRange, context);
                }
                return eventStore;
            case 'REMOVE_EVENTS':
                return excludeSubEventStore(eventStore, action.eventStore);
            case 'REMOVE_EVENT_SOURCE':
                return excludeEventsBySourceId(eventStore, action.sourceId);
            case 'REMOVE_ALL_EVENT_SOURCES':
                return filterEventStoreDefs(eventStore, (eventDef) => (!eventDef.sourceId // only keep events with no source id
                ));
            case 'REMOVE_ALL_EVENTS':
                return createEmptyEventStore();
            default:
                return eventStore;
        }
    }
    function receiveRawEvents(eventStore, eventSource, fetchId, fetchRange, rawEvents, context) {
        if (eventSource && // not already removed
            fetchId === eventSource.latestFetchId // TODO: wish this logic was always in event-sources
        ) {
            let subset = parseEvents(transformRawEvents(rawEvents, eventSource, context), eventSource, context);
            if (fetchRange) {
                subset = expandRecurring(subset, fetchRange, context);
            }
            return mergeEventStores(excludeEventsBySourceId(eventStore, eventSource.sourceId), subset);
        }
        return eventStore;
    }
    function transformRawEvents(rawEvents, eventSource, context) {
        let calEachTransform = context.options.eventDataTransform;
        let sourceEachTransform = eventSource ? eventSource.eventDataTransform : null;
        if (sourceEachTransform) {
            rawEvents = transformEachRawEvent(rawEvents, sourceEachTransform);
        }
        if (calEachTransform) {
            rawEvents = transformEachRawEvent(rawEvents, calEachTransform);
        }
        return rawEvents;
    }
    function transformEachRawEvent(rawEvents, func) {
        let refinedEvents;
        if (!func) {
            refinedEvents = rawEvents;
        }
        else {
            refinedEvents = [];
            for (let rawEvent of rawEvents) {
                let refinedEvent = func(rawEvent);
                if (refinedEvent) {
                    refinedEvents.push(refinedEvent);
                }
                else if (refinedEvent == null) {
                    refinedEvents.push(rawEvent);
                } // if a different falsy value, do nothing
            }
        }
        return refinedEvents;
    }
    function addEvent(eventStore, subset, expandRange, context) {
        if (expandRange) {
            subset = expandRecurring(subset, expandRange, context);
        }
        return mergeEventStores(eventStore, subset);
    }
    function rezoneEventStoreDates(eventStore, oldDateEnv, newDateEnv) {
        let { defs } = eventStore;
        let instances = mapHash(eventStore.instances, (instance) => {
            let def = defs[instance.defId];
            if (def.allDay || def.recurringDef) {
                return instance; // isn't dependent on timezone
            }
            return Object.assign(Object.assign({}, instance), { range: {
                    start: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.start, instance.forcedStartTzo)),
                    end: newDateEnv.createMarker(oldDateEnv.toDate(instance.range.end, instance.forcedEndTzo)),
                }, forcedStartTzo: newDateEnv.canComputeOffset ? null : instance.forcedStartTzo, forcedEndTzo: newDateEnv.canComputeOffset ? null : instance.forcedEndTzo });
        });
        return { defs, instances };
    }
    function excludeEventsBySourceId(eventStore, sourceId) {
        return filterEventStoreDefs(eventStore, (eventDef) => eventDef.sourceId !== sourceId);
    }
    // QUESTION: why not just return instances? do a general object-property-exclusion util
    function excludeInstances(eventStore, removals) {
        return {
            defs: eventStore.defs,
            instances: filterHash(eventStore.instances, (instance) => !removals[instance.instanceId]),
        };
    }

    class Emitter {
        constructor() {
            this.handlers = {};
            this.thisContext = null;
        }
        setThisContext(thisContext) {
            this.thisContext = thisContext;
        }
        setOptions(options) {
            this.options = options;
        }
        on(type, handler) {
            addToHash(this.handlers, type, handler);
        }
        off(type, handler) {
            removeFromHash(this.handlers, type, handler);
        }
        trigger(type, ...args) {
            let attachedHandlers = this.handlers[type] || [];
            let optionHandler = this.options && this.options[type];
            let handlers = [].concat(optionHandler || [], attachedHandlers);
            for (let handler of handlers) {
                handler.apply(this.thisContext, args);
            }
        }
        hasHandlers(type) {
            return Boolean((this.handlers[type] && this.handlers[type].length) ||
                (this.options && this.options[type]));
        }
    }
    function addToHash(hash, type, handler) {
        (hash[type] || (hash[type] = []))
            .push(handler);
    }
    function removeFromHash(hash, type, handler) {
        if (handler) {
            if (hash[type]) {
                hash[type] = hash[type].filter((func) => func !== handler);
            }
        }
        else {
            delete hash[type]; // remove all handler funcs for this type
        }
    }

    const DEF_DEFAULTS = {
        startTime: '09:00',
        endTime: '17:00',
        daysOfWeek: [1, 2, 3, 4, 5],
        display: 'inverse-background',
        classNames: 'fc-non-business',
        groupId: '_businessHours', // so multiple defs get grouped
    };
    /*
    TODO: pass around as EventDefHash!!!
    */
    function parseBusinessHours(input, context) {
        return parseEvents(refineInputs(input), null, context);
    }
    function refineInputs(input) {
        let rawDefs;
        if (input === true) {
            rawDefs = [{}]; // will get DEF_DEFAULTS verbatim
        }
        else if (Array.isArray(input)) {
            // if specifying an array, every sub-definition NEEDS a day-of-week
            rawDefs = input.filter((rawDef) => rawDef.daysOfWeek);
        }
        else if (typeof input === 'object' && input) { // non-null object
            rawDefs = [input];
        }
        else { // is probably false
            rawDefs = [];
        }
        rawDefs = rawDefs.map((rawDef) => (Object.assign(Object.assign({}, DEF_DEFAULTS), rawDef)));
        return rawDefs;
    }

    function triggerDateSelect(selection, pev, context) {
        context.emitter.trigger('select', Object.assign(Object.assign({}, buildDateSpanApiWithContext(selection, context)), { jsEvent: pev ? pev.origEvent : null, view: context.viewApi || context.calendarApi.view }));
    }
    function triggerDateUnselect(pev, context) {
        context.emitter.trigger('unselect', {
            jsEvent: pev ? pev.origEvent : null,
            view: context.viewApi || context.calendarApi.view,
        });
    }
    function buildDateSpanApiWithContext(dateSpan, context) {
        let props = {};
        for (let transform of context.pluginHooks.dateSpanTransforms) {
            Object.assign(props, transform(dateSpan, context));
        }
        Object.assign(props, buildDateSpanApi(dateSpan, context.dateEnv));
        return props;
    }
    // Given an event's allDay status and start date, return what its fallback end date should be.
    // TODO: rename to computeDefaultEventEnd
    function getDefaultEventEnd(allDay, marker, context) {
        let { dateEnv, options } = context;
        let end = marker;
        if (allDay) {
            end = startOfDay(end);
            end = dateEnv.add(end, options.defaultAllDayEventDuration);
        }
        else {
            end = dateEnv.add(end, options.defaultTimedEventDuration);
        }
        return end;
    }

    // applies the mutation to ALL defs/instances within the event store
    function applyMutationToEventStore(eventStore, eventConfigBase, mutation, context) {
        let eventConfigs = compileEventUis(eventStore.defs, eventConfigBase);
        let dest = createEmptyEventStore();
        for (let defId in eventStore.defs) {
            let def = eventStore.defs[defId];
            dest.defs[defId] = applyMutationToEventDef(def, eventConfigs[defId], mutation, context);
        }
        for (let instanceId in eventStore.instances) {
            let instance = eventStore.instances[instanceId];
            let def = dest.defs[instance.defId]; // important to grab the newly modified def
            dest.instances[instanceId] = applyMutationToEventInstance(instance, def, eventConfigs[instance.defId], mutation, context);
        }
        return dest;
    }
    function applyMutationToEventDef(eventDef, eventConfig, mutation, context) {
        let standardProps = mutation.standardProps || {};
        // if hasEnd has not been specified, guess a good value based on deltas.
        // if duration will change, there's no way the default duration will persist,
        // and thus, we need to mark the event as having a real end
        if (standardProps.hasEnd == null &&
            eventConfig.durationEditable &&
            (mutation.startDelta || mutation.endDelta)) {
            standardProps.hasEnd = true; // TODO: is this mutation okay?
        }
        let copy = Object.assign(Object.assign(Object.assign({}, eventDef), standardProps), { ui: Object.assign(Object.assign({}, eventDef.ui), standardProps.ui) });
        if (mutation.extendedProps) {
            copy.extendedProps = Object.assign(Object.assign({}, copy.extendedProps), mutation.extendedProps);
        }
        for (let applier of context.pluginHooks.eventDefMutationAppliers) {
            applier(copy, mutation, context);
        }
        if (!copy.hasEnd && context.options.forceEventDuration) {
            copy.hasEnd = true;
        }
        return copy;
    }
    function applyMutationToEventInstance(eventInstance, eventDef, // must first be modified by applyMutationToEventDef
    eventConfig, mutation, context) {
        let { dateEnv } = context;
        let forceAllDay = mutation.standardProps && mutation.standardProps.allDay === true;
        let clearEnd = mutation.standardProps && mutation.standardProps.hasEnd === false;
        let copy = Object.assign({}, eventInstance);
        if (forceAllDay) {
            copy.range = computeAlignedDayRange(copy.range);
        }
        if (mutation.datesDelta && eventConfig.startEditable) {
            copy.range = {
                start: dateEnv.add(copy.range.start, mutation.datesDelta),
                end: dateEnv.add(copy.range.end, mutation.datesDelta),
            };
        }
        if (mutation.startDelta && eventConfig.durationEditable) {
            copy.range = {
                start: dateEnv.add(copy.range.start, mutation.startDelta),
                end: copy.range.end,
            };
        }
        if (mutation.endDelta && eventConfig.durationEditable) {
            copy.range = {
                start: copy.range.start,
                end: dateEnv.add(copy.range.end, mutation.endDelta),
            };
        }
        if (clearEnd) {
            copy.range = {
                start: copy.range.start,
                end: getDefaultEventEnd(eventDef.allDay, copy.range.start, context),
            };
        }
        // in case event was all-day but the supplied deltas were not
        // better util for this?
        if (eventDef.allDay) {
            copy.range = {
                start: startOfDay(copy.range.start),
                end: startOfDay(copy.range.end),
            };
        }
        // handle invalid durations
        if (copy.range.end < copy.range.start) {
            copy.range.end = getDefaultEventEnd(eventDef.allDay, copy.range.start, context);
        }
        return copy;
    }

    class EventSourceImpl {
        constructor(context, internalEventSource) {
            this.context = context;
            this.internalEventSource = internalEventSource;
        }
        remove() {
            this.context.dispatch({
                type: 'REMOVE_EVENT_SOURCE',
                sourceId: this.internalEventSource.sourceId,
            });
        }
        refetch() {
            this.context.dispatch({
                type: 'FETCH_EVENT_SOURCES',
                sourceIds: [this.internalEventSource.sourceId],
                isRefetch: true,
            });
        }
        get id() {
            return this.internalEventSource.publicId;
        }
        get url() {
            return this.internalEventSource.meta.url;
        }
        get format() {
            return this.internalEventSource.meta.format; // TODO: bad. not guaranteed
        }
    }

    class EventImpl {
        // instance will be null if expressing a recurring event that has no current instances,
        // OR if trying to validate an incoming external event that has no dates assigned
        constructor(context, def, instance) {
            this._context = context;
            this._def = def;
            this._instance = instance || null;
        }
        /*
        TODO: make event struct more responsible for this
        */
        setProp(name, val) {
            if (name in EVENT_DATE_REFINERS) {
                console.warn('Could not set date-related prop \'name\'. Use one of the date-related methods instead.');
                // TODO: make proper aliasing system?
            }
            else if (name === 'id') {
                val = EVENT_NON_DATE_REFINERS[name](val);
                this.mutate({
                    standardProps: { publicId: val }, // hardcoded internal name
                });
            }
            else if (name in EVENT_NON_DATE_REFINERS) {
                val = EVENT_NON_DATE_REFINERS[name](val);
                this.mutate({
                    standardProps: { [name]: val },
                });
            }
            else if (name in EVENT_UI_REFINERS) {
                let ui = EVENT_UI_REFINERS[name](val);
                if (name === 'color') {
                    ui = { backgroundColor: val, borderColor: val };
                }
                else if (name === 'editable') {
                    ui = { startEditable: val, durationEditable: val };
                }
                else {
                    ui = { [name]: val };
                }
                this.mutate({
                    standardProps: { ui },
                });
            }
            else {
                console.warn(`Could not set prop '${name}'. Use setExtendedProp instead.`);
            }
        }
        setExtendedProp(name, val) {
            this.mutate({
                extendedProps: { [name]: val },
            });
        }
        setStart(startInput, options = {}) {
            let { dateEnv } = this._context;
            let start = dateEnv.createMarker(startInput);
            if (start && this._instance) { // TODO: warning if parsed bad
                let instanceRange = this._instance.range;
                let startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity); // what if parsed bad!?
                if (options.maintainDuration) {
                    this.mutate({ datesDelta: startDelta });
                }
                else {
                    this.mutate({ startDelta });
                }
            }
        }
        setEnd(endInput, options = {}) {
            let { dateEnv } = this._context;
            let end;
            if (endInput != null) {
                end = dateEnv.createMarker(endInput);
                if (!end) {
                    return; // TODO: warning if parsed bad
                }
            }
            if (this._instance) {
                if (end) {
                    let endDelta = diffDates(this._instance.range.end, end, dateEnv, options.granularity);
                    this.mutate({ endDelta });
                }
                else {
                    this.mutate({ standardProps: { hasEnd: false } });
                }
            }
        }
        setDates(startInput, endInput, options = {}) {
            let { dateEnv } = this._context;
            let standardProps = { allDay: options.allDay };
            let start = dateEnv.createMarker(startInput);
            let end;
            if (!start) {
                return; // TODO: warning if parsed bad
            }
            if (endInput != null) {
                end = dateEnv.createMarker(endInput);
                if (!end) { // TODO: warning if parsed bad
                    return;
                }
            }
            if (this._instance) {
                let instanceRange = this._instance.range;
                // when computing the diff for an event being converted to all-day,
                // compute diff off of the all-day values the way event-mutation does.
                if (options.allDay === true) {
                    instanceRange = computeAlignedDayRange(instanceRange);
                }
                let startDelta = diffDates(instanceRange.start, start, dateEnv, options.granularity);
                if (end) {
                    let endDelta = diffDates(instanceRange.end, end, dateEnv, options.granularity);
                    if (durationsEqual(startDelta, endDelta)) {
                        this.mutate({ datesDelta: startDelta, standardProps });
                    }
                    else {
                        this.mutate({ startDelta, endDelta, standardProps });
                    }
                }
                else { // means "clear the end"
                    standardProps.hasEnd = false;
                    this.mutate({ datesDelta: startDelta, standardProps });
                }
            }
        }
        moveStart(deltaInput) {
            let delta = createDuration(deltaInput);
            if (delta) { // TODO: warning if parsed bad
                this.mutate({ startDelta: delta });
            }
        }
        moveEnd(deltaInput) {
            let delta = createDuration(deltaInput);
            if (delta) { // TODO: warning if parsed bad
                this.mutate({ endDelta: delta });
            }
        }
        moveDates(deltaInput) {
            let delta = createDuration(deltaInput);
            if (delta) { // TODO: warning if parsed bad
                this.mutate({ datesDelta: delta });
            }
        }
        setAllDay(allDay, options = {}) {
            let standardProps = { allDay };
            let { maintainDuration } = options;
            if (maintainDuration == null) {
                maintainDuration = this._context.options.allDayMaintainDuration;
            }
            if (this._def.allDay !== allDay) {
                standardProps.hasEnd = maintainDuration;
            }
            this.mutate({ standardProps });
        }
        formatRange(formatInput) {
            let { dateEnv } = this._context;
            let instance = this._instance;
            let formatter = createFormatter(formatInput);
            if (this._def.hasEnd) {
                return dateEnv.formatRange(instance.range.start, instance.range.end, formatter, {
                    forcedStartTzo: instance.forcedStartTzo,
                    forcedEndTzo: instance.forcedEndTzo,
                });
            }
            return dateEnv.format(instance.range.start, formatter, {
                forcedTzo: instance.forcedStartTzo,
            });
        }
        mutate(mutation) {
            let instance = this._instance;
            if (instance) {
                let def = this._def;
                let context = this._context;
                let { eventStore } = context.getCurrentData();
                let relevantEvents = getRelevantEvents(eventStore, instance.instanceId);
                let eventConfigBase = {
                    '': {
                        display: '',
                        startEditable: true,
                        durationEditable: true,
                        constraints: [],
                        overlap: null,
                        allows: [],
                        backgroundColor: '',
                        borderColor: '',
                        textColor: '',
                        classNames: [],
                    },
                };
                relevantEvents = applyMutationToEventStore(relevantEvents, eventConfigBase, mutation, context);
                let oldEvent = new EventImpl(context, def, instance); // snapshot
                this._def = relevantEvents.defs[def.defId];
                this._instance = relevantEvents.instances[instance.instanceId];
                context.dispatch({
                    type: 'MERGE_EVENTS',
                    eventStore: relevantEvents,
                });
                context.emitter.trigger('eventChange', {
                    oldEvent,
                    event: this,
                    relatedEvents: buildEventApis(relevantEvents, context, instance),
                    revert() {
                        context.dispatch({
                            type: 'RESET_EVENTS',
                            eventStore, // the ORIGINAL store
                        });
                    },
                });
            }
        }
        remove() {
            let context = this._context;
            let asStore = eventApiToStore(this);
            context.dispatch({
                type: 'REMOVE_EVENTS',
                eventStore: asStore,
            });
            context.emitter.trigger('eventRemove', {
                event: this,
                relatedEvents: [],
                revert() {
                    context.dispatch({
                        type: 'MERGE_EVENTS',
                        eventStore: asStore,
                    });
                },
            });
        }
        get source() {
            let { sourceId } = this._def;
            if (sourceId) {
                return new EventSourceImpl(this._context, this._context.getCurrentData().eventSources[sourceId]);
            }
            return null;
        }
        get start() {
            return this._instance ?
                this._context.dateEnv.toDate(this._instance.range.start) :
                null;
        }
        get end() {
            return (this._instance && this._def.hasEnd) ?
                this._context.dateEnv.toDate(this._instance.range.end) :
                null;
        }
        get startStr() {
            let instance = this._instance;
            if (instance) {
                return this._context.dateEnv.formatIso(instance.range.start, {
                    omitTime: this._def.allDay,
                    forcedTzo: instance.forcedStartTzo,
                });
            }
            return '';
        }
        get endStr() {
            let instance = this._instance;
            if (instance && this._def.hasEnd) {
                return this._context.dateEnv.formatIso(instance.range.end, {
                    omitTime: this._def.allDay,
                    forcedTzo: instance.forcedEndTzo,
                });
            }
            return '';
        }
        // computable props that all access the def
        // TODO: find a TypeScript-compatible way to do this at scale
        get id() { return this._def.publicId; }
        get groupId() { return this._def.groupId; }
        get allDay() { return this._def.allDay; }
        get title() { return this._def.title; }
        get url() { return this._def.url; }
        get display() { return this._def.ui.display || 'auto'; } // bad. just normalize the type earlier
        get startEditable() { return this._def.ui.startEditable; }
        get durationEditable() { return this._def.ui.durationEditable; }
        get constraint() { return this._def.ui.constraints[0] || null; }
        get overlap() { return this._def.ui.overlap; }
        get allow() { return this._def.ui.allows[0] || null; }
        get backgroundColor() { return this._def.ui.backgroundColor; }
        get borderColor() { return this._def.ui.borderColor; }
        get textColor() { return this._def.ui.textColor; }
        // NOTE: user can't modify these because Object.freeze was called in event-def parsing
        get classNames() { return this._def.ui.classNames; }
        get extendedProps() { return this._def.extendedProps; }
        toPlainObject(settings = {}) {
            let def = this._def;
            let { ui } = def;
            let { startStr, endStr } = this;
            let res = {};
            if (def.title) {
                res.title = def.title;
            }
            if (startStr) {
                res.start = startStr;
            }
            if (endStr) {
                res.end = endStr;
            }
            if (def.publicId) {
                res.id = def.publicId;
            }
            if (def.groupId) {
                res.groupId = def.groupId;
            }
            if (def.url) {
                res.url = def.url;
            }
            if (ui.display && ui.display !== 'auto') {
                res.display = ui.display;
            }
            // TODO: what about recurring-event properties???
            // TODO: include startEditable/durationEditable/constraint/overlap/allow
            if (settings.collapseColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
                res.color = ui.backgroundColor;
            }
            else {
                if (ui.backgroundColor) {
                    res.backgroundColor = ui.backgroundColor;
                }
                if (ui.borderColor) {
                    res.borderColor = ui.borderColor;
                }
            }
            if (ui.textColor) {
                res.textColor = ui.textColor;
            }
            if (ui.classNames.length) {
                res.classNames = ui.classNames;
            }
            if (Object.keys(def.extendedProps).length) {
                if (settings.collapseExtendedProps) {
                    Object.assign(res, def.extendedProps);
                }
                else {
                    res.extendedProps = def.extendedProps;
                }
            }
            return res;
        }
        toJSON() {
            return this.toPlainObject();
        }
    }
    function eventApiToStore(eventApi) {
        let def = eventApi._def;
        let instance = eventApi._instance;
        return {
            defs: { [def.defId]: def },
            instances: instance
                ? { [instance.instanceId]: instance }
                : {},
        };
    }
    function buildEventApis(eventStore, context, excludeInstance) {
        let { defs, instances } = eventStore;
        let eventApis = [];
        let excludeInstanceId = excludeInstance ? excludeInstance.instanceId : '';
        for (let id in instances) {
            let instance = instances[id];
            let def = defs[instance.defId];
            if (instance.instanceId !== excludeInstanceId) {
                eventApis.push(new EventImpl(context, def, instance));
            }
        }
        return eventApis;
    }

    /*
    Specifying nextDayThreshold signals that all-day ranges should be sliced.
    */
    function sliceEventStore(eventStore, eventUiBases, framingRange, nextDayThreshold) {
        let inverseBgByGroupId = {};
        let inverseBgByDefId = {};
        let defByGroupId = {};
        let bgRanges = [];
        let fgRanges = [];
        let eventUis = compileEventUis(eventStore.defs, eventUiBases);
        for (let defId in eventStore.defs) {
            let def = eventStore.defs[defId];
            let ui = eventUis[def.defId];
            if (ui.display === 'inverse-background') {
                if (def.groupId) {
                    inverseBgByGroupId[def.groupId] = [];
                    if (!defByGroupId[def.groupId]) {
                        defByGroupId[def.groupId] = def;
                    }
                }
                else {
                    inverseBgByDefId[defId] = [];
                }
            }
        }
        for (let instanceId in eventStore.instances) {
            let instance = eventStore.instances[instanceId];
            let def = eventStore.defs[instance.defId];
            let ui = eventUis[def.defId];
            let origRange = instance.range;
            let normalRange = (!def.allDay && nextDayThreshold) ?
                computeVisibleDayRange(origRange, nextDayThreshold) :
                origRange;
            let slicedRange = intersectRanges(normalRange, framingRange);
            if (slicedRange) {
                if (ui.display === 'inverse-background') {
                    if (def.groupId) {
                        inverseBgByGroupId[def.groupId].push(slicedRange);
                    }
                    else {
                        inverseBgByDefId[instance.defId].push(slicedRange);
                    }
                }
                else if (ui.display !== 'none') {
                    (ui.display === 'background' ? bgRanges : fgRanges).push({
                        def,
                        ui,
                        instance,
                        range: slicedRange,
                        isStart: normalRange.start && normalRange.start.valueOf() === slicedRange.start.valueOf(),
                        isEnd: normalRange.end && normalRange.end.valueOf() === slicedRange.end.valueOf(),
                    });
                }
            }
        }
        for (let groupId in inverseBgByGroupId) { // BY GROUP
            let ranges = inverseBgByGroupId[groupId];
            let invertedRanges = invertRanges(ranges, framingRange);
            for (let invertedRange of invertedRanges) {
                let def = defByGroupId[groupId];
                let ui = eventUis[def.defId];
                bgRanges.push({
                    def,
                    ui,
                    instance: null,
                    range: invertedRange,
                    isStart: false,
                    isEnd: false,
                });
            }
        }
        for (let defId in inverseBgByDefId) {
            let ranges = inverseBgByDefId[defId];
            let invertedRanges = invertRanges(ranges, framingRange);
            for (let invertedRange of invertedRanges) {
                bgRanges.push({
                    def: eventStore.defs[defId],
                    ui: eventUis[defId],
                    instance: null,
                    range: invertedRange,
                    isStart: false,
                    isEnd: false,
                });
            }
        }
        return { bg: bgRanges, fg: fgRanges };
    }
    function hasBgRendering(def) {
        return def.ui.display === 'background' || def.ui.display === 'inverse-background';
    }
    function setElSeg(el, seg) {
        el.fcSeg = seg;
    }
    function getElSeg(el) {
        return el.fcSeg ||
            el.parentNode.fcSeg || // for the harness
            null;
    }
    // event ui computation
    function compileEventUis(eventDefs, eventUiBases) {
        return mapHash(eventDefs, (eventDef) => compileEventUi(eventDef, eventUiBases));
    }
    function compileEventUi(eventDef, eventUiBases) {
        let uis = [];
        if (eventUiBases['']) {
            uis.push(eventUiBases['']);
        }
        if (eventUiBases[eventDef.defId]) {
            uis.push(eventUiBases[eventDef.defId]);
        }
        uis.push(eventDef.ui);
        return combineEventUis(uis);
    }
    function sortEventSegs(segs, eventOrderSpecs) {
        let objs = segs.map(buildSegCompareObj);
        objs.sort((obj0, obj1) => compareByFieldSpecs(obj0, obj1, eventOrderSpecs));
        return objs.map((c) => c._seg);
    }
    // returns a object with all primitive props that can be compared
    function buildSegCompareObj(seg) {
        let { eventRange } = seg;
        let eventDef = eventRange.def;
        let range = eventRange.instance ? eventRange.instance.range : eventRange.range;
        let start = range.start ? range.start.valueOf() : 0; // TODO: better support for open-range events
        let end = range.end ? range.end.valueOf() : 0; // "
        return Object.assign(Object.assign(Object.assign({}, eventDef.extendedProps), eventDef), { id: eventDef.publicId, start,
            end, duration: end - start, allDay: Number(eventDef.allDay), _seg: seg });
    }
    function computeSegDraggable(seg, context) {
        let { pluginHooks } = context;
        let transformers = pluginHooks.isDraggableTransformers;
        let { def, ui } = seg.eventRange;
        let val = ui.startEditable;
        for (let transformer of transformers) {
            val = transformer(val, def, ui, context);
        }
        return val;
    }
    function computeSegStartResizable(seg, context) {
        return seg.isStart && seg.eventRange.ui.durationEditable && context.options.eventResizableFromStart;
    }
    function computeSegEndResizable(seg, context) {
        return seg.isEnd && seg.eventRange.ui.durationEditable;
    }
    function buildSegTimeText(seg, timeFormat, context, defaultDisplayEventTime, // defaults to true
    defaultDisplayEventEnd, // defaults to true
    startOverride, endOverride) {
        let { dateEnv, options } = context;
        let { displayEventTime, displayEventEnd } = options;
        let eventDef = seg.eventRange.def;
        let eventInstance = seg.eventRange.instance;
        if (displayEventTime == null) {
            displayEventTime = defaultDisplayEventTime !== false;
        }
        if (displayEventEnd == null) {
            displayEventEnd = defaultDisplayEventEnd !== false;
        }
        let wholeEventStart = eventInstance.range.start;
        let wholeEventEnd = eventInstance.range.end;
        let segStart = startOverride || seg.start || seg.eventRange.range.start;
        let segEnd = endOverride || seg.end || seg.eventRange.range.end;
        let isStartDay = startOfDay(wholeEventStart).valueOf() === startOfDay(segStart).valueOf();
        let isEndDay = startOfDay(addMs(wholeEventEnd, -1)).valueOf() === startOfDay(addMs(segEnd, -1)).valueOf();
        if (displayEventTime && !eventDef.allDay && (isStartDay || isEndDay)) {
            segStart = isStartDay ? wholeEventStart : segStart;
            segEnd = isEndDay ? wholeEventEnd : segEnd;
            if (displayEventEnd && eventDef.hasEnd) {
                return dateEnv.formatRange(segStart, segEnd, timeFormat, {
                    forcedStartTzo: startOverride ? null : eventInstance.forcedStartTzo,
                    forcedEndTzo: endOverride ? null : eventInstance.forcedEndTzo,
                });
            }
            return dateEnv.format(segStart, timeFormat, {
                forcedTzo: startOverride ? null : eventInstance.forcedStartTzo, // nooooo, same
            });
        }
        return '';
    }
    function getSegMeta(seg, todayRange, nowDate) {
        let segRange = seg.eventRange.range;
        return {
            isPast: segRange.end < (nowDate || todayRange.start),
            isFuture: segRange.start >= (nowDate || todayRange.end),
            isToday: todayRange && rangeContainsMarker(todayRange, segRange.start),
        };
    }
    function getEventClassNames(props) {
        let classNames = ['fc-event'];
        if (props.isMirror) {
            classNames.push('fc-event-mirror');
        }
        if (props.isDraggable) {
            classNames.push('fc-event-draggable');
        }
        if (props.isStartResizable || props.isEndResizable) {
            classNames.push('fc-event-resizable');
        }
        if (props.isDragging) {
            classNames.push('fc-event-dragging');
        }
        if (props.isResizing) {
            classNames.push('fc-event-resizing');
        }
        if (props.isSelected) {
            classNames.push('fc-event-selected');
        }
        if (props.isStart) {
            classNames.push('fc-event-start');
        }
        if (props.isEnd) {
            classNames.push('fc-event-end');
        }
        if (props.isPast) {
            classNames.push('fc-event-past');
        }
        if (props.isToday) {
            classNames.push('fc-event-today');
        }
        if (props.isFuture) {
            classNames.push('fc-event-future');
        }
        return classNames;
    }
    function buildEventRangeKey(eventRange) {
        return eventRange.instance
            ? eventRange.instance.instanceId
            : `${eventRange.def.defId}:${eventRange.range.start.toISOString()}`;
        // inverse-background events don't have specific instances. TODO: better solution
    }
    function getSegAnchorAttrs(seg, context) {
        let { def, instance } = seg.eventRange;
        let { url } = def;
        if (url) {
            return { href: url };
        }
        let { emitter, options } = context;
        let { eventInteractive } = options;
        if (eventInteractive == null) {
            eventInteractive = def.interactive;
            if (eventInteractive == null) {
                eventInteractive = Boolean(emitter.hasHandlers('eventClick'));
            }
        }
        // mock what happens in EventClicking
        if (eventInteractive) {
            // only attach keyboard-related handlers because click handler is already done in EventClicking
            return createAriaKeyboardAttrs((ev) => {
                emitter.trigger('eventClick', {
                    el: ev.target,
                    event: new EventImpl(context, def, instance),
                    jsEvent: ev,
                    view: context.viewApi,
                });
            });
        }
        return {};
    }

    const STANDARD_PROPS = {
        start: identity,
        end: identity,
        allDay: Boolean,
    };
    function parseDateSpan(raw, dateEnv, defaultDuration) {
        let span = parseOpenDateSpan(raw, dateEnv);
        let { range } = span;
        if (!range.start) {
            return null;
        }
        if (!range.end) {
            if (defaultDuration == null) {
                return null;
            }
            range.end = dateEnv.add(range.start, defaultDuration);
        }
        return span;
    }
    /*
    TODO: somehow combine with parseRange?
    Will return null if the start/end props were present but parsed invalidly.
    */
    function parseOpenDateSpan(raw, dateEnv) {
        let { refined: standardProps, extra } = refineProps(raw, STANDARD_PROPS);
        let startMeta = standardProps.start ? dateEnv.createMarkerMeta(standardProps.start) : null;
        let endMeta = standardProps.end ? dateEnv.createMarkerMeta(standardProps.end) : null;
        let { allDay } = standardProps;
        if (allDay == null) {
            allDay = (startMeta && startMeta.isTimeUnspecified) &&
                (!endMeta || endMeta.isTimeUnspecified);
        }
        return Object.assign({ range: {
                start: startMeta ? startMeta.marker : null,
                end: endMeta ? endMeta.marker : null,
            }, allDay }, extra);
    }
    function isDateSpansEqual(span0, span1) {
        return rangesEqual(span0.range, span1.range) &&
            span0.allDay === span1.allDay &&
            isSpanPropsEqual(span0, span1);
    }
    // the NON-DATE-RELATED props
    function isSpanPropsEqual(span0, span1) {
        for (let propName in span1) {
            if (propName !== 'range' && propName !== 'allDay') {
                if (span0[propName] !== span1[propName]) {
                    return false;
                }
            }
        }
        // are there any props that span0 has that span1 DOESN'T have?
        // both have range/allDay, so no need to special-case.
        for (let propName in span0) {
            if (!(propName in span1)) {
                return false;
            }
        }
        return true;
    }
    function buildDateSpanApi(span, dateEnv) {
        return Object.assign(Object.assign({}, buildRangeApi(span.range, dateEnv, span.allDay)), { allDay: span.allDay });
    }
    function buildRangeApiWithTimeZone(range, dateEnv, omitTime) {
        return Object.assign(Object.assign({}, buildRangeApi(range, dateEnv, omitTime)), { timeZone: dateEnv.timeZone });
    }
    function buildRangeApi(range, dateEnv, omitTime) {
        return {
            start: dateEnv.toDate(range.start),
            end: dateEnv.toDate(range.end),
            startStr: dateEnv.formatIso(range.start, { omitTime }),
            endStr: dateEnv.formatIso(range.end, { omitTime }),
        };
    }
    function fabricateEventRange(dateSpan, eventUiBases, context) {
        let res = refineEventDef({ editable: false }, context);
        let def = parseEventDef(res.refined, res.extra, '', // sourceId
        dateSpan.allDay, true, // hasEnd
        context);
        return {
            def,
            ui: compileEventUi(def, eventUiBases),
            instance: createEventInstance(def.defId, dateSpan.range),
            range: dateSpan.range,
            isStart: true,
            isEnd: true,
        };
    }

    /*
    given a function that resolves a result asynchronously.
    the function can either call passed-in success and failure callbacks,
    or it can return a promise.
    if you need to pass additional params to func, bind them first.
    */
    function unpromisify(func, normalizedSuccessCallback, normalizedFailureCallback) {
        // guard against success/failure callbacks being called more than once
        // and guard against a promise AND callback being used together.
        let isResolved = false;
        let wrappedSuccess = function (res) {
            if (!isResolved) {
                isResolved = true;
                normalizedSuccessCallback(res);
            }
        };
        let wrappedFailure = function (error) {
            if (!isResolved) {
                isResolved = true;
                normalizedFailureCallback(error);
            }
        };
        let res = func(wrappedSuccess, wrappedFailure);
        if (res && typeof res.then === 'function') {
            res.then(wrappedSuccess, wrappedFailure);
        }
    }

    class JsonRequestError extends Error {
        constructor(message, response) {
            super(message);
            this.response = response;
        }
    }
    function requestJson(method, url, params) {
        method = method.toUpperCase();
        const fetchOptions = {
            method,
        };
        if (method === 'GET') {
            url += (url.indexOf('?') === -1 ? '?' : '&') +
                new URLSearchParams(params);
        }
        else {
            fetchOptions.body = new URLSearchParams(params);
            fetchOptions.headers = {
                'Content-Type': 'application/x-www-form-urlencoded',
            };
        }
        return fetch(url, fetchOptions).then((fetchRes) => {
            if (fetchRes.ok) {
                return fetchRes.json().then((parsedResponse) => {
                    return [parsedResponse, fetchRes];
                }, () => {
                    throw new JsonRequestError('Failure parsing JSON', fetchRes);
                });
            }
            else {
                throw new JsonRequestError('Request failed', fetchRes);
            }
        });
    }

    let canVGrowWithinCell;
    function getCanVGrowWithinCell() {
        if (canVGrowWithinCell == null) {
            canVGrowWithinCell = computeCanVGrowWithinCell();
        }
        return canVGrowWithinCell;
    }
    function computeCanVGrowWithinCell() {
        // for SSR, because this function is call immediately at top-level
        // TODO: just make this logic execute top-level, immediately, instead of doing lazily
        if (typeof document === 'undefined') {
            return true;
        }
        let el = document.createElement('div');
        el.style.position = 'absolute';
        el.style.top = '0px';
        el.style.left = '0px';
        el.innerHTML = '<table><tr><td><div></div></td></tr></table>';
        el.querySelector('table').style.height = '100px';
        el.querySelector('div').style.height = '100%';
        document.body.appendChild(el);
        let div = el.querySelector('div');
        let possible = div.offsetHeight > 0;
        document.body.removeChild(el);
        return possible;
    }

    class CalendarRoot extends BaseComponent {
        constructor() {
            super(...arguments);
            this.state = {
                forPrint: false,
            };
            this.handleBeforePrint = () => {
                this.setState({ forPrint: true });
            };
            this.handleAfterPrint = () => {
                this.setState({ forPrint: false });
            };
        }
        render() {
            let { props } = this;
            let { options } = props;
            let { forPrint } = this.state;
            let isHeightAuto = forPrint || options.height === 'auto' || options.contentHeight === 'auto';
            let height = (!isHeightAuto && options.height != null) ? options.height : '';
            let classNames = [
                'fc',
                forPrint ? 'fc-media-print' : 'fc-media-screen',
                `fc-direction-${options.direction}`,
                props.theme.getClass('root'),
            ];
            if (!getCanVGrowWithinCell()) {
                classNames.push('fc-liquid-hack');
            }
            return props.children(classNames, height, isHeightAuto, forPrint);
        }
        componentDidMount() {
            let { emitter } = this.props;
            emitter.on('_beforeprint', this.handleBeforePrint);
            emitter.on('_afterprint', this.handleAfterPrint);
        }
        componentWillUnmount() {
            let { emitter } = this.props;
            emitter.off('_beforeprint', this.handleBeforePrint);
            emitter.off('_afterprint', this.handleAfterPrint);
        }
    }

    class Interaction {
        constructor(settings) {
            this.component = settings.component;
            this.isHitComboAllowed = settings.isHitComboAllowed || null;
        }
        destroy() {
        }
    }
    function parseInteractionSettings(component, input) {
        return {
            component,
            el: input.el,
            useEventCenter: input.useEventCenter != null ? input.useEventCenter : true,
            isHitComboAllowed: input.isHitComboAllowed || null,
        };
    }
    function interactionSettingsToStore(settings) {
        return {
            [settings.component.uid]: settings,
        };
    }
    // global state
    const interactionSettingsStore = {};

    class CalendarImpl {
        getCurrentData() {
            return this.currentDataManager.getCurrentData();
        }
        dispatch(action) {
            this.currentDataManager.dispatch(action);
        }
        get view() { return this.getCurrentData().viewApi; }
        batchRendering(callback) {
            callback();
        }
        updateSize() {
            this.trigger('_resize', true);
        }
        // Options
        // -----------------------------------------------------------------------------------------------------------------
        setOption(name, val) {
            this.dispatch({
                type: 'SET_OPTION',
                optionName: name,
                rawOptionValue: val,
            });
        }
        getOption(name) {
            return this.currentDataManager.currentCalendarOptionsInput[name];
        }
        getAvailableLocaleCodes() {
            return Object.keys(this.getCurrentData().availableRawLocales);
        }
        // Trigger
        // -----------------------------------------------------------------------------------------------------------------
        on(handlerName, handler) {
            let { currentDataManager } = this;
            if (currentDataManager.currentCalendarOptionsRefiners[handlerName]) {
                currentDataManager.emitter.on(handlerName, handler);
            }
            else {
                console.warn(`Unknown listener name '${handlerName}'`);
            }
        }
        off(handlerName, handler) {
            this.currentDataManager.emitter.off(handlerName, handler);
        }
        // not meant for public use
        trigger(handlerName, ...args) {
            this.currentDataManager.emitter.trigger(handlerName, ...args);
        }
        // View
        // -----------------------------------------------------------------------------------------------------------------
        changeView(viewType, dateOrRange) {
            this.batchRendering(() => {
                this.unselect();
                if (dateOrRange) {
                    if (dateOrRange.start && dateOrRange.end) { // a range
                        this.dispatch({
                            type: 'CHANGE_VIEW_TYPE',
                            viewType,
                        });
                        this.dispatch({
                            type: 'SET_OPTION',
                            optionName: 'visibleRange',
                            rawOptionValue: dateOrRange,
                        });
                    }
                    else {
                        let { dateEnv } = this.getCurrentData();
                        this.dispatch({
                            type: 'CHANGE_VIEW_TYPE',
                            viewType,
                            dateMarker: dateEnv.createMarker(dateOrRange),
                        });
                    }
                }
                else {
                    this.dispatch({
                        type: 'CHANGE_VIEW_TYPE',
                        viewType,
                    });
                }
            });
        }
        // Forces navigation to a view for the given date.
        // `viewType` can be a specific view name or a generic one like "week" or "day".
        // needs to change
        zoomTo(dateMarker, viewType) {
            let state = this.getCurrentData();
            let spec;
            viewType = viewType || 'day'; // day is default zoom
            spec = state.viewSpecs[viewType] || this.getUnitViewSpec(viewType);
            this.unselect();
            if (spec) {
                this.dispatch({
                    type: 'CHANGE_VIEW_TYPE',
                    viewType: spec.type,
                    dateMarker,
                });
            }
            else {
                this.dispatch({
                    type: 'CHANGE_DATE',
                    dateMarker,
                });
            }
        }
        // Given a duration singular unit, like "week" or "day", finds a matching view spec.
        // Preference is given to views that have corresponding buttons.
        getUnitViewSpec(unit) {
            let { viewSpecs, toolbarConfig } = this.getCurrentData();
            let viewTypes = [].concat(toolbarConfig.header ? toolbarConfig.header.viewsWithButtons : [], toolbarConfig.footer ? toolbarConfig.footer.viewsWithButtons : []);
            let i;
            let spec;
            for (let viewType in viewSpecs) {
                viewTypes.push(viewType);
            }
            for (i = 0; i < viewTypes.length; i += 1) {
                spec = viewSpecs[viewTypes[i]];
                if (spec) {
                    if (spec.singleUnit === unit) {
                        return spec;
                    }
                }
            }
            return null;
        }
        // Current Date
        // -----------------------------------------------------------------------------------------------------------------
        prev() {
            this.unselect();
            this.dispatch({ type: 'PREV' });
        }
        next() {
            this.unselect();
            this.dispatch({ type: 'NEXT' });
        }
        prevYear() {
            let state = this.getCurrentData();
            this.unselect();
            this.dispatch({
                type: 'CHANGE_DATE',
                dateMarker: state.dateEnv.addYears(state.currentDate, -1),
            });
        }
        nextYear() {
            let state = this.getCurrentData();
            this.unselect();
            this.dispatch({
                type: 'CHANGE_DATE',
                dateMarker: state.dateEnv.addYears(state.currentDate, 1),
            });
        }
        today() {
            let state = this.getCurrentData();
            this.unselect();
            this.dispatch({
                type: 'CHANGE_DATE',
                dateMarker: getNow(state.calendarOptions.now, state.dateEnv),
            });
        }
        gotoDate(zonedDateInput) {
            let state = this.getCurrentData();
            this.unselect();
            this.dispatch({
                type: 'CHANGE_DATE',
                dateMarker: state.dateEnv.createMarker(zonedDateInput),
            });
        }
        incrementDate(deltaInput) {
            let state = this.getCurrentData();
            let delta = createDuration(deltaInput);
            if (delta) { // else, warn about invalid input?
                this.unselect();
                this.dispatch({
                    type: 'CHANGE_DATE',
                    dateMarker: state.dateEnv.add(state.currentDate, delta),
                });
            }
        }
        getDate() {
            let state = this.getCurrentData();
            return state.dateEnv.toDate(state.currentDate);
        }
        // Date Formatting Utils
        // -----------------------------------------------------------------------------------------------------------------
        formatDate(d, formatter) {
            let { dateEnv } = this.getCurrentData();
            return dateEnv.format(dateEnv.createMarker(d), createFormatter(formatter));
        }
        // `settings` is for formatter AND isEndExclusive
        formatRange(d0, d1, settings) {
            let { dateEnv } = this.getCurrentData();
            return dateEnv.formatRange(dateEnv.createMarker(d0), dateEnv.createMarker(d1), createFormatter(settings), settings);
        }
        formatIso(d, omitTime) {
            let { dateEnv } = this.getCurrentData();
            return dateEnv.formatIso(dateEnv.createMarker(d), { omitTime });
        }
        // Date Selection / Event Selection / DayClick
        // -----------------------------------------------------------------------------------------------------------------
        select(dateOrObj, endDate) {
            let selectionInput;
            if (endDate == null) {
                if (dateOrObj.start != null) {
                    selectionInput = dateOrObj;
                }
                else {
                    selectionInput = {
                        start: dateOrObj,
                        end: null,
                    };
                }
            }
            else {
                selectionInput = {
                    start: dateOrObj,
                    end: endDate,
                };
            }
            let state = this.getCurrentData();
            let selection = parseDateSpan(selectionInput, state.dateEnv, createDuration({ days: 1 }));
            if (selection) { // throw parse error otherwise?
                this.dispatch({ type: 'SELECT_DATES', selection });
                triggerDateSelect(selection, null, state);
            }
        }
        unselect(pev) {
            let state = this.getCurrentData();
            if (state.dateSelection) {
                this.dispatch({ type: 'UNSELECT_DATES' });
                triggerDateUnselect(pev, state);
            }
        }
        // Public Events API
        // -----------------------------------------------------------------------------------------------------------------
        addEvent(eventInput, sourceInput) {
            if (eventInput instanceof EventImpl) {
                let def = eventInput._def;
                let instance = eventInput._instance;
                let currentData = this.getCurrentData();
                // not already present? don't want to add an old snapshot
                if (!currentData.eventStore.defs[def.defId]) {
                    this.dispatch({
                        type: 'ADD_EVENTS',
                        eventStore: eventTupleToStore({ def, instance }), // TODO: better util for two args?
                    });
                    this.triggerEventAdd(eventInput);
                }
                return eventInput;
            }
            let state = this.getCurrentData();
            let eventSource;
            if (sourceInput instanceof EventSourceImpl) {
                eventSource = sourceInput.internalEventSource;
            }
            else if (typeof sourceInput === 'boolean') {
                if (sourceInput) { // true. part of the first event source
                    [eventSource] = hashValuesToArray(state.eventSources);
                }
            }
            else if (sourceInput != null) { // an ID. accepts a number too
                let sourceApi = this.getEventSourceById(sourceInput); // TODO: use an internal function
                if (!sourceApi) {
                    console.warn(`Could not find an event source with ID "${sourceInput}"`); // TODO: test
                    return null;
                }
                eventSource = sourceApi.internalEventSource;
            }
            let tuple = parseEvent(eventInput, eventSource, state, false);
            if (tuple) {
                let newEventApi = new EventImpl(state, tuple.def, tuple.def.recurringDef ? null : tuple.instance);
                this.dispatch({
                    type: 'ADD_EVENTS',
                    eventStore: eventTupleToStore(tuple),
                });
                this.triggerEventAdd(newEventApi);
                return newEventApi;
            }
            return null;
        }
        triggerEventAdd(eventApi) {
            let { emitter } = this.getCurrentData();
            emitter.trigger('eventAdd', {
                event: eventApi,
                relatedEvents: [],
                revert: () => {
                    this.dispatch({
                        type: 'REMOVE_EVENTS',
                        eventStore: eventApiToStore(eventApi),
                    });
                },
            });
        }
        // TODO: optimize
        getEventById(id) {
            let state = this.getCurrentData();
            let { defs, instances } = state.eventStore;
            id = String(id);
            for (let defId in defs) {
                let def = defs[defId];
                if (def.publicId === id) {
                    if (def.recurringDef) {
                        return new EventImpl(state, def, null);
                    }
                    for (let instanceId in instances) {
                        let instance = instances[instanceId];
                        if (instance.defId === def.defId) {
                            return new EventImpl(state, def, instance);
                        }
                    }
                }
            }
            return null;
        }
        getEvents() {
            let currentData = this.getCurrentData();
            return buildEventApis(currentData.eventStore, currentData);
        }
        removeAllEvents() {
            this.dispatch({ type: 'REMOVE_ALL_EVENTS' });
        }
        // Public Event Sources API
        // -----------------------------------------------------------------------------------------------------------------
        getEventSources() {
            let state = this.getCurrentData();
            let sourceHash = state.eventSources;
            let sourceApis = [];
            for (let internalId in sourceHash) {
                sourceApis.push(new EventSourceImpl(state, sourceHash[internalId]));
            }
            return sourceApis;
        }
        getEventSourceById(id) {
            let state = this.getCurrentData();
            let sourceHash = state.eventSources;
            id = String(id);
            for (let sourceId in sourceHash) {
                if (sourceHash[sourceId].publicId === id) {
                    return new EventSourceImpl(state, sourceHash[sourceId]);
                }
            }
            return null;
        }
        addEventSource(sourceInput) {
            let state = this.getCurrentData();
            if (sourceInput instanceof EventSourceImpl) {
                // not already present? don't want to add an old snapshot
                if (!state.eventSources[sourceInput.internalEventSource.sourceId]) {
                    this.dispatch({
                        type: 'ADD_EVENT_SOURCES',
                        sources: [sourceInput.internalEventSource],
                    });
                }
                return sourceInput;
            }
            let eventSource = parseEventSource(sourceInput, state);
            if (eventSource) { // TODO: error otherwise?
                this.dispatch({ type: 'ADD_EVENT_SOURCES', sources: [eventSource] });
                return new EventSourceImpl(state, eventSource);
            }
            return null;
        }
        removeAllEventSources() {
            this.dispatch({ type: 'REMOVE_ALL_EVENT_SOURCES' });
        }
        refetchEvents() {
            this.dispatch({ type: 'FETCH_EVENT_SOURCES', isRefetch: true });
        }
        // Scroll
        // -----------------------------------------------------------------------------------------------------------------
        scrollToTime(timeInput) {
            let time = createDuration(timeInput);
            if (time) {
                this.trigger('_scrollRequest', { time });
            }
        }
    }

    function pointInsideRect(point, rect) {
        return point.left >= rect.left &&
            point.left < rect.right &&
            point.top >= rect.top &&
            point.top < rect.bottom;
    }
    // Returns a new rectangle that is the intersection of the two rectangles. If they don't intersect, returns false
    function intersectRects(rect1, rect2) {
        let res = {
            left: Math.max(rect1.left, rect2.left),
            right: Math.min(rect1.right, rect2.right),
            top: Math.max(rect1.top, rect2.top),
            bottom: Math.min(rect1.bottom, rect2.bottom),
        };
        if (res.left < res.right && res.top < res.bottom) {
            return res;
        }
        return false;
    }
    function translateRect(rect, deltaX, deltaY) {
        return {
            left: rect.left + deltaX,
            right: rect.right + deltaX,
            top: rect.top + deltaY,
            bottom: rect.bottom + deltaY,
        };
    }
    // Returns a new point that will have been moved to reside within the given rectangle
    function constrainPoint(point, rect) {
        return {
            left: Math.min(Math.max(point.left, rect.left), rect.right),
            top: Math.min(Math.max(point.top, rect.top), rect.bottom),
        };
    }
    // Returns a point that is the center of the given rectangle
    function getRectCenter(rect) {
        return {
            left: (rect.left + rect.right) / 2,
            top: (rect.top + rect.bottom) / 2,
        };
    }
    // Subtracts point2's coordinates from point1's coordinates, returning a delta
    function diffPoints(point1, point2) {
        return {
            left: point1.left - point2.left,
            top: point1.top - point2.top,
        };
    }

    const EMPTY_EVENT_STORE = createEmptyEventStore(); // for purecomponents. TODO: keep elsewhere
    class Splitter {
        constructor() {
            this.getKeysForEventDefs = memoize(this._getKeysForEventDefs);
            this.splitDateSelection = memoize(this._splitDateSpan);
            this.splitEventStore = memoize(this._splitEventStore);
            this.splitIndividualUi = memoize(this._splitIndividualUi);
            this.splitEventDrag = memoize(this._splitInteraction);
            this.splitEventResize = memoize(this._splitInteraction);
            this.eventUiBuilders = {}; // TODO: typescript protection
        }
        splitProps(props) {
            let keyInfos = this.getKeyInfo(props);
            let defKeys = this.getKeysForEventDefs(props.eventStore);
            let dateSelections = this.splitDateSelection(props.dateSelection);
            let individualUi = this.splitIndividualUi(props.eventUiBases, defKeys); // the individual *bases*
            let eventStores = this.splitEventStore(props.eventStore, defKeys);
            let eventDrags = this.splitEventDrag(props.eventDrag);
            let eventResizes = this.splitEventResize(props.eventResize);
            let splitProps = {};
            this.eventUiBuilders = mapHash(keyInfos, (info, key) => this.eventUiBuilders[key] || memoize(buildEventUiForKey));
            for (let key in keyInfos) {
                let keyInfo = keyInfos[key];
                let eventStore = eventStores[key] || EMPTY_EVENT_STORE;
                let buildEventUi = this.eventUiBuilders[key];
                splitProps[key] = {
                    businessHours: keyInfo.businessHours || props.businessHours,
                    dateSelection: dateSelections[key] || null,
                    eventStore,
                    eventUiBases: buildEventUi(props.eventUiBases[''], keyInfo.ui, individualUi[key]),
                    eventSelection: eventStore.instances[props.eventSelection] ? props.eventSelection : '',
                    eventDrag: eventDrags[key] || null,
                    eventResize: eventResizes[key] || null,
                };
            }
            return splitProps;
        }
        _splitDateSpan(dateSpan) {
            let dateSpans = {};
            if (dateSpan) {
                let keys = this.getKeysForDateSpan(dateSpan);
                for (let key of keys) {
                    dateSpans[key] = dateSpan;
                }
            }
            return dateSpans;
        }
        _getKeysForEventDefs(eventStore) {
            return mapHash(eventStore.defs, (eventDef) => this.getKeysForEventDef(eventDef));
        }
        _splitEventStore(eventStore, defKeys) {
            let { defs, instances } = eventStore;
            let splitStores = {};
            for (let defId in defs) {
                for (let key of defKeys[defId]) {
                    if (!splitStores[key]) {
                        splitStores[key] = createEmptyEventStore();
                    }
                    splitStores[key].defs[defId] = defs[defId];
                }
            }
            for (let instanceId in instances) {
                let instance = instances[instanceId];
                for (let key of defKeys[instance.defId]) {
                    if (splitStores[key]) { // must have already been created
                        splitStores[key].instances[instanceId] = instance;
                    }
                }
            }
            return splitStores;
        }
        _splitIndividualUi(eventUiBases, defKeys) {
            let splitHashes = {};
            for (let defId in eventUiBases) {
                if (defId) { // not the '' key
                    for (let key of defKeys[defId]) {
                        if (!splitHashes[key]) {
                            splitHashes[key] = {};
                        }
                        splitHashes[key][defId] = eventUiBases[defId];
                    }
                }
            }
            return splitHashes;
        }
        _splitInteraction(interaction) {
            let splitStates = {};
            if (interaction) {
                let affectedStores = this._splitEventStore(interaction.affectedEvents, this._getKeysForEventDefs(interaction.affectedEvents));
                // can't rely on defKeys because event data is mutated
                let mutatedKeysByDefId = this._getKeysForEventDefs(interaction.mutatedEvents);
                let mutatedStores = this._splitEventStore(interaction.mutatedEvents, mutatedKeysByDefId);
                let populate = (key) => {
                    if (!splitStates[key]) {
                        splitStates[key] = {
                            affectedEvents: affectedStores[key] || EMPTY_EVENT_STORE,
                            mutatedEvents: mutatedStores[key] || EMPTY_EVENT_STORE,
                            isEvent: interaction.isEvent,
                        };
                    }
                };
                for (let key in affectedStores) {
                    populate(key);
                }
                for (let key in mutatedStores) {
                    populate(key);
                }
            }
            return splitStates;
        }
    }
    function buildEventUiForKey(allUi, eventUiForKey, individualUi) {
        let baseParts = [];
        if (allUi) {
            baseParts.push(allUi);
        }
        if (eventUiForKey) {
            baseParts.push(eventUiForKey);
        }
        let stuff = {
            '': combineEventUis(baseParts),
        };
        if (individualUi) {
            Object.assign(stuff, individualUi);
        }
        return stuff;
    }

    function getDateMeta(date, todayRange, nowDate, dateProfile) {
        return {
            dow: date.getUTCDay(),
            isDisabled: Boolean(dateProfile && !rangeContainsMarker(dateProfile.activeRange, date)),
            isOther: Boolean(dateProfile && !rangeContainsMarker(dateProfile.currentRange, date)),
            isToday: Boolean(todayRange && rangeContainsMarker(todayRange, date)),
            isPast: Boolean(nowDate ? (date < nowDate) : todayRange ? (date < todayRange.start) : false),
            isFuture: Boolean(nowDate ? (date > nowDate) : todayRange ? (date >= todayRange.end) : false),
        };
    }
    function getDayClassNames(meta, theme) {
        let classNames = [
            'fc-day',
            `fc-day-${DAY_IDS[meta.dow]}`,
        ];
        if (meta.isDisabled) {
            classNames.push('fc-day-disabled');
        }
        else {
            if (meta.isToday) {
                classNames.push('fc-day-today');
                classNames.push(theme.getClass('today'));
            }
            if (meta.isPast) {
                classNames.push('fc-day-past');
            }
            if (meta.isFuture) {
                classNames.push('fc-day-future');
            }
            if (meta.isOther) {
                classNames.push('fc-day-other');
            }
        }
        return classNames;
    }
    function getSlotClassNames(meta, theme) {
        let classNames = [
            'fc-slot',
            `fc-slot-${DAY_IDS[meta.dow]}`,
        ];
        if (meta.isDisabled) {
            classNames.push('fc-slot-disabled');
        }
        else {
            if (meta.isToday) {
                classNames.push('fc-slot-today');
                classNames.push(theme.getClass('today'));
            }
            if (meta.isPast) {
                classNames.push('fc-slot-past');
            }
            if (meta.isFuture) {
                classNames.push('fc-slot-future');
            }
        }
        return classNames;
    }

    const DAY_FORMAT = createFormatter({ year: 'numeric', month: 'long', day: 'numeric' });
    const WEEK_FORMAT = createFormatter({ week: 'long' });
    function buildNavLinkAttrs(context, dateMarker, viewType = 'day', isTabbable = true) {
        const { dateEnv, options, calendarApi } = context;
        let dateStr = dateEnv.format(dateMarker, viewType === 'week' ? WEEK_FORMAT : DAY_FORMAT);
        if (options.navLinks) {
            let zonedDate = dateEnv.toDate(dateMarker);
            const handleInteraction = (ev) => {
                let customAction = viewType === 'day' ? options.navLinkDayClick :
                    viewType === 'week' ? options.navLinkWeekClick : null;
                if (typeof customAction === 'function') {
                    customAction.call(calendarApi, dateEnv.toDate(dateMarker), ev);
                }
                else {
                    if (typeof customAction === 'string') {
                        viewType = customAction;
                    }
                    calendarApi.zoomTo(dateMarker, viewType);
                }
            };
            return Object.assign({ title: formatWithOrdinals(options.navLinkHint, [dateStr, zonedDate], dateStr), 'data-navlink': '' }, (isTabbable
                ? createAriaClickAttrs(handleInteraction)
                : { onClick: handleInteraction }));
        }
        return { 'aria-label': dateStr };
    }

    let _isRtlScrollbarOnLeft = null;
    function getIsRtlScrollbarOnLeft() {
        if (_isRtlScrollbarOnLeft === null) {
            _isRtlScrollbarOnLeft = computeIsRtlScrollbarOnLeft();
        }
        return _isRtlScrollbarOnLeft;
    }
    function computeIsRtlScrollbarOnLeft() {
        let outerEl = document.createElement('div');
        applyStyle(outerEl, {
            position: 'absolute',
            top: -1000,
            left: 0,
            border: 0,
            padding: 0,
            overflow: 'scroll',
            direction: 'rtl',
        });
        outerEl.innerHTML = '<div></div>';
        document.body.appendChild(outerEl);
        let innerEl = outerEl.firstChild;
        let res = innerEl.getBoundingClientRect().left > outerEl.getBoundingClientRect().left;
        removeElement(outerEl);
        return res;
    }

    let _scrollbarWidths;
    function getScrollbarWidths() {
        if (!_scrollbarWidths) {
            _scrollbarWidths = computeScrollbarWidths();
        }
        return _scrollbarWidths;
    }
    function computeScrollbarWidths() {
        let el = document.createElement('div');
        el.style.overflow = 'scroll';
        el.style.position = 'absolute';
        el.style.top = '-9999px';
        el.style.left = '-9999px';
        document.body.appendChild(el);
        let res = computeScrollbarWidthsForEl(el);
        document.body.removeChild(el);
        return res;
    }
    // WARNING: will include border
    function computeScrollbarWidthsForEl(el) {
        return {
            x: el.offsetHeight - el.clientHeight,
            y: el.offsetWidth - el.clientWidth,
        };
    }

    function computeEdges(el, getPadding = false) {
        let computedStyle = window.getComputedStyle(el);
        let borderLeft = parseInt(computedStyle.borderLeftWidth, 10) || 0;
        let borderRight = parseInt(computedStyle.borderRightWidth, 10) || 0;
        let borderTop = parseInt(computedStyle.borderTopWidth, 10) || 0;
        let borderBottom = parseInt(computedStyle.borderBottomWidth, 10) || 0;
        let badScrollbarWidths = computeScrollbarWidthsForEl(el); // includes border!
        let scrollbarLeftRight = badScrollbarWidths.y - borderLeft - borderRight;
        let scrollbarBottom = badScrollbarWidths.x - borderTop - borderBottom;
        let res = {
            borderLeft,
            borderRight,
            borderTop,
            borderBottom,
            scrollbarBottom,
            scrollbarLeft: 0,
            scrollbarRight: 0,
        };
        if (getIsRtlScrollbarOnLeft() && computedStyle.direction === 'rtl') { // is the scrollbar on the left side?
            res.scrollbarLeft = scrollbarLeftRight;
        }
        else {
            res.scrollbarRight = scrollbarLeftRight;
        }
        if (getPadding) {
            res.paddingLeft = parseInt(computedStyle.paddingLeft, 10) || 0;
            res.paddingRight = parseInt(computedStyle.paddingRight, 10) || 0;
            res.paddingTop = parseInt(computedStyle.paddingTop, 10) || 0;
            res.paddingBottom = parseInt(computedStyle.paddingBottom, 10) || 0;
        }
        return res;
    }
    function computeInnerRect(el, goWithinPadding = false, doFromWindowViewport) {
        let outerRect = doFromWindowViewport ? el.getBoundingClientRect() : computeRect(el);
        let edges = computeEdges(el, goWithinPadding);
        let res = {
            left: outerRect.left + edges.borderLeft + edges.scrollbarLeft,
            right: outerRect.right - edges.borderRight - edges.scrollbarRight,
            top: outerRect.top + edges.borderTop,
            bottom: outerRect.bottom - edges.borderBottom - edges.scrollbarBottom,
        };
        if (goWithinPadding) {
            res.left += edges.paddingLeft;
            res.right -= edges.paddingRight;
            res.top += edges.paddingTop;
            res.bottom -= edges.paddingBottom;
        }
        return res;
    }
    function computeRect(el) {
        let rect = el.getBoundingClientRect();
        return {
            left: rect.left + window.pageXOffset,
            top: rect.top + window.pageYOffset,
            right: rect.right + window.pageXOffset,
            bottom: rect.bottom + window.pageYOffset,
        };
    }
    function computeClippedClientRect(el) {
        let clippingParents = getClippingParents(el);
        let rect = el.getBoundingClientRect();
        for (let clippingParent of clippingParents) {
            let intersection = intersectRects(rect, clippingParent.getBoundingClientRect());
            if (intersection) {
                rect = intersection;
            }
            else {
                return null;
            }
        }
        return rect;
    }
    // does not return window
    function getClippingParents(el) {
        let parents = [];
        while (el instanceof HTMLElement) { // will stop when gets to document or null
            let computedStyle = window.getComputedStyle(el);
            if (computedStyle.position === 'fixed') {
                break;
            }
            if ((/(auto|scroll)/).test(computedStyle.overflow + computedStyle.overflowY + computedStyle.overflowX)) {
                parents.push(el);
            }
            el = el.parentNode;
        }
        return parents;
    }

    /*
    Records offset information for a set of elements, relative to an origin element.
    Can record the left/right OR the top/bottom OR both.
    Provides methods for querying the cache by position.
    */
    class PositionCache {
        constructor(originEl, els, isHorizontal, isVertical) {
            this.els = els;
            let originClientRect = this.originClientRect = originEl.getBoundingClientRect(); // relative to viewport top-left
            if (isHorizontal) {
                this.buildElHorizontals(originClientRect.left);
            }
            if (isVertical) {
                this.buildElVerticals(originClientRect.top);
            }
        }
        // Populates the left/right internal coordinate arrays
        buildElHorizontals(originClientLeft) {
            let lefts = [];
            let rights = [];
            for (let el of this.els) {
                let rect = el.getBoundingClientRect();
                lefts.push(rect.left - originClientLeft);
                rights.push(rect.right - originClientLeft);
            }
            this.lefts = lefts;
            this.rights = rights;
        }
        // Populates the top/bottom internal coordinate arrays
        buildElVerticals(originClientTop) {
            let tops = [];
            let bottoms = [];
            for (let el of this.els) {
                let rect = el.getBoundingClientRect();
                tops.push(rect.top - originClientTop);
                bottoms.push(rect.bottom - originClientTop);
            }
            this.tops = tops;
            this.bottoms = bottoms;
        }
        // Given a left offset (from document left), returns the index of the el that it horizontally intersects.
        // If no intersection is made, returns undefined.
        leftToIndex(leftPosition) {
            let { lefts, rights } = this;
            let len = lefts.length;
            let i;
            for (i = 0; i < len; i += 1) {
                if (leftPosition >= lefts[i] && leftPosition < rights[i]) {
                    return i;
                }
            }
            return undefined; // TODO: better
        }
        // Given a top offset (from document top), returns the index of the el that it vertically intersects.
        // If no intersection is made, returns undefined.
        topToIndex(topPosition) {
            let { tops, bottoms } = this;
            let len = tops.length;
            let i;
            for (i = 0; i < len; i += 1) {
                if (topPosition >= tops[i] && topPosition < bottoms[i]) {
                    return i;
                }
            }
            return undefined; // TODO: better
        }
        // Gets the width of the element at the given index
        getWidth(leftIndex) {
            return this.rights[leftIndex] - this.lefts[leftIndex];
        }
        // Gets the height of the element at the given index
        getHeight(topIndex) {
            return this.bottoms[topIndex] - this.tops[topIndex];
        }
    }

    /* eslint max-classes-per-file: "off" */
    /*
    An object for getting/setting scroll-related information for an element.
    Internally, this is done very differently for window versus DOM element,
    so this object serves as a common interface.
    */
    class ScrollController {
        getMaxScrollTop() {
            return this.getScrollHeight() - this.getClientHeight();
        }
        getMaxScrollLeft() {
            return this.getScrollWidth() - this.getClientWidth();
        }
        canScrollVertically() {
            return this.getMaxScrollTop() > 0;
        }
        canScrollHorizontally() {
            return this.getMaxScrollLeft() > 0;
        }
        canScrollUp() {
            return this.getScrollTop() > 0;
        }
        canScrollDown() {
            return this.getScrollTop() < this.getMaxScrollTop();
        }
        canScrollLeft() {
            return this.getScrollLeft() > 0;
        }
        canScrollRight() {
            return this.getScrollLeft() < this.getMaxScrollLeft();
        }
    }
    class ElementScrollController extends ScrollController {
        constructor(el) {
            super();
            this.el = el;
        }
        getScrollTop() {
            return this.el.scrollTop;
        }
        getScrollLeft() {
            return this.el.scrollLeft;
        }
        setScrollTop(top) {
            this.el.scrollTop = top;
        }
        setScrollLeft(left) {
            this.el.scrollLeft = left;
        }
        getScrollWidth() {
            return this.el.scrollWidth;
        }
        getScrollHeight() {
            return this.el.scrollHeight;
        }
        getClientHeight() {
            return this.el.clientHeight;
        }
        getClientWidth() {
            return this.el.clientWidth;
        }
    }
    class WindowScrollController extends ScrollController {
        getScrollTop() {
            return window.pageYOffset;
        }
        getScrollLeft() {
            return window.pageXOffset;
        }
        setScrollTop(n) {
            window.scroll(window.pageXOffset, n);
        }
        setScrollLeft(n) {
            window.scroll(n, window.pageYOffset);
        }
        getScrollWidth() {
            return document.documentElement.scrollWidth;
        }
        getScrollHeight() {
            return document.documentElement.scrollHeight;
        }
        getClientHeight() {
            return document.documentElement.clientHeight;
        }
        getClientWidth() {
            return document.documentElement.clientWidth;
        }
    }

    /*
    an INTERACTABLE date component

    PURPOSES:
    - hook up to fg, fill, and mirror renderers
    - interface for dragging and hits
    */
    class DateComponent extends BaseComponent {
        constructor() {
            super(...arguments);
            this.uid = guid();
        }
        // Hit System
        // -----------------------------------------------------------------------------------------------------------------
        prepareHits() {
        }
        queryHit(positionLeft, positionTop, elWidth, elHeight) {
            return null; // this should be abstract
        }
        // Pointer Interaction Utils
        // -----------------------------------------------------------------------------------------------------------------
        isValidSegDownEl(el) {
            return !this.props.eventDrag && // HACK
                !this.props.eventResize && // HACK
                !elementClosest(el, '.fc-event-mirror');
        }
        isValidDateDownEl(el) {
            return !elementClosest(el, '.fc-event:not(.fc-bg-event)') &&
                !elementClosest(el, '.fc-more-link') && // a "more.." link
                !elementClosest(el, 'a[data-navlink]') && // a clickable nav link
                !elementClosest(el, '.fc-popover'); // hack
        }
    }

    class NamedTimeZoneImpl {
        constructor(timeZoneName) {
            this.timeZoneName = timeZoneName;
        }
    }

    class SegHierarchy {
        constructor() {
            // settings
            this.strictOrder = false;
            this.allowReslicing = false;
            this.maxCoord = -1; // -1 means no max
            this.maxStackCnt = -1; // -1 means no max
            this.levelCoords = []; // ordered
            this.entriesByLevel = []; // parallel with levelCoords
            this.stackCnts = {}; // TODO: use better technique!?
        }
        addSegs(inputs) {
            let hiddenEntries = [];
            for (let input of inputs) {
                this.insertEntry(input, hiddenEntries);
            }
            return hiddenEntries;
        }
        insertEntry(entry, hiddenEntries) {
            let insertion = this.findInsertion(entry);
            if (this.isInsertionValid(insertion, entry)) {
                this.insertEntryAt(entry, insertion);
                return 1;
            }
            return this.handleInvalidInsertion(insertion, entry, hiddenEntries);
        }
        isInsertionValid(insertion, entry) {
            return (this.maxCoord === -1 || insertion.levelCoord + entry.thickness <= this.maxCoord) &&
                (this.maxStackCnt === -1 || insertion.stackCnt < this.maxStackCnt);
        }
        // returns number of new entries inserted
        handleInvalidInsertion(insertion, entry, hiddenEntries) {
            if (this.allowReslicing && insertion.touchingEntry) {
                return this.splitEntry(entry, insertion.touchingEntry, hiddenEntries);
            }
            hiddenEntries.push(entry);
            return 0;
        }
        splitEntry(entry, barrier, hiddenEntries) {
            let partCnt = 0;
            let splitHiddenEntries = [];
            let entrySpan = entry.span;
            let barrierSpan = barrier.span;
            if (entrySpan.start < barrierSpan.start) {
                partCnt += this.insertEntry({
                    index: entry.index,
                    thickness: entry.thickness,
                    span: { start: entrySpan.start, end: barrierSpan.start },
                }, splitHiddenEntries);
            }
            if (entrySpan.end > barrierSpan.end) {
                partCnt += this.insertEntry({
                    index: entry.index,
                    thickness: entry.thickness,
                    span: { start: barrierSpan.end, end: entrySpan.end },
                }, splitHiddenEntries);
            }
            if (partCnt) {
                hiddenEntries.push({
                    index: entry.index,
                    thickness: entry.thickness,
                    span: intersectSpans(barrierSpan, entrySpan), // guaranteed to intersect
                }, ...splitHiddenEntries);
                return partCnt;
            }
            hiddenEntries.push(entry);
            return 0;
        }
        insertEntryAt(entry, insertion) {
            let { entriesByLevel, levelCoords } = this;
            if (insertion.lateral === -1) {
                // create a new level
                insertAt(levelCoords, insertion.level, insertion.levelCoord);
                insertAt(entriesByLevel, insertion.level, [entry]);
            }
            else {
                // insert into existing level
                insertAt(entriesByLevel[insertion.level], insertion.lateral, entry);
            }
            this.stackCnts[buildEntryKey(entry)] = insertion.stackCnt;
        }
        findInsertion(newEntry) {
            let { levelCoords, entriesByLevel, strictOrder, stackCnts } = this;
            let levelCnt = levelCoords.length;
            let candidateCoord = 0;
            let touchingLevel = -1;
            let touchingLateral = -1;
            let touchingEntry = null;
            let stackCnt = 0;
            for (let trackingLevel = 0; trackingLevel < levelCnt; trackingLevel += 1) {
                let trackingCoord = levelCoords[trackingLevel];
                // if the current level is past the placed entry, we have found a good empty space and can stop.
                // if strictOrder, keep finding more lateral intersections.
                if (!strictOrder && trackingCoord >= candidateCoord + newEntry.thickness) {
                    break;
                }
                let trackingEntries = entriesByLevel[trackingLevel];
                let trackingEntry;
                let searchRes = binarySearch(trackingEntries, newEntry.span.start, getEntrySpanEnd); // find first entry after newEntry's end
                let lateralIndex = searchRes[0] + searchRes[1]; // if exact match (which doesn't collide), go to next one
                while ( // loop through entries that horizontally intersect
                (trackingEntry = trackingEntries[lateralIndex]) && // but not past the whole entry list
                    trackingEntry.span.start < newEntry.span.end // and not entirely past newEntry
                ) {
                    let trackingEntryBottom = trackingCoord + trackingEntry.thickness;
                    // intersects into the top of the candidate?
                    if (trackingEntryBottom > candidateCoord) {
                        candidateCoord = trackingEntryBottom;
                        touchingEntry = trackingEntry;
                        touchingLevel = trackingLevel;
                        touchingLateral = lateralIndex;
                    }
                    // butts up against top of candidate? (will happen if just intersected as well)
                    if (trackingEntryBottom === candidateCoord) {
                        // accumulate the highest possible stackCnt of the trackingEntries that butt up
                        stackCnt = Math.max(stackCnt, stackCnts[buildEntryKey(trackingEntry)] + 1);
                    }
                    lateralIndex += 1;
                }
            }
            // the destination level will be after touchingEntry's level. find it
            let destLevel = 0;
            if (touchingEntry) {
                destLevel = touchingLevel + 1;
                while (destLevel < levelCnt && levelCoords[destLevel] < candidateCoord) {
                    destLevel += 1;
                }
            }
            // if adding to an existing level, find where to insert
            let destLateral = -1;
            if (destLevel < levelCnt && levelCoords[destLevel] === candidateCoord) {
                destLateral = binarySearch(entriesByLevel[destLevel], newEntry.span.end, getEntrySpanEnd)[0];
            }
            return {
                touchingLevel,
                touchingLateral,
                touchingEntry,
                stackCnt,
                levelCoord: candidateCoord,
                level: destLevel,
                lateral: destLateral,
            };
        }
        // sorted by levelCoord (lowest to highest)
        toRects() {
            let { entriesByLevel, levelCoords } = this;
            let levelCnt = entriesByLevel.length;
            let rects = [];
            for (let level = 0; level < levelCnt; level += 1) {
                let entries = entriesByLevel[level];
                let levelCoord = levelCoords[level];
                for (let entry of entries) {
                    rects.push(Object.assign(Object.assign({}, entry), { levelCoord }));
                }
            }
            return rects;
        }
    }
    function getEntrySpanEnd(entry) {
        return entry.span.end;
    }
    function buildEntryKey(entry) {
        return entry.index + ':' + entry.span.start;
    }
    // returns groups with entries sorted by input order
    function groupIntersectingEntries(entries) {
        let merges = [];
        for (let entry of entries) {
            let filteredMerges = [];
            let hungryMerge = {
                span: entry.span,
                entries: [entry],
            };
            for (let merge of merges) {
                if (intersectSpans(merge.span, hungryMerge.span)) {
                    hungryMerge = {
                        entries: merge.entries.concat(hungryMerge.entries),
                        span: joinSpans(merge.span, hungryMerge.span),
                    };
                }
                else {
                    filteredMerges.push(merge);
                }
            }
            filteredMerges.push(hungryMerge);
            merges = filteredMerges;
        }
        return merges;
    }
    function joinSpans(span0, span1) {
        return {
            start: Math.min(span0.start, span1.start),
            end: Math.max(span0.end, span1.end),
        };
    }
    function intersectSpans(span0, span1) {
        let start = Math.max(span0.start, span1.start);
        let end = Math.min(span0.end, span1.end);
        if (start < end) {
            return { start, end };
        }
        return null;
    }
    // general util
    // ---------------------------------------------------------------------------------------------------------------------
    function insertAt(arr, index, item) {
        arr.splice(index, 0, item);
    }
    function binarySearch(a, searchVal, getItemVal) {
        let startIndex = 0;
        let endIndex = a.length; // exclusive
        if (!endIndex || searchVal < getItemVal(a[startIndex])) { // no items OR before first item
            return [0, 0];
        }
        if (searchVal > getItemVal(a[endIndex - 1])) { // after last item
            return [endIndex, 0];
        }
        while (startIndex < endIndex) {
            let middleIndex = Math.floor(startIndex + (endIndex - startIndex) / 2);
            let middleVal = getItemVal(a[middleIndex]);
            if (searchVal < middleVal) {
                endIndex = middleIndex;
            }
            else if (searchVal > middleVal) {
                startIndex = middleIndex + 1;
            }
            else { // equal!
                return [middleIndex, 1];
            }
        }
        return [startIndex, 0];
    }

    /*
    An abstraction for a dragging interaction originating on an event.
    Does higher-level things than PointerDragger, such as possibly:
    - a "mirror" that moves with the pointer
    - a minimum number of pixels or other criteria for a true drag to begin

    subclasses must emit:
    - pointerdown
    - dragstart
    - dragmove
    - pointerup
    - dragend
    */
    class ElementDragging {
        constructor(el, selector) {
            this.emitter = new Emitter();
        }
        destroy() {
        }
        setMirrorIsVisible(bool) {
            // optional if subclass doesn't want to support a mirror
        }
        setMirrorNeedsRevert(bool) {
            // optional if subclass doesn't want to support a mirror
        }
        setAutoScrollEnabled(bool) {
            // optional
        }
    }

    // TODO: get rid of this in favor of options system,
    // tho it's really easy to access this globally rather than pass thru options.
    const config = {};

    /*
    Information about what will happen when an external element is dragged-and-dropped
    onto a calendar. Contains information for creating an event.
    */
    const DRAG_META_REFINERS = {
        startTime: createDuration,
        duration: createDuration,
        create: Boolean,
        sourceId: String,
    };
    function parseDragMeta(raw) {
        let { refined, extra } = refineProps(raw, DRAG_META_REFINERS);
        return {
            startTime: refined.startTime || null,
            duration: refined.duration || null,
            create: refined.create != null ? refined.create : true,
            sourceId: refined.sourceId,
            leftoverProps: extra,
        };
    }

    // Computes a default column header formatting string if `colFormat` is not explicitly defined
    function computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt) {
        // if more than one week row, or if there are a lot of columns with not much space,
        // put just the day numbers will be in each cell
        if (!datesRepDistinctDays || dayCnt > 10) {
            return createFormatter({ weekday: 'short' }); // "Sat"
        }
        if (dayCnt > 1) {
            return createFormatter({ weekday: 'short', month: 'numeric', day: 'numeric', omitCommas: true }); // "Sat 11/12"
        }
        return createFormatter({ weekday: 'long' }); // "Saturday"
    }

    const CLASS_NAME = 'fc-col-header-cell'; // do the cushion too? no
    function renderInner$1(renderProps) {
        return renderProps.text;
    }

    // BAD name for this class now. used in the Header
    class TableDateCell extends BaseComponent {
        render() {
            let { dateEnv, options, theme, viewApi } = this.context;
            let { props } = this;
            let { date, dateProfile } = props;
            let dayMeta = getDateMeta(date, props.todayRange, null, dateProfile);
            let classNames = [CLASS_NAME].concat(getDayClassNames(dayMeta, theme));
            let text = dateEnv.format(date, props.dayHeaderFormat);
            // if colCnt is 1, we are already in a day-view and don't need a navlink
            let navLinkAttrs = (!dayMeta.isDisabled && props.colCnt > 1)
                ? buildNavLinkAttrs(this.context, date)
                : {};
            let renderProps = Object.assign(Object.assign(Object.assign({ date: dateEnv.toDate(date), view: viewApi }, props.extraRenderProps), { text }), dayMeta);
            return (h(ContentContainer, { elTag: "th", elClasses: classNames, elAttrs: Object.assign({ role: 'columnheader', colSpan: props.colSpan, 'data-date': !dayMeta.isDisabled ? formatDayString(date) : undefined }, props.extraDataAttrs), renderProps: renderProps, generatorName: "dayHeaderContent", generator: options.dayHeaderContent || renderInner$1, classNameGenerator: options.dayHeaderClassNames, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, (InnerContainer) => (h("div", { className: "fc-scrollgrid-sync-inner" }, !dayMeta.isDisabled && (h(InnerContainer, { elTag: "a", elAttrs: navLinkAttrs, elClasses: [
                    'fc-col-header-cell-cushion',
                    props.isSticky && 'fc-sticky',
                ] }))))));
        }
    }

    const WEEKDAY_FORMAT = createFormatter({ weekday: 'long' });
    class TableDowCell extends BaseComponent {
        render() {
            let { props } = this;
            let { dateEnv, theme, viewApi, options } = this.context;
            let date = addDays(new Date(259200000), props.dow); // start with Sun, 04 Jan 1970 00:00:00 GMT
            let dateMeta = {
                dow: props.dow,
                isDisabled: false,
                isFuture: false,
                isPast: false,
                isToday: false,
                isOther: false,
            };
            let text = dateEnv.format(date, props.dayHeaderFormat);
            let renderProps = Object.assign(Object.assign(Object.assign(Object.assign({ // TODO: make this public?
                date }, dateMeta), { view: viewApi }), props.extraRenderProps), { text });
            return (h(ContentContainer, { elTag: "th", elClasses: [
                    CLASS_NAME,
                    ...getDayClassNames(dateMeta, theme),
                    ...(props.extraClassNames || []),
                ], elAttrs: Object.assign({ role: 'columnheader', colSpan: props.colSpan }, props.extraDataAttrs), renderProps: renderProps, generatorName: "dayHeaderContent", generator: options.dayHeaderContent || renderInner$1, classNameGenerator: options.dayHeaderClassNames, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, (InnerContent) => (h("div", { className: "fc-scrollgrid-sync-inner" },
                h(InnerContent, { elTag: "a", elClasses: [
                        'fc-col-header-cell-cushion',
                        props.isSticky && 'fc-sticky',
                    ], elAttrs: {
                        'aria-label': dateEnv.format(date, WEEKDAY_FORMAT),
                    } })))));
        }
    }

    class NowTimer extends d {
        constructor(props, context) {
            super(props, context);
            this.initialNowDate = getNow(context.options.now, context.dateEnv);
            this.initialNowQueriedMs = new Date().valueOf();
            this.state = this.computeTiming().currentState;
        }
        render() {
            let { props, state } = this;
            return props.children(state.nowDate, state.todayRange);
        }
        componentDidMount() {
            this.setTimeout();
        }
        componentDidUpdate(prevProps) {
            if (prevProps.unit !== this.props.unit) {
                this.clearTimeout();
                this.setTimeout();
            }
        }
        componentWillUnmount() {
            this.clearTimeout();
        }
        computeTiming() {
            let { props, context } = this;
            let unroundedNow = addMs(this.initialNowDate, new Date().valueOf() - this.initialNowQueriedMs);
            let currentUnitStart = context.dateEnv.startOf(unroundedNow, props.unit);
            let nextUnitStart = context.dateEnv.add(currentUnitStart, createDuration(1, props.unit));
            let waitMs = nextUnitStart.valueOf() - unroundedNow.valueOf();
            // there is a max setTimeout ms value (https://stackoverflow.com/a/3468650/96342)
            // ensure no longer than a day
            waitMs = Math.min(1000 * 60 * 60 * 24, waitMs);
            return {
                currentState: { nowDate: currentUnitStart, todayRange: buildDayRange(currentUnitStart) },
                nextState: { nowDate: nextUnitStart, todayRange: buildDayRange(nextUnitStart) },
                waitMs,
            };
        }
        setTimeout() {
            let { nextState, waitMs } = this.computeTiming();
            this.timeoutId = setTimeout(() => {
                this.setState(nextState, () => {
                    this.setTimeout();
                });
            }, waitMs);
        }
        clearTimeout() {
            if (this.timeoutId) {
                clearTimeout(this.timeoutId);
            }
        }
    }
    NowTimer.contextType = ViewContextType;
    function buildDayRange(date) {
        let start = startOfDay(date);
        let end = addDays(start, 1);
        return { start, end };
    }

    class DayHeader extends BaseComponent {
        constructor() {
            super(...arguments);
            this.createDayHeaderFormatter = memoize(createDayHeaderFormatter);
        }
        render() {
            let { context } = this;
            let { dates, dateProfile, datesRepDistinctDays, renderIntro } = this.props;
            let dayHeaderFormat = this.createDayHeaderFormatter(context.options.dayHeaderFormat, datesRepDistinctDays, dates.length);
            return (h(NowTimer, { unit: "day" }, (nowDate, todayRange) => (h("tr", { role: "row" },
                renderIntro && renderIntro('day'),
                dates.map((date) => (datesRepDistinctDays ? (h(TableDateCell, { key: date.toISOString(), date: date, dateProfile: dateProfile, todayRange: todayRange, colCnt: dates.length, dayHeaderFormat: dayHeaderFormat })) : (h(TableDowCell, { key: date.getUTCDay(), dow: date.getUTCDay(), dayHeaderFormat: dayHeaderFormat }))))))));
        }
    }
    function createDayHeaderFormatter(explicitFormat, datesRepDistinctDays, dateCnt) {
        return explicitFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dateCnt);
    }

    class DaySeriesModel {
        constructor(range, dateProfileGenerator) {
            let date = range.start;
            let { end } = range;
            let indices = [];
            let dates = [];
            let dayIndex = -1;
            while (date < end) { // loop each day from start to end
                if (dateProfileGenerator.isHiddenDay(date)) {
                    indices.push(dayIndex + 0.5); // mark that it's between indices
                }
                else {
                    dayIndex += 1;
                    indices.push(dayIndex);
                    dates.push(date);
                }
                date = addDays(date, 1);
            }
            this.dates = dates;
            this.indices = indices;
            this.cnt = dates.length;
        }
        sliceRange(range) {
            let firstIndex = this.getDateDayIndex(range.start); // inclusive first index
            let lastIndex = this.getDateDayIndex(addDays(range.end, -1)); // inclusive last index
            let clippedFirstIndex = Math.max(0, firstIndex);
            let clippedLastIndex = Math.min(this.cnt - 1, lastIndex);
            // deal with in-between indices
            clippedFirstIndex = Math.ceil(clippedFirstIndex); // in-between starts round to next cell
            clippedLastIndex = Math.floor(clippedLastIndex); // in-between ends round to prev cell
            if (clippedFirstIndex <= clippedLastIndex) {
                return {
                    firstIndex: clippedFirstIndex,
                    lastIndex: clippedLastIndex,
                    isStart: firstIndex === clippedFirstIndex,
                    isEnd: lastIndex === clippedLastIndex,
                };
            }
            return null;
        }
        // Given a date, returns its chronolocial cell-index from the first cell of the grid.
        // If the date lies between cells (because of hiddenDays), returns a floating-point value between offsets.
        // If before the first offset, returns a negative number.
        // If after the last offset, returns an offset past the last cell offset.
        // Only works for *start* dates of cells. Will not work for exclusive end dates for cells.
        getDateDayIndex(date) {
            let { indices } = this;
            let dayOffset = Math.floor(diffDays(this.dates[0], date));
            if (dayOffset < 0) {
                return indices[0] - 1;
            }
            if (dayOffset >= indices.length) {
                return indices[indices.length - 1] + 1;
            }
            return indices[dayOffset];
        }
    }

    class DayTableModel {
        constructor(daySeries, breakOnWeeks) {
            let { dates } = daySeries;
            let daysPerRow;
            let firstDay;
            let rowCnt;
            if (breakOnWeeks) {
                // count columns until the day-of-week repeats
                firstDay = dates[0].getUTCDay();
                for (daysPerRow = 1; daysPerRow < dates.length; daysPerRow += 1) {
                    if (dates[daysPerRow].getUTCDay() === firstDay) {
                        break;
                    }
                }
                rowCnt = Math.ceil(dates.length / daysPerRow);
            }
            else {
                rowCnt = 1;
                daysPerRow = dates.length;
            }
            this.rowCnt = rowCnt;
            this.colCnt = daysPerRow;
            this.daySeries = daySeries;
            this.cells = this.buildCells();
            this.headerDates = this.buildHeaderDates();
        }
        buildCells() {
            let rows = [];
            for (let row = 0; row < this.rowCnt; row += 1) {
                let cells = [];
                for (let col = 0; col < this.colCnt; col += 1) {
                    cells.push(this.buildCell(row, col));
                }
                rows.push(cells);
            }
            return rows;
        }
        buildCell(row, col) {
            let date = this.daySeries.dates[row * this.colCnt + col];
            return {
                key: date.toISOString(),
                date,
            };
        }
        buildHeaderDates() {
            let dates = [];
            for (let col = 0; col < this.colCnt; col += 1) {
                dates.push(this.cells[0][col].date);
            }
            return dates;
        }
        sliceRange(range) {
            let { colCnt } = this;
            let seriesSeg = this.daySeries.sliceRange(range);
            let segs = [];
            if (seriesSeg) {
                let { firstIndex, lastIndex } = seriesSeg;
                let index = firstIndex;
                while (index <= lastIndex) {
                    let row = Math.floor(index / colCnt);
                    let nextIndex = Math.min((row + 1) * colCnt, lastIndex + 1);
                    segs.push({
                        row,
                        firstCol: index % colCnt,
                        lastCol: (nextIndex - 1) % colCnt,
                        isStart: seriesSeg.isStart && index === firstIndex,
                        isEnd: seriesSeg.isEnd && (nextIndex - 1) === lastIndex,
                    });
                    index = nextIndex;
                }
            }
            return segs;
        }
    }

    class Slicer {
        constructor() {
            this.sliceBusinessHours = memoize(this._sliceBusinessHours);
            this.sliceDateSelection = memoize(this._sliceDateSpan);
            this.sliceEventStore = memoize(this._sliceEventStore);
            this.sliceEventDrag = memoize(this._sliceInteraction);
            this.sliceEventResize = memoize(this._sliceInteraction);
            this.forceDayIfListItem = false; // hack
        }
        sliceProps(props, dateProfile, nextDayThreshold, context, ...extraArgs) {
            let { eventUiBases } = props;
            let eventSegs = this.sliceEventStore(props.eventStore, eventUiBases, dateProfile, nextDayThreshold, ...extraArgs);
            return {
                dateSelectionSegs: this.sliceDateSelection(props.dateSelection, eventUiBases, context, ...extraArgs),
                businessHourSegs: this.sliceBusinessHours(props.businessHours, dateProfile, nextDayThreshold, context, ...extraArgs),
                fgEventSegs: eventSegs.fg,
                bgEventSegs: eventSegs.bg,
                eventDrag: this.sliceEventDrag(props.eventDrag, eventUiBases, dateProfile, nextDayThreshold, ...extraArgs),
                eventResize: this.sliceEventResize(props.eventResize, eventUiBases, dateProfile, nextDayThreshold, ...extraArgs),
                eventSelection: props.eventSelection,
            }; // TODO: give interactionSegs?
        }
        sliceNowDate(// does not memoize
        date, context, ...extraArgs) {
            return this._sliceDateSpan({ range: { start: date, end: addMs(date, 1) }, allDay: false }, // add 1 ms, protect against null range
            {}, context, ...extraArgs);
        }
        _sliceBusinessHours(businessHours, dateProfile, nextDayThreshold, context, ...extraArgs) {
            if (!businessHours) {
                return [];
            }
            return this._sliceEventStore(expandRecurring(businessHours, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), context), {}, dateProfile, nextDayThreshold, ...extraArgs).bg;
        }
        _sliceEventStore(eventStore, eventUiBases, dateProfile, nextDayThreshold, ...extraArgs) {
            if (eventStore) {
                let rangeRes = sliceEventStore(eventStore, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
                return {
                    bg: this.sliceEventRanges(rangeRes.bg, extraArgs),
                    fg: this.sliceEventRanges(rangeRes.fg, extraArgs),
                };
            }
            return { bg: [], fg: [] };
        }
        _sliceInteraction(interaction, eventUiBases, dateProfile, nextDayThreshold, ...extraArgs) {
            if (!interaction) {
                return null;
            }
            let rangeRes = sliceEventStore(interaction.mutatedEvents, eventUiBases, computeActiveRange(dateProfile, Boolean(nextDayThreshold)), nextDayThreshold);
            return {
                segs: this.sliceEventRanges(rangeRes.fg, extraArgs),
                affectedInstances: interaction.affectedEvents.instances,
                isEvent: interaction.isEvent,
            };
        }
        _sliceDateSpan(dateSpan, eventUiBases, context, ...extraArgs) {
            if (!dateSpan) {
                return [];
            }
            let eventRange = fabricateEventRange(dateSpan, eventUiBases, context);
            let segs = this.sliceRange(dateSpan.range, ...extraArgs);
            for (let seg of segs) {
                seg.eventRange = eventRange;
            }
            return segs;
        }
        /*
        "complete" seg means it has component and eventRange
        */
        sliceEventRanges(eventRanges, extraArgs) {
            let segs = [];
            for (let eventRange of eventRanges) {
                segs.push(...this.sliceEventRange(eventRange, extraArgs));
            }
            return segs;
        }
        /*
        "complete" seg means it has component and eventRange
        */
        sliceEventRange(eventRange, extraArgs) {
            let dateRange = eventRange.range;
            // hack to make multi-day events that are being force-displayed as list-items to take up only one day
            if (this.forceDayIfListItem && eventRange.ui.display === 'list-item') {
                dateRange = {
                    start: dateRange.start,
                    end: addDays(dateRange.start, 1),
                };
            }
            let segs = this.sliceRange(dateRange, ...extraArgs);
            for (let seg of segs) {
                seg.eventRange = eventRange;
                seg.isStart = eventRange.isStart && seg.isStart;
                seg.isEnd = eventRange.isEnd && seg.isEnd;
            }
            return segs;
        }
    }
    /*
    for incorporating slotMinTime/slotMaxTime if appropriate
    TODO: should be part of DateProfile!
    TimelineDateProfile already does this btw
    */
    function computeActiveRange(dateProfile, isComponentAllDay) {
        let range = dateProfile.activeRange;
        if (isComponentAllDay) {
            return range;
        }
        return {
            start: addMs(range.start, dateProfile.slotMinTime.milliseconds),
            end: addMs(range.end, dateProfile.slotMaxTime.milliseconds - 864e5), // 864e5 = ms in a day
        };
    }

    // high-level segmenting-aware tester functions
    // ------------------------------------------------------------------------------------------------------------------------
    function isInteractionValid(interaction, dateProfile, context) {
        let { instances } = interaction.mutatedEvents;
        for (let instanceId in instances) {
            if (!rangeContainsRange(dateProfile.validRange, instances[instanceId].range)) {
                return false;
            }
        }
        return isNewPropsValid({ eventDrag: interaction }, context); // HACK: the eventDrag props is used for ALL interactions
    }
    function isDateSelectionValid(dateSelection, dateProfile, context) {
        if (!rangeContainsRange(dateProfile.validRange, dateSelection.range)) {
            return false;
        }
        return isNewPropsValid({ dateSelection }, context);
    }
    function isNewPropsValid(newProps, context) {
        let calendarState = context.getCurrentData();
        let props = Object.assign({ businessHours: calendarState.businessHours, dateSelection: '', eventStore: calendarState.eventStore, eventUiBases: calendarState.eventUiBases, eventSelection: '', eventDrag: null, eventResize: null }, newProps);
        return (context.pluginHooks.isPropsValid || isPropsValid)(props, context);
    }
    function isPropsValid(state, context, dateSpanMeta = {}, filterConfig) {
        if (state.eventDrag && !isInteractionPropsValid(state, context, dateSpanMeta, filterConfig)) {
            return false;
        }
        if (state.dateSelection && !isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig)) {
            return false;
        }
        return true;
    }
    // Moving Event Validation
    // ------------------------------------------------------------------------------------------------------------------------
    function isInteractionPropsValid(state, context, dateSpanMeta, filterConfig) {
        let currentState = context.getCurrentData();
        let interaction = state.eventDrag; // HACK: the eventDrag props is used for ALL interactions
        let subjectEventStore = interaction.mutatedEvents;
        let subjectDefs = subjectEventStore.defs;
        let subjectInstances = subjectEventStore.instances;
        let subjectConfigs = compileEventUis(subjectDefs, interaction.isEvent ?
            state.eventUiBases :
            { '': currentState.selectionConfig });
        if (filterConfig) {
            subjectConfigs = mapHash(subjectConfigs, filterConfig);
        }
        // exclude the subject events. TODO: exclude defs too?
        let otherEventStore = excludeInstances(state.eventStore, interaction.affectedEvents.instances);
        let otherDefs = otherEventStore.defs;
        let otherInstances = otherEventStore.instances;
        let otherConfigs = compileEventUis(otherDefs, state.eventUiBases);
        for (let subjectInstanceId in subjectInstances) {
            let subjectInstance = subjectInstances[subjectInstanceId];
            let subjectRange = subjectInstance.range;
            let subjectConfig = subjectConfigs[subjectInstance.defId];
            let subjectDef = subjectDefs[subjectInstance.defId];
            // constraint
            if (!allConstraintsPass(subjectConfig.constraints, subjectRange, otherEventStore, state.businessHours, context)) {
                return false;
            }
            // overlap
            let { eventOverlap } = context.options;
            let eventOverlapFunc = typeof eventOverlap === 'function' ? eventOverlap : null;
            for (let otherInstanceId in otherInstances) {
                let otherInstance = otherInstances[otherInstanceId];
                // intersect! evaluate
                if (rangesIntersect(subjectRange, otherInstance.range)) {
                    let otherOverlap = otherConfigs[otherInstance.defId].overlap;
                    // consider the other event's overlap. only do this if the subject event is a "real" event
                    if (otherOverlap === false && interaction.isEvent) {
                        return false;
                    }
                    if (subjectConfig.overlap === false) {
                        return false;
                    }
                    if (eventOverlapFunc && !eventOverlapFunc(new EventImpl(context, otherDefs[otherInstance.defId], otherInstance), // still event
                    new EventImpl(context, subjectDef, subjectInstance))) {
                        return false;
                    }
                }
            }
            // allow (a function)
            let calendarEventStore = currentState.eventStore; // need global-to-calendar, not local to component (splittable)state
            for (let subjectAllow of subjectConfig.allows) {
                let subjectDateSpan = Object.assign(Object.assign({}, dateSpanMeta), { range: subjectInstance.range, allDay: subjectDef.allDay });
                let origDef = calendarEventStore.defs[subjectDef.defId];
                let origInstance = calendarEventStore.instances[subjectInstanceId];
                let eventApi;
                if (origDef) { // was previously in the calendar
                    eventApi = new EventImpl(context, origDef, origInstance);
                }
                else { // was an external event
                    eventApi = new EventImpl(context, subjectDef); // no instance, because had no dates
                }
                if (!subjectAllow(buildDateSpanApiWithContext(subjectDateSpan, context), eventApi)) {
                    return false;
                }
            }
        }
        return true;
    }
    // Date Selection Validation
    // ------------------------------------------------------------------------------------------------------------------------
    function isDateSelectionPropsValid(state, context, dateSpanMeta, filterConfig) {
        let relevantEventStore = state.eventStore;
        let relevantDefs = relevantEventStore.defs;
        let relevantInstances = relevantEventStore.instances;
        let selection = state.dateSelection;
        let selectionRange = selection.range;
        let { selectionConfig } = context.getCurrentData();
        if (filterConfig) {
            selectionConfig = filterConfig(selectionConfig);
        }
        // constraint
        if (!allConstraintsPass(selectionConfig.constraints, selectionRange, relevantEventStore, state.businessHours, context)) {
            return false;
        }
        // overlap
        let { selectOverlap } = context.options;
        let selectOverlapFunc = typeof selectOverlap === 'function' ? selectOverlap : null;
        for (let relevantInstanceId in relevantInstances) {
            let relevantInstance = relevantInstances[relevantInstanceId];
            // intersect! evaluate
            if (rangesIntersect(selectionRange, relevantInstance.range)) {
                if (selectionConfig.overlap === false) {
                    return false;
                }
                if (selectOverlapFunc && !selectOverlapFunc(new EventImpl(context, relevantDefs[relevantInstance.defId], relevantInstance), null)) {
                    return false;
                }
            }
        }
        // allow (a function)
        for (let selectionAllow of selectionConfig.allows) {
            let fullDateSpan = Object.assign(Object.assign({}, dateSpanMeta), selection);
            if (!selectionAllow(buildDateSpanApiWithContext(fullDateSpan, context), null)) {
                return false;
            }
        }
        return true;
    }
    // Constraint Utils
    // ------------------------------------------------------------------------------------------------------------------------
    function allConstraintsPass(constraints, subjectRange, otherEventStore, businessHoursUnexpanded, context) {
        for (let constraint of constraints) {
            if (!anyRangesContainRange(constraintToRanges(constraint, subjectRange, otherEventStore, businessHoursUnexpanded, context), subjectRange)) {
                return false;
            }
        }
        return true;
    }
    function constraintToRanges(constraint, subjectRange, // for expanding a recurring constraint, or expanding business hours
    otherEventStore, // for if constraint is an even group ID
    businessHoursUnexpanded, // for if constraint is 'businessHours'
    context) {
        if (constraint === 'businessHours') {
            return eventStoreToRanges(expandRecurring(businessHoursUnexpanded, subjectRange, context));
        }
        if (typeof constraint === 'string') { // an group ID
            return eventStoreToRanges(filterEventStoreDefs(otherEventStore, (eventDef) => eventDef.groupId === constraint));
        }
        if (typeof constraint === 'object' && constraint) { // non-null object
            return eventStoreToRanges(expandRecurring(constraint, subjectRange, context));
        }
        return []; // if it's false
    }
    // TODO: move to event-store file?
    function eventStoreToRanges(eventStore) {
        let { instances } = eventStore;
        let ranges = [];
        for (let instanceId in instances) {
            ranges.push(instances[instanceId].range);
        }
        return ranges;
    }
    // TODO: move to geom file?
    function anyRangesContainRange(outerRanges, innerRange) {
        for (let outerRange of outerRanges) {
            if (rangeContainsRange(outerRange, innerRange)) {
                return true;
            }
        }
        return false;
    }

    const VISIBLE_HIDDEN_RE = /^(visible|hidden)$/;
    class Scroller extends BaseComponent {
        constructor() {
            super(...arguments);
            this.handleEl = (el) => {
                this.el = el;
                setRef(this.props.elRef, el);
            };
        }
        render() {
            let { props } = this;
            let { liquid, liquidIsAbsolute } = props;
            let isAbsolute = liquid && liquidIsAbsolute;
            let className = ['fc-scroller'];
            if (liquid) {
                if (liquidIsAbsolute) {
                    className.push('fc-scroller-liquid-absolute');
                }
                else {
                    className.push('fc-scroller-liquid');
                }
            }
            return (h("div", { ref: this.handleEl, className: className.join(' '), style: {
                    overflowX: props.overflowX,
                    overflowY: props.overflowY,
                    left: (isAbsolute && -(props.overcomeLeft || 0)) || '',
                    right: (isAbsolute && -(props.overcomeRight || 0)) || '',
                    bottom: (isAbsolute && -(props.overcomeBottom || 0)) || '',
                    marginLeft: (!isAbsolute && -(props.overcomeLeft || 0)) || '',
                    marginRight: (!isAbsolute && -(props.overcomeRight || 0)) || '',
                    marginBottom: (!isAbsolute && -(props.overcomeBottom || 0)) || '',
                    maxHeight: props.maxHeight || '',
                } }, props.children));
        }
        needsXScrolling() {
            if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
                return false;
            }
            // testing scrollWidth>clientWidth is unreliable cross-browser when pixel heights aren't integers.
            // much more reliable to see if children are taller than the scroller, even tho doesn't account for
            // inner-child margins and absolute positioning
            let { el } = this;
            let realClientWidth = this.el.getBoundingClientRect().width - this.getYScrollbarWidth();
            let { children } = el;
            for (let i = 0; i < children.length; i += 1) {
                let childEl = children[i];
                if (childEl.getBoundingClientRect().width > realClientWidth) {
                    return true;
                }
            }
            return false;
        }
        needsYScrolling() {
            if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
                return false;
            }
            // testing scrollHeight>clientHeight is unreliable cross-browser when pixel heights aren't integers.
            // much more reliable to see if children are taller than the scroller, even tho doesn't account for
            // inner-child margins and absolute positioning
            let { el } = this;
            let realClientHeight = this.el.getBoundingClientRect().height - this.getXScrollbarWidth();
            let { children } = el;
            for (let i = 0; i < children.length; i += 1) {
                let childEl = children[i];
                if (childEl.getBoundingClientRect().height > realClientHeight) {
                    return true;
                }
            }
            return false;
        }
        getXScrollbarWidth() {
            if (VISIBLE_HIDDEN_RE.test(this.props.overflowX)) {
                return 0;
            }
            return this.el.offsetHeight - this.el.clientHeight; // only works because we guarantee no borders. TODO: add to CSS with important?
        }
        getYScrollbarWidth() {
            if (VISIBLE_HIDDEN_RE.test(this.props.overflowY)) {
                return 0;
            }
            return this.el.offsetWidth - this.el.clientWidth; // only works because we guarantee no borders. TODO: add to CSS with important?
        }
    }

    /*
    TODO: somehow infer OtherArgs from masterCallback?
    TODO: infer RefType from masterCallback if provided
    */
    class RefMap {
        constructor(masterCallback) {
            this.masterCallback = masterCallback;
            this.currentMap = {};
            this.depths = {};
            this.callbackMap = {};
            this.handleValue = (val, key) => {
                let { depths, currentMap } = this;
                let removed = false;
                let added = false;
                if (val !== null) {
                    // for bug... ACTUALLY: can probably do away with this now that callers don't share numeric indices anymore
                    removed = (key in currentMap);
                    currentMap[key] = val;
                    depths[key] = (depths[key] || 0) + 1;
                    added = true;
                }
                else {
                    depths[key] -= 1;
                    if (!depths[key]) {
                        delete currentMap[key];
                        delete this.callbackMap[key];
                        removed = true;
                    }
                }
                if (this.masterCallback) {
                    if (removed) {
                        this.masterCallback(null, String(key));
                    }
                    if (added) {
                        this.masterCallback(val, String(key));
                    }
                }
            };
        }
        createRef(key) {
            let refCallback = this.callbackMap[key];
            if (!refCallback) {
                refCallback = this.callbackMap[key] = (val) => {
                    this.handleValue(val, String(key));
                };
            }
            return refCallback;
        }
        // TODO: check callers that don't care about order. should use getAll instead
        // NOTE: this method has become less valuable now that we are encouraged to map order by some other index
        // TODO: provide ONE array-export function, buildArray, which fails on non-numeric indexes. caller can manipulate and "collect"
        collect(startIndex, endIndex, step) {
            return collectFromHash(this.currentMap, startIndex, endIndex, step);
        }
        getAll() {
            return hashValuesToArray(this.currentMap);
        }
    }

    function computeShrinkWidth(chunkEls) {
        let shrinkCells = findElements(chunkEls, '.fc-scrollgrid-shrink');
        let largestWidth = 0;
        for (let shrinkCell of shrinkCells) {
            largestWidth = Math.max(largestWidth, computeSmallestCellWidth(shrinkCell));
        }
        return Math.ceil(largestWidth); // <table> elements work best with integers. round up to ensure contents fits
    }
    function getSectionHasLiquidHeight(props, sectionConfig) {
        return props.liquid && sectionConfig.liquid; // does the section do liquid-height? (need to have whole scrollgrid liquid-height as well)
    }
    function getAllowYScrolling(props, sectionConfig) {
        return sectionConfig.maxHeight != null || // if its possible for the height to max out, we might need scrollbars
            getSectionHasLiquidHeight(props, sectionConfig); // if the section is liquid height, it might condense enough to require scrollbars
    }
    // TODO: ONLY use `arg`. force out internal function to use same API
    function renderChunkContent(sectionConfig, chunkConfig, arg, isHeader) {
        let { expandRows } = arg;
        let content = typeof chunkConfig.content === 'function' ?
            chunkConfig.content(arg) :
            h('table', {
                role: 'presentation',
                className: [
                    chunkConfig.tableClassName,
                    sectionConfig.syncRowHeights ? 'fc-scrollgrid-sync-table' : '',
                ].join(' '),
                style: {
                    minWidth: arg.tableMinWidth,
                    width: arg.clientWidth,
                    height: expandRows ? arg.clientHeight : '', // css `height` on a <table> serves as a min-height
                },
            }, arg.tableColGroupNode, h(isHeader ? 'thead' : 'tbody', {
                role: 'presentation',
            }, typeof chunkConfig.rowContent === 'function'
                ? chunkConfig.rowContent(arg)
                : chunkConfig.rowContent));
        return content;
    }
    function isColPropsEqual(cols0, cols1) {
        return isArraysEqual(cols0, cols1, isPropsEqual);
    }
    function renderMicroColGroup(cols, shrinkWidth) {
        let colNodes = [];
        /*
        for ColProps with spans, it would have been great to make a single <col span="">
        HOWEVER, Chrome was getting messing up distributing the width to <td>/<th> elements with colspans.
        SOLUTION: making individual <col> elements makes Chrome behave.
        */
        for (let colProps of cols) {
            let span = colProps.span || 1;
            for (let i = 0; i < span; i += 1) {
                colNodes.push(h("col", { style: {
                        width: colProps.width === 'shrink' ? sanitizeShrinkWidth(shrinkWidth) : (colProps.width || ''),
                        minWidth: colProps.minWidth || '',
                    } }));
            }
        }
        return h('colgroup', {}, ...colNodes);
    }
    function sanitizeShrinkWidth(shrinkWidth) {
        /* why 4? if we do 0, it will kill any border, which are needed for computeSmallestCellWidth
        4 accounts for 2 2-pixel borders. TODO: better solution? */
        return shrinkWidth == null ? 4 : shrinkWidth;
    }
    function hasShrinkWidth(cols) {
        for (let col of cols) {
            if (col.width === 'shrink') {
                return true;
            }
        }
        return false;
    }
    function getScrollGridClassNames(liquid, context) {
        let classNames = [
            'fc-scrollgrid',
            context.theme.getClass('table'),
        ];
        if (liquid) {
            classNames.push('fc-scrollgrid-liquid');
        }
        return classNames;
    }
    function getSectionClassNames(sectionConfig, wholeTableVGrow) {
        let classNames = [
            'fc-scrollgrid-section',
            `fc-scrollgrid-section-${sectionConfig.type}`,
            sectionConfig.className, // used?
        ];
        if (wholeTableVGrow && sectionConfig.liquid && sectionConfig.maxHeight == null) {
            classNames.push('fc-scrollgrid-section-liquid');
        }
        if (sectionConfig.isSticky) {
            classNames.push('fc-scrollgrid-section-sticky');
        }
        return classNames;
    }
    function renderScrollShim(arg) {
        return (h("div", { className: "fc-scrollgrid-sticky-shim", style: {
                width: arg.clientWidth,
                minWidth: arg.tableMinWidth,
            } }));
    }
    function getStickyHeaderDates(options) {
        let { stickyHeaderDates } = options;
        if (stickyHeaderDates == null || stickyHeaderDates === 'auto') {
            stickyHeaderDates = options.height === 'auto' || options.viewHeight === 'auto';
        }
        return stickyHeaderDates;
    }
    function getStickyFooterScrollbar(options) {
        let { stickyFooterScrollbar } = options;
        if (stickyFooterScrollbar == null || stickyFooterScrollbar === 'auto') {
            stickyFooterScrollbar = options.height === 'auto' || options.viewHeight === 'auto';
        }
        return stickyFooterScrollbar;
    }

    class SimpleScrollGrid extends BaseComponent {
        constructor() {
            super(...arguments);
            this.processCols = memoize((a) => a, isColPropsEqual); // so we get same `cols` props every time
            // yucky to memoize VNodes, but much more efficient for consumers
            this.renderMicroColGroup = memoize(renderMicroColGroup);
            this.scrollerRefs = new RefMap();
            this.scrollerElRefs = new RefMap(this._handleScrollerEl.bind(this));
            this.state = {
                shrinkWidth: null,
                forceYScrollbars: false,
                scrollerClientWidths: {},
                scrollerClientHeights: {},
            };
            // TODO: can do a really simple print-view. dont need to join rows
            this.handleSizing = () => {
                this.safeSetState(Object.assign({ shrinkWidth: this.computeShrinkWidth() }, this.computeScrollerDims()));
            };
        }
        render() {
            let { props, state, context } = this;
            let sectionConfigs = props.sections || [];
            let cols = this.processCols(props.cols);
            let microColGroupNode = this.renderMicroColGroup(cols, state.shrinkWidth);
            let classNames = getScrollGridClassNames(props.liquid, context);
            if (props.collapsibleWidth) {
                classNames.push('fc-scrollgrid-collapsible');
            }
            // TODO: make DRY
            let configCnt = sectionConfigs.length;
            let configI = 0;
            let currentConfig;
            let headSectionNodes = [];
            let bodySectionNodes = [];
            let footSectionNodes = [];
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'header') {
                headSectionNodes.push(this.renderSection(currentConfig, microColGroupNode, true));
                configI += 1;
            }
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'body') {
                bodySectionNodes.push(this.renderSection(currentConfig, microColGroupNode, false));
                configI += 1;
            }
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'footer') {
                footSectionNodes.push(this.renderSection(currentConfig, microColGroupNode, true));
                configI += 1;
            }
            // firefox bug: when setting height on table and there is a thead or tfoot,
            // the necessary height:100% on the liquid-height body section forces the *whole* table to be taller. (bug #5524)
            // use getCanVGrowWithinCell as a way to detect table-stupid firefox.
            // if so, use a simpler dom structure, jam everything into a lone tbody.
            let isBuggy = !getCanVGrowWithinCell();
            const roleAttrs = { role: 'rowgroup' };
            return h('table', {
                role: 'grid',
                className: classNames.join(' '),
                style: { height: props.height },
            }, Boolean(!isBuggy && headSectionNodes.length) && h('thead', roleAttrs, ...headSectionNodes), Boolean(!isBuggy && bodySectionNodes.length) && h('tbody', roleAttrs, ...bodySectionNodes), Boolean(!isBuggy && footSectionNodes.length) && h('tfoot', roleAttrs, ...footSectionNodes), isBuggy && h('tbody', roleAttrs, ...headSectionNodes, ...bodySectionNodes, ...footSectionNodes));
        }
        renderSection(sectionConfig, microColGroupNode, isHeader) {
            if ('outerContent' in sectionConfig) {
                return (h(p, { key: sectionConfig.key }, sectionConfig.outerContent));
            }
            return (h("tr", { key: sectionConfig.key, role: "presentation", className: getSectionClassNames(sectionConfig, this.props.liquid).join(' ') }, this.renderChunkTd(sectionConfig, microColGroupNode, sectionConfig.chunk, isHeader)));
        }
        renderChunkTd(sectionConfig, microColGroupNode, chunkConfig, isHeader) {
            if ('outerContent' in chunkConfig) {
                return chunkConfig.outerContent;
            }
            let { props } = this;
            let { forceYScrollbars, scrollerClientWidths, scrollerClientHeights } = this.state;
            let needsYScrolling = getAllowYScrolling(props, sectionConfig); // TODO: do lazily. do in section config?
            let isLiquid = getSectionHasLiquidHeight(props, sectionConfig);
            // for `!props.liquid` - is WHOLE scrollgrid natural height?
            // TODO: do same thing in advanced scrollgrid? prolly not b/c always has horizontal scrollbars
            let overflowY = !props.liquid ? 'visible' :
                forceYScrollbars ? 'scroll' :
                    !needsYScrolling ? 'hidden' :
                        'auto';
            let sectionKey = sectionConfig.key;
            let content = renderChunkContent(sectionConfig, chunkConfig, {
                tableColGroupNode: microColGroupNode,
                tableMinWidth: '',
                clientWidth: (!props.collapsibleWidth && scrollerClientWidths[sectionKey] !== undefined) ? scrollerClientWidths[sectionKey] : null,
                clientHeight: scrollerClientHeights[sectionKey] !== undefined ? scrollerClientHeights[sectionKey] : null,
                expandRows: sectionConfig.expandRows,
                syncRowHeights: false,
                rowSyncHeights: [],
                reportRowHeightChange: () => { },
            }, isHeader);
            return h(isHeader ? 'th' : 'td', {
                ref: chunkConfig.elRef,
                role: 'presentation',
            }, h("div", { className: `fc-scroller-harness${isLiquid ? ' fc-scroller-harness-liquid' : ''}` },
                h(Scroller, { ref: this.scrollerRefs.createRef(sectionKey), elRef: this.scrollerElRefs.createRef(sectionKey), overflowY: overflowY, overflowX: !props.liquid ? 'visible' : 'hidden' /* natural height? */, maxHeight: sectionConfig.maxHeight, liquid: isLiquid, liquidIsAbsolute // because its within a harness
                    : true }, content)));
        }
        _handleScrollerEl(scrollerEl, key) {
            let section = getSectionByKey(this.props.sections, key);
            if (section) {
                setRef(section.chunk.scrollerElRef, scrollerEl);
            }
        }
        componentDidMount() {
            this.handleSizing();
            this.context.addResizeHandler(this.handleSizing);
        }
        componentDidUpdate() {
            // TODO: need better solution when state contains non-sizing things
            this.handleSizing();
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleSizing);
        }
        computeShrinkWidth() {
            return hasShrinkWidth(this.props.cols)
                ? computeShrinkWidth(this.scrollerElRefs.getAll())
                : 0;
        }
        computeScrollerDims() {
            let scrollbarWidth = getScrollbarWidths();
            let { scrollerRefs, scrollerElRefs } = this;
            let forceYScrollbars = false;
            let scrollerClientWidths = {};
            let scrollerClientHeights = {};
            for (let sectionKey in scrollerRefs.currentMap) {
                let scroller = scrollerRefs.currentMap[sectionKey];
                if (scroller && scroller.needsYScrolling()) {
                    forceYScrollbars = true;
                    break;
                }
            }
            for (let section of this.props.sections) {
                let sectionKey = section.key;
                let scrollerEl = scrollerElRefs.currentMap[sectionKey];
                if (scrollerEl) {
                    let harnessEl = scrollerEl.parentNode; // TODO: weird way to get this. need harness b/c doesn't include table borders
                    scrollerClientWidths[sectionKey] = Math.floor(harnessEl.getBoundingClientRect().width - (forceYScrollbars
                        ? scrollbarWidth.y // use global because scroller might not have scrollbars yet but will need them in future
                        : 0));
                    scrollerClientHeights[sectionKey] = Math.floor(harnessEl.getBoundingClientRect().height);
                }
            }
            return { forceYScrollbars, scrollerClientWidths, scrollerClientHeights };
        }
    }
    SimpleScrollGrid.addStateEquality({
        scrollerClientWidths: isPropsEqual,
        scrollerClientHeights: isPropsEqual,
    });
    function getSectionByKey(sections, key) {
        for (let section of sections) {
            if (section.key === key) {
                return section;
            }
        }
        return null;
    }

    class EventContainer extends BaseComponent {
        constructor() {
            super(...arguments);
            this.handleEl = (el) => {
                this.el = el;
                if (el) {
                    setElSeg(el, this.props.seg);
                }
            };
        }
        render() {
            const { props, context } = this;
            const { options } = context;
            const { seg } = props;
            const { eventRange } = seg;
            const { ui } = eventRange;
            const renderProps = {
                event: new EventImpl(context, eventRange.def, eventRange.instance),
                view: context.viewApi,
                timeText: props.timeText,
                textColor: ui.textColor,
                backgroundColor: ui.backgroundColor,
                borderColor: ui.borderColor,
                isDraggable: !props.disableDragging && computeSegDraggable(seg, context),
                isStartResizable: !props.disableResizing && computeSegStartResizable(seg, context),
                isEndResizable: !props.disableResizing && computeSegEndResizable(seg),
                isMirror: Boolean(props.isDragging || props.isResizing || props.isDateSelecting),
                isStart: Boolean(seg.isStart),
                isEnd: Boolean(seg.isEnd),
                isPast: Boolean(props.isPast),
                isFuture: Boolean(props.isFuture),
                isToday: Boolean(props.isToday),
                isSelected: Boolean(props.isSelected),
                isDragging: Boolean(props.isDragging),
                isResizing: Boolean(props.isResizing),
            };
            return (h(ContentContainer, Object.assign({}, props /* contains children */, { elRef: this.handleEl, elClasses: [
                    ...getEventClassNames(renderProps),
                    ...seg.eventRange.ui.classNames,
                    ...(props.elClasses || []),
                ], renderProps: renderProps, generatorName: "eventContent", generator: options.eventContent || props.defaultGenerator, classNameGenerator: options.eventClassNames, didMount: options.eventDidMount, willUnmount: options.eventWillUnmount })));
        }
        componentDidUpdate(prevProps) {
            if (this.el && this.props.seg !== prevProps.seg) {
                setElSeg(this.el, this.props.seg);
            }
        }
    }

    // should not be a purecomponent
    class StandardEvent extends BaseComponent {
        render() {
            let { props, context } = this;
            let { options } = context;
            let { seg } = props;
            let { ui } = seg.eventRange;
            let timeFormat = options.eventTimeFormat || props.defaultTimeFormat;
            let timeText = buildSegTimeText(seg, timeFormat, context, props.defaultDisplayEventTime, props.defaultDisplayEventEnd);
            return (h(EventContainer, Object.assign({}, props /* includes elRef */, { elTag: "a", elStyle: {
                    borderColor: ui.borderColor,
                    backgroundColor: ui.backgroundColor,
                }, elAttrs: getSegAnchorAttrs(seg, context), defaultGenerator: renderInnerContent$1$1, timeText: timeText }), (InnerContent, eventContentArg) => (h(p, null,
                h(InnerContent, { elTag: "div", elClasses: ['fc-event-main'], elStyle: { color: eventContentArg.textColor } }),
                Boolean(eventContentArg.isStartResizable) && (h("div", { className: "fc-event-resizer fc-event-resizer-start" })),
                Boolean(eventContentArg.isEndResizable) && (h("div", { className: "fc-event-resizer fc-event-resizer-end" }))))));
        }
    }
    function renderInnerContent$1$1(innerProps) {
        return (h("div", { className: "fc-event-main-frame" },
            innerProps.timeText && (h("div", { className: "fc-event-time" }, innerProps.timeText)),
            h("div", { className: "fc-event-title-container" },
                h("div", { className: "fc-event-title fc-sticky" }, innerProps.event.title || h(p, null, "\u00A0")))));
    }

    const NowIndicatorContainer = (props) => (h(ViewContextType.Consumer, null, (context) => {
        let { options } = context;
        let renderProps = {
            isAxis: props.isAxis,
            date: context.dateEnv.toDate(props.date),
            view: context.viewApi,
        };
        return (h(ContentContainer, Object.assign({}, props /* includes children */, { elTag: props.elTag || 'div', renderProps: renderProps, generatorName: "nowIndicatorContent", generator: options.nowIndicatorContent, classNameGenerator: options.nowIndicatorClassNames, didMount: options.nowIndicatorDidMount, willUnmount: options.nowIndicatorWillUnmount })));
    }));

    const DAY_NUM_FORMAT = createFormatter({ day: 'numeric' });
    class DayCellContainer extends BaseComponent {
        constructor() {
            super(...arguments);
            this.refineRenderProps = memoizeObjArg(refineRenderProps$4);
        }
        render() {
            let { props, context } = this;
            let { options } = context;
            let renderProps = this.refineRenderProps({
                date: props.date,
                dateProfile: props.dateProfile,
                todayRange: props.todayRange,
                showDayNumber: props.showDayNumber,
                extraRenderProps: props.extraRenderProps,
                viewApi: context.viewApi,
                dateEnv: context.dateEnv,
            });
            return (h(ContentContainer, Object.assign({}, props /* includes children */, { elClasses: [
                    ...getDayClassNames(renderProps, context.theme),
                    ...(props.elClasses || []),
                ], elAttrs: Object.assign(Object.assign({}, props.elAttrs), (renderProps.isDisabled ? {} : { 'data-date': formatDayString(props.date) })), renderProps: renderProps, generatorName: "dayCellContent", generator: options.dayCellContent || props.defaultGenerator, classNameGenerator: 
                // don't use custom classNames if disabled
                renderProps.isDisabled ? undefined : options.dayCellClassNames, didMount: options.dayCellDidMount, willUnmount: options.dayCellWillUnmount })));
        }
    }
    function hasCustomDayCellContent(options) {
        return Boolean(options.dayCellContent || hasCustomRenderingHandler('dayCellContent', options));
    }
    function refineRenderProps$4(raw) {
        let { date, dateEnv } = raw;
        let dayMeta = getDateMeta(date, raw.todayRange, null, raw.dateProfile);
        return Object.assign(Object.assign(Object.assign({ date: dateEnv.toDate(date), view: raw.viewApi }, dayMeta), { dayNumberText: raw.showDayNumber ? dateEnv.format(date, DAY_NUM_FORMAT) : '' }), raw.extraRenderProps);
    }

    class BgEvent extends BaseComponent {
        render() {
            let { props } = this;
            let { seg } = props;
            return (h(EventContainer, { elTag: "div", elClasses: ['fc-bg-event'], elStyle: { backgroundColor: seg.eventRange.ui.backgroundColor }, defaultGenerator: renderInnerContent$5, seg: seg, timeText: "", isDragging: false, isResizing: false, isDateSelecting: false, isSelected: false, isPast: props.isPast, isFuture: props.isFuture, isToday: props.isToday, disableDragging: true, disableResizing: true }));
        }
    }
    function renderInnerContent$5(props) {
        let { title } = props.event;
        return title && (h("div", { className: "fc-event-title" }, props.event.title));
    }
    function renderFill(fillType) {
        return (h("div", { className: `fc-${fillType}` }));
    }

    const WeekNumberContainer = (props) => (h(ViewContextType.Consumer, null, (context) => {
        let { dateEnv, options } = context;
        let { date } = props;
        let format = options.weekNumberFormat || props.defaultFormat;
        let num = dateEnv.computeWeekNumber(date); // TODO: somehow use for formatting as well?
        let text = dateEnv.format(date, format);
        let renderProps = { num, text, date };
        return (h(ContentContainer // why isn't WeekNumberContentArg being auto-detected?
        , Object.assign({}, props /* includes children */, { renderProps: renderProps, generatorName: "weekNumberContent", generator: options.weekNumberContent || renderInner, classNameGenerator: options.weekNumberClassNames, didMount: options.weekNumberDidMount, willUnmount: options.weekNumberWillUnmount })));
    }));
    function renderInner(innerProps) {
        return innerProps.text;
    }

    const PADDING_FROM_VIEWPORT = 10;
    class Popover extends BaseComponent {
        constructor() {
            super(...arguments);
            this.state = {
                titleId: getUniqueDomId(),
            };
            this.handleRootEl = (el) => {
                this.rootEl = el;
                if (this.props.elRef) {
                    setRef(this.props.elRef, el);
                }
            };
            // Triggered when the user clicks *anywhere* in the document, for the autoHide feature
            this.handleDocumentMouseDown = (ev) => {
                // only hide the popover if the click happened outside the popover
                const target = getEventTargetViaRoot(ev);
                if (!this.rootEl.contains(target)) {
                    this.handleCloseClick();
                }
            };
            this.handleDocumentKeyDown = (ev) => {
                if (ev.key === 'Escape') {
                    this.handleCloseClick();
                }
            };
            this.handleCloseClick = () => {
                let { onClose } = this.props;
                if (onClose) {
                    onClose();
                }
            };
        }
        render() {
            let { theme, options } = this.context;
            let { props, state } = this;
            let classNames = [
                'fc-popover',
                theme.getClass('popover'),
            ].concat(props.extraClassNames || []);
            return j(h("div", Object.assign({}, props.extraAttrs, { id: props.id, className: classNames.join(' '), "aria-labelledby": state.titleId, ref: this.handleRootEl }),
                h("div", { className: 'fc-popover-header ' + theme.getClass('popoverHeader') },
                    h("span", { className: "fc-popover-title", id: state.titleId }, props.title),
                    h("span", { className: 'fc-popover-close ' + theme.getIconClass('close'), title: options.closeHint, onClick: this.handleCloseClick })),
                h("div", { className: 'fc-popover-body ' + theme.getClass('popoverContent') }, props.children)), props.parentEl);
        }
        componentDidMount() {
            document.addEventListener('mousedown', this.handleDocumentMouseDown);
            document.addEventListener('keydown', this.handleDocumentKeyDown);
            this.updateSize();
        }
        componentWillUnmount() {
            document.removeEventListener('mousedown', this.handleDocumentMouseDown);
            document.removeEventListener('keydown', this.handleDocumentKeyDown);
        }
        updateSize() {
            let { isRtl } = this.context;
            let { alignmentEl, alignGridTop } = this.props;
            let { rootEl } = this;
            let alignmentRect = computeClippedClientRect(alignmentEl);
            if (alignmentRect) {
                let popoverDims = rootEl.getBoundingClientRect();
                // position relative to viewport
                let popoverTop = alignGridTop
                    ? elementClosest(alignmentEl, '.fc-scrollgrid').getBoundingClientRect().top
                    : alignmentRect.top;
                let popoverLeft = isRtl ? alignmentRect.right - popoverDims.width : alignmentRect.left;
                // constrain
                popoverTop = Math.max(popoverTop, PADDING_FROM_VIEWPORT);
                popoverLeft = Math.min(popoverLeft, document.documentElement.clientWidth - PADDING_FROM_VIEWPORT - popoverDims.width);
                popoverLeft = Math.max(popoverLeft, PADDING_FROM_VIEWPORT);
                let origin = rootEl.offsetParent.getBoundingClientRect();
                applyStyle(rootEl, {
                    top: popoverTop - origin.top,
                    left: popoverLeft - origin.left,
                });
            }
        }
    }

    class MorePopover extends DateComponent {
        constructor() {
            super(...arguments);
            this.handleRootEl = (rootEl) => {
                this.rootEl = rootEl;
                if (rootEl) {
                    this.context.registerInteractiveComponent(this, {
                        el: rootEl,
                        useEventCenter: false,
                    });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
        }
        render() {
            let { options, dateEnv } = this.context;
            let { props } = this;
            let { startDate, todayRange, dateProfile } = props;
            let title = dateEnv.format(startDate, options.dayPopoverFormat);
            return (h(DayCellContainer, { elRef: this.handleRootEl, date: startDate, dateProfile: dateProfile, todayRange: todayRange }, (InnerContent, renderProps, elAttrs) => (h(Popover, { elRef: elAttrs.ref, id: props.id, title: title, extraClassNames: ['fc-more-popover'].concat(elAttrs.className || []), extraAttrs: elAttrs /* TODO: make these time-based when not whole-day? */, parentEl: props.parentEl, alignmentEl: props.alignmentEl, alignGridTop: props.alignGridTop, onClose: props.onClose },
                hasCustomDayCellContent(options) && (h(InnerContent, { elTag: "div", elClasses: ['fc-more-popover-misc'] })),
                props.children))));
        }
        queryHit(positionLeft, positionTop, elWidth, elHeight) {
            let { rootEl, props } = this;
            if (positionLeft >= 0 && positionLeft < elWidth &&
                positionTop >= 0 && positionTop < elHeight) {
                return {
                    dateProfile: props.dateProfile,
                    dateSpan: Object.assign({ allDay: true, range: {
                            start: props.startDate,
                            end: props.endDate,
                        } }, props.extraDateSpan),
                    dayEl: rootEl,
                    rect: {
                        left: 0,
                        top: 0,
                        right: elWidth,
                        bottom: elHeight,
                    },
                    layer: 1, // important when comparing with hits from other components
                };
            }
            return null;
        }
    }

    class MoreLinkContainer extends BaseComponent {
        constructor() {
            super(...arguments);
            this.linkElRef = y();
            this.state = {
                isPopoverOpen: false,
                popoverId: getUniqueDomId(),
            };
            this.handleClick = (ev) => {
                let { props, context } = this;
                let { moreLinkClick } = context.options;
                let date = computeRange(props).start;
                function buildPublicSeg(seg) {
                    let { def, instance, range } = seg.eventRange;
                    return {
                        event: new EventImpl(context, def, instance),
                        start: context.dateEnv.toDate(range.start),
                        end: context.dateEnv.toDate(range.end),
                        isStart: seg.isStart,
                        isEnd: seg.isEnd,
                    };
                }
                if (typeof moreLinkClick === 'function') {
                    moreLinkClick = moreLinkClick({
                        date,
                        allDay: Boolean(props.allDayDate),
                        allSegs: props.allSegs.map(buildPublicSeg),
                        hiddenSegs: props.hiddenSegs.map(buildPublicSeg),
                        jsEvent: ev,
                        view: context.viewApi,
                    });
                }
                if (!moreLinkClick || moreLinkClick === 'popover') {
                    this.setState({ isPopoverOpen: true });
                }
                else if (typeof moreLinkClick === 'string') { // a view name
                    context.calendarApi.zoomTo(date, moreLinkClick);
                }
            };
            this.handlePopoverClose = () => {
                this.setState({ isPopoverOpen: false });
            };
        }
        render() {
            let { props, state } = this;
            return (h(ViewContextType.Consumer, null, (context) => {
                let { viewApi, options, calendarApi } = context;
                let { moreLinkText } = options;
                let { moreCnt } = props;
                let range = computeRange(props);
                let text = typeof moreLinkText === 'function' // TODO: eventually use formatWithOrdinals
                    ? moreLinkText.call(calendarApi, moreCnt)
                    : `+${moreCnt} ${moreLinkText}`;
                let hint = formatWithOrdinals(options.moreLinkHint, [moreCnt], text);
                let renderProps = {
                    num: moreCnt,
                    shortText: `+${moreCnt}`,
                    text,
                    view: viewApi,
                };
                return (h(p, null,
                    Boolean(props.moreCnt) && (h(ContentContainer, { elTag: props.elTag || 'a', elRef: this.linkElRef, elClasses: [
                            ...(props.elClasses || []),
                            'fc-more-link',
                        ], elAttrs: Object.assign(Object.assign(Object.assign({}, props.elAttrs), createAriaClickAttrs(this.handleClick)), { title: hint, 'aria-expanded': state.isPopoverOpen, 'aria-controls': state.isPopoverOpen ? state.popoverId : '' }), renderProps: renderProps, generatorName: "moreLinkContent", generator: options.moreLinkContent || props.defaultGenerator || renderMoreLinkInner$1, classNameGenerator: options.moreLinkClassNames, didMount: options.moreLinkDidMount, willUnmount: options.moreLinkWillUnmount }, props.children)),
                    state.isPopoverOpen && (h(MorePopover, { id: state.popoverId, startDate: range.start, endDate: range.end, dateProfile: props.dateProfile, todayRange: props.todayRange, extraDateSpan: props.extraDateSpan, parentEl: this.parentEl, alignmentEl: props.alignmentElRef ?
                            props.alignmentElRef.current :
                            this.linkElRef.current, alignGridTop: props.alignGridTop, onClose: this.handlePopoverClose }, props.popoverContent()))));
            }));
        }
        componentDidMount() {
            this.updateParentEl();
        }
        componentDidUpdate() {
            this.updateParentEl();
        }
        updateParentEl() {
            if (this.linkElRef.current) {
                this.parentEl = elementClosest(this.linkElRef.current, '.fc-view-harness');
            }
        }
    }
    function renderMoreLinkInner$1(props) {
        return props.text;
    }
    function computeRange(props) {
        if (props.allDayDate) {
            return {
                start: props.allDayDate,
                end: addDays(props.allDayDate, 1),
            };
        }
        let { hiddenSegs } = props;
        return {
            start: computeEarliestSegStart(hiddenSegs),
            end: computeLatestSegEnd(hiddenSegs),
        };
    }
    function computeEarliestSegStart(segs) {
        return segs.reduce(pickEarliestStart).eventRange.range.start;
    }
    function pickEarliestStart(seg0, seg1) {
        return seg0.eventRange.range.start < seg1.eventRange.range.start ? seg0 : seg1;
    }
    function computeLatestSegEnd(segs) {
        return segs.reduce(pickLatestEnd).eventRange.range.end;
    }
    function pickLatestEnd(seg0, seg1) {
        return seg0.eventRange.range.end > seg1.eventRange.range.end ? seg0 : seg1;
    }

    class Store {
        constructor() {
            this.handlers = [];
        }
        set(value) {
            this.currentValue = value;
            for (let handler of this.handlers) {
                handler(value);
            }
        }
        subscribe(handler) {
            this.handlers.push(handler);
            if (this.currentValue !== undefined) {
                handler(this.currentValue);
            }
        }
    }

    /*
    Subscribers will get a LIST of CustomRenderings
    */
    class CustomRenderingStore extends Store {
        constructor() {
            super(...arguments);
            this.map = new Map();
        }
        // for consistent order
        handle(customRendering) {
            const { map } = this;
            let updated = false;
            if (customRendering.isActive) {
                map.set(customRendering.id, customRendering);
                updated = true;
            }
            else if (map.has(customRendering.id)) {
                map.delete(customRendering.id);
                updated = true;
            }
            if (updated) {
                this.set(map);
            }
        }
    }

    var internal = {
        __proto__: null,
        BASE_OPTION_DEFAULTS: BASE_OPTION_DEFAULTS,
        BaseComponent: BaseComponent,
        BgEvent: BgEvent,
        CalendarImpl: CalendarImpl,
        CalendarRoot: CalendarRoot,
        ContentContainer: ContentContainer,
        CustomRenderingStore: CustomRenderingStore,
        DateComponent: DateComponent,
        DateEnv: DateEnv,
        DateProfileGenerator: DateProfileGenerator,
        DayCellContainer: DayCellContainer,
        DayHeader: DayHeader,
        DaySeriesModel: DaySeriesModel,
        DayTableModel: DayTableModel,
        DelayedRunner: DelayedRunner,
        ElementDragging: ElementDragging,
        ElementScrollController: ElementScrollController,
        Emitter: Emitter,
        EventContainer: EventContainer,
        EventImpl: EventImpl,
        Interaction: Interaction,
        MoreLinkContainer: MoreLinkContainer,
        NamedTimeZoneImpl: NamedTimeZoneImpl,
        NowIndicatorContainer: NowIndicatorContainer,
        NowTimer: NowTimer,
        PositionCache: PositionCache,
        RefMap: RefMap,
        ScrollController: ScrollController,
        ScrollResponder: ScrollResponder,
        Scroller: Scroller,
        SegHierarchy: SegHierarchy,
        SimpleScrollGrid: SimpleScrollGrid,
        Slicer: Slicer,
        Splitter: Splitter,
        StandardEvent: StandardEvent,
        TableDateCell: TableDateCell,
        TableDowCell: TableDowCell,
        Theme: Theme,
        ViewContainer: ViewContainer$1,
        ViewContextType: ViewContextType,
        WeekNumberContainer: WeekNumberContainer,
        WindowScrollController: WindowScrollController,
        addDays: addDays,
        addDurations: addDurations,
        addMs: addMs,
        addWeeks: addWeeks,
        allowContextMenu: allowContextMenu,
        allowSelection: allowSelection,
        applyMutationToEventStore: applyMutationToEventStore,
        applyStyle: applyStyle,
        asCleanDays: asCleanDays,
        asRoughMinutes: asRoughMinutes,
        asRoughMs: asRoughMs,
        asRoughSeconds: asRoughSeconds,
        binarySearch: binarySearch,
        buildElAttrs: buildElAttrs,
        buildEntryKey: buildEntryKey,
        buildEventApis: buildEventApis,
        buildEventRangeKey: buildEventRangeKey,
        buildIsoString: buildIsoString,
        buildNavLinkAttrs: buildNavLinkAttrs,
        buildSegTimeText: buildSegTimeText,
        collectFromHash: collectFromHash,
        combineEventUis: combineEventUis,
        compareByFieldSpecs: compareByFieldSpecs,
        compareNumbers: compareNumbers,
        compareObjs: compareObjs,
        computeEarliestSegStart: computeEarliestSegStart,
        computeEdges: computeEdges,
        computeFallbackHeaderFormat: computeFallbackHeaderFormat,
        computeInnerRect: computeInnerRect,
        computeRect: computeRect,
        computeShrinkWidth: computeShrinkWidth,
        computeVisibleDayRange: computeVisibleDayRange,
        config: config,
        constrainPoint: constrainPoint,
        createDuration: createDuration,
        createEmptyEventStore: createEmptyEventStore,
        createEventInstance: createEventInstance,
        createEventUi: createEventUi,
        createFormatter: createFormatter,
        diffDates: diffDates,
        diffDayAndTime: diffDayAndTime,
        diffDays: diffDays,
        diffPoints: diffPoints,
        diffWeeks: diffWeeks,
        diffWholeDays: diffWholeDays,
        diffWholeWeeks: diffWholeWeeks,
        disableCursor: disableCursor,
        elementClosest: elementClosest,
        elementMatches: elementMatches,
        enableCursor: enableCursor,
        eventTupleToStore: eventTupleToStore,
        filterHash: filterHash,
        findDirectChildren: findDirectChildren,
        findElements: findElements,
        flexibleCompare: flexibleCompare,
        formatDayString: formatDayString,
        formatIsoTimeString: formatIsoTimeString,
        getAllowYScrolling: getAllowYScrolling,
        getCanVGrowWithinCell: getCanVGrowWithinCell,
        getClippingParents: getClippingParents,
        getDateMeta: getDateMeta,
        getDayClassNames: getDayClassNames,
        getDefaultEventEnd: getDefaultEventEnd,
        getElRoot: getElRoot,
        getElSeg: getElSeg,
        getEntrySpanEnd: getEntrySpanEnd,
        getEventTargetViaRoot: getEventTargetViaRoot,
        getIsRtlScrollbarOnLeft: getIsRtlScrollbarOnLeft,
        getRectCenter: getRectCenter,
        getRelevantEvents: getRelevantEvents,
        getScrollGridClassNames: getScrollGridClassNames,
        getScrollbarWidths: getScrollbarWidths,
        getSectionClassNames: getSectionClassNames,
        getSectionHasLiquidHeight: getSectionHasLiquidHeight,
        getSegAnchorAttrs: getSegAnchorAttrs,
        getSegMeta: getSegMeta,
        getSlotClassNames: getSlotClassNames,
        getStickyFooterScrollbar: getStickyFooterScrollbar,
        getStickyHeaderDates: getStickyHeaderDates,
        getUniqueDomId: getUniqueDomId,
        greatestDurationDenominator: greatestDurationDenominator,
        groupIntersectingEntries: groupIntersectingEntries,
        guid: guid,
        hasBgRendering: hasBgRendering,
        hasCustomDayCellContent: hasCustomDayCellContent,
        hasShrinkWidth: hasShrinkWidth,
        identity: identity,
        injectStyles: injectStyles,
        interactionSettingsStore: interactionSettingsStore,
        interactionSettingsToStore: interactionSettingsToStore,
        intersectRanges: intersectRanges,
        intersectRects: intersectRects,
        intersectSpans: intersectSpans,
        isArraysEqual: isArraysEqual,
        isColPropsEqual: isColPropsEqual,
        isDateSelectionValid: isDateSelectionValid,
        isDateSpansEqual: isDateSpansEqual,
        isInt: isInt,
        isInteractionValid: isInteractionValid,
        isMultiDayRange: isMultiDayRange,
        isPropsEqual: isPropsEqual,
        isPropsValid: isPropsValid,
        isValidDate: isValidDate$1,
        mapHash: mapHash,
        memoize: memoize,
        memoizeArraylike: memoizeArraylike,
        memoizeHashlike: memoizeHashlike,
        memoizeObjArg: memoizeObjArg,
        mergeEventStores: mergeEventStores,
        multiplyDuration: multiplyDuration,
        padStart: padStart,
        parseBusinessHours: parseBusinessHours,
        parseClassNames: parseClassNames,
        parseDragMeta: parseDragMeta,
        parseEventDef: parseEventDef,
        parseFieldSpecs: parseFieldSpecs,
        parseMarker: parse,
        pointInsideRect: pointInsideRect,
        preventContextMenu: preventContextMenu,
        preventDefault: preventDefault,
        preventSelection: preventSelection,
        rangeContainsMarker: rangeContainsMarker,
        rangeContainsRange: rangeContainsRange,
        rangesEqual: rangesEqual,
        rangesIntersect: rangesIntersect,
        refineEventDef: refineEventDef,
        refineProps: refineProps,
        removeElement: removeElement,
        removeExact: removeExact,
        renderChunkContent: renderChunkContent,
        renderFill: renderFill,
        renderMicroColGroup: renderMicroColGroup,
        renderScrollShim: renderScrollShim,
        requestJson: requestJson,
        sanitizeShrinkWidth: sanitizeShrinkWidth,
        setRef: setRef,
        sliceEventStore: sliceEventStore,
        sortEventSegs: sortEventSegs,
        startOfDay: startOfDay,
        translateRect: translateRect,
        triggerDateSelect: triggerDateSelect,
        unpromisify: unpromisify,
        whenTransitionDone: whenTransitionDone,
        wholeDivideDurations: wholeDivideDurations
    };

    var css_248z$6 = ":root{--fc-small-font-size:.85em;--fc-page-bg-color:#fff;--fc-neutral-bg-color:hsla(0,0%,82%,.3);--fc-neutral-text-color:grey;--fc-border-color:#ddd;--fc-button-text-color:#fff;--fc-button-bg-color:#2c3e50;--fc-button-border-color:#2c3e50;--fc-button-hover-bg-color:#1e2b37;--fc-button-hover-border-color:#1a252f;--fc-button-active-bg-color:#1a252f;--fc-button-active-border-color:#151e27;--fc-event-bg-color:#3788d8;--fc-event-border-color:#3788d8;--fc-event-text-color:#fff;--fc-event-selected-overlay-color:rgba(0,0,0,.25);--fc-more-link-bg-color:#d0d0d0;--fc-more-link-text-color:inherit;--fc-event-resizer-thickness:8px;--fc-event-resizer-dot-total-width:8px;--fc-event-resizer-dot-border-width:1px;--fc-non-business-color:hsla(0,0%,84%,.3);--fc-bg-event-color:#8fdf82;--fc-bg-event-opacity:0.3;--fc-highlight-color:rgba(188,232,241,.3);--fc-today-bg-color:rgba(255,220,40,.15);--fc-now-indicator-color:red}.fc-not-allowed,.fc-not-allowed .fc-event{cursor:not-allowed}.fc-unselectable{-webkit-touch-callout:none;-webkit-tap-highlight-color:rgba(0,0,0,0);-webkit-user-select:none;-moz-user-select:none;user-select:none}.fc{display:flex;flex-direction:column;font-size:1em}.fc,.fc *,.fc :after,.fc :before{box-sizing:border-box}.fc table{border-collapse:collapse;border-spacing:0;font-size:1em}.fc th{text-align:center}.fc td,.fc th{padding:0;vertical-align:top}.fc a[data-navlink]{cursor:pointer}.fc a[data-navlink]:hover{text-decoration:underline}.fc-direction-ltr{direction:ltr;text-align:left}.fc-direction-rtl{direction:rtl;text-align:right}.fc-theme-standard td,.fc-theme-standard th{border:1px solid var(--fc-border-color)}.fc-liquid-hack td,.fc-liquid-hack th{position:relative}@font-face{font-family:fcicons;font-style:normal;font-weight:400;src:url(\"data:application/x-font-ttf;charset=utf-8;base64,AAEAAAALAIAAAwAwT1MvMg8SBfAAAAC8AAAAYGNtYXAXVtKNAAABHAAAAFRnYXNwAAAAEAAAAXAAAAAIZ2x5ZgYydxIAAAF4AAAFNGhlYWQUJ7cIAAAGrAAAADZoaGVhB20DzAAABuQAAAAkaG10eCIABhQAAAcIAAAALGxvY2ED4AU6AAAHNAAAABhtYXhwAA8AjAAAB0wAAAAgbmFtZXsr690AAAdsAAABhnBvc3QAAwAAAAAI9AAAACAAAwPAAZAABQAAApkCzAAAAI8CmQLMAAAB6wAzAQkAAAAAAAAAAAAAAAAAAAABEAAAAAAAAAAAAAAAAAAAAABAAADpBgPA/8AAQAPAAEAAAAABAAAAAAAAAAAAAAAgAAAAAAADAAAAAwAAABwAAQADAAAAHAADAAEAAAAcAAQAOAAAAAoACAACAAIAAQAg6Qb//f//AAAAAAAg6QD//f//AAH/4xcEAAMAAQAAAAAAAAAAAAAAAQAB//8ADwABAAAAAAAAAAAAAgAANzkBAAAAAAEAAAAAAAAAAAACAAA3OQEAAAAAAQAAAAAAAAAAAAIAADc5AQAAAAABAWIAjQKeAskAEwAAJSc3NjQnJiIHAQYUFwEWMjc2NCcCnuLiDQ0MJAz/AA0NAQAMJAwNDcni4gwjDQwM/wANIwz/AA0NDCMNAAAAAQFiAI0CngLJABMAACUBNjQnASYiBwYUHwEHBhQXFjI3AZ4BAA0N/wAMJAwNDeLiDQ0MJAyNAQAMIw0BAAwMDSMM4uINIwwNDQAAAAIA4gC3Ax4CngATACcAACUnNzY0JyYiDwEGFB8BFjI3NjQnISc3NjQnJiIPAQYUHwEWMjc2NCcB87e3DQ0MIw3VDQ3VDSMMDQ0BK7e3DQ0MJAzVDQ3VDCQMDQ3zuLcMJAwNDdUNIwzWDAwNIwy4twwkDA0N1Q0jDNYMDA0jDAAAAgDiALcDHgKeABMAJwAAJTc2NC8BJiIHBhQfAQcGFBcWMjchNzY0LwEmIgcGFB8BBwYUFxYyNwJJ1Q0N1Q0jDA0Nt7cNDQwjDf7V1Q0N1QwkDA0Nt7cNDQwkDLfWDCMN1Q0NDCQMt7gMIw0MDNYMIw3VDQ0MJAy3uAwjDQwMAAADAFUAAAOrA1UAMwBoAHcAABMiBgcOAQcOAQcOARURFBYXHgEXHgEXHgEzITI2Nz4BNz4BNz4BNRE0JicuAScuAScuASMFITIWFx4BFx4BFx4BFREUBgcOAQcOAQcOASMhIiYnLgEnLgEnLgE1ETQ2Nz4BNz4BNz4BMxMhMjY1NCYjISIGFRQWM9UNGAwLFQkJDgUFBQUFBQ4JCRULDBgNAlYNGAwLFQkJDgUFBQUFBQ4JCRULDBgN/aoCVgQIBAQHAwMFAQIBAQIBBQMDBwQECAT9qgQIBAQHAwMFAQIBAQIBBQMDBwQECASAAVYRGRkR/qoRGRkRA1UFBAUOCQkVDAsZDf2rDRkLDBUJCA4FBQUFBQUOCQgVDAsZDQJVDRkLDBUJCQ4FBAVVAgECBQMCBwQECAX9qwQJAwQHAwMFAQICAgIBBQMDBwQDCQQCVQUIBAQHAgMFAgEC/oAZEhEZGRESGQAAAAADAFUAAAOrA1UAMwBoAIkAABMiBgcOAQcOAQcOARURFBYXHgEXHgEXHgEzITI2Nz4BNz4BNz4BNRE0JicuAScuAScuASMFITIWFx4BFx4BFx4BFREUBgcOAQcOAQcOASMhIiYnLgEnLgEnLgE1ETQ2Nz4BNz4BNz4BMxMzFRQWMzI2PQEzMjY1NCYrATU0JiMiBh0BIyIGFRQWM9UNGAwLFQkJDgUFBQUFBQ4JCRULDBgNAlYNGAwLFQkJDgUFBQUFBQ4JCRULDBgN/aoCVgQIBAQHAwMFAQIBAQIBBQMDBwQECAT9qgQIBAQHAwMFAQIBAQIBBQMDBwQECASAgBkSEhmAERkZEYAZEhIZgBEZGREDVQUEBQ4JCRUMCxkN/asNGQsMFQkIDgUFBQUFBQ4JCBUMCxkNAlUNGQsMFQkJDgUEBVUCAQIFAwIHBAQIBf2rBAkDBAcDAwUBAgICAgEFAwMHBAMJBAJVBQgEBAcCAwUCAQL+gIASGRkSgBkSERmAEhkZEoAZERIZAAABAOIAjQMeAskAIAAAExcHBhQXFjI/ARcWMjc2NC8BNzY0JyYiDwEnJiIHBhQX4uLiDQ0MJAzi4gwkDA0N4uINDQwkDOLiDCQMDQ0CjeLiDSMMDQ3h4Q0NDCMN4uIMIw0MDOLiDAwNIwwAAAABAAAAAQAAa5n0y18PPPUACwQAAAAAANivOVsAAAAA2K85WwAAAAADqwNVAAAACAACAAAAAAAAAAEAAAPA/8AAAAQAAAAAAAOrAAEAAAAAAAAAAAAAAAAAAAALBAAAAAAAAAAAAAAAAgAAAAQAAWIEAAFiBAAA4gQAAOIEAABVBAAAVQQAAOIAAAAAAAoAFAAeAEQAagCqAOoBngJkApoAAQAAAAsAigADAAAAAAACAAAAAAAAAAAAAAAAAAAAAAAAAA4ArgABAAAAAAABAAcAAAABAAAAAAACAAcAYAABAAAAAAADAAcANgABAAAAAAAEAAcAdQABAAAAAAAFAAsAFQABAAAAAAAGAAcASwABAAAAAAAKABoAigADAAEECQABAA4ABwADAAEECQACAA4AZwADAAEECQADAA4APQADAAEECQAEAA4AfAADAAEECQAFABYAIAADAAEECQAGAA4AUgADAAEECQAKADQApGZjaWNvbnMAZgBjAGkAYwBvAG4Ac1ZlcnNpb24gMS4wAFYAZQByAHMAaQBvAG4AIAAxAC4AMGZjaWNvbnMAZgBjAGkAYwBvAG4Ac2ZjaWNvbnMAZgBjAGkAYwBvAG4Ac1JlZ3VsYXIAUgBlAGcAdQBsAGEAcmZjaWNvbnMAZgBjAGkAYwBvAG4Ac0ZvbnQgZ2VuZXJhdGVkIGJ5IEljb01vb24uAEYAbwBuAHQAIABnAGUAbgBlAHIAYQB0AGUAZAAgAGIAeQAgAEkAYwBvAE0AbwBvAG4ALgAAAAMAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAA=\") format(\"truetype\")}.fc-icon{speak:none;-webkit-font-smoothing:antialiased;-moz-osx-font-smoothing:grayscale;display:inline-block;font-family:fcicons!important;font-style:normal;font-variant:normal;font-weight:400;height:1em;line-height:1;text-align:center;text-transform:none;-webkit-user-select:none;-moz-user-select:none;user-select:none;width:1em}.fc-icon-chevron-left:before{content:\"\\e900\"}.fc-icon-chevron-right:before{content:\"\\e901\"}.fc-icon-chevrons-left:before{content:\"\\e902\"}.fc-icon-chevrons-right:before{content:\"\\e903\"}.fc-icon-minus-square:before{content:\"\\e904\"}.fc-icon-plus-square:before{content:\"\\e905\"}.fc-icon-x:before{content:\"\\e906\"}.fc .fc-button{border-radius:0;font-family:inherit;font-size:inherit;line-height:inherit;margin:0;overflow:visible;text-transform:none}.fc .fc-button:focus{outline:1px dotted;outline:5px auto -webkit-focus-ring-color}.fc .fc-button{-webkit-appearance:button}.fc .fc-button:not(:disabled){cursor:pointer}.fc .fc-button::-moz-focus-inner{border-style:none;padding:0}.fc .fc-button{background-color:transparent;border:1px solid transparent;border-radius:.25em;display:inline-block;font-size:1em;font-weight:400;line-height:1.5;padding:.4em .65em;text-align:center;-webkit-user-select:none;-moz-user-select:none;user-select:none;vertical-align:middle}.fc .fc-button:hover{text-decoration:none}.fc .fc-button:focus{box-shadow:0 0 0 .2rem rgba(44,62,80,.25);outline:0}.fc .fc-button:disabled{opacity:.65}.fc .fc-button-primary{background-color:var(--fc-button-bg-color);border-color:var(--fc-button-border-color);color:var(--fc-button-text-color)}.fc .fc-button-primary:hover{background-color:var(--fc-button-hover-bg-color);border-color:var(--fc-button-hover-border-color);color:var(--fc-button-text-color)}.fc .fc-button-primary:disabled{background-color:var(--fc-button-bg-color);border-color:var(--fc-button-border-color);color:var(--fc-button-text-color)}.fc .fc-button-primary:focus{box-shadow:0 0 0 .2rem rgba(76,91,106,.5)}.fc .fc-button-primary:not(:disabled).fc-button-active,.fc .fc-button-primary:not(:disabled):active{background-color:var(--fc-button-active-bg-color);border-color:var(--fc-button-active-border-color);color:var(--fc-button-text-color)}.fc .fc-button-primary:not(:disabled).fc-button-active:focus,.fc .fc-button-primary:not(:disabled):active:focus{box-shadow:0 0 0 .2rem rgba(76,91,106,.5)}.fc .fc-button .fc-icon{font-size:1.5em;vertical-align:middle}.fc .fc-button-group{display:inline-flex;position:relative;vertical-align:middle}.fc .fc-button-group>.fc-button{flex:1 1 auto;position:relative}.fc .fc-button-group>.fc-button.fc-button-active,.fc .fc-button-group>.fc-button:active,.fc .fc-button-group>.fc-button:focus,.fc .fc-button-group>.fc-button:hover{z-index:1}.fc-direction-ltr .fc-button-group>.fc-button:not(:first-child){border-bottom-left-radius:0;border-top-left-radius:0;margin-left:-1px}.fc-direction-ltr .fc-button-group>.fc-button:not(:last-child){border-bottom-right-radius:0;border-top-right-radius:0}.fc-direction-rtl .fc-button-group>.fc-button:not(:first-child){border-bottom-right-radius:0;border-top-right-radius:0;margin-right:-1px}.fc-direction-rtl .fc-button-group>.fc-button:not(:last-child){border-bottom-left-radius:0;border-top-left-radius:0}.fc .fc-toolbar{align-items:center;display:flex;justify-content:space-between}.fc .fc-toolbar.fc-header-toolbar{margin-bottom:1.5em}.fc .fc-toolbar.fc-footer-toolbar{margin-top:1.5em}.fc .fc-toolbar-title{font-size:1.75em;margin:0}.fc-direction-ltr .fc-toolbar>*>:not(:first-child){margin-left:.75em}.fc-direction-rtl .fc-toolbar>*>:not(:first-child){margin-right:.75em}.fc-direction-rtl .fc-toolbar-ltr{flex-direction:row-reverse}.fc .fc-scroller{-webkit-overflow-scrolling:touch;position:relative}.fc .fc-scroller-liquid{height:100%}.fc .fc-scroller-liquid-absolute{bottom:0;left:0;position:absolute;right:0;top:0}.fc .fc-scroller-harness{direction:ltr;overflow:hidden;position:relative}.fc .fc-scroller-harness-liquid{height:100%}.fc-direction-rtl .fc-scroller-harness>.fc-scroller{direction:rtl}.fc-theme-standard .fc-scrollgrid{border:1px solid var(--fc-border-color)}.fc .fc-scrollgrid,.fc .fc-scrollgrid table{table-layout:fixed;width:100%}.fc .fc-scrollgrid table{border-left-style:hidden;border-right-style:hidden;border-top-style:hidden}.fc .fc-scrollgrid{border-bottom-width:0;border-collapse:separate;border-right-width:0}.fc .fc-scrollgrid-liquid{height:100%}.fc .fc-scrollgrid-section,.fc .fc-scrollgrid-section table,.fc .fc-scrollgrid-section>td{height:1px}.fc .fc-scrollgrid-section-liquid>td{height:100%}.fc .fc-scrollgrid-section>*{border-left-width:0;border-top-width:0}.fc .fc-scrollgrid-section-footer>*,.fc .fc-scrollgrid-section-header>*{border-bottom-width:0}.fc .fc-scrollgrid-section-body table,.fc .fc-scrollgrid-section-footer table{border-bottom-style:hidden}.fc .fc-scrollgrid-section-sticky>*{background:var(--fc-page-bg-color);position:sticky;z-index:3}.fc .fc-scrollgrid-section-header.fc-scrollgrid-section-sticky>*{top:0}.fc .fc-scrollgrid-section-footer.fc-scrollgrid-section-sticky>*{bottom:0}.fc .fc-scrollgrid-sticky-shim{height:1px;margin-bottom:-1px}.fc-sticky{position:sticky}.fc .fc-view-harness{flex-grow:1;position:relative}.fc .fc-view-harness-active>.fc-view{bottom:0;left:0;position:absolute;right:0;top:0}.fc .fc-col-header-cell-cushion{display:inline-block;padding:2px 4px}.fc .fc-bg-event,.fc .fc-highlight,.fc .fc-non-business{bottom:0;left:0;position:absolute;right:0;top:0}.fc .fc-non-business{background:var(--fc-non-business-color)}.fc .fc-bg-event{background:var(--fc-bg-event-color);opacity:var(--fc-bg-event-opacity)}.fc .fc-bg-event .fc-event-title{font-size:var(--fc-small-font-size);font-style:italic;margin:.5em}.fc .fc-highlight{background:var(--fc-highlight-color)}.fc .fc-cell-shaded,.fc .fc-day-disabled{background:var(--fc-neutral-bg-color)}a.fc-event,a.fc-event:hover{text-decoration:none}.fc-event.fc-event-draggable,.fc-event[href]{cursor:pointer}.fc-event .fc-event-main{position:relative;z-index:2}.fc-event-dragging:not(.fc-event-selected){opacity:.75}.fc-event-dragging.fc-event-selected{box-shadow:0 2px 7px rgba(0,0,0,.3)}.fc-event .fc-event-resizer{display:none;position:absolute;z-index:4}.fc-event-selected .fc-event-resizer,.fc-event:hover .fc-event-resizer{display:block}.fc-event-selected .fc-event-resizer{background:var(--fc-page-bg-color);border-color:inherit;border-radius:calc(var(--fc-event-resizer-dot-total-width)/2);border-style:solid;border-width:var(--fc-event-resizer-dot-border-width);height:var(--fc-event-resizer-dot-total-width);width:var(--fc-event-resizer-dot-total-width)}.fc-event-selected .fc-event-resizer:before{bottom:-20px;content:\"\";left:-20px;position:absolute;right:-20px;top:-20px}.fc-event-selected,.fc-event:focus{box-shadow:0 2px 5px rgba(0,0,0,.2)}.fc-event-selected:before,.fc-event:focus:before{bottom:0;content:\"\";left:0;position:absolute;right:0;top:0;z-index:3}.fc-event-selected:after,.fc-event:focus:after{background:var(--fc-event-selected-overlay-color);bottom:-1px;content:\"\";left:-1px;position:absolute;right:-1px;top:-1px;z-index:1}.fc-h-event{background-color:var(--fc-event-bg-color);border:1px solid var(--fc-event-border-color);display:block}.fc-h-event .fc-event-main{color:var(--fc-event-text-color)}.fc-h-event .fc-event-main-frame{display:flex}.fc-h-event .fc-event-time{max-width:100%;overflow:hidden}.fc-h-event .fc-event-title-container{flex-grow:1;flex-shrink:1;min-width:0}.fc-h-event .fc-event-title{display:inline-block;left:0;max-width:100%;overflow:hidden;right:0;vertical-align:top}.fc-h-event.fc-event-selected:before{bottom:-10px;top:-10px}.fc-direction-ltr .fc-daygrid-block-event:not(.fc-event-start),.fc-direction-rtl .fc-daygrid-block-event:not(.fc-event-end){border-bottom-left-radius:0;border-left-width:0;border-top-left-radius:0}.fc-direction-ltr .fc-daygrid-block-event:not(.fc-event-end),.fc-direction-rtl .fc-daygrid-block-event:not(.fc-event-start){border-bottom-right-radius:0;border-right-width:0;border-top-right-radius:0}.fc-h-event:not(.fc-event-selected) .fc-event-resizer{bottom:0;top:0;width:var(--fc-event-resizer-thickness)}.fc-direction-ltr .fc-h-event:not(.fc-event-selected) .fc-event-resizer-start,.fc-direction-rtl .fc-h-event:not(.fc-event-selected) .fc-event-resizer-end{cursor:w-resize;left:calc(var(--fc-event-resizer-thickness)*-.5)}.fc-direction-ltr .fc-h-event:not(.fc-event-selected) .fc-event-resizer-end,.fc-direction-rtl .fc-h-event:not(.fc-event-selected) .fc-event-resizer-start{cursor:e-resize;right:calc(var(--fc-event-resizer-thickness)*-.5)}.fc-h-event.fc-event-selected .fc-event-resizer{margin-top:calc(var(--fc-event-resizer-dot-total-width)*-.5);top:50%}.fc-direction-ltr .fc-h-event.fc-event-selected .fc-event-resizer-start,.fc-direction-rtl .fc-h-event.fc-event-selected .fc-event-resizer-end{left:calc(var(--fc-event-resizer-dot-total-width)*-.5)}.fc-direction-ltr .fc-h-event.fc-event-selected .fc-event-resizer-end,.fc-direction-rtl .fc-h-event.fc-event-selected .fc-event-resizer-start{right:calc(var(--fc-event-resizer-dot-total-width)*-.5)}.fc .fc-popover{box-shadow:0 2px 6px rgba(0,0,0,.15);position:absolute;z-index:9999}.fc .fc-popover-header{align-items:center;display:flex;flex-direction:row;justify-content:space-between;padding:3px 4px}.fc .fc-popover-title{margin:0 2px}.fc .fc-popover-close{cursor:pointer;font-size:1.1em;opacity:.65}.fc-theme-standard .fc-popover{background:var(--fc-page-bg-color);border:1px solid var(--fc-border-color)}.fc-theme-standard .fc-popover-header{background:var(--fc-neutral-bg-color)}";
    injectStyles(css_248z$6);

    const globalLocales = [];

    const MINIMAL_RAW_EN_LOCALE = {
        code: 'en',
        week: {
            dow: 0,
            doy: 4, // 4 days need to be within the year to be considered the first week
        },
        direction: 'ltr',
        buttonText: {
            prev: 'prev',
            next: 'next',
            prevYear: 'prev year',
            nextYear: 'next year',
            year: 'year',
            today: 'today',
            month: 'month',
            week: 'week',
            day: 'day',
            list: 'list',
        },
        weekText: 'W',
        weekTextLong: 'Week',
        closeHint: 'Close',
        timeHint: 'Time',
        eventHint: 'Event',
        allDayText: 'all-day',
        moreLinkText: 'more',
        noEventsText: 'No events to display',
    };
    const RAW_EN_LOCALE = Object.assign(Object.assign({}, MINIMAL_RAW_EN_LOCALE), { 
        // Includes things we don't want other locales to inherit,
        // things that derive from other translatable strings.
        buttonHints: {
            prev: 'Previous $0',
            next: 'Next $0',
            today(buttonText, unit) {
                return (unit === 'day')
                    ? 'Today'
                    : `This ${buttonText}`;
            },
        }, viewHint: '$0 view', navLinkHint: 'Go to $0', moreLinkHint(eventCnt) {
            return `Show ${eventCnt} more event${eventCnt === 1 ? '' : 's'}`;
        } });
    function organizeRawLocales(explicitRawLocales) {
        let defaultCode = explicitRawLocales.length > 0 ? explicitRawLocales[0].code : 'en';
        let allRawLocales = globalLocales.concat(explicitRawLocales);
        let rawLocaleMap = {
            en: RAW_EN_LOCALE,
        };
        for (let rawLocale of allRawLocales) {
            rawLocaleMap[rawLocale.code] = rawLocale;
        }
        return {
            map: rawLocaleMap,
            defaultCode,
        };
    }
    function buildLocale(inputSingular, available) {
        if (typeof inputSingular === 'object' && !Array.isArray(inputSingular)) {
            return parseLocale(inputSingular.code, [inputSingular.code], inputSingular);
        }
        return queryLocale(inputSingular, available);
    }
    function queryLocale(codeArg, available) {
        let codes = [].concat(codeArg || []); // will convert to array
        let raw = queryRawLocale(codes, available) || RAW_EN_LOCALE;
        return parseLocale(codeArg, codes, raw);
    }
    function queryRawLocale(codes, available) {
        for (let i = 0; i < codes.length; i += 1) {
            let parts = codes[i].toLocaleLowerCase().split('-');
            for (let j = parts.length; j > 0; j -= 1) {
                let simpleId = parts.slice(0, j).join('-');
                if (available[simpleId]) {
                    return available[simpleId];
                }
            }
        }
        return null;
    }
    function parseLocale(codeArg, codes, raw) {
        let merged = mergeProps([MINIMAL_RAW_EN_LOCALE, raw], ['buttonText']);
        delete merged.code; // don't want this part of the options
        let { week } = merged;
        delete merged.week;
        return {
            codeArg,
            codes,
            week,
            simpleNumberFormat: new Intl.NumberFormat(codeArg),
            options: merged,
        };
    }

    // TODO: easier way to add new hooks? need to update a million things
    function createPlugin(input) {
        return {
            id: guid(),
            name: input.name,
            premiumReleaseDate: input.premiumReleaseDate ? new Date(input.premiumReleaseDate) : undefined,
            deps: input.deps || [],
            reducers: input.reducers || [],
            isLoadingFuncs: input.isLoadingFuncs || [],
            contextInit: [].concat(input.contextInit || []),
            eventRefiners: input.eventRefiners || {},
            eventDefMemberAdders: input.eventDefMemberAdders || [],
            eventSourceRefiners: input.eventSourceRefiners || {},
            isDraggableTransformers: input.isDraggableTransformers || [],
            eventDragMutationMassagers: input.eventDragMutationMassagers || [],
            eventDefMutationAppliers: input.eventDefMutationAppliers || [],
            dateSelectionTransformers: input.dateSelectionTransformers || [],
            datePointTransforms: input.datePointTransforms || [],
            dateSpanTransforms: input.dateSpanTransforms || [],
            views: input.views || {},
            viewPropsTransformers: input.viewPropsTransformers || [],
            isPropsValid: input.isPropsValid || null,
            externalDefTransforms: input.externalDefTransforms || [],
            viewContainerAppends: input.viewContainerAppends || [],
            eventDropTransformers: input.eventDropTransformers || [],
            componentInteractions: input.componentInteractions || [],
            calendarInteractions: input.calendarInteractions || [],
            themeClasses: input.themeClasses || {},
            eventSourceDefs: input.eventSourceDefs || [],
            cmdFormatter: input.cmdFormatter,
            recurringTypes: input.recurringTypes || [],
            namedTimeZonedImpl: input.namedTimeZonedImpl,
            initialView: input.initialView || '',
            elementDraggingImpl: input.elementDraggingImpl,
            optionChangeHandlers: input.optionChangeHandlers || {},
            scrollGridImpl: input.scrollGridImpl || null,
            listenerRefiners: input.listenerRefiners || {},
            optionRefiners: input.optionRefiners || {},
            propSetHandlers: input.propSetHandlers || {},
        };
    }
    function buildPluginHooks(pluginDefs, globalDefs) {
        let currentPluginIds = {};
        let hooks = {
            premiumReleaseDate: undefined,
            reducers: [],
            isLoadingFuncs: [],
            contextInit: [],
            eventRefiners: {},
            eventDefMemberAdders: [],
            eventSourceRefiners: {},
            isDraggableTransformers: [],
            eventDragMutationMassagers: [],
            eventDefMutationAppliers: [],
            dateSelectionTransformers: [],
            datePointTransforms: [],
            dateSpanTransforms: [],
            views: {},
            viewPropsTransformers: [],
            isPropsValid: null,
            externalDefTransforms: [],
            viewContainerAppends: [],
            eventDropTransformers: [],
            componentInteractions: [],
            calendarInteractions: [],
            themeClasses: {},
            eventSourceDefs: [],
            cmdFormatter: null,
            recurringTypes: [],
            namedTimeZonedImpl: null,
            initialView: '',
            elementDraggingImpl: null,
            optionChangeHandlers: {},
            scrollGridImpl: null,
            listenerRefiners: {},
            optionRefiners: {},
            propSetHandlers: {},
        };
        function addDefs(defs) {
            for (let def of defs) {
                const pluginName = def.name;
                const currentId = currentPluginIds[pluginName];
                if (currentId === undefined) {
                    currentPluginIds[pluginName] = def.id;
                    addDefs(def.deps);
                    hooks = combineHooks(hooks, def);
                }
                else if (currentId !== def.id) {
                    // different ID than the one already added
                    console.warn(`Duplicate plugin '${pluginName}'`);
                }
            }
        }
        if (pluginDefs) {
            addDefs(pluginDefs);
        }
        addDefs(globalDefs);
        return hooks;
    }
    function buildBuildPluginHooks() {
        let currentOverrideDefs = [];
        let currentGlobalDefs = [];
        let currentHooks;
        return (overrideDefs, globalDefs) => {
            if (!currentHooks || !isArraysEqual(overrideDefs, currentOverrideDefs) || !isArraysEqual(globalDefs, currentGlobalDefs)) {
                currentHooks = buildPluginHooks(overrideDefs, globalDefs);
            }
            currentOverrideDefs = overrideDefs;
            currentGlobalDefs = globalDefs;
            return currentHooks;
        };
    }
    function combineHooks(hooks0, hooks1) {
        return {
            premiumReleaseDate: compareOptionalDates(hooks0.premiumReleaseDate, hooks1.premiumReleaseDate),
            reducers: hooks0.reducers.concat(hooks1.reducers),
            isLoadingFuncs: hooks0.isLoadingFuncs.concat(hooks1.isLoadingFuncs),
            contextInit: hooks0.contextInit.concat(hooks1.contextInit),
            eventRefiners: Object.assign(Object.assign({}, hooks0.eventRefiners), hooks1.eventRefiners),
            eventDefMemberAdders: hooks0.eventDefMemberAdders.concat(hooks1.eventDefMemberAdders),
            eventSourceRefiners: Object.assign(Object.assign({}, hooks0.eventSourceRefiners), hooks1.eventSourceRefiners),
            isDraggableTransformers: hooks0.isDraggableTransformers.concat(hooks1.isDraggableTransformers),
            eventDragMutationMassagers: hooks0.eventDragMutationMassagers.concat(hooks1.eventDragMutationMassagers),
            eventDefMutationAppliers: hooks0.eventDefMutationAppliers.concat(hooks1.eventDefMutationAppliers),
            dateSelectionTransformers: hooks0.dateSelectionTransformers.concat(hooks1.dateSelectionTransformers),
            datePointTransforms: hooks0.datePointTransforms.concat(hooks1.datePointTransforms),
            dateSpanTransforms: hooks0.dateSpanTransforms.concat(hooks1.dateSpanTransforms),
            views: Object.assign(Object.assign({}, hooks0.views), hooks1.views),
            viewPropsTransformers: hooks0.viewPropsTransformers.concat(hooks1.viewPropsTransformers),
            isPropsValid: hooks1.isPropsValid || hooks0.isPropsValid,
            externalDefTransforms: hooks0.externalDefTransforms.concat(hooks1.externalDefTransforms),
            viewContainerAppends: hooks0.viewContainerAppends.concat(hooks1.viewContainerAppends),
            eventDropTransformers: hooks0.eventDropTransformers.concat(hooks1.eventDropTransformers),
            calendarInteractions: hooks0.calendarInteractions.concat(hooks1.calendarInteractions),
            componentInteractions: hooks0.componentInteractions.concat(hooks1.componentInteractions),
            themeClasses: Object.assign(Object.assign({}, hooks0.themeClasses), hooks1.themeClasses),
            eventSourceDefs: hooks0.eventSourceDefs.concat(hooks1.eventSourceDefs),
            cmdFormatter: hooks1.cmdFormatter || hooks0.cmdFormatter,
            recurringTypes: hooks0.recurringTypes.concat(hooks1.recurringTypes),
            namedTimeZonedImpl: hooks1.namedTimeZonedImpl || hooks0.namedTimeZonedImpl,
            initialView: hooks0.initialView || hooks1.initialView,
            elementDraggingImpl: hooks0.elementDraggingImpl || hooks1.elementDraggingImpl,
            optionChangeHandlers: Object.assign(Object.assign({}, hooks0.optionChangeHandlers), hooks1.optionChangeHandlers),
            scrollGridImpl: hooks1.scrollGridImpl || hooks0.scrollGridImpl,
            listenerRefiners: Object.assign(Object.assign({}, hooks0.listenerRefiners), hooks1.listenerRefiners),
            optionRefiners: Object.assign(Object.assign({}, hooks0.optionRefiners), hooks1.optionRefiners),
            propSetHandlers: Object.assign(Object.assign({}, hooks0.propSetHandlers), hooks1.propSetHandlers),
        };
    }
    function compareOptionalDates(date0, date1) {
        if (date0 === undefined) {
            return date1;
        }
        if (date1 === undefined) {
            return date0;
        }
        return new Date(Math.max(date0.valueOf(), date1.valueOf()));
    }

    class StandardTheme extends Theme {
    }
    StandardTheme.prototype.classes = {
        root: 'fc-theme-standard',
        tableCellShaded: 'fc-cell-shaded',
        buttonGroup: 'fc-button-group',
        button: 'fc-button fc-button-primary',
        buttonActive: 'fc-button-active',
    };
    StandardTheme.prototype.baseIconClass = 'fc-icon';
    StandardTheme.prototype.iconClasses = {
        close: 'fc-icon-x',
        prev: 'fc-icon-chevron-left',
        next: 'fc-icon-chevron-right',
        prevYear: 'fc-icon-chevrons-left',
        nextYear: 'fc-icon-chevrons-right',
    };
    StandardTheme.prototype.rtlIconClasses = {
        prev: 'fc-icon-chevron-right',
        next: 'fc-icon-chevron-left',
        prevYear: 'fc-icon-chevrons-right',
        nextYear: 'fc-icon-chevrons-left',
    };
    StandardTheme.prototype.iconOverrideOption = 'buttonIcons'; // TODO: make TS-friendly
    StandardTheme.prototype.iconOverrideCustomButtonOption = 'icon';
    StandardTheme.prototype.iconOverridePrefix = 'fc-icon-';

    function compileViewDefs(defaultConfigs, overrideConfigs) {
        let hash = {};
        let viewType;
        for (viewType in defaultConfigs) {
            ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs);
        }
        for (viewType in overrideConfigs) {
            ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs);
        }
        return hash;
    }
    function ensureViewDef(viewType, hash, defaultConfigs, overrideConfigs) {
        if (hash[viewType]) {
            return hash[viewType];
        }
        let viewDef = buildViewDef(viewType, hash, defaultConfigs, overrideConfigs);
        if (viewDef) {
            hash[viewType] = viewDef;
        }
        return viewDef;
    }
    function buildViewDef(viewType, hash, defaultConfigs, overrideConfigs) {
        let defaultConfig = defaultConfigs[viewType];
        let overrideConfig = overrideConfigs[viewType];
        let queryProp = (name) => ((defaultConfig && defaultConfig[name] !== null) ? defaultConfig[name] :
            ((overrideConfig && overrideConfig[name] !== null) ? overrideConfig[name] : null));
        let theComponent = queryProp('component');
        let superType = queryProp('superType');
        let superDef = null;
        if (superType) {
            if (superType === viewType) {
                throw new Error('Can\'t have a custom view type that references itself');
            }
            superDef = ensureViewDef(superType, hash, defaultConfigs, overrideConfigs);
        }
        if (!theComponent && superDef) {
            theComponent = superDef.component;
        }
        if (!theComponent) {
            return null; // don't throw a warning, might be settings for a single-unit view
        }
        return {
            type: viewType,
            component: theComponent,
            defaults: Object.assign(Object.assign({}, (superDef ? superDef.defaults : {})), (defaultConfig ? defaultConfig.rawOptions : {})),
            overrides: Object.assign(Object.assign({}, (superDef ? superDef.overrides : {})), (overrideConfig ? overrideConfig.rawOptions : {})),
        };
    }

    function parseViewConfigs(inputs) {
        return mapHash(inputs, parseViewConfig);
    }
    function parseViewConfig(input) {
        let rawOptions = typeof input === 'function' ?
            { component: input } :
            input;
        let { component } = rawOptions;
        if (rawOptions.content) {
            component = createViewHookComponent(rawOptions);
            // TODO: remove content/classNames/didMount/etc from options?
        }
        return {
            superType: rawOptions.type,
            component: component,
            rawOptions, // includes type and component too :(
        };
    }
    function createViewHookComponent(options) {
        return (viewProps) => (h(ViewContextType.Consumer, null, (context) => (h(ContentContainer, { elTag: "div", elClasses: buildViewClassNames(context.viewSpec), renderProps: Object.assign(Object.assign({}, viewProps), { nextDayThreshold: context.options.nextDayThreshold }), generatorName: undefined, generator: options.content, classNameGenerator: options.classNames, didMount: options.didMount, willUnmount: options.willUnmount }))));
    }

    function buildViewSpecs(defaultInputs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
        let defaultConfigs = parseViewConfigs(defaultInputs);
        let overrideConfigs = parseViewConfigs(optionOverrides.views);
        let viewDefs = compileViewDefs(defaultConfigs, overrideConfigs);
        return mapHash(viewDefs, (viewDef) => buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults));
    }
    function buildViewSpec(viewDef, overrideConfigs, optionOverrides, dynamicOptionOverrides, localeDefaults) {
        let durationInput = viewDef.overrides.duration ||
            viewDef.defaults.duration ||
            dynamicOptionOverrides.duration ||
            optionOverrides.duration;
        let duration = null;
        let durationUnit = '';
        let singleUnit = '';
        let singleUnitOverrides = {};
        if (durationInput) {
            duration = createDurationCached(durationInput);
            if (duration) { // valid?
                let denom = greatestDurationDenominator(duration);
                durationUnit = denom.unit;
                if (denom.value === 1) {
                    singleUnit = durationUnit;
                    singleUnitOverrides = overrideConfigs[durationUnit] ? overrideConfigs[durationUnit].rawOptions : {};
                }
            }
        }
        let queryButtonText = (optionsSubset) => {
            let buttonTextMap = optionsSubset.buttonText || {};
            let buttonTextKey = viewDef.defaults.buttonTextKey;
            if (buttonTextKey != null && buttonTextMap[buttonTextKey] != null) {
                return buttonTextMap[buttonTextKey];
            }
            if (buttonTextMap[viewDef.type] != null) {
                return buttonTextMap[viewDef.type];
            }
            if (buttonTextMap[singleUnit] != null) {
                return buttonTextMap[singleUnit];
            }
            return null;
        };
        let queryButtonTitle = (optionsSubset) => {
            let buttonHints = optionsSubset.buttonHints || {};
            let buttonKey = viewDef.defaults.buttonTextKey; // use same key as text
            if (buttonKey != null && buttonHints[buttonKey] != null) {
                return buttonHints[buttonKey];
            }
            if (buttonHints[viewDef.type] != null) {
                return buttonHints[viewDef.type];
            }
            if (buttonHints[singleUnit] != null) {
                return buttonHints[singleUnit];
            }
            return null;
        };
        return {
            type: viewDef.type,
            component: viewDef.component,
            duration,
            durationUnit,
            singleUnit,
            optionDefaults: viewDef.defaults,
            optionOverrides: Object.assign(Object.assign({}, singleUnitOverrides), viewDef.overrides),
            buttonTextOverride: queryButtonText(dynamicOptionOverrides) ||
                queryButtonText(optionOverrides) || // constructor-specified buttonText lookup hash takes precedence
                viewDef.overrides.buttonText,
            buttonTextDefault: queryButtonText(localeDefaults) ||
                viewDef.defaults.buttonText ||
                queryButtonText(BASE_OPTION_DEFAULTS) ||
                viewDef.type,
            // not DRY
            buttonTitleOverride: queryButtonTitle(dynamicOptionOverrides) ||
                queryButtonTitle(optionOverrides) ||
                viewDef.overrides.buttonHint,
            buttonTitleDefault: queryButtonTitle(localeDefaults) ||
                viewDef.defaults.buttonHint ||
                queryButtonTitle(BASE_OPTION_DEFAULTS),
            // will eventually fall back to buttonText
        };
    }
    // hack to get memoization working
    let durationInputMap = {};
    function createDurationCached(durationInput) {
        let json = JSON.stringify(durationInput);
        let res = durationInputMap[json];
        if (res === undefined) {
            res = createDuration(durationInput);
            durationInputMap[json] = res;
        }
        return res;
    }

    function reduceViewType(viewType, action) {
        switch (action.type) {
            case 'CHANGE_VIEW_TYPE':
                viewType = action.viewType;
        }
        return viewType;
    }

    function reduceDynamicOptionOverrides(dynamicOptionOverrides, action) {
        switch (action.type) {
            case 'SET_OPTION':
                return Object.assign(Object.assign({}, dynamicOptionOverrides), { [action.optionName]: action.rawOptionValue });
            default:
                return dynamicOptionOverrides;
        }
    }

    function reduceDateProfile(currentDateProfile, action, currentDate, dateProfileGenerator) {
        let dp;
        switch (action.type) {
            case 'CHANGE_VIEW_TYPE':
                return dateProfileGenerator.build(action.dateMarker || currentDate);
            case 'CHANGE_DATE':
                return dateProfileGenerator.build(action.dateMarker);
            case 'PREV':
                dp = dateProfileGenerator.buildPrev(currentDateProfile, currentDate);
                if (dp.isValid) {
                    return dp;
                }
                break;
            case 'NEXT':
                dp = dateProfileGenerator.buildNext(currentDateProfile, currentDate);
                if (dp.isValid) {
                    return dp;
                }
                break;
        }
        return currentDateProfile;
    }

    function initEventSources(calendarOptions, dateProfile, context) {
        let activeRange = dateProfile ? dateProfile.activeRange : null;
        return addSources({}, parseInitialSources(calendarOptions, context), activeRange, context);
    }
    function reduceEventSources(eventSources, action, dateProfile, context) {
        let activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
        switch (action.type) {
            case 'ADD_EVENT_SOURCES': // already parsed
                return addSources(eventSources, action.sources, activeRange, context);
            case 'REMOVE_EVENT_SOURCE':
                return removeSource(eventSources, action.sourceId);
            case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
            case 'NEXT':
            case 'CHANGE_DATE':
            case 'CHANGE_VIEW_TYPE':
                if (dateProfile) {
                    return fetchDirtySources(eventSources, activeRange, context);
                }
                return eventSources;
            case 'FETCH_EVENT_SOURCES':
                return fetchSourcesByIds(eventSources, action.sourceIds ? // why no type?
                    arrayToHash(action.sourceIds) :
                    excludeStaticSources(eventSources, context), activeRange, action.isRefetch || false, context);
            case 'RECEIVE_EVENTS':
            case 'RECEIVE_EVENT_ERROR':
                return receiveResponse$1(eventSources, action.sourceId, action.fetchId, action.fetchRange);
            case 'REMOVE_ALL_EVENT_SOURCES':
                return {};
            default:
                return eventSources;
        }
    }
    function reduceEventSourcesNewTimeZone(eventSources, dateProfile, context) {
        let activeRange = dateProfile ? dateProfile.activeRange : null; // need this check?
        return fetchSourcesByIds(eventSources, excludeStaticSources(eventSources, context), activeRange, true, context);
    }
    function computeEventSourcesLoading(eventSources) {
        for (let sourceId in eventSources) {
            if (eventSources[sourceId].isFetching) {
                return true;
            }
        }
        return false;
    }
    function addSources(eventSourceHash, sources, fetchRange, context) {
        let hash = {};
        for (let source of sources) {
            hash[source.sourceId] = source;
        }
        if (fetchRange) {
            hash = fetchDirtySources(hash, fetchRange, context);
        }
        return Object.assign(Object.assign({}, eventSourceHash), hash);
    }
    function removeSource(eventSourceHash, sourceId) {
        return filterHash(eventSourceHash, (eventSource) => eventSource.sourceId !== sourceId);
    }
    function fetchDirtySources(sourceHash, fetchRange, context) {
        return fetchSourcesByIds(sourceHash, filterHash(sourceHash, (eventSource) => isSourceDirty(eventSource, fetchRange, context)), fetchRange, false, context);
    }
    function isSourceDirty(eventSource, fetchRange, context) {
        if (!doesSourceNeedRange(eventSource, context)) {
            return !eventSource.latestFetchId;
        }
        return !context.options.lazyFetching ||
            !eventSource.fetchRange ||
            eventSource.isFetching || // always cancel outdated in-progress fetches
            fetchRange.start < eventSource.fetchRange.start ||
            fetchRange.end > eventSource.fetchRange.end;
    }
    function fetchSourcesByIds(prevSources, sourceIdHash, fetchRange, isRefetch, context) {
        let nextSources = {};
        for (let sourceId in prevSources) {
            let source = prevSources[sourceId];
            if (sourceIdHash[sourceId]) {
                nextSources[sourceId] = fetchSource$1(source, fetchRange, isRefetch, context);
            }
            else {
                nextSources[sourceId] = source;
            }
        }
        return nextSources;
    }
    function fetchSource$1(eventSource, fetchRange, isRefetch, context) {
        let { options, calendarApi } = context;
        let sourceDef = context.pluginHooks.eventSourceDefs[eventSource.sourceDefId];
        let fetchId = guid();
        sourceDef.fetch({
            eventSource,
            range: fetchRange,
            isRefetch,
            context,
        }, (res) => {
            let { rawEvents } = res;
            if (options.eventSourceSuccess) {
                rawEvents = options.eventSourceSuccess.call(calendarApi, rawEvents, res.response) || rawEvents;
            }
            if (eventSource.success) {
                rawEvents = eventSource.success.call(calendarApi, rawEvents, res.response) || rawEvents;
            }
            context.dispatch({
                type: 'RECEIVE_EVENTS',
                sourceId: eventSource.sourceId,
                fetchId,
                fetchRange,
                rawEvents,
            });
        }, (error) => {
            let errorHandled = false;
            if (options.eventSourceFailure) {
                options.eventSourceFailure.call(calendarApi, error);
                errorHandled = true;
            }
            if (eventSource.failure) {
                eventSource.failure(error);
                errorHandled = true;
            }
            if (!errorHandled) {
                console.warn(error.message, error);
            }
            context.dispatch({
                type: 'RECEIVE_EVENT_ERROR',
                sourceId: eventSource.sourceId,
                fetchId,
                fetchRange,
                error,
            });
        });
        return Object.assign(Object.assign({}, eventSource), { isFetching: true, latestFetchId: fetchId });
    }
    function receiveResponse$1(sourceHash, sourceId, fetchId, fetchRange) {
        let eventSource = sourceHash[sourceId];
        if (eventSource && // not already removed
            fetchId === eventSource.latestFetchId) {
            return Object.assign(Object.assign({}, sourceHash), { [sourceId]: Object.assign(Object.assign({}, eventSource), { isFetching: false, fetchRange }) });
        }
        return sourceHash;
    }
    function excludeStaticSources(eventSources, context) {
        return filterHash(eventSources, (eventSource) => doesSourceNeedRange(eventSource, context));
    }
    function parseInitialSources(rawOptions, context) {
        let refiners = buildEventSourceRefiners(context);
        let rawSources = [].concat(rawOptions.eventSources || []);
        let sources = []; // parsed
        if (rawOptions.initialEvents) {
            rawSources.unshift(rawOptions.initialEvents);
        }
        if (rawOptions.events) {
            rawSources.unshift(rawOptions.events);
        }
        for (let rawSource of rawSources) {
            let source = parseEventSource(rawSource, context, refiners);
            if (source) {
                sources.push(source);
            }
        }
        return sources;
    }
    function doesSourceNeedRange(eventSource, context) {
        let defs = context.pluginHooks.eventSourceDefs;
        return !defs[eventSource.sourceDefId].ignoreRange;
    }

    function reduceDateSelection(currentSelection, action) {
        switch (action.type) {
            case 'UNSELECT_DATES':
                return null;
            case 'SELECT_DATES':
                return action.selection;
            default:
                return currentSelection;
        }
    }

    function reduceSelectedEvent(currentInstanceId, action) {
        switch (action.type) {
            case 'UNSELECT_EVENT':
                return '';
            case 'SELECT_EVENT':
                return action.eventInstanceId;
            default:
                return currentInstanceId;
        }
    }

    function reduceEventDrag(currentDrag, action) {
        let newDrag;
        switch (action.type) {
            case 'UNSET_EVENT_DRAG':
                return null;
            case 'SET_EVENT_DRAG':
                newDrag = action.state;
                return {
                    affectedEvents: newDrag.affectedEvents,
                    mutatedEvents: newDrag.mutatedEvents,
                    isEvent: newDrag.isEvent,
                };
            default:
                return currentDrag;
        }
    }

    function reduceEventResize(currentResize, action) {
        let newResize;
        switch (action.type) {
            case 'UNSET_EVENT_RESIZE':
                return null;
            case 'SET_EVENT_RESIZE':
                newResize = action.state;
                return {
                    affectedEvents: newResize.affectedEvents,
                    mutatedEvents: newResize.mutatedEvents,
                    isEvent: newResize.isEvent,
                };
            default:
                return currentResize;
        }
    }

    function parseToolbars(calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) {
        let header = calendarOptions.headerToolbar ? parseToolbar(calendarOptions.headerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) : null;
        let footer = calendarOptions.footerToolbar ? parseToolbar(calendarOptions.footerToolbar, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) : null;
        return { header, footer };
    }
    function parseToolbar(sectionStrHash, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi) {
        let sectionWidgets = {};
        let viewsWithButtons = [];
        let hasTitle = false;
        for (let sectionName in sectionStrHash) {
            let sectionStr = sectionStrHash[sectionName];
            let sectionRes = parseSection(sectionStr, calendarOptions, calendarOptionOverrides, theme, viewSpecs, calendarApi);
            sectionWidgets[sectionName] = sectionRes.widgets;
            viewsWithButtons.push(...sectionRes.viewsWithButtons);
            hasTitle = hasTitle || sectionRes.hasTitle;
        }
        return { sectionWidgets, viewsWithButtons, hasTitle };
    }
    /*
    BAD: querying icons and text here. should be done at render time
    */
    function parseSection(sectionStr, calendarOptions, // defaults+overrides, then refined
    calendarOptionOverrides, // overrides only!, unrefined :(
    theme, viewSpecs, calendarApi) {
        let isRtl = calendarOptions.direction === 'rtl';
        let calendarCustomButtons = calendarOptions.customButtons || {};
        let calendarButtonTextOverrides = calendarOptionOverrides.buttonText || {};
        let calendarButtonText = calendarOptions.buttonText || {};
        let calendarButtonHintOverrides = calendarOptionOverrides.buttonHints || {};
        let calendarButtonHints = calendarOptions.buttonHints || {};
        let sectionSubstrs = sectionStr ? sectionStr.split(' ') : [];
        let viewsWithButtons = [];
        let hasTitle = false;
        let widgets = sectionSubstrs.map((buttonGroupStr) => (buttonGroupStr.split(',').map((buttonName) => {
            if (buttonName === 'title') {
                hasTitle = true;
                return { buttonName };
            }
            let customButtonProps;
            let viewSpec;
            let buttonClick;
            let buttonIcon; // only one of these will be set
            let buttonText; // "
            let buttonHint;
            // ^ for the title="" attribute, for accessibility
            if ((customButtonProps = calendarCustomButtons[buttonName])) {
                buttonClick = (ev) => {
                    if (customButtonProps.click) {
                        customButtonProps.click.call(ev.target, ev, ev.target); // TODO: use Calendar this context?
                    }
                };
                (buttonIcon = theme.getCustomButtonIconClass(customButtonProps)) ||
                    (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
                    (buttonText = customButtonProps.text);
                buttonHint = customButtonProps.hint || customButtonProps.text;
            }
            else if ((viewSpec = viewSpecs[buttonName])) {
                viewsWithButtons.push(buttonName);
                buttonClick = () => {
                    calendarApi.changeView(buttonName);
                };
                (buttonText = viewSpec.buttonTextOverride) ||
                    (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
                    (buttonText = viewSpec.buttonTextDefault);
                let textFallback = viewSpec.buttonTextOverride ||
                    viewSpec.buttonTextDefault;
                buttonHint = formatWithOrdinals(viewSpec.buttonTitleOverride ||
                    viewSpec.buttonTitleDefault ||
                    calendarOptions.viewHint, [textFallback, buttonName], // view-name = buttonName
                textFallback);
            }
            else if (calendarApi[buttonName]) { // a calendarApi method
                buttonClick = () => {
                    calendarApi[buttonName]();
                };
                (buttonText = calendarButtonTextOverrides[buttonName]) ||
                    (buttonIcon = theme.getIconClass(buttonName, isRtl)) ||
                    (buttonText = calendarButtonText[buttonName]); // everything else is considered default
                if (buttonName === 'prevYear' || buttonName === 'nextYear') {
                    let prevOrNext = buttonName === 'prevYear' ? 'prev' : 'next';
                    buttonHint = formatWithOrdinals(calendarButtonHintOverrides[prevOrNext] ||
                        calendarButtonHints[prevOrNext], [
                        calendarButtonText.year || 'year',
                        'year',
                    ], calendarButtonText[buttonName]);
                }
                else {
                    buttonHint = (navUnit) => formatWithOrdinals(calendarButtonHintOverrides[buttonName] ||
                        calendarButtonHints[buttonName], [
                        calendarButtonText[navUnit] || navUnit,
                        navUnit,
                    ], calendarButtonText[buttonName]);
                }
            }
            return { buttonName, buttonClick, buttonIcon, buttonText, buttonHint };
        })));
        return { widgets, viewsWithButtons, hasTitle };
    }

    // always represents the current view. otherwise, it'd need to change value every time date changes
    class ViewImpl {
        constructor(type, getCurrentData, dateEnv) {
            this.type = type;
            this.getCurrentData = getCurrentData;
            this.dateEnv = dateEnv;
        }
        get calendar() {
            return this.getCurrentData().calendarApi;
        }
        get title() {
            return this.getCurrentData().viewTitle;
        }
        get activeStart() {
            return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.start);
        }
        get activeEnd() {
            return this.dateEnv.toDate(this.getCurrentData().dateProfile.activeRange.end);
        }
        get currentStart() {
            return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.start);
        }
        get currentEnd() {
            return this.dateEnv.toDate(this.getCurrentData().dateProfile.currentRange.end);
        }
        getOption(name) {
            return this.getCurrentData().options[name]; // are the view-specific options
        }
    }

    let eventSourceDef$2 = {
        ignoreRange: true,
        parseMeta(refined) {
            if (Array.isArray(refined.events)) {
                return refined.events;
            }
            return null;
        },
        fetch(arg, successCallback) {
            successCallback({
                rawEvents: arg.eventSource.meta,
            });
        },
    };
    const arrayEventSourcePlugin = createPlugin({
        name: 'array-event-source',
        eventSourceDefs: [eventSourceDef$2],
    });

    let eventSourceDef$1 = {
        parseMeta(refined) {
            if (typeof refined.events === 'function') {
                return refined.events;
            }
            return null;
        },
        fetch(arg, successCallback, errorCallback) {
            const { dateEnv } = arg.context;
            const func = arg.eventSource.meta;
            unpromisify(func.bind(null, buildRangeApiWithTimeZone(arg.range, dateEnv)), (rawEvents) => successCallback({ rawEvents }), errorCallback);
        },
    };
    const funcEventSourcePlugin = createPlugin({
        name: 'func-event-source',
        eventSourceDefs: [eventSourceDef$1],
    });

    const JSON_FEED_EVENT_SOURCE_REFINERS = {
        method: String,
        extraParams: identity,
        startParam: String,
        endParam: String,
        timeZoneParam: String,
    };

    let eventSourceDef = {
        parseMeta(refined) {
            if (refined.url && (refined.format === 'json' || !refined.format)) {
                return {
                    url: refined.url,
                    format: 'json',
                    method: (refined.method || 'GET').toUpperCase(),
                    extraParams: refined.extraParams,
                    startParam: refined.startParam,
                    endParam: refined.endParam,
                    timeZoneParam: refined.timeZoneParam,
                };
            }
            return null;
        },
        fetch(arg, successCallback, errorCallback) {
            const { meta } = arg.eventSource;
            const requestParams = buildRequestParams$1(meta, arg.range, arg.context);
            requestJson(meta.method, meta.url, requestParams).then(([rawEvents, response]) => {
                successCallback({ rawEvents, response });
            }, errorCallback);
        },
    };
    const jsonFeedEventSourcePlugin = createPlugin({
        name: 'json-event-source',
        eventSourceRefiners: JSON_FEED_EVENT_SOURCE_REFINERS,
        eventSourceDefs: [eventSourceDef],
    });
    function buildRequestParams$1(meta, range, context) {
        let { dateEnv, options } = context;
        let startParam;
        let endParam;
        let timeZoneParam;
        let customRequestParams;
        let params = {};
        startParam = meta.startParam;
        if (startParam == null) {
            startParam = options.startParam;
        }
        endParam = meta.endParam;
        if (endParam == null) {
            endParam = options.endParam;
        }
        timeZoneParam = meta.timeZoneParam;
        if (timeZoneParam == null) {
            timeZoneParam = options.timeZoneParam;
        }
        // retrieve any outbound GET/POST data from the options
        if (typeof meta.extraParams === 'function') {
            // supplied as a function that returns a key/value object
            customRequestParams = meta.extraParams();
        }
        else {
            // probably supplied as a straight key/value object
            customRequestParams = meta.extraParams || {};
        }
        Object.assign(params, customRequestParams);
        params[startParam] = dateEnv.formatIso(range.start);
        params[endParam] = dateEnv.formatIso(range.end);
        if (dateEnv.timeZone !== 'local') {
            params[timeZoneParam] = dateEnv.timeZone;
        }
        return params;
    }

    const SIMPLE_RECURRING_REFINERS = {
        daysOfWeek: identity,
        startTime: createDuration,
        endTime: createDuration,
        duration: createDuration,
        startRecur: identity,
        endRecur: identity,
    };

    let recurring = {
        parse(refined, dateEnv) {
            if (refined.daysOfWeek || refined.startTime || refined.endTime || refined.startRecur || refined.endRecur) {
                let recurringData = {
                    daysOfWeek: refined.daysOfWeek || null,
                    startTime: refined.startTime || null,
                    endTime: refined.endTime || null,
                    startRecur: refined.startRecur ? dateEnv.createMarker(refined.startRecur) : null,
                    endRecur: refined.endRecur ? dateEnv.createMarker(refined.endRecur) : null,
                };
                let duration;
                if (refined.duration) {
                    duration = refined.duration;
                }
                if (!duration && refined.startTime && refined.endTime) {
                    duration = subtractDurations(refined.endTime, refined.startTime);
                }
                return {
                    allDayGuess: Boolean(!refined.startTime && !refined.endTime),
                    duration,
                    typeData: recurringData, // doesn't need endTime anymore but oh well
                };
            }
            return null;
        },
        expand(typeData, framingRange, dateEnv) {
            let clippedFramingRange = intersectRanges(framingRange, { start: typeData.startRecur, end: typeData.endRecur });
            if (clippedFramingRange) {
                return expandRanges(typeData.daysOfWeek, typeData.startTime, clippedFramingRange, dateEnv);
            }
            return [];
        },
    };
    const simpleRecurringEventsPlugin = createPlugin({
        name: 'simple-recurring-event',
        recurringTypes: [recurring],
        eventRefiners: SIMPLE_RECURRING_REFINERS,
    });
    function expandRanges(daysOfWeek, startTime, framingRange, dateEnv) {
        let dowHash = daysOfWeek ? arrayToHash(daysOfWeek) : null;
        let dayMarker = startOfDay(framingRange.start);
        let endMarker = framingRange.end;
        let instanceStarts = [];
        while (dayMarker < endMarker) {
            let instanceStart;
            // if everyday, or this particular day-of-week
            if (!dowHash || dowHash[dayMarker.getUTCDay()]) {
                if (startTime) {
                    instanceStart = dateEnv.add(dayMarker, startTime);
                }
                else {
                    instanceStart = dayMarker;
                }
                instanceStarts.push(instanceStart);
            }
            dayMarker = addDays(dayMarker, 1);
        }
        return instanceStarts;
    }

    const changeHandlerPlugin = createPlugin({
        name: 'change-handler',
        optionChangeHandlers: {
            events(events, context) {
                handleEventSources([events], context);
            },
            eventSources: handleEventSources,
        },
    });
    /*
    BUG: if `event` was supplied, all previously-given `eventSources` will be wiped out
    */
    function handleEventSources(inputs, context) {
        let unfoundSources = hashValuesToArray(context.getCurrentData().eventSources);
        let newInputs = [];
        for (let input of inputs) {
            let inputFound = false;
            for (let i = 0; i < unfoundSources.length; i += 1) {
                if (unfoundSources[i]._raw === input) {
                    unfoundSources.splice(i, 1); // delete
                    inputFound = true;
                    break;
                }
            }
            if (!inputFound) {
                newInputs.push(input);
            }
        }
        for (let unfoundSource of unfoundSources) {
            context.dispatch({
                type: 'REMOVE_EVENT_SOURCE',
                sourceId: unfoundSource.sourceId,
            });
        }
        for (let newInput of newInputs) {
            context.calendarApi.addEventSource(newInput);
        }
    }

    function handleDateProfile(dateProfile, context) {
        context.emitter.trigger('datesSet', Object.assign(Object.assign({}, buildRangeApiWithTimeZone(dateProfile.activeRange, context.dateEnv)), { view: context.viewApi }));
    }

    function handleEventStore(eventStore, context) {
        let { emitter } = context;
        if (emitter.hasHandlers('eventsSet')) {
            emitter.trigger('eventsSet', buildEventApis(eventStore, context));
        }
    }

    /*
    this array is exposed on the root namespace so that UMD plugins can add to it.
    see the rollup-bundles script.
    */
    const globalPlugins = [
        arrayEventSourcePlugin,
        funcEventSourcePlugin,
        jsonFeedEventSourcePlugin,
        simpleRecurringEventsPlugin,
        changeHandlerPlugin,
        createPlugin({
            name: 'misc',
            isLoadingFuncs: [
                (state) => computeEventSourcesLoading(state.eventSources),
            ],
            propSetHandlers: {
                dateProfile: handleDateProfile,
                eventStore: handleEventStore,
            },
        }),
    ];

    class TaskRunner {
        constructor(runTaskOption, drainedOption) {
            this.runTaskOption = runTaskOption;
            this.drainedOption = drainedOption;
            this.queue = [];
            this.delayedRunner = new DelayedRunner(this.drain.bind(this));
        }
        request(task, delay) {
            this.queue.push(task);
            this.delayedRunner.request(delay);
        }
        pause(scope) {
            this.delayedRunner.pause(scope);
        }
        resume(scope, force) {
            this.delayedRunner.resume(scope, force);
        }
        drain() {
            let { queue } = this;
            while (queue.length) {
                let completedTasks = [];
                let task;
                while ((task = queue.shift())) {
                    this.runTask(task);
                    completedTasks.push(task);
                }
                this.drained(completedTasks);
            } // keep going, in case new tasks were added in the drained handler
        }
        runTask(task) {
            if (this.runTaskOption) {
                this.runTaskOption(task);
            }
        }
        drained(completedTasks) {
            if (this.drainedOption) {
                this.drainedOption(completedTasks);
            }
        }
    }

    // Computes what the title at the top of the calendarApi should be for this view
    function buildTitle(dateProfile, viewOptions, dateEnv) {
        let range;
        // for views that span a large unit of time, show the proper interval, ignoring stray days before and after
        if (/^(year|month)$/.test(dateProfile.currentRangeUnit)) {
            range = dateProfile.currentRange;
        }
        else { // for day units or smaller, use the actual day range
            range = dateProfile.activeRange;
        }
        return dateEnv.formatRange(range.start, range.end, createFormatter(viewOptions.titleFormat || buildTitleFormat(dateProfile)), {
            isEndExclusive: dateProfile.isRangeAllDay,
            defaultSeparator: viewOptions.titleRangeSeparator,
        });
    }
    // Generates the format string that should be used to generate the title for the current date range.
    // Attempts to compute the most appropriate format if not explicitly specified with `titleFormat`.
    function buildTitleFormat(dateProfile) {
        let { currentRangeUnit } = dateProfile;
        if (currentRangeUnit === 'year') {
            return { year: 'numeric' };
        }
        if (currentRangeUnit === 'month') {
            return { year: 'numeric', month: 'long' }; // like "September 2014"
        }
        let days = diffWholeDays(dateProfile.currentRange.start, dateProfile.currentRange.end);
        if (days !== null && days > 1) {
            // multi-day range. shorter, like "Sep 9 - 10 2014"
            return { year: 'numeric', month: 'short', day: 'numeric' };
        }
        // one day. longer, like "September 9 2014"
        return { year: 'numeric', month: 'long', day: 'numeric' };
    }

    // in future refactor, do the redux-style function(state=initial) for initial-state
    // also, whatever is happening in constructor, have it happen in action queue too
    class CalendarDataManager {
        constructor(props) {
            this.computeOptionsData = memoize(this._computeOptionsData);
            this.computeCurrentViewData = memoize(this._computeCurrentViewData);
            this.organizeRawLocales = memoize(organizeRawLocales);
            this.buildLocale = memoize(buildLocale);
            this.buildPluginHooks = buildBuildPluginHooks();
            this.buildDateEnv = memoize(buildDateEnv$1);
            this.buildTheme = memoize(buildTheme);
            this.parseToolbars = memoize(parseToolbars);
            this.buildViewSpecs = memoize(buildViewSpecs);
            this.buildDateProfileGenerator = memoizeObjArg(buildDateProfileGenerator);
            this.buildViewApi = memoize(buildViewApi);
            this.buildViewUiProps = memoizeObjArg(buildViewUiProps);
            this.buildEventUiBySource = memoize(buildEventUiBySource, isPropsEqual);
            this.buildEventUiBases = memoize(buildEventUiBases);
            this.parseContextBusinessHours = memoizeObjArg(parseContextBusinessHours);
            this.buildTitle = memoize(buildTitle);
            this.emitter = new Emitter();
            this.actionRunner = new TaskRunner(this._handleAction.bind(this), this.updateData.bind(this));
            this.currentCalendarOptionsInput = {};
            this.currentCalendarOptionsRefined = {};
            this.currentViewOptionsInput = {};
            this.currentViewOptionsRefined = {};
            this.currentCalendarOptionsRefiners = {};
            this.getCurrentData = () => this.data;
            this.dispatch = (action) => {
                this.actionRunner.request(action); // protects against recursive calls to _handleAction
            };
            this.props = props;
            this.actionRunner.pause();
            let dynamicOptionOverrides = {};
            let optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
            let currentViewType = optionsData.calendarOptions.initialView || optionsData.pluginHooks.initialView;
            let currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
            // wire things up
            // TODO: not DRY
            props.calendarApi.currentDataManager = this;
            this.emitter.setThisContext(props.calendarApi);
            this.emitter.setOptions(currentViewData.options);
            let currentDate = getInitialDate(optionsData.calendarOptions, optionsData.dateEnv);
            let dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
            if (!rangeContainsMarker(dateProfile.activeRange, currentDate)) {
                currentDate = dateProfile.currentRange.start;
            }
            let calendarContext = {
                dateEnv: optionsData.dateEnv,
                options: optionsData.calendarOptions,
                pluginHooks: optionsData.pluginHooks,
                calendarApi: props.calendarApi,
                dispatch: this.dispatch,
                emitter: this.emitter,
                getCurrentData: this.getCurrentData,
            };
            // needs to be after setThisContext
            for (let callback of optionsData.pluginHooks.contextInit) {
                callback(calendarContext);
            }
            // NOT DRY
            let eventSources = initEventSources(optionsData.calendarOptions, dateProfile, calendarContext);
            let initialState = {
                dynamicOptionOverrides,
                currentViewType,
                currentDate,
                dateProfile,
                businessHours: this.parseContextBusinessHours(calendarContext),
                eventSources,
                eventUiBases: {},
                eventStore: createEmptyEventStore(),
                renderableEventStore: createEmptyEventStore(),
                dateSelection: null,
                eventSelection: '',
                eventDrag: null,
                eventResize: null,
                selectionConfig: this.buildViewUiProps(calendarContext).selectionConfig,
            };
            let contextAndState = Object.assign(Object.assign({}, calendarContext), initialState);
            for (let reducer of optionsData.pluginHooks.reducers) {
                Object.assign(initialState, reducer(null, null, contextAndState));
            }
            if (computeIsLoading(initialState, calendarContext)) {
                this.emitter.trigger('loading', true); // NOT DRY
            }
            this.state = initialState;
            this.updateData();
            this.actionRunner.resume();
        }
        resetOptions(optionOverrides, append) {
            let { props } = this;
            props.optionOverrides = append
                ? Object.assign(Object.assign({}, props.optionOverrides), optionOverrides) : optionOverrides;
            this.actionRunner.request({
                type: 'NOTHING',
            });
        }
        _handleAction(action) {
            let { props, state, emitter } = this;
            let dynamicOptionOverrides = reduceDynamicOptionOverrides(state.dynamicOptionOverrides, action);
            let optionsData = this.computeOptionsData(props.optionOverrides, dynamicOptionOverrides, props.calendarApi);
            let currentViewType = reduceViewType(state.currentViewType, action);
            let currentViewData = this.computeCurrentViewData(currentViewType, optionsData, props.optionOverrides, dynamicOptionOverrides);
            // wire things up
            // TODO: not DRY
            props.calendarApi.currentDataManager = this;
            emitter.setThisContext(props.calendarApi);
            emitter.setOptions(currentViewData.options);
            let calendarContext = {
                dateEnv: optionsData.dateEnv,
                options: optionsData.calendarOptions,
                pluginHooks: optionsData.pluginHooks,
                calendarApi: props.calendarApi,
                dispatch: this.dispatch,
                emitter,
                getCurrentData: this.getCurrentData,
            };
            let { currentDate, dateProfile } = state;
            if (this.data && this.data.dateProfileGenerator !== currentViewData.dateProfileGenerator) { // hack
                dateProfile = currentViewData.dateProfileGenerator.build(currentDate);
            }
            currentDate = reduceCurrentDate(currentDate, action);
            dateProfile = reduceDateProfile(dateProfile, action, currentDate, currentViewData.dateProfileGenerator);
            if (action.type === 'PREV' || // TODO: move this logic into DateProfileGenerator
                action.type === 'NEXT' || // "
                !rangeContainsMarker(dateProfile.currentRange, currentDate)) {
                currentDate = dateProfile.currentRange.start;
            }
            let eventSources = reduceEventSources(state.eventSources, action, dateProfile, calendarContext);
            let eventStore = reduceEventStore(state.eventStore, action, eventSources, dateProfile, calendarContext);
            let isEventsLoading = computeEventSourcesLoading(eventSources); // BAD. also called in this func in computeIsLoading
            let renderableEventStore = (isEventsLoading && !currentViewData.options.progressiveEventRendering) ?
                (state.renderableEventStore || eventStore) : // try from previous state
                eventStore;
            let { eventUiSingleBase, selectionConfig } = this.buildViewUiProps(calendarContext); // will memoize obj
            let eventUiBySource = this.buildEventUiBySource(eventSources);
            let eventUiBases = this.buildEventUiBases(renderableEventStore.defs, eventUiSingleBase, eventUiBySource);
            let newState = {
                dynamicOptionOverrides,
                currentViewType,
                currentDate,
                dateProfile,
                eventSources,
                eventStore,
                renderableEventStore,
                selectionConfig,
                eventUiBases,
                businessHours: this.parseContextBusinessHours(calendarContext),
                dateSelection: reduceDateSelection(state.dateSelection, action),
                eventSelection: reduceSelectedEvent(state.eventSelection, action),
                eventDrag: reduceEventDrag(state.eventDrag, action),
                eventResize: reduceEventResize(state.eventResize, action),
            };
            let contextAndState = Object.assign(Object.assign({}, calendarContext), newState);
            for (let reducer of optionsData.pluginHooks.reducers) {
                Object.assign(newState, reducer(state, action, contextAndState)); // give the OLD state, for old value
            }
            let wasLoading = computeIsLoading(state, calendarContext);
            let isLoading = computeIsLoading(newState, calendarContext);
            // TODO: use propSetHandlers in plugin system
            if (!wasLoading && isLoading) {
                emitter.trigger('loading', true);
            }
            else if (wasLoading && !isLoading) {
                emitter.trigger('loading', false);
            }
            this.state = newState;
            if (props.onAction) {
                props.onAction(action);
            }
        }
        updateData() {
            let { props, state } = this;
            let oldData = this.data;
            let optionsData = this.computeOptionsData(props.optionOverrides, state.dynamicOptionOverrides, props.calendarApi);
            let currentViewData = this.computeCurrentViewData(state.currentViewType, optionsData, props.optionOverrides, state.dynamicOptionOverrides);
            let data = this.data = Object.assign(Object.assign(Object.assign({ viewTitle: this.buildTitle(state.dateProfile, currentViewData.options, optionsData.dateEnv), calendarApi: props.calendarApi, dispatch: this.dispatch, emitter: this.emitter, getCurrentData: this.getCurrentData }, optionsData), currentViewData), state);
            let changeHandlers = optionsData.pluginHooks.optionChangeHandlers;
            let oldCalendarOptions = oldData && oldData.calendarOptions;
            let newCalendarOptions = optionsData.calendarOptions;
            if (oldCalendarOptions && oldCalendarOptions !== newCalendarOptions) {
                if (oldCalendarOptions.timeZone !== newCalendarOptions.timeZone) {
                    // hack
                    state.eventSources = data.eventSources = reduceEventSourcesNewTimeZone(data.eventSources, state.dateProfile, data);
                    state.eventStore = data.eventStore = rezoneEventStoreDates(data.eventStore, oldData.dateEnv, data.dateEnv);
                }
                for (let optionName in changeHandlers) {
                    if (oldCalendarOptions[optionName] !== newCalendarOptions[optionName]) {
                        changeHandlers[optionName](newCalendarOptions[optionName], data);
                    }
                }
            }
            if (props.onData) {
                props.onData(data);
            }
        }
        _computeOptionsData(optionOverrides, dynamicOptionOverrides, calendarApi) {
            // TODO: blacklist options that are handled by optionChangeHandlers
            let { refinedOptions, pluginHooks, localeDefaults, availableLocaleData, extra, } = this.processRawCalendarOptions(optionOverrides, dynamicOptionOverrides);
            warnUnknownOptions(extra);
            let dateEnv = this.buildDateEnv(refinedOptions.timeZone, refinedOptions.locale, refinedOptions.weekNumberCalculation, refinedOptions.firstDay, refinedOptions.weekText, pluginHooks, availableLocaleData, refinedOptions.defaultRangeSeparator);
            let viewSpecs = this.buildViewSpecs(pluginHooks.views, optionOverrides, dynamicOptionOverrides, localeDefaults);
            let theme = this.buildTheme(refinedOptions, pluginHooks);
            let toolbarConfig = this.parseToolbars(refinedOptions, optionOverrides, theme, viewSpecs, calendarApi);
            return {
                calendarOptions: refinedOptions,
                pluginHooks,
                dateEnv,
                viewSpecs,
                theme,
                toolbarConfig,
                localeDefaults,
                availableRawLocales: availableLocaleData.map,
            };
        }
        // always called from behind a memoizer
        processRawCalendarOptions(optionOverrides, dynamicOptionOverrides) {
            let { locales, locale } = mergeRawOptions([
                BASE_OPTION_DEFAULTS,
                optionOverrides,
                dynamicOptionOverrides,
            ]);
            let availableLocaleData = this.organizeRawLocales(locales);
            let availableRawLocales = availableLocaleData.map;
            let localeDefaults = this.buildLocale(locale || availableLocaleData.defaultCode, availableRawLocales).options;
            let pluginHooks = this.buildPluginHooks(optionOverrides.plugins || [], globalPlugins);
            let refiners = this.currentCalendarOptionsRefiners = Object.assign(Object.assign(Object.assign(Object.assign(Object.assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
            let extra = {};
            let raw = mergeRawOptions([
                BASE_OPTION_DEFAULTS,
                localeDefaults,
                optionOverrides,
                dynamicOptionOverrides,
            ]);
            let refined = {};
            let currentRaw = this.currentCalendarOptionsInput;
            let currentRefined = this.currentCalendarOptionsRefined;
            let anyChanges = false;
            for (let optionName in raw) {
                if (optionName !== 'plugins') { // because plugins is special-cased
                    if (raw[optionName] === currentRaw[optionName] ||
                        (COMPLEX_OPTION_COMPARATORS[optionName] &&
                            (optionName in currentRaw) &&
                            COMPLEX_OPTION_COMPARATORS[optionName](currentRaw[optionName], raw[optionName]))) {
                        refined[optionName] = currentRefined[optionName];
                    }
                    else if (refiners[optionName]) {
                        refined[optionName] = refiners[optionName](raw[optionName]);
                        anyChanges = true;
                    }
                    else {
                        extra[optionName] = currentRaw[optionName];
                    }
                }
            }
            if (anyChanges) {
                this.currentCalendarOptionsInput = raw;
                this.currentCalendarOptionsRefined = refined;
            }
            return {
                rawOptions: this.currentCalendarOptionsInput,
                refinedOptions: this.currentCalendarOptionsRefined,
                pluginHooks,
                availableLocaleData,
                localeDefaults,
                extra,
            };
        }
        _computeCurrentViewData(viewType, optionsData, optionOverrides, dynamicOptionOverrides) {
            let viewSpec = optionsData.viewSpecs[viewType];
            if (!viewSpec) {
                throw new Error(`viewType "${viewType}" is not available. Please make sure you've loaded all neccessary plugins`);
            }
            let { refinedOptions, extra } = this.processRawViewOptions(viewSpec, optionsData.pluginHooks, optionsData.localeDefaults, optionOverrides, dynamicOptionOverrides);
            warnUnknownOptions(extra);
            let dateProfileGenerator = this.buildDateProfileGenerator({
                dateProfileGeneratorClass: viewSpec.optionDefaults.dateProfileGeneratorClass,
                duration: viewSpec.duration,
                durationUnit: viewSpec.durationUnit,
                usesMinMaxTime: viewSpec.optionDefaults.usesMinMaxTime,
                dateEnv: optionsData.dateEnv,
                calendarApi: this.props.calendarApi,
                slotMinTime: refinedOptions.slotMinTime,
                slotMaxTime: refinedOptions.slotMaxTime,
                showNonCurrentDates: refinedOptions.showNonCurrentDates,
                dayCount: refinedOptions.dayCount,
                dateAlignment: refinedOptions.dateAlignment,
                dateIncrement: refinedOptions.dateIncrement,
                hiddenDays: refinedOptions.hiddenDays,
                weekends: refinedOptions.weekends,
                nowInput: refinedOptions.now,
                validRangeInput: refinedOptions.validRange,
                visibleRangeInput: refinedOptions.visibleRange,
                monthMode: refinedOptions.monthMode,
                fixedWeekCount: refinedOptions.fixedWeekCount,
            });
            let viewApi = this.buildViewApi(viewType, this.getCurrentData, optionsData.dateEnv);
            return { viewSpec, options: refinedOptions, dateProfileGenerator, viewApi };
        }
        processRawViewOptions(viewSpec, pluginHooks, localeDefaults, optionOverrides, dynamicOptionOverrides) {
            let raw = mergeRawOptions([
                BASE_OPTION_DEFAULTS,
                viewSpec.optionDefaults,
                localeDefaults,
                optionOverrides,
                viewSpec.optionOverrides,
                dynamicOptionOverrides,
            ]);
            let refiners = Object.assign(Object.assign(Object.assign(Object.assign(Object.assign(Object.assign({}, BASE_OPTION_REFINERS), CALENDAR_LISTENER_REFINERS), CALENDAR_OPTION_REFINERS), VIEW_OPTION_REFINERS), pluginHooks.listenerRefiners), pluginHooks.optionRefiners);
            let refined = {};
            let currentRaw = this.currentViewOptionsInput;
            let currentRefined = this.currentViewOptionsRefined;
            let anyChanges = false;
            let extra = {};
            for (let optionName in raw) {
                if (raw[optionName] === currentRaw[optionName] ||
                    (COMPLEX_OPTION_COMPARATORS[optionName] &&
                        COMPLEX_OPTION_COMPARATORS[optionName](raw[optionName], currentRaw[optionName]))) {
                    refined[optionName] = currentRefined[optionName];
                }
                else {
                    if (raw[optionName] === this.currentCalendarOptionsInput[optionName] ||
                        (COMPLEX_OPTION_COMPARATORS[optionName] &&
                            COMPLEX_OPTION_COMPARATORS[optionName](raw[optionName], this.currentCalendarOptionsInput[optionName]))) {
                        if (optionName in this.currentCalendarOptionsRefined) { // might be an "extra" prop
                            refined[optionName] = this.currentCalendarOptionsRefined[optionName];
                        }
                    }
                    else if (refiners[optionName]) {
                        refined[optionName] = refiners[optionName](raw[optionName]);
                    }
                    else {
                        extra[optionName] = raw[optionName];
                    }
                    anyChanges = true;
                }
            }
            if (anyChanges) {
                this.currentViewOptionsInput = raw;
                this.currentViewOptionsRefined = refined;
            }
            return {
                rawOptions: this.currentViewOptionsInput,
                refinedOptions: this.currentViewOptionsRefined,
                extra,
            };
        }
    }
    function buildDateEnv$1(timeZone, explicitLocale, weekNumberCalculation, firstDay, weekText, pluginHooks, availableLocaleData, defaultSeparator) {
        let locale = buildLocale(explicitLocale || availableLocaleData.defaultCode, availableLocaleData.map);
        return new DateEnv({
            calendarSystem: 'gregory',
            timeZone,
            namedTimeZoneImpl: pluginHooks.namedTimeZonedImpl,
            locale,
            weekNumberCalculation,
            firstDay,
            weekText,
            cmdFormatter: pluginHooks.cmdFormatter,
            defaultSeparator,
        });
    }
    function buildTheme(options, pluginHooks) {
        let ThemeClass = pluginHooks.themeClasses[options.themeSystem] || StandardTheme;
        return new ThemeClass(options);
    }
    function buildDateProfileGenerator(props) {
        let DateProfileGeneratorClass = props.dateProfileGeneratorClass || DateProfileGenerator;
        return new DateProfileGeneratorClass(props);
    }
    function buildViewApi(type, getCurrentData, dateEnv) {
        return new ViewImpl(type, getCurrentData, dateEnv);
    }
    function buildEventUiBySource(eventSources) {
        return mapHash(eventSources, (eventSource) => eventSource.ui);
    }
    function buildEventUiBases(eventDefs, eventUiSingleBase, eventUiBySource) {
        let eventUiBases = { '': eventUiSingleBase };
        for (let defId in eventDefs) {
            let def = eventDefs[defId];
            if (def.sourceId && eventUiBySource[def.sourceId]) {
                eventUiBases[defId] = eventUiBySource[def.sourceId];
            }
        }
        return eventUiBases;
    }
    function buildViewUiProps(calendarContext) {
        let { options } = calendarContext;
        return {
            eventUiSingleBase: createEventUi({
                display: options.eventDisplay,
                editable: options.editable,
                startEditable: options.eventStartEditable,
                durationEditable: options.eventDurationEditable,
                constraint: options.eventConstraint,
                overlap: typeof options.eventOverlap === 'boolean' ? options.eventOverlap : undefined,
                allow: options.eventAllow,
                backgroundColor: options.eventBackgroundColor,
                borderColor: options.eventBorderColor,
                textColor: options.eventTextColor,
                color: options.eventColor,
                // classNames: options.eventClassNames // render hook will handle this
            }, calendarContext),
            selectionConfig: createEventUi({
                constraint: options.selectConstraint,
                overlap: typeof options.selectOverlap === 'boolean' ? options.selectOverlap : undefined,
                allow: options.selectAllow,
            }, calendarContext),
        };
    }
    function computeIsLoading(state, context) {
        for (let isLoadingFunc of context.pluginHooks.isLoadingFuncs) {
            if (isLoadingFunc(state)) {
                return true;
            }
        }
        return false;
    }
    function parseContextBusinessHours(calendarContext) {
        return parseBusinessHours(calendarContext.options.businessHours, calendarContext);
    }
    function warnUnknownOptions(options, viewName) {
        for (let optionName in options) {
            console.warn(`Unknown option '${optionName}'` +
                (viewName ? ` for view '${viewName}'` : ''));
        }
    }

    class ToolbarSection extends BaseComponent {
        render() {
            let children = this.props.widgetGroups.map((widgetGroup) => this.renderWidgetGroup(widgetGroup));
            return h('div', { className: 'fc-toolbar-chunk' }, ...children);
        }
        renderWidgetGroup(widgetGroup) {
            let { props } = this;
            let { theme } = this.context;
            let children = [];
            let isOnlyButtons = true;
            for (let widget of widgetGroup) {
                let { buttonName, buttonClick, buttonText, buttonIcon, buttonHint } = widget;
                if (buttonName === 'title') {
                    isOnlyButtons = false;
                    children.push(h("h2", { className: "fc-toolbar-title", id: props.titleId }, props.title));
                }
                else {
                    let isPressed = buttonName === props.activeButton;
                    let isDisabled = (!props.isTodayEnabled && buttonName === 'today') ||
                        (!props.isPrevEnabled && buttonName === 'prev') ||
                        (!props.isNextEnabled && buttonName === 'next');
                    let buttonClasses = [`fc-${buttonName}-button`, theme.getClass('button')];
                    if (isPressed) {
                        buttonClasses.push(theme.getClass('buttonActive'));
                    }
                    children.push(h("button", { type: "button", title: typeof buttonHint === 'function' ? buttonHint(props.navUnit) : buttonHint, disabled: isDisabled, "aria-pressed": isPressed, className: buttonClasses.join(' '), onClick: buttonClick }, buttonText || (buttonIcon ? h("span", { className: buttonIcon }) : '')));
                }
            }
            if (children.length > 1) {
                let groupClassName = (isOnlyButtons && theme.getClass('buttonGroup')) || '';
                return h('div', { className: groupClassName }, ...children);
            }
            return children[0];
        }
    }

    class Toolbar extends BaseComponent {
        render() {
            let { model, extraClassName } = this.props;
            let forceLtr = false;
            let startContent;
            let endContent;
            let sectionWidgets = model.sectionWidgets;
            let centerContent = sectionWidgets.center;
            if (sectionWidgets.left) {
                forceLtr = true;
                startContent = sectionWidgets.left;
            }
            else {
                startContent = sectionWidgets.start;
            }
            if (sectionWidgets.right) {
                forceLtr = true;
                endContent = sectionWidgets.right;
            }
            else {
                endContent = sectionWidgets.end;
            }
            let classNames = [
                extraClassName || '',
                'fc-toolbar',
                forceLtr ? 'fc-toolbar-ltr' : '',
            ];
            return (h("div", { className: classNames.join(' ') },
                this.renderSection('start', startContent || []),
                this.renderSection('center', centerContent || []),
                this.renderSection('end', endContent || [])));
        }
        renderSection(key, widgetGroups) {
            let { props } = this;
            return (h(ToolbarSection, { key: key, widgetGroups: widgetGroups, title: props.title, navUnit: props.navUnit, activeButton: props.activeButton, isTodayEnabled: props.isTodayEnabled, isPrevEnabled: props.isPrevEnabled, isNextEnabled: props.isNextEnabled, titleId: props.titleId }));
        }
    }

    // TODO: do function component?
    class ViewContainer extends BaseComponent {
        constructor() {
            super(...arguments);
            this.state = {
                availableWidth: null,
            };
            this.handleEl = (el) => {
                this.el = el;
                setRef(this.props.elRef, el);
                this.updateAvailableWidth();
            };
            this.handleResize = () => {
                this.updateAvailableWidth();
            };
        }
        render() {
            let { props, state } = this;
            let { aspectRatio } = props;
            let classNames = [
                'fc-view-harness',
                (aspectRatio || props.liquid || props.height)
                    ? 'fc-view-harness-active' // harness controls the height
                    : 'fc-view-harness-passive', // let the view do the height
            ];
            let height = '';
            let paddingBottom = '';
            if (aspectRatio) {
                if (state.availableWidth !== null) {
                    height = state.availableWidth / aspectRatio;
                }
                else {
                    // while waiting to know availableWidth, we can't set height to *zero*
                    // because will cause lots of unnecessary scrollbars within scrollgrid.
                    // BETTER: don't start rendering ANYTHING yet until we know container width
                    // NOTE: why not always use paddingBottom? Causes height oscillation (issue 5606)
                    paddingBottom = `${(1 / aspectRatio) * 100}%`;
                }
            }
            else {
                height = props.height || '';
            }
            return (h("div", { "aria-labelledby": props.labeledById, ref: this.handleEl, className: classNames.join(' '), style: { height, paddingBottom } }, props.children));
        }
        componentDidMount() {
            this.context.addResizeHandler(this.handleResize);
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleResize);
        }
        updateAvailableWidth() {
            if (this.el && // needed. but why?
                this.props.aspectRatio // aspectRatio is the only height setting that needs availableWidth
            ) {
                this.setState({ availableWidth: this.el.offsetWidth });
            }
        }
    }

    /*
    Detects when the user clicks on an event within a DateComponent
    */
    class EventClicking extends Interaction {
        constructor(settings) {
            super(settings);
            this.handleSegClick = (ev, segEl) => {
                let { component } = this;
                let { context } = component;
                let seg = getElSeg(segEl);
                if (seg && // might be the <div> surrounding the more link
                    component.isValidSegDownEl(ev.target)) {
                    // our way to simulate a link click for elements that can't be <a> tags
                    // grab before trigger fired in case trigger trashes DOM thru rerendering
                    let hasUrlContainer = elementClosest(ev.target, '.fc-event-forced-url');
                    let url = hasUrlContainer ? hasUrlContainer.querySelector('a[href]').href : '';
                    context.emitter.trigger('eventClick', {
                        el: segEl,
                        event: new EventImpl(component.context, seg.eventRange.def, seg.eventRange.instance),
                        jsEvent: ev,
                        view: context.viewApi,
                    });
                    if (url && !ev.defaultPrevented) {
                        window.location.href = url;
                    }
                }
            };
            this.destroy = listenBySelector(settings.el, 'click', '.fc-event', // on both fg and bg events
            this.handleSegClick);
        }
    }

    /*
    Triggers events and adds/removes core classNames when the user's pointer
    enters/leaves event-elements of a component.
    */
    class EventHovering extends Interaction {
        constructor(settings) {
            super(settings);
            // for simulating an eventMouseLeave when the event el is destroyed while mouse is over it
            this.handleEventElRemove = (el) => {
                if (el === this.currentSegEl) {
                    this.handleSegLeave(null, this.currentSegEl);
                }
            };
            this.handleSegEnter = (ev, segEl) => {
                if (getElSeg(segEl)) { // TODO: better way to make sure not hovering over more+ link or its wrapper
                    this.currentSegEl = segEl;
                    this.triggerEvent('eventMouseEnter', ev, segEl);
                }
            };
            this.handleSegLeave = (ev, segEl) => {
                if (this.currentSegEl) {
                    this.currentSegEl = null;
                    this.triggerEvent('eventMouseLeave', ev, segEl);
                }
            };
            this.removeHoverListeners = listenToHoverBySelector(settings.el, '.fc-event', // on both fg and bg events
            this.handleSegEnter, this.handleSegLeave);
        }
        destroy() {
            this.removeHoverListeners();
        }
        triggerEvent(publicEvName, ev, segEl) {
            let { component } = this;
            let { context } = component;
            let seg = getElSeg(segEl);
            if (!ev || component.isValidSegDownEl(ev.target)) {
                context.emitter.trigger(publicEvName, {
                    el: segEl,
                    event: new EventImpl(context, seg.eventRange.def, seg.eventRange.instance),
                    jsEvent: ev,
                    view: context.viewApi,
                });
            }
        }
    }

    class CalendarContent extends PureComponent {
        constructor() {
            super(...arguments);
            this.buildViewContext = memoize(buildViewContext);
            this.buildViewPropTransformers = memoize(buildViewPropTransformers);
            this.buildToolbarProps = memoize(buildToolbarProps);
            this.headerRef = y();
            this.footerRef = y();
            this.interactionsStore = {};
            // eslint-disable-next-line
            this.state = {
                viewLabelId: getUniqueDomId(),
            };
            // Component Registration
            // -----------------------------------------------------------------------------------------------------------------
            this.registerInteractiveComponent = (component, settingsInput) => {
                let settings = parseInteractionSettings(component, settingsInput);
                let DEFAULT_INTERACTIONS = [
                    EventClicking,
                    EventHovering,
                ];
                let interactionClasses = DEFAULT_INTERACTIONS.concat(this.props.pluginHooks.componentInteractions);
                let interactions = interactionClasses.map((TheInteractionClass) => new TheInteractionClass(settings));
                this.interactionsStore[component.uid] = interactions;
                interactionSettingsStore[component.uid] = settings;
            };
            this.unregisterInteractiveComponent = (component) => {
                let listeners = this.interactionsStore[component.uid];
                if (listeners) {
                    for (let listener of listeners) {
                        listener.destroy();
                    }
                    delete this.interactionsStore[component.uid];
                }
                delete interactionSettingsStore[component.uid];
            };
            // Resizing
            // -----------------------------------------------------------------------------------------------------------------
            this.resizeRunner = new DelayedRunner(() => {
                this.props.emitter.trigger('_resize', true); // should window resizes be considered "forced" ?
                this.props.emitter.trigger('windowResize', { view: this.props.viewApi });
            });
            this.handleWindowResize = (ev) => {
                let { options } = this.props;
                if (options.handleWindowResize &&
                    ev.target === window // avoid jqui events
                ) {
                    this.resizeRunner.request(options.windowResizeDelay);
                }
            };
        }
        /*
        renders INSIDE of an outer div
        */
        render() {
            let { props } = this;
            let { toolbarConfig, options } = props;
            let toolbarProps = this.buildToolbarProps(props.viewSpec, props.dateProfile, props.dateProfileGenerator, props.currentDate, getNow(props.options.now, props.dateEnv), // TODO: use NowTimer????
            props.viewTitle);
            let viewVGrow = false;
            let viewHeight = '';
            let viewAspectRatio;
            if (props.isHeightAuto || props.forPrint) {
                viewHeight = '';
            }
            else if (options.height != null) {
                viewVGrow = true;
            }
            else if (options.contentHeight != null) {
                viewHeight = options.contentHeight;
            }
            else {
                viewAspectRatio = Math.max(options.aspectRatio, 0.5); // prevent from getting too tall
            }
            let viewContext = this.buildViewContext(props.viewSpec, props.viewApi, props.options, props.dateProfileGenerator, props.dateEnv, props.theme, props.pluginHooks, props.dispatch, props.getCurrentData, props.emitter, props.calendarApi, this.registerInteractiveComponent, this.unregisterInteractiveComponent);
            let viewLabelId = (toolbarConfig.header && toolbarConfig.header.hasTitle)
                ? this.state.viewLabelId
                : '';
            return (h(ViewContextType.Provider, { value: viewContext },
                toolbarConfig.header && (h(Toolbar, Object.assign({ ref: this.headerRef, extraClassName: "fc-header-toolbar", model: toolbarConfig.header, titleId: viewLabelId }, toolbarProps))),
                h(ViewContainer, { liquid: viewVGrow, height: viewHeight, aspectRatio: viewAspectRatio, labeledById: viewLabelId },
                    this.renderView(props),
                    this.buildAppendContent()),
                toolbarConfig.footer && (h(Toolbar, Object.assign({ ref: this.footerRef, extraClassName: "fc-footer-toolbar", model: toolbarConfig.footer, titleId: "" }, toolbarProps)))));
        }
        componentDidMount() {
            let { props } = this;
            this.calendarInteractions = props.pluginHooks.calendarInteractions
                .map((CalendarInteractionClass) => new CalendarInteractionClass(props));
            window.addEventListener('resize', this.handleWindowResize);
            let { propSetHandlers } = props.pluginHooks;
            for (let propName in propSetHandlers) {
                propSetHandlers[propName](props[propName], props);
            }
        }
        componentDidUpdate(prevProps) {
            let { props } = this;
            let { propSetHandlers } = props.pluginHooks;
            for (let propName in propSetHandlers) {
                if (props[propName] !== prevProps[propName]) {
                    propSetHandlers[propName](props[propName], props);
                }
            }
        }
        componentWillUnmount() {
            window.removeEventListener('resize', this.handleWindowResize);
            this.resizeRunner.clear();
            for (let interaction of this.calendarInteractions) {
                interaction.destroy();
            }
            this.props.emitter.trigger('_unmount');
        }
        buildAppendContent() {
            let { props } = this;
            let children = props.pluginHooks.viewContainerAppends.map((buildAppendContent) => buildAppendContent(props));
            return h(p, {}, ...children);
        }
        renderView(props) {
            let { pluginHooks } = props;
            let { viewSpec } = props;
            let viewProps = {
                dateProfile: props.dateProfile,
                businessHours: props.businessHours,
                eventStore: props.renderableEventStore,
                eventUiBases: props.eventUiBases,
                dateSelection: props.dateSelection,
                eventSelection: props.eventSelection,
                eventDrag: props.eventDrag,
                eventResize: props.eventResize,
                isHeightAuto: props.isHeightAuto,
                forPrint: props.forPrint,
            };
            let transformers = this.buildViewPropTransformers(pluginHooks.viewPropsTransformers);
            for (let transformer of transformers) {
                Object.assign(viewProps, transformer.transform(viewProps, props));
            }
            let ViewComponent = viewSpec.component;
            return (h(ViewComponent, Object.assign({}, viewProps)));
        }
    }
    function buildToolbarProps(viewSpec, dateProfile, dateProfileGenerator, currentDate, now, title) {
        // don't force any date-profiles to valid date profiles (the `false`) so that we can tell if it's invalid
        let todayInfo = dateProfileGenerator.build(now, undefined, false); // TODO: need `undefined` or else INFINITE LOOP for some reason
        let prevInfo = dateProfileGenerator.buildPrev(dateProfile, currentDate, false);
        let nextInfo = dateProfileGenerator.buildNext(dateProfile, currentDate, false);
        return {
            title,
            activeButton: viewSpec.type,
            navUnit: viewSpec.singleUnit,
            isTodayEnabled: todayInfo.isValid && !rangeContainsMarker(dateProfile.currentRange, now),
            isPrevEnabled: prevInfo.isValid,
            isNextEnabled: nextInfo.isValid,
        };
    }
    // Plugin
    // -----------------------------------------------------------------------------------------------------------------
    function buildViewPropTransformers(theClasses) {
        return theClasses.map((TheClass) => new TheClass());
    }

    class Calendar extends CalendarImpl {
        constructor(el, optionOverrides = {}) {
            super();
            this.isRendering = false;
            this.isRendered = false;
            this.currentClassNames = [];
            this.customContentRenderId = 0;
            this.handleAction = (action) => {
                // actions we know we want to render immediately
                switch (action.type) {
                    case 'SET_EVENT_DRAG':
                    case 'SET_EVENT_RESIZE':
                        this.renderRunner.tryDrain();
                }
            };
            this.handleData = (data) => {
                this.currentData = data;
                this.renderRunner.request(data.calendarOptions.rerenderDelay);
            };
            this.handleRenderRequest = () => {
                if (this.isRendering) {
                    this.isRendered = true;
                    let { currentData } = this;
                    flushSync(() => {
                        P$1(h(CalendarRoot, { options: currentData.calendarOptions, theme: currentData.theme, emitter: currentData.emitter }, (classNames, height, isHeightAuto, forPrint) => {
                            this.setClassNames(classNames);
                            this.setHeight(height);
                            return (h(RenderId.Provider, { value: this.customContentRenderId },
                                h(CalendarContent, Object.assign({ isHeightAuto: isHeightAuto, forPrint: forPrint }, currentData))));
                        }), this.el);
                    });
                }
                else if (this.isRendered) {
                    this.isRendered = false;
                    P$1(null, this.el);
                    this.setClassNames([]);
                    this.setHeight('');
                }
            };
            this.el = el;
            this.renderRunner = new DelayedRunner(this.handleRenderRequest);
            new CalendarDataManager({
                optionOverrides,
                calendarApi: this,
                onAction: this.handleAction,
                onData: this.handleData,
            });
        }
        render() {
            let wasRendering = this.isRendering;
            if (!wasRendering) {
                this.isRendering = true;
            }
            else {
                this.customContentRenderId += 1;
            }
            this.renderRunner.request();
            if (wasRendering) {
                this.updateSize();
            }
        }
        destroy() {
            if (this.isRendering) {
                this.isRendering = false;
                this.renderRunner.request();
            }
        }
        updateSize() {
            flushSync(() => {
                super.updateSize();
            });
        }
        batchRendering(func) {
            this.renderRunner.pause('batchRendering');
            func();
            this.renderRunner.resume('batchRendering');
        }
        pauseRendering() {
            this.renderRunner.pause('pauseRendering');
        }
        resumeRendering() {
            this.renderRunner.resume('pauseRendering', true);
        }
        resetOptions(optionOverrides, append) {
            this.currentDataManager.resetOptions(optionOverrides, append);
        }
        setClassNames(classNames) {
            if (!isArraysEqual(classNames, this.currentClassNames)) {
                let { classList } = this.el;
                for (let className of this.currentClassNames) {
                    classList.remove(className);
                }
                for (let className of classNames) {
                    classList.add(className);
                }
                this.currentClassNames = classNames;
            }
        }
        setHeight(height) {
            applyStyleProp(this.el, 'height', height);
        }
    }

    function formatDate(dateInput, options = {}) {
        let dateEnv = buildDateEnv(options);
        let formatter = createFormatter(options);
        let dateMeta = dateEnv.createMarkerMeta(dateInput);
        if (!dateMeta) { // TODO: warning?
            return '';
        }
        return dateEnv.format(dateMeta.marker, formatter, {
            forcedTzo: dateMeta.forcedTzo,
        });
    }
    function formatRange(startInput, endInput, options) {
        let dateEnv = buildDateEnv(typeof options === 'object' && options ? options : {}); // pass in if non-null object
        let formatter = createFormatter(options);
        let startMeta = dateEnv.createMarkerMeta(startInput);
        let endMeta = dateEnv.createMarkerMeta(endInput);
        if (!startMeta || !endMeta) { // TODO: warning?
            return '';
        }
        return dateEnv.formatRange(startMeta.marker, endMeta.marker, formatter, {
            forcedStartTzo: startMeta.forcedTzo,
            forcedEndTzo: endMeta.forcedTzo,
            isEndExclusive: options.isEndExclusive,
            defaultSeparator: BASE_OPTION_DEFAULTS.defaultRangeSeparator,
        });
    }
    // TODO: more DRY and optimized
    function buildDateEnv(settings) {
        let locale = buildLocale(settings.locale || 'en', organizeRawLocales([]).map); // TODO: don't hardcode 'en' everywhere
        return new DateEnv(Object.assign(Object.assign({ timeZone: BASE_OPTION_DEFAULTS.timeZone, calendarSystem: 'gregory' }, settings), { locale }));
    }

    // HELPERS
    /*
    if nextDayThreshold is specified, slicing is done in an all-day fashion.
    you can get nextDayThreshold from context.nextDayThreshold
    */
    function sliceEvents(props, allDay) {
        return sliceEventStore(props.eventStore, props.eventUiBases, props.dateProfile.activeRange, allDay ? props.nextDayThreshold : null).fg;
    }

    const version = '6.0.2';

    config.touchMouseIgnoreWait = 500;
    let ignoreMouseDepth = 0;
    let listenerCnt = 0;
    let isWindowTouchMoveCancelled = false;
    /*
    Uses a "pointer" abstraction, which monitors UI events for both mouse and touch.
    Tracks when the pointer "drags" on a certain element, meaning down+move+up.

    Also, tracks if there was touch-scrolling.
    Also, can prevent touch-scrolling from happening.
    Also, can fire pointermove events when scrolling happens underneath, even when no real pointer movement.

    emits:
    - pointerdown
    - pointermove
    - pointerup
    */
    class PointerDragging {
        constructor(containerEl) {
            this.subjectEl = null;
            // options that can be directly assigned by caller
            this.selector = ''; // will cause subjectEl in all emitted events to be this element
            this.handleSelector = '';
            this.shouldIgnoreMove = false;
            this.shouldWatchScroll = true; // for simulating pointermove on scroll
            // internal states
            this.isDragging = false;
            this.isTouchDragging = false;
            this.wasTouchScroll = false;
            // Mouse
            // ----------------------------------------------------------------------------------------------------
            this.handleMouseDown = (ev) => {
                if (!this.shouldIgnoreMouse() &&
                    isPrimaryMouseButton(ev) &&
                    this.tryStart(ev)) {
                    let pev = this.createEventFromMouse(ev, true);
                    this.emitter.trigger('pointerdown', pev);
                    this.initScrollWatch(pev);
                    if (!this.shouldIgnoreMove) {
                        document.addEventListener('mousemove', this.handleMouseMove);
                    }
                    document.addEventListener('mouseup', this.handleMouseUp);
                }
            };
            this.handleMouseMove = (ev) => {
                let pev = this.createEventFromMouse(ev);
                this.recordCoords(pev);
                this.emitter.trigger('pointermove', pev);
            };
            this.handleMouseUp = (ev) => {
                document.removeEventListener('mousemove', this.handleMouseMove);
                document.removeEventListener('mouseup', this.handleMouseUp);
                this.emitter.trigger('pointerup', this.createEventFromMouse(ev));
                this.cleanup(); // call last so that pointerup has access to props
            };
            // Touch
            // ----------------------------------------------------------------------------------------------------
            this.handleTouchStart = (ev) => {
                if (this.tryStart(ev)) {
                    this.isTouchDragging = true;
                    let pev = this.createEventFromTouch(ev, true);
                    this.emitter.trigger('pointerdown', pev);
                    this.initScrollWatch(pev);
                    // unlike mouse, need to attach to target, not document
                    // https://stackoverflow.com/a/45760014
                    let targetEl = ev.target;
                    if (!this.shouldIgnoreMove) {
                        targetEl.addEventListener('touchmove', this.handleTouchMove);
                    }
                    targetEl.addEventListener('touchend', this.handleTouchEnd);
                    targetEl.addEventListener('touchcancel', this.handleTouchEnd); // treat it as a touch end
                    // attach a handler to get called when ANY scroll action happens on the page.
                    // this was impossible to do with normal on/off because 'scroll' doesn't bubble.
                    // http://stackoverflow.com/a/32954565/96342
                    window.addEventListener('scroll', this.handleTouchScroll, true);
                }
            };
            this.handleTouchMove = (ev) => {
                let pev = this.createEventFromTouch(ev);
                this.recordCoords(pev);
                this.emitter.trigger('pointermove', pev);
            };
            this.handleTouchEnd = (ev) => {
                if (this.isDragging) { // done to guard against touchend followed by touchcancel
                    let targetEl = ev.target;
                    targetEl.removeEventListener('touchmove', this.handleTouchMove);
                    targetEl.removeEventListener('touchend', this.handleTouchEnd);
                    targetEl.removeEventListener('touchcancel', this.handleTouchEnd);
                    window.removeEventListener('scroll', this.handleTouchScroll, true); // useCaptured=true
                    this.emitter.trigger('pointerup', this.createEventFromTouch(ev));
                    this.cleanup(); // call last so that pointerup has access to props
                    this.isTouchDragging = false;
                    startIgnoringMouse();
                }
            };
            this.handleTouchScroll = () => {
                this.wasTouchScroll = true;
            };
            this.handleScroll = (ev) => {
                if (!this.shouldIgnoreMove) {
                    let pageX = (window.pageXOffset - this.prevScrollX) + this.prevPageX;
                    let pageY = (window.pageYOffset - this.prevScrollY) + this.prevPageY;
                    this.emitter.trigger('pointermove', {
                        origEvent: ev,
                        isTouch: this.isTouchDragging,
                        subjectEl: this.subjectEl,
                        pageX,
                        pageY,
                        deltaX: pageX - this.origPageX,
                        deltaY: pageY - this.origPageY,
                    });
                }
            };
            this.containerEl = containerEl;
            this.emitter = new Emitter();
            containerEl.addEventListener('mousedown', this.handleMouseDown);
            containerEl.addEventListener('touchstart', this.handleTouchStart, { passive: true });
            listenerCreated();
        }
        destroy() {
            this.containerEl.removeEventListener('mousedown', this.handleMouseDown);
            this.containerEl.removeEventListener('touchstart', this.handleTouchStart, { passive: true });
            listenerDestroyed();
        }
        tryStart(ev) {
            let subjectEl = this.querySubjectEl(ev);
            let downEl = ev.target;
            if (subjectEl &&
                (!this.handleSelector || elementClosest(downEl, this.handleSelector))) {
                this.subjectEl = subjectEl;
                this.isDragging = true; // do this first so cancelTouchScroll will work
                this.wasTouchScroll = false;
                return true;
            }
            return false;
        }
        cleanup() {
            isWindowTouchMoveCancelled = false;
            this.isDragging = false;
            this.subjectEl = null;
            // keep wasTouchScroll around for later access
            this.destroyScrollWatch();
        }
        querySubjectEl(ev) {
            if (this.selector) {
                return elementClosest(ev.target, this.selector);
            }
            return this.containerEl;
        }
        shouldIgnoreMouse() {
            return ignoreMouseDepth || this.isTouchDragging;
        }
        // can be called by user of this class, to cancel touch-based scrolling for the current drag
        cancelTouchScroll() {
            if (this.isDragging) {
                isWindowTouchMoveCancelled = true;
            }
        }
        // Scrolling that simulates pointermoves
        // ----------------------------------------------------------------------------------------------------
        initScrollWatch(ev) {
            if (this.shouldWatchScroll) {
                this.recordCoords(ev);
                window.addEventListener('scroll', this.handleScroll, true); // useCapture=true
            }
        }
        recordCoords(ev) {
            if (this.shouldWatchScroll) {
                this.prevPageX = ev.pageX;
                this.prevPageY = ev.pageY;
                this.prevScrollX = window.pageXOffset;
                this.prevScrollY = window.pageYOffset;
            }
        }
        destroyScrollWatch() {
            if (this.shouldWatchScroll) {
                window.removeEventListener('scroll', this.handleScroll, true); // useCaptured=true
            }
        }
        // Event Normalization
        // ----------------------------------------------------------------------------------------------------
        createEventFromMouse(ev, isFirst) {
            let deltaX = 0;
            let deltaY = 0;
            // TODO: repeat code
            if (isFirst) {
                this.origPageX = ev.pageX;
                this.origPageY = ev.pageY;
            }
            else {
                deltaX = ev.pageX - this.origPageX;
                deltaY = ev.pageY - this.origPageY;
            }
            return {
                origEvent: ev,
                isTouch: false,
                subjectEl: this.subjectEl,
                pageX: ev.pageX,
                pageY: ev.pageY,
                deltaX,
                deltaY,
            };
        }
        createEventFromTouch(ev, isFirst) {
            let touches = ev.touches;
            let pageX;
            let pageY;
            let deltaX = 0;
            let deltaY = 0;
            // if touch coords available, prefer,
            // because FF would give bad ev.pageX ev.pageY
            if (touches && touches.length) {
                pageX = touches[0].pageX;
                pageY = touches[0].pageY;
            }
            else {
                pageX = ev.pageX;
                pageY = ev.pageY;
            }
            // TODO: repeat code
            if (isFirst) {
                this.origPageX = pageX;
                this.origPageY = pageY;
            }
            else {
                deltaX = pageX - this.origPageX;
                deltaY = pageY - this.origPageY;
            }
            return {
                origEvent: ev,
                isTouch: true,
                subjectEl: this.subjectEl,
                pageX,
                pageY,
                deltaX,
                deltaY,
            };
        }
    }
    // Returns a boolean whether this was a left mouse click and no ctrl key (which means right click on Mac)
    function isPrimaryMouseButton(ev) {
        return ev.button === 0 && !ev.ctrlKey;
    }
    // Ignoring fake mouse events generated by touch
    // ----------------------------------------------------------------------------------------------------
    function startIgnoringMouse() {
        ignoreMouseDepth += 1;
        setTimeout(() => {
            ignoreMouseDepth -= 1;
        }, config.touchMouseIgnoreWait);
    }
    // We want to attach touchmove as early as possible for Safari
    // ----------------------------------------------------------------------------------------------------
    function listenerCreated() {
        listenerCnt += 1;
        if (listenerCnt === 1) {
            window.addEventListener('touchmove', onWindowTouchMove, { passive: false });
        }
    }
    function listenerDestroyed() {
        listenerCnt -= 1;
        if (!listenerCnt) {
            window.removeEventListener('touchmove', onWindowTouchMove, { passive: false });
        }
    }
    function onWindowTouchMove(ev) {
        if (isWindowTouchMoveCancelled) {
            ev.preventDefault();
        }
    }

    /*
    An effect in which an element follows the movement of a pointer across the screen.
    The moving element is a clone of some other element.
    Must call start + handleMove + stop.
    */
    class ElementMirror {
        constructor() {
            this.isVisible = false; // must be explicitly enabled
            this.sourceEl = null;
            this.mirrorEl = null;
            this.sourceElRect = null; // screen coords relative to viewport
            // options that can be set directly by caller
            this.parentNode = document.body; // HIGHLY SUGGESTED to set this to sidestep ShadowDOM issues
            this.zIndex = 9999;
            this.revertDuration = 0;
        }
        start(sourceEl, pageX, pageY) {
            this.sourceEl = sourceEl;
            this.sourceElRect = this.sourceEl.getBoundingClientRect();
            this.origScreenX = pageX - window.pageXOffset;
            this.origScreenY = pageY - window.pageYOffset;
            this.deltaX = 0;
            this.deltaY = 0;
            this.updateElPosition();
        }
        handleMove(pageX, pageY) {
            this.deltaX = (pageX - window.pageXOffset) - this.origScreenX;
            this.deltaY = (pageY - window.pageYOffset) - this.origScreenY;
            this.updateElPosition();
        }
        // can be called before start
        setIsVisible(bool) {
            if (bool) {
                if (!this.isVisible) {
                    if (this.mirrorEl) {
                        this.mirrorEl.style.display = '';
                    }
                    this.isVisible = bool; // needs to happen before updateElPosition
                    this.updateElPosition(); // because was not updating the position while invisible
                }
            }
            else if (this.isVisible) {
                if (this.mirrorEl) {
                    this.mirrorEl.style.display = 'none';
                }
                this.isVisible = bool;
            }
        }
        // always async
        stop(needsRevertAnimation, callback) {
            let done = () => {
                this.cleanup();
                callback();
            };
            if (needsRevertAnimation &&
                this.mirrorEl &&
                this.isVisible &&
                this.revertDuration && // if 0, transition won't work
                (this.deltaX || this.deltaY) // if same coords, transition won't work
            ) {
                this.doRevertAnimation(done, this.revertDuration);
            }
            else {
                setTimeout(done, 0);
            }
        }
        doRevertAnimation(callback, revertDuration) {
            let mirrorEl = this.mirrorEl;
            let finalSourceElRect = this.sourceEl.getBoundingClientRect(); // because autoscrolling might have happened
            mirrorEl.style.transition =
                'top ' + revertDuration + 'ms,' +
                    'left ' + revertDuration + 'ms';
            applyStyle(mirrorEl, {
                left: finalSourceElRect.left,
                top: finalSourceElRect.top,
            });
            whenTransitionDone(mirrorEl, () => {
                mirrorEl.style.transition = '';
                callback();
            });
        }
        cleanup() {
            if (this.mirrorEl) {
                removeElement(this.mirrorEl);
                this.mirrorEl = null;
            }
            this.sourceEl = null;
        }
        updateElPosition() {
            if (this.sourceEl && this.isVisible) {
                applyStyle(this.getMirrorEl(), {
                    left: this.sourceElRect.left + this.deltaX,
                    top: this.sourceElRect.top + this.deltaY,
                });
            }
        }
        getMirrorEl() {
            let sourceElRect = this.sourceElRect;
            let mirrorEl = this.mirrorEl;
            if (!mirrorEl) {
                mirrorEl = this.mirrorEl = this.sourceEl.cloneNode(true); // cloneChildren=true
                // we don't want long taps or any mouse interaction causing selection/menus.
                // would use preventSelection(), but that prevents selectstart, causing problems.
                mirrorEl.classList.add('fc-unselectable');
                mirrorEl.classList.add('fc-event-dragging');
                applyStyle(mirrorEl, {
                    position: 'fixed',
                    zIndex: this.zIndex,
                    visibility: '',
                    boxSizing: 'border-box',
                    width: sourceElRect.right - sourceElRect.left,
                    height: sourceElRect.bottom - sourceElRect.top,
                    right: 'auto',
                    bottom: 'auto',
                    margin: 0,
                });
                this.parentNode.appendChild(mirrorEl);
            }
            return mirrorEl;
        }
    }

    /*
    Is a cache for a given element's scroll information (all the info that ScrollController stores)
    in addition the "client rectangle" of the element.. the area within the scrollbars.

    The cache can be in one of two modes:
    - doesListening:false - ignores when the container is scrolled by someone else
    - doesListening:true - watch for scrolling and update the cache
    */
    class ScrollGeomCache extends ScrollController {
        constructor(scrollController, doesListening) {
            super();
            this.handleScroll = () => {
                this.scrollTop = this.scrollController.getScrollTop();
                this.scrollLeft = this.scrollController.getScrollLeft();
                this.handleScrollChange();
            };
            this.scrollController = scrollController;
            this.doesListening = doesListening;
            this.scrollTop = this.origScrollTop = scrollController.getScrollTop();
            this.scrollLeft = this.origScrollLeft = scrollController.getScrollLeft();
            this.scrollWidth = scrollController.getScrollWidth();
            this.scrollHeight = scrollController.getScrollHeight();
            this.clientWidth = scrollController.getClientWidth();
            this.clientHeight = scrollController.getClientHeight();
            this.clientRect = this.computeClientRect(); // do last in case it needs cached values
            if (this.doesListening) {
                this.getEventTarget().addEventListener('scroll', this.handleScroll);
            }
        }
        destroy() {
            if (this.doesListening) {
                this.getEventTarget().removeEventListener('scroll', this.handleScroll);
            }
        }
        getScrollTop() {
            return this.scrollTop;
        }
        getScrollLeft() {
            return this.scrollLeft;
        }
        setScrollTop(top) {
            this.scrollController.setScrollTop(top);
            if (!this.doesListening) {
                // we are not relying on the element to normalize out-of-bounds scroll values
                // so we need to sanitize ourselves
                this.scrollTop = Math.max(Math.min(top, this.getMaxScrollTop()), 0);
                this.handleScrollChange();
            }
        }
        setScrollLeft(top) {
            this.scrollController.setScrollLeft(top);
            if (!this.doesListening) {
                // we are not relying on the element to normalize out-of-bounds scroll values
                // so we need to sanitize ourselves
                this.scrollLeft = Math.max(Math.min(top, this.getMaxScrollLeft()), 0);
                this.handleScrollChange();
            }
        }
        getClientWidth() {
            return this.clientWidth;
        }
        getClientHeight() {
            return this.clientHeight;
        }
        getScrollWidth() {
            return this.scrollWidth;
        }
        getScrollHeight() {
            return this.scrollHeight;
        }
        handleScrollChange() {
        }
    }

    class ElementScrollGeomCache extends ScrollGeomCache {
        constructor(el, doesListening) {
            super(new ElementScrollController(el), doesListening);
        }
        getEventTarget() {
            return this.scrollController.el;
        }
        computeClientRect() {
            return computeInnerRect(this.scrollController.el);
        }
    }

    class WindowScrollGeomCache extends ScrollGeomCache {
        constructor(doesListening) {
            super(new WindowScrollController(), doesListening);
        }
        getEventTarget() {
            return window;
        }
        computeClientRect() {
            return {
                left: this.scrollLeft,
                right: this.scrollLeft + this.clientWidth,
                top: this.scrollTop,
                bottom: this.scrollTop + this.clientHeight,
            };
        }
        // the window is the only scroll object that changes it's rectangle relative
        // to the document's topleft as it scrolls
        handleScrollChange() {
            this.clientRect = this.computeClientRect();
        }
    }

    // If available we are using native "performance" API instead of "Date"
    // Read more about it on MDN:
    // https://developer.mozilla.org/en-US/docs/Web/API/Performance
    const getTime = typeof performance === 'function' ? performance.now : Date.now;
    /*
    For a pointer interaction, automatically scrolls certain scroll containers when the pointer
    approaches the edge.

    The caller must call start + handleMove + stop.
    */
    class AutoScroller {
        constructor() {
            // options that can be set by caller
            this.isEnabled = true;
            this.scrollQuery = [window, '.fc-scroller'];
            this.edgeThreshold = 50; // pixels
            this.maxVelocity = 300; // pixels per second
            // internal state
            this.pointerScreenX = null;
            this.pointerScreenY = null;
            this.isAnimating = false;
            this.scrollCaches = null;
            // protect against the initial pointerdown being too close to an edge and starting the scroll
            this.everMovedUp = false;
            this.everMovedDown = false;
            this.everMovedLeft = false;
            this.everMovedRight = false;
            this.animate = () => {
                if (this.isAnimating) { // wasn't cancelled between animation calls
                    let edge = this.computeBestEdge(this.pointerScreenX + window.pageXOffset, this.pointerScreenY + window.pageYOffset);
                    if (edge) {
                        let now = getTime();
                        this.handleSide(edge, (now - this.msSinceRequest) / 1000);
                        this.requestAnimation(now);
                    }
                    else {
                        this.isAnimating = false; // will stop animation
                    }
                }
            };
        }
        start(pageX, pageY, scrollStartEl) {
            if (this.isEnabled) {
                this.scrollCaches = this.buildCaches(scrollStartEl);
                this.pointerScreenX = null;
                this.pointerScreenY = null;
                this.everMovedUp = false;
                this.everMovedDown = false;
                this.everMovedLeft = false;
                this.everMovedRight = false;
                this.handleMove(pageX, pageY);
            }
        }
        handleMove(pageX, pageY) {
            if (this.isEnabled) {
                let pointerScreenX = pageX - window.pageXOffset;
                let pointerScreenY = pageY - window.pageYOffset;
                let yDelta = this.pointerScreenY === null ? 0 : pointerScreenY - this.pointerScreenY;
                let xDelta = this.pointerScreenX === null ? 0 : pointerScreenX - this.pointerScreenX;
                if (yDelta < 0) {
                    this.everMovedUp = true;
                }
                else if (yDelta > 0) {
                    this.everMovedDown = true;
                }
                if (xDelta < 0) {
                    this.everMovedLeft = true;
                }
                else if (xDelta > 0) {
                    this.everMovedRight = true;
                }
                this.pointerScreenX = pointerScreenX;
                this.pointerScreenY = pointerScreenY;
                if (!this.isAnimating) {
                    this.isAnimating = true;
                    this.requestAnimation(getTime());
                }
            }
        }
        stop() {
            if (this.isEnabled) {
                this.isAnimating = false; // will stop animation
                for (let scrollCache of this.scrollCaches) {
                    scrollCache.destroy();
                }
                this.scrollCaches = null;
            }
        }
        requestAnimation(now) {
            this.msSinceRequest = now;
            requestAnimationFrame(this.animate);
        }
        handleSide(edge, seconds) {
            let { scrollCache } = edge;
            let { edgeThreshold } = this;
            let invDistance = edgeThreshold - edge.distance;
            let velocity = // the closer to the edge, the faster we scroll
             ((invDistance * invDistance) / (edgeThreshold * edgeThreshold)) * // quadratic
                this.maxVelocity * seconds;
            let sign = 1;
            switch (edge.name) {
                case 'left':
                    sign = -1;
                // falls through
                case 'right':
                    scrollCache.setScrollLeft(scrollCache.getScrollLeft() + velocity * sign);
                    break;
                case 'top':
                    sign = -1;
                // falls through
                case 'bottom':
                    scrollCache.setScrollTop(scrollCache.getScrollTop() + velocity * sign);
                    break;
            }
        }
        // left/top are relative to document topleft
        computeBestEdge(left, top) {
            let { edgeThreshold } = this;
            let bestSide = null;
            let scrollCaches = this.scrollCaches || [];
            for (let scrollCache of scrollCaches) {
                let rect = scrollCache.clientRect;
                let leftDist = left - rect.left;
                let rightDist = rect.right - left;
                let topDist = top - rect.top;
                let bottomDist = rect.bottom - top;
                // completely within the rect?
                if (leftDist >= 0 && rightDist >= 0 && topDist >= 0 && bottomDist >= 0) {
                    if (topDist <= edgeThreshold && this.everMovedUp && scrollCache.canScrollUp() &&
                        (!bestSide || bestSide.distance > topDist)) {
                        bestSide = { scrollCache, name: 'top', distance: topDist };
                    }
                    if (bottomDist <= edgeThreshold && this.everMovedDown && scrollCache.canScrollDown() &&
                        (!bestSide || bestSide.distance > bottomDist)) {
                        bestSide = { scrollCache, name: 'bottom', distance: bottomDist };
                    }
                    if (leftDist <= edgeThreshold && this.everMovedLeft && scrollCache.canScrollLeft() &&
                        (!bestSide || bestSide.distance > leftDist)) {
                        bestSide = { scrollCache, name: 'left', distance: leftDist };
                    }
                    if (rightDist <= edgeThreshold && this.everMovedRight && scrollCache.canScrollRight() &&
                        (!bestSide || bestSide.distance > rightDist)) {
                        bestSide = { scrollCache, name: 'right', distance: rightDist };
                    }
                }
            }
            return bestSide;
        }
        buildCaches(scrollStartEl) {
            return this.queryScrollEls(scrollStartEl).map((el) => {
                if (el === window) {
                    return new WindowScrollGeomCache(false); // false = don't listen to user-generated scrolls
                }
                return new ElementScrollGeomCache(el, false); // false = don't listen to user-generated scrolls
            });
        }
        queryScrollEls(scrollStartEl) {
            let els = [];
            for (let query of this.scrollQuery) {
                if (typeof query === 'object') {
                    els.push(query);
                }
                else {
                    els.push(...Array.prototype.slice.call(getElRoot(scrollStartEl).querySelectorAll(query)));
                }
            }
            return els;
        }
    }

    /*
    Monitors dragging on an element. Has a number of high-level features:
    - minimum distance required before dragging
    - minimum wait time ("delay") before dragging
    - a mirror element that follows the pointer
    */
    class FeaturefulElementDragging extends ElementDragging {
        constructor(containerEl, selector) {
            super(containerEl);
            this.containerEl = containerEl;
            // options that can be directly set by caller
            // the caller can also set the PointerDragging's options as well
            this.delay = null;
            this.minDistance = 0;
            this.touchScrollAllowed = true; // prevents drag from starting and blocks scrolling during drag
            this.mirrorNeedsRevert = false;
            this.isInteracting = false; // is the user validly moving the pointer? lasts until pointerup
            this.isDragging = false; // is it INTENTFULLY dragging? lasts until after revert animation
            this.isDelayEnded = false;
            this.isDistanceSurpassed = false;
            this.delayTimeoutId = null;
            this.onPointerDown = (ev) => {
                if (!this.isDragging) { // so new drag doesn't happen while revert animation is going
                    this.isInteracting = true;
                    this.isDelayEnded = false;
                    this.isDistanceSurpassed = false;
                    preventSelection(document.body);
                    preventContextMenu(document.body);
                    // prevent links from being visited if there's an eventual drag.
                    // also prevents selection in older browsers (maybe?).
                    // not necessary for touch, besides, browser would complain about passiveness.
                    if (!ev.isTouch) {
                        ev.origEvent.preventDefault();
                    }
                    this.emitter.trigger('pointerdown', ev);
                    if (this.isInteracting && // not destroyed via pointerdown handler
                        !this.pointer.shouldIgnoreMove) {
                        // actions related to initiating dragstart+dragmove+dragend...
                        this.mirror.setIsVisible(false); // reset. caller must set-visible
                        this.mirror.start(ev.subjectEl, ev.pageX, ev.pageY); // must happen on first pointer down
                        this.startDelay(ev);
                        if (!this.minDistance) {
                            this.handleDistanceSurpassed(ev);
                        }
                    }
                }
            };
            this.onPointerMove = (ev) => {
                if (this.isInteracting) {
                    this.emitter.trigger('pointermove', ev);
                    if (!this.isDistanceSurpassed) {
                        let minDistance = this.minDistance;
                        let distanceSq; // current distance from the origin, squared
                        let { deltaX, deltaY } = ev;
                        distanceSq = deltaX * deltaX + deltaY * deltaY;
                        if (distanceSq >= minDistance * minDistance) { // use pythagorean theorem
                            this.handleDistanceSurpassed(ev);
                        }
                    }
                    if (this.isDragging) {
                        // a real pointer move? (not one simulated by scrolling)
                        if (ev.origEvent.type !== 'scroll') {
                            this.mirror.handleMove(ev.pageX, ev.pageY);
                            this.autoScroller.handleMove(ev.pageX, ev.pageY);
                        }
                        this.emitter.trigger('dragmove', ev);
                    }
                }
            };
            this.onPointerUp = (ev) => {
                if (this.isInteracting) {
                    this.isInteracting = false;
                    allowSelection(document.body);
                    allowContextMenu(document.body);
                    this.emitter.trigger('pointerup', ev); // can potentially set mirrorNeedsRevert
                    if (this.isDragging) {
                        this.autoScroller.stop();
                        this.tryStopDrag(ev); // which will stop the mirror
                    }
                    if (this.delayTimeoutId) {
                        clearTimeout(this.delayTimeoutId);
                        this.delayTimeoutId = null;
                    }
                }
            };
            let pointer = this.pointer = new PointerDragging(containerEl);
            pointer.emitter.on('pointerdown', this.onPointerDown);
            pointer.emitter.on('pointermove', this.onPointerMove);
            pointer.emitter.on('pointerup', this.onPointerUp);
            if (selector) {
                pointer.selector = selector;
            }
            this.mirror = new ElementMirror();
            this.autoScroller = new AutoScroller();
        }
        destroy() {
            this.pointer.destroy();
            // HACK: simulate a pointer-up to end the current drag
            // TODO: fire 'dragend' directly and stop interaction. discourage use of pointerup event (b/c might not fire)
            this.onPointerUp({});
        }
        startDelay(ev) {
            if (typeof this.delay === 'number') {
                this.delayTimeoutId = setTimeout(() => {
                    this.delayTimeoutId = null;
                    this.handleDelayEnd(ev);
                }, this.delay); // not assignable to number!
            }
            else {
                this.handleDelayEnd(ev);
            }
        }
        handleDelayEnd(ev) {
            this.isDelayEnded = true;
            this.tryStartDrag(ev);
        }
        handleDistanceSurpassed(ev) {
            this.isDistanceSurpassed = true;
            this.tryStartDrag(ev);
        }
        tryStartDrag(ev) {
            if (this.isDelayEnded && this.isDistanceSurpassed) {
                if (!this.pointer.wasTouchScroll || this.touchScrollAllowed) {
                    this.isDragging = true;
                    this.mirrorNeedsRevert = false;
                    this.autoScroller.start(ev.pageX, ev.pageY, this.containerEl);
                    this.emitter.trigger('dragstart', ev);
                    if (this.touchScrollAllowed === false) {
                        this.pointer.cancelTouchScroll();
                    }
                }
            }
        }
        tryStopDrag(ev) {
            // .stop() is ALWAYS asynchronous, which we NEED because we want all pointerup events
            // that come from the document to fire beforehand. much more convenient this way.
            this.mirror.stop(this.mirrorNeedsRevert, this.stopDrag.bind(this, ev));
        }
        stopDrag(ev) {
            this.isDragging = false;
            this.emitter.trigger('dragend', ev);
        }
        // fill in the implementations...
        setIgnoreMove(bool) {
            this.pointer.shouldIgnoreMove = bool;
        }
        setMirrorIsVisible(bool) {
            this.mirror.setIsVisible(bool);
        }
        setMirrorNeedsRevert(bool) {
            this.mirrorNeedsRevert = bool;
        }
        setAutoScrollEnabled(bool) {
            this.autoScroller.isEnabled = bool;
        }
    }

    /*
    When this class is instantiated, it records the offset of an element (relative to the document topleft),
    and continues to monitor scrolling, updating the cached coordinates if it needs to.
    Does not access the DOM after instantiation, so highly performant.

    Also keeps track of all scrolling/overflow:hidden containers that are parents of the given element
    and an determine if a given point is inside the combined clipping rectangle.
    */
    class OffsetTracker {
        constructor(el) {
            this.origRect = computeRect(el);
            // will work fine for divs that have overflow:hidden
            this.scrollCaches = getClippingParents(el).map((scrollEl) => new ElementScrollGeomCache(scrollEl, true));
        }
        destroy() {
            for (let scrollCache of this.scrollCaches) {
                scrollCache.destroy();
            }
        }
        computeLeft() {
            let left = this.origRect.left;
            for (let scrollCache of this.scrollCaches) {
                left += scrollCache.origScrollLeft - scrollCache.getScrollLeft();
            }
            return left;
        }
        computeTop() {
            let top = this.origRect.top;
            for (let scrollCache of this.scrollCaches) {
                top += scrollCache.origScrollTop - scrollCache.getScrollTop();
            }
            return top;
        }
        isWithinClipping(pageX, pageY) {
            let point = { left: pageX, top: pageY };
            for (let scrollCache of this.scrollCaches) {
                if (!isIgnoredClipping(scrollCache.getEventTarget()) &&
                    !pointInsideRect(point, scrollCache.clientRect)) {
                    return false;
                }
            }
            return true;
        }
    }
    // certain clipping containers should never constrain interactions, like <html> and <body>
    // https://github.com/fullcalendar/fullcalendar/issues/3615
    function isIgnoredClipping(node) {
        let tagName = node.tagName;
        return tagName === 'HTML' || tagName === 'BODY';
    }

    /*
    Tracks movement over multiple droppable areas (aka "hits")
    that exist in one or more DateComponents.
    Relies on an existing draggable.

    emits:
    - pointerdown
    - dragstart
    - hitchange - fires initially, even if not over a hit
    - pointerup
    - (hitchange - again, to null, if ended over a hit)
    - dragend
    */
    class HitDragging {
        constructor(dragging, droppableStore) {
            // options that can be set by caller
            this.useSubjectCenter = false;
            this.requireInitial = true; // if doesn't start out on a hit, won't emit any events
            this.initialHit = null;
            this.movingHit = null;
            this.finalHit = null; // won't ever be populated if shouldIgnoreMove
            this.handlePointerDown = (ev) => {
                let { dragging } = this;
                this.initialHit = null;
                this.movingHit = null;
                this.finalHit = null;
                this.prepareHits();
                this.processFirstCoord(ev);
                if (this.initialHit || !this.requireInitial) {
                    dragging.setIgnoreMove(false);
                    // TODO: fire this before computing processFirstCoord, so listeners can cancel. this gets fired by almost every handler :(
                    this.emitter.trigger('pointerdown', ev);
                }
                else {
                    dragging.setIgnoreMove(true);
                }
            };
            this.handleDragStart = (ev) => {
                this.emitter.trigger('dragstart', ev);
                this.handleMove(ev, true); // force = fire even if initially null
            };
            this.handleDragMove = (ev) => {
                this.emitter.trigger('dragmove', ev);
                this.handleMove(ev);
            };
            this.handlePointerUp = (ev) => {
                this.releaseHits();
                this.emitter.trigger('pointerup', ev);
            };
            this.handleDragEnd = (ev) => {
                if (this.movingHit) {
                    this.emitter.trigger('hitupdate', null, true, ev);
                }
                this.finalHit = this.movingHit;
                this.movingHit = null;
                this.emitter.trigger('dragend', ev);
            };
            this.droppableStore = droppableStore;
            dragging.emitter.on('pointerdown', this.handlePointerDown);
            dragging.emitter.on('dragstart', this.handleDragStart);
            dragging.emitter.on('dragmove', this.handleDragMove);
            dragging.emitter.on('pointerup', this.handlePointerUp);
            dragging.emitter.on('dragend', this.handleDragEnd);
            this.dragging = dragging;
            this.emitter = new Emitter();
        }
        // sets initialHit
        // sets coordAdjust
        processFirstCoord(ev) {
            let origPoint = { left: ev.pageX, top: ev.pageY };
            let adjustedPoint = origPoint;
            let subjectEl = ev.subjectEl;
            let subjectRect;
            if (subjectEl instanceof HTMLElement) { // i.e. not a Document/ShadowRoot
                subjectRect = computeRect(subjectEl);
                adjustedPoint = constrainPoint(adjustedPoint, subjectRect);
            }
            let initialHit = this.initialHit = this.queryHitForOffset(adjustedPoint.left, adjustedPoint.top);
            if (initialHit) {
                if (this.useSubjectCenter && subjectRect) {
                    let slicedSubjectRect = intersectRects(subjectRect, initialHit.rect);
                    if (slicedSubjectRect) {
                        adjustedPoint = getRectCenter(slicedSubjectRect);
                    }
                }
                this.coordAdjust = diffPoints(adjustedPoint, origPoint);
            }
            else {
                this.coordAdjust = { left: 0, top: 0 };
            }
        }
        handleMove(ev, forceHandle) {
            let hit = this.queryHitForOffset(ev.pageX + this.coordAdjust.left, ev.pageY + this.coordAdjust.top);
            if (forceHandle || !isHitsEqual(this.movingHit, hit)) {
                this.movingHit = hit;
                this.emitter.trigger('hitupdate', hit, false, ev);
            }
        }
        prepareHits() {
            this.offsetTrackers = mapHash(this.droppableStore, (interactionSettings) => {
                interactionSettings.component.prepareHits();
                return new OffsetTracker(interactionSettings.el);
            });
        }
        releaseHits() {
            let { offsetTrackers } = this;
            for (let id in offsetTrackers) {
                offsetTrackers[id].destroy();
            }
            this.offsetTrackers = {};
        }
        queryHitForOffset(offsetLeft, offsetTop) {
            let { droppableStore, offsetTrackers } = this;
            let bestHit = null;
            for (let id in droppableStore) {
                let component = droppableStore[id].component;
                let offsetTracker = offsetTrackers[id];
                if (offsetTracker && // wasn't destroyed mid-drag
                    offsetTracker.isWithinClipping(offsetLeft, offsetTop)) {
                    let originLeft = offsetTracker.computeLeft();
                    let originTop = offsetTracker.computeTop();
                    let positionLeft = offsetLeft - originLeft;
                    let positionTop = offsetTop - originTop;
                    let { origRect } = offsetTracker;
                    let width = origRect.right - origRect.left;
                    let height = origRect.bottom - origRect.top;
                    if (
                    // must be within the element's bounds
                    positionLeft >= 0 && positionLeft < width &&
                        positionTop >= 0 && positionTop < height) {
                        let hit = component.queryHit(positionLeft, positionTop, width, height);
                        if (hit && (
                        // make sure the hit is within activeRange, meaning it's not a dead cell
                        rangeContainsRange(hit.dateProfile.activeRange, hit.dateSpan.range)) &&
                            (!bestHit || hit.layer > bestHit.layer)) {
                            hit.componentId = id;
                            hit.context = component.context;
                            // TODO: better way to re-orient rectangle
                            hit.rect.left += originLeft;
                            hit.rect.right += originLeft;
                            hit.rect.top += originTop;
                            hit.rect.bottom += originTop;
                            bestHit = hit;
                        }
                    }
                }
            }
            return bestHit;
        }
    }
    function isHitsEqual(hit0, hit1) {
        if (!hit0 && !hit1) {
            return true;
        }
        if (Boolean(hit0) !== Boolean(hit1)) {
            return false;
        }
        return isDateSpansEqual(hit0.dateSpan, hit1.dateSpan);
    }

    function buildDatePointApiWithContext(dateSpan, context) {
        let props = {};
        for (let transform of context.pluginHooks.datePointTransforms) {
            Object.assign(props, transform(dateSpan, context));
        }
        Object.assign(props, buildDatePointApi(dateSpan, context.dateEnv));
        return props;
    }
    function buildDatePointApi(span, dateEnv) {
        return {
            date: dateEnv.toDate(span.range.start),
            dateStr: dateEnv.formatIso(span.range.start, { omitTime: span.allDay }),
            allDay: span.allDay,
        };
    }

    /*
    Monitors when the user clicks on a specific date/time of a component.
    A pointerdown+pointerup on the same "hit" constitutes a click.
    */
    class DateClicking extends Interaction {
        constructor(settings) {
            super(settings);
            this.handlePointerDown = (pev) => {
                let { dragging } = this;
                let downEl = pev.origEvent.target;
                // do this in pointerdown (not dragend) because DOM might be mutated by the time dragend is fired
                dragging.setIgnoreMove(!this.component.isValidDateDownEl(downEl));
            };
            // won't even fire if moving was ignored
            this.handleDragEnd = (ev) => {
                let { component } = this;
                let { pointer } = this.dragging;
                if (!pointer.wasTouchScroll) {
                    let { initialHit, finalHit } = this.hitDragging;
                    if (initialHit && finalHit && isHitsEqual(initialHit, finalHit)) {
                        let { context } = component;
                        let arg = Object.assign(Object.assign({}, buildDatePointApiWithContext(initialHit.dateSpan, context)), { dayEl: initialHit.dayEl, jsEvent: ev.origEvent, view: context.viewApi || context.calendarApi.view });
                        context.emitter.trigger('dateClick', arg);
                    }
                }
            };
            // we DO want to watch pointer moves because otherwise finalHit won't get populated
            this.dragging = new FeaturefulElementDragging(settings.el);
            this.dragging.autoScroller.isEnabled = false;
            let hitDragging = this.hitDragging = new HitDragging(this.dragging, interactionSettingsToStore(settings));
            hitDragging.emitter.on('pointerdown', this.handlePointerDown);
            hitDragging.emitter.on('dragend', this.handleDragEnd);
        }
        destroy() {
            this.dragging.destroy();
        }
    }

    /*
    Tracks when the user selects a portion of time of a component,
    constituted by a drag over date cells, with a possible delay at the beginning of the drag.
    */
    class DateSelecting extends Interaction {
        constructor(settings) {
            super(settings);
            this.dragSelection = null;
            this.handlePointerDown = (ev) => {
                let { component, dragging } = this;
                let { options } = component.context;
                let canSelect = options.selectable &&
                    component.isValidDateDownEl(ev.origEvent.target);
                // don't bother to watch expensive moves if component won't do selection
                dragging.setIgnoreMove(!canSelect);
                // if touch, require user to hold down
                dragging.delay = ev.isTouch ? getComponentTouchDelay$1(component) : null;
            };
            this.handleDragStart = (ev) => {
                this.component.context.calendarApi.unselect(ev); // unselect previous selections
            };
            this.handleHitUpdate = (hit, isFinal) => {
                let { context } = this.component;
                let dragSelection = null;
                let isInvalid = false;
                if (hit) {
                    let initialHit = this.hitDragging.initialHit;
                    let disallowed = hit.componentId === initialHit.componentId
                        && this.isHitComboAllowed
                        && !this.isHitComboAllowed(initialHit, hit);
                    if (!disallowed) {
                        dragSelection = joinHitsIntoSelection(initialHit, hit, context.pluginHooks.dateSelectionTransformers);
                    }
                    if (!dragSelection || !isDateSelectionValid(dragSelection, hit.dateProfile, context)) {
                        isInvalid = true;
                        dragSelection = null;
                    }
                }
                if (dragSelection) {
                    context.dispatch({ type: 'SELECT_DATES', selection: dragSelection });
                }
                else if (!isFinal) { // only unselect if moved away while dragging
                    context.dispatch({ type: 'UNSELECT_DATES' });
                }
                if (!isInvalid) {
                    enableCursor();
                }
                else {
                    disableCursor();
                }
                if (!isFinal) {
                    this.dragSelection = dragSelection; // only clear if moved away from all hits while dragging
                }
            };
            this.handlePointerUp = (pev) => {
                if (this.dragSelection) {
                    // selection is already rendered, so just need to report selection
                    triggerDateSelect(this.dragSelection, pev, this.component.context);
                    this.dragSelection = null;
                }
            };
            let { component } = settings;
            let { options } = component.context;
            let dragging = this.dragging = new FeaturefulElementDragging(settings.el);
            dragging.touchScrollAllowed = false;
            dragging.minDistance = options.selectMinDistance || 0;
            dragging.autoScroller.isEnabled = options.dragScroll;
            let hitDragging = this.hitDragging = new HitDragging(this.dragging, interactionSettingsToStore(settings));
            hitDragging.emitter.on('pointerdown', this.handlePointerDown);
            hitDragging.emitter.on('dragstart', this.handleDragStart);
            hitDragging.emitter.on('hitupdate', this.handleHitUpdate);
            hitDragging.emitter.on('pointerup', this.handlePointerUp);
        }
        destroy() {
            this.dragging.destroy();
        }
    }
    function getComponentTouchDelay$1(component) {
        let { options } = component.context;
        let delay = options.selectLongPressDelay;
        if (delay == null) {
            delay = options.longPressDelay;
        }
        return delay;
    }
    function joinHitsIntoSelection(hit0, hit1, dateSelectionTransformers) {
        let dateSpan0 = hit0.dateSpan;
        let dateSpan1 = hit1.dateSpan;
        let ms = [
            dateSpan0.range.start,
            dateSpan0.range.end,
            dateSpan1.range.start,
            dateSpan1.range.end,
        ];
        ms.sort(compareNumbers);
        let props = {};
        for (let transformer of dateSelectionTransformers) {
            let res = transformer(hit0, hit1);
            if (res === false) {
                return null;
            }
            if (res) {
                Object.assign(props, res);
            }
        }
        props.range = { start: ms[0], end: ms[3] };
        props.allDay = dateSpan0.allDay;
        return props;
    }

    class EventDragging extends Interaction {
        constructor(settings) {
            super(settings);
            // internal state
            this.subjectEl = null;
            this.subjectSeg = null; // the seg being selected/dragged
            this.isDragging = false;
            this.eventRange = null;
            this.relevantEvents = null; // the events being dragged
            this.receivingContext = null;
            this.validMutation = null;
            this.mutatedRelevantEvents = null;
            this.handlePointerDown = (ev) => {
                let origTarget = ev.origEvent.target;
                let { component, dragging } = this;
                let { mirror } = dragging;
                let { options } = component.context;
                let initialContext = component.context;
                this.subjectEl = ev.subjectEl;
                let subjectSeg = this.subjectSeg = getElSeg(ev.subjectEl);
                let eventRange = this.eventRange = subjectSeg.eventRange;
                let eventInstanceId = eventRange.instance.instanceId;
                this.relevantEvents = getRelevantEvents(initialContext.getCurrentData().eventStore, eventInstanceId);
                dragging.minDistance = ev.isTouch ? 0 : options.eventDragMinDistance;
                dragging.delay =
                    // only do a touch delay if touch and this event hasn't been selected yet
                    (ev.isTouch && eventInstanceId !== component.props.eventSelection) ?
                        getComponentTouchDelay(component) :
                        null;
                if (options.fixedMirrorParent) {
                    mirror.parentNode = options.fixedMirrorParent;
                }
                else {
                    mirror.parentNode = elementClosest(origTarget, '.fc');
                }
                mirror.revertDuration = options.dragRevertDuration;
                let isValid = component.isValidSegDownEl(origTarget) &&
                    !elementClosest(origTarget, '.fc-event-resizer'); // NOT on a resizer
                dragging.setIgnoreMove(!isValid);
                // disable dragging for elements that are resizable (ie, selectable)
                // but are not draggable
                this.isDragging = isValid &&
                    ev.subjectEl.classList.contains('fc-event-draggable');
            };
            this.handleDragStart = (ev) => {
                let initialContext = this.component.context;
                let eventRange = this.eventRange;
                let eventInstanceId = eventRange.instance.instanceId;
                if (ev.isTouch) {
                    // need to select a different event?
                    if (eventInstanceId !== this.component.props.eventSelection) {
                        initialContext.dispatch({ type: 'SELECT_EVENT', eventInstanceId });
                    }
                }
                else {
                    // if now using mouse, but was previous touch interaction, clear selected event
                    initialContext.dispatch({ type: 'UNSELECT_EVENT' });
                }
                if (this.isDragging) {
                    initialContext.calendarApi.unselect(ev); // unselect *date* selection
                    initialContext.emitter.trigger('eventDragStart', {
                        el: this.subjectEl,
                        event: new EventImpl(initialContext, eventRange.def, eventRange.instance),
                        jsEvent: ev.origEvent,
                        view: initialContext.viewApi,
                    });
                }
            };
            this.handleHitUpdate = (hit, isFinal) => {
                if (!this.isDragging) {
                    return;
                }
                let relevantEvents = this.relevantEvents;
                let initialHit = this.hitDragging.initialHit;
                let initialContext = this.component.context;
                // states based on new hit
                let receivingContext = null;
                let mutation = null;
                let mutatedRelevantEvents = null;
                let isInvalid = false;
                let interaction = {
                    affectedEvents: relevantEvents,
                    mutatedEvents: createEmptyEventStore(),
                    isEvent: true,
                };
                if (hit) {
                    receivingContext = hit.context;
                    let receivingOptions = receivingContext.options;
                    if (initialContext === receivingContext ||
                        (receivingOptions.editable && receivingOptions.droppable)) {
                        mutation = computeEventMutation(initialHit, hit, receivingContext.getCurrentData().pluginHooks.eventDragMutationMassagers);
                        if (mutation) {
                            mutatedRelevantEvents = applyMutationToEventStore(relevantEvents, receivingContext.getCurrentData().eventUiBases, mutation, receivingContext);
                            interaction.mutatedEvents = mutatedRelevantEvents;
                            if (!isInteractionValid(interaction, hit.dateProfile, receivingContext)) {
                                isInvalid = true;
                                mutation = null;
                                mutatedRelevantEvents = null;
                                interaction.mutatedEvents = createEmptyEventStore();
                            }
                        }
                    }
                    else {
                        receivingContext = null;
                    }
                }
                this.displayDrag(receivingContext, interaction);
                if (!isInvalid) {
                    enableCursor();
                }
                else {
                    disableCursor();
                }
                if (!isFinal) {
                    if (initialContext === receivingContext && // TODO: write test for this
                        isHitsEqual(initialHit, hit)) {
                        mutation = null;
                    }
                    this.dragging.setMirrorNeedsRevert(!mutation);
                    // render the mirror if no already-rendered mirror
                    // TODO: wish we could somehow wait for dispatch to guarantee render
                    this.dragging.setMirrorIsVisible(!hit || !getElRoot(this.subjectEl).querySelector('.fc-event-mirror'));
                    // assign states based on new hit
                    this.receivingContext = receivingContext;
                    this.validMutation = mutation;
                    this.mutatedRelevantEvents = mutatedRelevantEvents;
                }
            };
            this.handlePointerUp = () => {
                if (!this.isDragging) {
                    this.cleanup(); // because handleDragEnd won't fire
                }
            };
            this.handleDragEnd = (ev) => {
                if (this.isDragging) {
                    let initialContext = this.component.context;
                    let initialView = initialContext.viewApi;
                    let { receivingContext, validMutation } = this;
                    let eventDef = this.eventRange.def;
                    let eventInstance = this.eventRange.instance;
                    let eventApi = new EventImpl(initialContext, eventDef, eventInstance);
                    let relevantEvents = this.relevantEvents;
                    let mutatedRelevantEvents = this.mutatedRelevantEvents;
                    let { finalHit } = this.hitDragging;
                    this.clearDrag(); // must happen after revert animation
                    initialContext.emitter.trigger('eventDragStop', {
                        el: this.subjectEl,
                        event: eventApi,
                        jsEvent: ev.origEvent,
                        view: initialView,
                    });
                    if (validMutation) {
                        // dropped within same calendar
                        if (receivingContext === initialContext) {
                            let updatedEventApi = new EventImpl(initialContext, mutatedRelevantEvents.defs[eventDef.defId], eventInstance ? mutatedRelevantEvents.instances[eventInstance.instanceId] : null);
                            initialContext.dispatch({
                                type: 'MERGE_EVENTS',
                                eventStore: mutatedRelevantEvents,
                            });
                            let eventChangeArg = {
                                oldEvent: eventApi,
                                event: updatedEventApi,
                                relatedEvents: buildEventApis(mutatedRelevantEvents, initialContext, eventInstance),
                                revert() {
                                    initialContext.dispatch({
                                        type: 'MERGE_EVENTS',
                                        eventStore: relevantEvents, // the pre-change data
                                    });
                                },
                            };
                            let transformed = {};
                            for (let transformer of initialContext.getCurrentData().pluginHooks.eventDropTransformers) {
                                Object.assign(transformed, transformer(validMutation, initialContext));
                            }
                            initialContext.emitter.trigger('eventDrop', Object.assign(Object.assign(Object.assign({}, eventChangeArg), transformed), { el: ev.subjectEl, delta: validMutation.datesDelta, jsEvent: ev.origEvent, view: initialView }));
                            initialContext.emitter.trigger('eventChange', eventChangeArg);
                            // dropped in different calendar
                        }
                        else if (receivingContext) {
                            let eventRemoveArg = {
                                event: eventApi,
                                relatedEvents: buildEventApis(relevantEvents, initialContext, eventInstance),
                                revert() {
                                    initialContext.dispatch({
                                        type: 'MERGE_EVENTS',
                                        eventStore: relevantEvents,
                                    });
                                },
                            };
                            initialContext.emitter.trigger('eventLeave', Object.assign(Object.assign({}, eventRemoveArg), { draggedEl: ev.subjectEl, view: initialView }));
                            initialContext.dispatch({
                                type: 'REMOVE_EVENTS',
                                eventStore: relevantEvents,
                            });
                            initialContext.emitter.trigger('eventRemove', eventRemoveArg);
                            let addedEventDef = mutatedRelevantEvents.defs[eventDef.defId];
                            let addedEventInstance = mutatedRelevantEvents.instances[eventInstance.instanceId];
                            let addedEventApi = new EventImpl(receivingContext, addedEventDef, addedEventInstance);
                            receivingContext.dispatch({
                                type: 'MERGE_EVENTS',
                                eventStore: mutatedRelevantEvents,
                            });
                            let eventAddArg = {
                                event: addedEventApi,
                                relatedEvents: buildEventApis(mutatedRelevantEvents, receivingContext, addedEventInstance),
                                revert() {
                                    receivingContext.dispatch({
                                        type: 'REMOVE_EVENTS',
                                        eventStore: mutatedRelevantEvents,
                                    });
                                },
                            };
                            receivingContext.emitter.trigger('eventAdd', eventAddArg);
                            if (ev.isTouch) {
                                receivingContext.dispatch({
                                    type: 'SELECT_EVENT',
                                    eventInstanceId: eventInstance.instanceId,
                                });
                            }
                            receivingContext.emitter.trigger('drop', Object.assign(Object.assign({}, buildDatePointApiWithContext(finalHit.dateSpan, receivingContext)), { draggedEl: ev.subjectEl, jsEvent: ev.origEvent, view: finalHit.context.viewApi }));
                            receivingContext.emitter.trigger('eventReceive', Object.assign(Object.assign({}, eventAddArg), { draggedEl: ev.subjectEl, view: finalHit.context.viewApi }));
                        }
                    }
                    else {
                        initialContext.emitter.trigger('_noEventDrop');
                    }
                }
                this.cleanup();
            };
            let { component } = this;
            let { options } = component.context;
            let dragging = this.dragging = new FeaturefulElementDragging(settings.el);
            dragging.pointer.selector = EventDragging.SELECTOR;
            dragging.touchScrollAllowed = false;
            dragging.autoScroller.isEnabled = options.dragScroll;
            let hitDragging = this.hitDragging = new HitDragging(this.dragging, interactionSettingsStore);
            hitDragging.useSubjectCenter = settings.useEventCenter;
            hitDragging.emitter.on('pointerdown', this.handlePointerDown);
            hitDragging.emitter.on('dragstart', this.handleDragStart);
            hitDragging.emitter.on('hitupdate', this.handleHitUpdate);
            hitDragging.emitter.on('pointerup', this.handlePointerUp);
            hitDragging.emitter.on('dragend', this.handleDragEnd);
        }
        destroy() {
            this.dragging.destroy();
        }
        // render a drag state on the next receivingCalendar
        displayDrag(nextContext, state) {
            let initialContext = this.component.context;
            let prevContext = this.receivingContext;
            // does the previous calendar need to be cleared?
            if (prevContext && prevContext !== nextContext) {
                // does the initial calendar need to be cleared?
                // if so, don't clear all the way. we still need to to hide the affectedEvents
                if (prevContext === initialContext) {
                    prevContext.dispatch({
                        type: 'SET_EVENT_DRAG',
                        state: {
                            affectedEvents: state.affectedEvents,
                            mutatedEvents: createEmptyEventStore(),
                            isEvent: true,
                        },
                    });
                    // completely clear the old calendar if it wasn't the initial
                }
                else {
                    prevContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
                }
            }
            if (nextContext) {
                nextContext.dispatch({ type: 'SET_EVENT_DRAG', state });
            }
        }
        clearDrag() {
            let initialCalendar = this.component.context;
            let { receivingContext } = this;
            if (receivingContext) {
                receivingContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
            }
            // the initial calendar might have an dummy drag state from displayDrag
            if (initialCalendar !== receivingContext) {
                initialCalendar.dispatch({ type: 'UNSET_EVENT_DRAG' });
            }
        }
        cleanup() {
            this.subjectSeg = null;
            this.isDragging = false;
            this.eventRange = null;
            this.relevantEvents = null;
            this.receivingContext = null;
            this.validMutation = null;
            this.mutatedRelevantEvents = null;
        }
    }
    // TODO: test this in IE11
    // QUESTION: why do we need it on the resizable???
    EventDragging.SELECTOR = '.fc-event-draggable, .fc-event-resizable';
    function computeEventMutation(hit0, hit1, massagers) {
        let dateSpan0 = hit0.dateSpan;
        let dateSpan1 = hit1.dateSpan;
        let date0 = dateSpan0.range.start;
        let date1 = dateSpan1.range.start;
        let standardProps = {};
        if (dateSpan0.allDay !== dateSpan1.allDay) {
            standardProps.allDay = dateSpan1.allDay;
            standardProps.hasEnd = hit1.context.options.allDayMaintainDuration;
            if (dateSpan1.allDay) {
                // means date1 is already start-of-day,
                // but date0 needs to be converted
                date0 = startOfDay(date0);
            }
        }
        let delta = diffDates(date0, date1, hit0.context.dateEnv, hit0.componentId === hit1.componentId ?
            hit0.largeUnit :
            null);
        if (delta.milliseconds) { // has hours/minutes/seconds
            standardProps.allDay = false;
        }
        let mutation = {
            datesDelta: delta,
            standardProps,
        };
        for (let massager of massagers) {
            massager(mutation, hit0, hit1);
        }
        return mutation;
    }
    function getComponentTouchDelay(component) {
        let { options } = component.context;
        let delay = options.eventLongPressDelay;
        if (delay == null) {
            delay = options.longPressDelay;
        }
        return delay;
    }

    class EventResizing extends Interaction {
        constructor(settings) {
            super(settings);
            // internal state
            this.draggingSegEl = null;
            this.draggingSeg = null; // TODO: rename to resizingSeg? subjectSeg?
            this.eventRange = null;
            this.relevantEvents = null;
            this.validMutation = null;
            this.mutatedRelevantEvents = null;
            this.handlePointerDown = (ev) => {
                let { component } = this;
                let segEl = this.querySegEl(ev);
                let seg = getElSeg(segEl);
                let eventRange = this.eventRange = seg.eventRange;
                this.dragging.minDistance = component.context.options.eventDragMinDistance;
                // if touch, need to be working with a selected event
                this.dragging.setIgnoreMove(!this.component.isValidSegDownEl(ev.origEvent.target) ||
                    (ev.isTouch && this.component.props.eventSelection !== eventRange.instance.instanceId));
            };
            this.handleDragStart = (ev) => {
                let { context } = this.component;
                let eventRange = this.eventRange;
                this.relevantEvents = getRelevantEvents(context.getCurrentData().eventStore, this.eventRange.instance.instanceId);
                let segEl = this.querySegEl(ev);
                this.draggingSegEl = segEl;
                this.draggingSeg = getElSeg(segEl);
                context.calendarApi.unselect();
                context.emitter.trigger('eventResizeStart', {
                    el: segEl,
                    event: new EventImpl(context, eventRange.def, eventRange.instance),
                    jsEvent: ev.origEvent,
                    view: context.viewApi,
                });
            };
            this.handleHitUpdate = (hit, isFinal, ev) => {
                let { context } = this.component;
                let relevantEvents = this.relevantEvents;
                let initialHit = this.hitDragging.initialHit;
                let eventInstance = this.eventRange.instance;
                let mutation = null;
                let mutatedRelevantEvents = null;
                let isInvalid = false;
                let interaction = {
                    affectedEvents: relevantEvents,
                    mutatedEvents: createEmptyEventStore(),
                    isEvent: true,
                };
                if (hit) {
                    let disallowed = hit.componentId === initialHit.componentId
                        && this.isHitComboAllowed
                        && !this.isHitComboAllowed(initialHit, hit);
                    if (!disallowed) {
                        mutation = computeMutation(initialHit, hit, ev.subjectEl.classList.contains('fc-event-resizer-start'), eventInstance.range);
                    }
                }
                if (mutation) {
                    mutatedRelevantEvents = applyMutationToEventStore(relevantEvents, context.getCurrentData().eventUiBases, mutation, context);
                    interaction.mutatedEvents = mutatedRelevantEvents;
                    if (!isInteractionValid(interaction, hit.dateProfile, context)) {
                        isInvalid = true;
                        mutation = null;
                        mutatedRelevantEvents = null;
                        interaction.mutatedEvents = null;
                    }
                }
                if (mutatedRelevantEvents) {
                    context.dispatch({
                        type: 'SET_EVENT_RESIZE',
                        state: interaction,
                    });
                }
                else {
                    context.dispatch({ type: 'UNSET_EVENT_RESIZE' });
                }
                if (!isInvalid) {
                    enableCursor();
                }
                else {
                    disableCursor();
                }
                if (!isFinal) {
                    if (mutation && isHitsEqual(initialHit, hit)) {
                        mutation = null;
                    }
                    this.validMutation = mutation;
                    this.mutatedRelevantEvents = mutatedRelevantEvents;
                }
            };
            this.handleDragEnd = (ev) => {
                let { context } = this.component;
                let eventDef = this.eventRange.def;
                let eventInstance = this.eventRange.instance;
                let eventApi = new EventImpl(context, eventDef, eventInstance);
                let relevantEvents = this.relevantEvents;
                let mutatedRelevantEvents = this.mutatedRelevantEvents;
                context.emitter.trigger('eventResizeStop', {
                    el: this.draggingSegEl,
                    event: eventApi,
                    jsEvent: ev.origEvent,
                    view: context.viewApi,
                });
                if (this.validMutation) {
                    let updatedEventApi = new EventImpl(context, mutatedRelevantEvents.defs[eventDef.defId], eventInstance ? mutatedRelevantEvents.instances[eventInstance.instanceId] : null);
                    context.dispatch({
                        type: 'MERGE_EVENTS',
                        eventStore: mutatedRelevantEvents,
                    });
                    let eventChangeArg = {
                        oldEvent: eventApi,
                        event: updatedEventApi,
                        relatedEvents: buildEventApis(mutatedRelevantEvents, context, eventInstance),
                        revert() {
                            context.dispatch({
                                type: 'MERGE_EVENTS',
                                eventStore: relevantEvents, // the pre-change events
                            });
                        },
                    };
                    context.emitter.trigger('eventResize', Object.assign(Object.assign({}, eventChangeArg), { el: this.draggingSegEl, startDelta: this.validMutation.startDelta || createDuration(0), endDelta: this.validMutation.endDelta || createDuration(0), jsEvent: ev.origEvent, view: context.viewApi }));
                    context.emitter.trigger('eventChange', eventChangeArg);
                }
                else {
                    context.emitter.trigger('_noEventResize');
                }
                // reset all internal state
                this.draggingSeg = null;
                this.relevantEvents = null;
                this.validMutation = null;
                // okay to keep eventInstance around. useful to set it in handlePointerDown
            };
            let { component } = settings;
            let dragging = this.dragging = new FeaturefulElementDragging(settings.el);
            dragging.pointer.selector = '.fc-event-resizer';
            dragging.touchScrollAllowed = false;
            dragging.autoScroller.isEnabled = component.context.options.dragScroll;
            let hitDragging = this.hitDragging = new HitDragging(this.dragging, interactionSettingsToStore(settings));
            hitDragging.emitter.on('pointerdown', this.handlePointerDown);
            hitDragging.emitter.on('dragstart', this.handleDragStart);
            hitDragging.emitter.on('hitupdate', this.handleHitUpdate);
            hitDragging.emitter.on('dragend', this.handleDragEnd);
        }
        destroy() {
            this.dragging.destroy();
        }
        querySegEl(ev) {
            return elementClosest(ev.subjectEl, '.fc-event');
        }
    }
    function computeMutation(hit0, hit1, isFromStart, instanceRange) {
        let dateEnv = hit0.context.dateEnv;
        let date0 = hit0.dateSpan.range.start;
        let date1 = hit1.dateSpan.range.start;
        let delta = diffDates(date0, date1, dateEnv, hit0.largeUnit);
        if (isFromStart) {
            if (dateEnv.add(instanceRange.start, delta) < instanceRange.end) {
                return { startDelta: delta };
            }
        }
        else if (dateEnv.add(instanceRange.end, delta) > instanceRange.start) {
            return { endDelta: delta };
        }
        return null;
    }

    class UnselectAuto {
        constructor(context) {
            this.context = context;
            this.isRecentPointerDateSelect = false; // wish we could use a selector to detect date selection, but uses hit system
            this.matchesCancel = false;
            this.matchesEvent = false;
            this.onSelect = (selectInfo) => {
                if (selectInfo.jsEvent) {
                    this.isRecentPointerDateSelect = true;
                }
            };
            this.onDocumentPointerDown = (pev) => {
                let unselectCancel = this.context.options.unselectCancel;
                let downEl = getEventTargetViaRoot(pev.origEvent);
                this.matchesCancel = !!elementClosest(downEl, unselectCancel);
                this.matchesEvent = !!elementClosest(downEl, EventDragging.SELECTOR); // interaction started on an event?
            };
            this.onDocumentPointerUp = (pev) => {
                let { context } = this;
                let { documentPointer } = this;
                let calendarState = context.getCurrentData();
                // touch-scrolling should never unfocus any type of selection
                if (!documentPointer.wasTouchScroll) {
                    if (calendarState.dateSelection && // an existing date selection?
                        !this.isRecentPointerDateSelect // a new pointer-initiated date selection since last onDocumentPointerUp?
                    ) {
                        let unselectAuto = context.options.unselectAuto;
                        if (unselectAuto && (!unselectAuto || !this.matchesCancel)) {
                            context.calendarApi.unselect(pev);
                        }
                    }
                    if (calendarState.eventSelection && // an existing event selected?
                        !this.matchesEvent // interaction DIDN'T start on an event
                    ) {
                        context.dispatch({ type: 'UNSELECT_EVENT' });
                    }
                }
                this.isRecentPointerDateSelect = false;
            };
            let documentPointer = this.documentPointer = new PointerDragging(document);
            documentPointer.shouldIgnoreMove = true;
            documentPointer.shouldWatchScroll = false;
            documentPointer.emitter.on('pointerdown', this.onDocumentPointerDown);
            documentPointer.emitter.on('pointerup', this.onDocumentPointerUp);
            /*
            TODO: better way to know about whether there was a selection with the pointer
            */
            context.emitter.on('select', this.onSelect);
        }
        destroy() {
            this.context.emitter.off('select', this.onSelect);
            this.documentPointer.destroy();
        }
    }

    const OPTION_REFINERS$4 = {
        fixedMirrorParent: identity,
    };
    const LISTENER_REFINERS$1 = {
        dateClick: identity,
        eventDragStart: identity,
        eventDragStop: identity,
        eventDrop: identity,
        eventResizeStart: identity,
        eventResizeStop: identity,
        eventResize: identity,
        drop: identity,
        eventReceive: identity,
        eventLeave: identity,
    };

    /*
    Given an already instantiated draggable object for one-or-more elements,
    Interprets any dragging as an attempt to drag an events that lives outside
    of a calendar onto a calendar.
    */
    class ExternalElementDragging {
        constructor(dragging, suppliedDragMeta) {
            this.receivingContext = null;
            this.droppableEvent = null; // will exist for all drags, even if create:false
            this.suppliedDragMeta = null;
            this.dragMeta = null;
            this.handleDragStart = (ev) => {
                this.dragMeta = this.buildDragMeta(ev.subjectEl);
            };
            this.handleHitUpdate = (hit, isFinal, ev) => {
                let { dragging } = this.hitDragging;
                let receivingContext = null;
                let droppableEvent = null;
                let isInvalid = false;
                let interaction = {
                    affectedEvents: createEmptyEventStore(),
                    mutatedEvents: createEmptyEventStore(),
                    isEvent: this.dragMeta.create,
                };
                if (hit) {
                    receivingContext = hit.context;
                    if (this.canDropElOnCalendar(ev.subjectEl, receivingContext)) {
                        droppableEvent = computeEventForDateSpan(hit.dateSpan, this.dragMeta, receivingContext);
                        interaction.mutatedEvents = eventTupleToStore(droppableEvent);
                        isInvalid = !isInteractionValid(interaction, hit.dateProfile, receivingContext);
                        if (isInvalid) {
                            interaction.mutatedEvents = createEmptyEventStore();
                            droppableEvent = null;
                        }
                    }
                }
                this.displayDrag(receivingContext, interaction);
                // show mirror if no already-rendered mirror element OR if we are shutting down the mirror (?)
                // TODO: wish we could somehow wait for dispatch to guarantee render
                dragging.setMirrorIsVisible(isFinal || !droppableEvent || !document.querySelector('.fc-event-mirror'));
                if (!isInvalid) {
                    enableCursor();
                }
                else {
                    disableCursor();
                }
                if (!isFinal) {
                    dragging.setMirrorNeedsRevert(!droppableEvent);
                    this.receivingContext = receivingContext;
                    this.droppableEvent = droppableEvent;
                }
            };
            this.handleDragEnd = (pev) => {
                let { receivingContext, droppableEvent } = this;
                this.clearDrag();
                if (receivingContext && droppableEvent) {
                    let finalHit = this.hitDragging.finalHit;
                    let finalView = finalHit.context.viewApi;
                    let dragMeta = this.dragMeta;
                    receivingContext.emitter.trigger('drop', Object.assign(Object.assign({}, buildDatePointApiWithContext(finalHit.dateSpan, receivingContext)), { draggedEl: pev.subjectEl, jsEvent: pev.origEvent, view: finalView }));
                    if (dragMeta.create) {
                        let addingEvents = eventTupleToStore(droppableEvent);
                        receivingContext.dispatch({
                            type: 'MERGE_EVENTS',
                            eventStore: addingEvents,
                        });
                        if (pev.isTouch) {
                            receivingContext.dispatch({
                                type: 'SELECT_EVENT',
                                eventInstanceId: droppableEvent.instance.instanceId,
                            });
                        }
                        // signal that an external event landed
                        receivingContext.emitter.trigger('eventReceive', {
                            event: new EventImpl(receivingContext, droppableEvent.def, droppableEvent.instance),
                            relatedEvents: [],
                            revert() {
                                receivingContext.dispatch({
                                    type: 'REMOVE_EVENTS',
                                    eventStore: addingEvents,
                                });
                            },
                            draggedEl: pev.subjectEl,
                            view: finalView,
                        });
                    }
                }
                this.receivingContext = null;
                this.droppableEvent = null;
            };
            let hitDragging = this.hitDragging = new HitDragging(dragging, interactionSettingsStore);
            hitDragging.requireInitial = false; // will start outside of a component
            hitDragging.emitter.on('dragstart', this.handleDragStart);
            hitDragging.emitter.on('hitupdate', this.handleHitUpdate);
            hitDragging.emitter.on('dragend', this.handleDragEnd);
            this.suppliedDragMeta = suppliedDragMeta;
        }
        buildDragMeta(subjectEl) {
            if (typeof this.suppliedDragMeta === 'object') {
                return parseDragMeta(this.suppliedDragMeta);
            }
            if (typeof this.suppliedDragMeta === 'function') {
                return parseDragMeta(this.suppliedDragMeta(subjectEl));
            }
            return getDragMetaFromEl(subjectEl);
        }
        displayDrag(nextContext, state) {
            let prevContext = this.receivingContext;
            if (prevContext && prevContext !== nextContext) {
                prevContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
            }
            if (nextContext) {
                nextContext.dispatch({ type: 'SET_EVENT_DRAG', state });
            }
        }
        clearDrag() {
            if (this.receivingContext) {
                this.receivingContext.dispatch({ type: 'UNSET_EVENT_DRAG' });
            }
        }
        canDropElOnCalendar(el, receivingContext) {
            let dropAccept = receivingContext.options.dropAccept;
            if (typeof dropAccept === 'function') {
                return dropAccept.call(receivingContext.calendarApi, el);
            }
            if (typeof dropAccept === 'string' && dropAccept) {
                return Boolean(elementMatches(el, dropAccept));
            }
            return true;
        }
    }
    // Utils for computing event store from the DragMeta
    // ----------------------------------------------------------------------------------------------------
    function computeEventForDateSpan(dateSpan, dragMeta, context) {
        let defProps = Object.assign({}, dragMeta.leftoverProps);
        for (let transform of context.pluginHooks.externalDefTransforms) {
            Object.assign(defProps, transform(dateSpan, dragMeta));
        }
        let { refined, extra } = refineEventDef(defProps, context);
        let def = parseEventDef(refined, extra, dragMeta.sourceId, dateSpan.allDay, context.options.forceEventDuration || Boolean(dragMeta.duration), // hasEnd
        context);
        let start = dateSpan.range.start;
        // only rely on time info if drop zone is all-day,
        // otherwise, we already know the time
        if (dateSpan.allDay && dragMeta.startTime) {
            start = context.dateEnv.add(start, dragMeta.startTime);
        }
        let end = dragMeta.duration ?
            context.dateEnv.add(start, dragMeta.duration) :
            getDefaultEventEnd(dateSpan.allDay, start, context);
        let instance = createEventInstance(def.defId, { start, end });
        return { def, instance };
    }
    // Utils for extracting data from element
    // ----------------------------------------------------------------------------------------------------
    function getDragMetaFromEl(el) {
        let str = getEmbeddedElData(el, 'event');
        let obj = str ?
            JSON.parse(str) :
            { create: false }; // if no embedded data, assume no event creation
        return parseDragMeta(obj);
    }
    config.dataAttrPrefix = '';
    function getEmbeddedElData(el, name) {
        let prefix = config.dataAttrPrefix;
        let prefixedName = (prefix ? prefix + '-' : '') + name;
        return el.getAttribute('data-' + prefixedName) || '';
    }

    /*
    Makes an element (that is *external* to any calendar) draggable.
    Can pass in data that determines how an event will be created when dropped onto a calendar.
    Leverages FullCalendar's internal drag-n-drop functionality WITHOUT a third-party drag system.
    */
    class ExternalDraggable {
        constructor(el, settings = {}) {
            this.handlePointerDown = (ev) => {
                let { dragging } = this;
                let { minDistance, longPressDelay } = this.settings;
                dragging.minDistance =
                    minDistance != null ?
                        minDistance :
                        (ev.isTouch ? 0 : BASE_OPTION_DEFAULTS.eventDragMinDistance);
                dragging.delay =
                    ev.isTouch ? // TODO: eventually read eventLongPressDelay instead vvv
                        (longPressDelay != null ? longPressDelay : BASE_OPTION_DEFAULTS.longPressDelay) :
                        0;
            };
            this.handleDragStart = (ev) => {
                if (ev.isTouch &&
                    this.dragging.delay &&
                    ev.subjectEl.classList.contains('fc-event')) {
                    this.dragging.mirror.getMirrorEl().classList.add('fc-event-selected');
                }
            };
            this.settings = settings;
            let dragging = this.dragging = new FeaturefulElementDragging(el);
            dragging.touchScrollAllowed = false;
            if (settings.itemSelector != null) {
                dragging.pointer.selector = settings.itemSelector;
            }
            if (settings.appendTo != null) {
                dragging.mirror.parentNode = settings.appendTo; // TODO: write tests
            }
            dragging.emitter.on('pointerdown', this.handlePointerDown);
            dragging.emitter.on('dragstart', this.handleDragStart);
            new ExternalElementDragging(dragging, settings.eventData); // eslint-disable-line no-new
        }
        destroy() {
            this.dragging.destroy();
        }
    }

    /*
    Detects when a *THIRD-PARTY* drag-n-drop system interacts with elements.
    The third-party system is responsible for drawing the visuals effects of the drag.
    This class simply monitors for pointer movements and fires events.
    It also has the ability to hide the moving element (the "mirror") during the drag.
    */
    class InferredElementDragging extends ElementDragging {
        constructor(containerEl) {
            super(containerEl);
            this.shouldIgnoreMove = false;
            this.mirrorSelector = '';
            this.currentMirrorEl = null;
            this.handlePointerDown = (ev) => {
                this.emitter.trigger('pointerdown', ev);
                if (!this.shouldIgnoreMove) {
                    // fire dragstart right away. does not support delay or min-distance
                    this.emitter.trigger('dragstart', ev);
                }
            };
            this.handlePointerMove = (ev) => {
                if (!this.shouldIgnoreMove) {
                    this.emitter.trigger('dragmove', ev);
                }
            };
            this.handlePointerUp = (ev) => {
                this.emitter.trigger('pointerup', ev);
                if (!this.shouldIgnoreMove) {
                    // fire dragend right away. does not support a revert animation
                    this.emitter.trigger('dragend', ev);
                }
            };
            let pointer = this.pointer = new PointerDragging(containerEl);
            pointer.emitter.on('pointerdown', this.handlePointerDown);
            pointer.emitter.on('pointermove', this.handlePointerMove);
            pointer.emitter.on('pointerup', this.handlePointerUp);
        }
        destroy() {
            this.pointer.destroy();
        }
        setIgnoreMove(bool) {
            this.shouldIgnoreMove = bool;
        }
        setMirrorIsVisible(bool) {
            if (bool) {
                // restore a previously hidden element.
                // use the reference in case the selector class has already been removed.
                if (this.currentMirrorEl) {
                    this.currentMirrorEl.style.visibility = '';
                    this.currentMirrorEl = null;
                }
            }
            else {
                let mirrorEl = this.mirrorSelector
                    // TODO: somehow query FullCalendars WITHIN shadow-roots
                    ? document.querySelector(this.mirrorSelector)
                    : null;
                if (mirrorEl) {
                    this.currentMirrorEl = mirrorEl;
                    mirrorEl.style.visibility = 'hidden';
                }
            }
        }
    }

    /*
    Bridges third-party drag-n-drop systems with FullCalendar.
    Must be instantiated and destroyed by caller.
    */
    class ThirdPartyDraggable {
        constructor(containerOrSettings, settings) {
            let containerEl = document;
            if (
            // wish we could just test instanceof EventTarget, but doesn't work in IE11
            containerOrSettings === document ||
                containerOrSettings instanceof Element) {
                containerEl = containerOrSettings;
                settings = settings || {};
            }
            else {
                settings = (containerOrSettings || {});
            }
            let dragging = this.dragging = new InferredElementDragging(containerEl);
            if (typeof settings.itemSelector === 'string') {
                dragging.pointer.selector = settings.itemSelector;
            }
            else if (containerEl === document) {
                dragging.pointer.selector = '[data-event]';
            }
            if (typeof settings.mirrorSelector === 'string') {
                dragging.mirrorSelector = settings.mirrorSelector;
            }
            new ExternalElementDragging(dragging, settings.eventData); // eslint-disable-line no-new
        }
        destroy() {
            this.dragging.destroy();
        }
    }

    var index$b = createPlugin({
        name: '@fullcalendar/interaction',
        componentInteractions: [DateClicking, DateSelecting, EventDragging, EventResizing],
        calendarInteractions: [UnselectAuto],
        elementDraggingImpl: FeaturefulElementDragging,
        optionRefiners: OPTION_REFINERS$4,
        listenerRefiners: LISTENER_REFINERS$1,
    });

    /* An abstract class for the daygrid views, as well as month view. Renders one or more rows of day cells.
    ----------------------------------------------------------------------------------------------------------------------*/
    // It is a manager for a Table subcomponent, which does most of the heavy lifting.
    // It is responsible for managing width/height.
    class TableView extends DateComponent {
        constructor() {
            super(...arguments);
            this.headerElRef = y();
        }
        renderSimpleLayout(headerRowContent, bodyContent) {
            let { props, context } = this;
            let sections = [];
            let stickyHeaderDates = getStickyHeaderDates(context.options);
            if (headerRowContent) {
                sections.push({
                    type: 'header',
                    key: 'header',
                    isSticky: stickyHeaderDates,
                    chunk: {
                        elRef: this.headerElRef,
                        tableClassName: 'fc-col-header',
                        rowContent: headerRowContent,
                    },
                });
            }
            sections.push({
                type: 'body',
                key: 'body',
                liquid: true,
                chunk: { content: bodyContent },
            });
            return (h(ViewContainer$1, { elClasses: ['fc-daygrid'], viewSpec: context.viewSpec },
                h(SimpleScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, cols: [] /* TODO: make optional? */, sections: sections })));
        }
        renderHScrollLayout(headerRowContent, bodyContent, colCnt, dayMinWidth) {
            let ScrollGrid = this.context.pluginHooks.scrollGridImpl;
            if (!ScrollGrid) {
                throw new Error('No ScrollGrid implementation');
            }
            let { props, context } = this;
            let stickyHeaderDates = !props.forPrint && getStickyHeaderDates(context.options);
            let stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(context.options);
            let sections = [];
            if (headerRowContent) {
                sections.push({
                    type: 'header',
                    key: 'header',
                    isSticky: stickyHeaderDates,
                    chunks: [{
                            key: 'main',
                            elRef: this.headerElRef,
                            tableClassName: 'fc-col-header',
                            rowContent: headerRowContent,
                        }],
                });
            }
            sections.push({
                type: 'body',
                key: 'body',
                liquid: true,
                chunks: [{
                        key: 'main',
                        content: bodyContent,
                    }],
            });
            if (stickyFooterScrollbar) {
                sections.push({
                    type: 'footer',
                    key: 'footer',
                    isSticky: true,
                    chunks: [{
                            key: 'main',
                            content: renderScrollShim,
                        }],
                });
            }
            return (h(ViewContainer$1, { elClasses: ['fc-daygrid'], viewSpec: context.viewSpec },
                h(ScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, colGroups: [{ cols: [{ span: colCnt, minWidth: dayMinWidth }] }], sections: sections })));
        }
    }

    function splitSegsByRow(segs, rowCnt) {
        let byRow = [];
        for (let i = 0; i < rowCnt; i += 1) {
            byRow[i] = [];
        }
        for (let seg of segs) {
            byRow[seg.row].push(seg);
        }
        return byRow;
    }
    function splitSegsByFirstCol(segs, colCnt) {
        let byCol = [];
        for (let i = 0; i < colCnt; i += 1) {
            byCol[i] = [];
        }
        for (let seg of segs) {
            byCol[seg.firstCol].push(seg);
        }
        return byCol;
    }
    function splitInteractionByRow(ui, rowCnt) {
        let byRow = [];
        if (!ui) {
            for (let i = 0; i < rowCnt; i += 1) {
                byRow[i] = null;
            }
        }
        else {
            for (let i = 0; i < rowCnt; i += 1) {
                byRow[i] = {
                    affectedInstances: ui.affectedInstances,
                    isEvent: ui.isEvent,
                    segs: [],
                };
            }
            for (let seg of ui.segs) {
                byRow[seg.row].segs.push(seg);
            }
        }
        return byRow;
    }

    const DEFAULT_TABLE_EVENT_TIME_FORMAT = createFormatter({
        hour: 'numeric',
        minute: '2-digit',
        omitZeroMinute: true,
        meridiem: 'narrow',
    });
    function hasListItemDisplay(seg) {
        let { display } = seg.eventRange.ui;
        return display === 'list-item' || (display === 'auto' &&
            !seg.eventRange.def.allDay &&
            seg.firstCol === seg.lastCol && // can't be multi-day
            seg.isStart && // "
            seg.isEnd // "
        );
    }

    class TableBlockEvent extends BaseComponent {
        render() {
            let { props } = this;
            return (h(StandardEvent, Object.assign({}, props, { elClasses: ['fc-daygrid-event', 'fc-daygrid-block-event', 'fc-h-event'], defaultTimeFormat: DEFAULT_TABLE_EVENT_TIME_FORMAT, defaultDisplayEventEnd: props.defaultDisplayEventEnd, disableResizing: !props.seg.eventRange.def.allDay })));
        }
    }

    class TableListItemEvent extends BaseComponent {
        render() {
            let { props, context } = this;
            let { options } = context;
            let { seg } = props;
            let timeFormat = options.eventTimeFormat || DEFAULT_TABLE_EVENT_TIME_FORMAT;
            let timeText = buildSegTimeText(seg, timeFormat, context, true, props.defaultDisplayEventEnd);
            return (h(EventContainer, Object.assign({}, props, { elTag: "a", elClasses: ['fc-daygrid-event', 'fc-daygrid-dot-event'], elAttrs: getSegAnchorAttrs(props.seg, context), defaultGenerator: renderInnerContent$4, timeText: timeText, isResizing: false, isDateSelecting: false })));
        }
    }
    function renderInnerContent$4(renderProps) {
        return (h(p, null,
            h("div", { className: "fc-daygrid-event-dot", style: { borderColor: renderProps.borderColor || renderProps.backgroundColor } }),
            renderProps.timeText && (h("div", { className: "fc-event-time" }, renderProps.timeText)),
            h("div", { className: "fc-event-title" }, renderProps.event.title || h(p, null, "\u00A0"))));
    }

    class TableCellMoreLink extends BaseComponent {
        constructor() {
            super(...arguments);
            this.compileSegs = memoize(compileSegs);
        }
        render() {
            let { props } = this;
            let { allSegs, invisibleSegs } = this.compileSegs(props.singlePlacements);
            return (h(MoreLinkContainer, { elClasses: ['fc-daygrid-more-link'], dateProfile: props.dateProfile, todayRange: props.todayRange, allDayDate: props.allDayDate, moreCnt: props.moreCnt, allSegs: allSegs, hiddenSegs: invisibleSegs, alignmentElRef: props.alignmentElRef, alignGridTop: props.alignGridTop, extraDateSpan: props.extraDateSpan, popoverContent: () => {
                    let isForcedInvisible = (props.eventDrag ? props.eventDrag.affectedInstances : null) ||
                        (props.eventResize ? props.eventResize.affectedInstances : null) ||
                        {};
                    return (h(p, null, allSegs.map((seg) => {
                        let instanceId = seg.eventRange.instance.instanceId;
                        return (h("div", { className: "fc-daygrid-event-harness", key: instanceId, style: {
                                visibility: isForcedInvisible[instanceId] ? 'hidden' : '',
                            } }, hasListItemDisplay(seg) ? (h(TableListItemEvent, Object.assign({ seg: seg, isDragging: false, isSelected: instanceId === props.eventSelection, defaultDisplayEventEnd: false }, getSegMeta(seg, props.todayRange)))) : (h(TableBlockEvent, Object.assign({ seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === props.eventSelection, defaultDisplayEventEnd: false }, getSegMeta(seg, props.todayRange))))));
                    })));
                } }));
        }
    }
    function compileSegs(singlePlacements) {
        let allSegs = [];
        let invisibleSegs = [];
        for (let placement of singlePlacements) {
            allSegs.push(placement.seg);
            if (!placement.isVisible) {
                invisibleSegs.push(placement.seg);
            }
        }
        return { allSegs, invisibleSegs };
    }

    const DEFAULT_WEEK_NUM_FORMAT$1 = createFormatter({ week: 'narrow' });
    class TableCell extends DateComponent {
        constructor() {
            super(...arguments);
            this.rootElRef = y();
            this.state = {
                dayNumberId: getUniqueDomId(),
            };
            this.handleRootEl = (el) => {
                setRef(this.rootElRef, el);
                setRef(this.props.elRef, el);
            };
        }
        render() {
            let { context, props, state, rootElRef } = this;
            let { options } = context;
            let { date, dateProfile } = props;
            return (h(DayCellContainer, { elTag: "td", elRef: this.handleRootEl, elClasses: [
                    'fc-daygrid-day',
                    ...(props.extraClassNames || []),
                ], elAttrs: Object.assign(Object.assign(Object.assign({}, props.extraDataAttrs), (props.showDayNumber ? { 'aria-labelledby': state.dayNumberId } : {})), { role: 'gridcell' }), defaultGenerator: renderTopInner, date: date, dateProfile: dateProfile, todayRange: props.todayRange, showDayNumber: props.showDayNumber, extraRenderProps: props.extraRenderProps }, (InnerContent, renderProps) => (h("div", { className: "fc-daygrid-day-frame fc-scrollgrid-sync-inner", ref: props.innerElRef },
                props.showWeekNumber && (h(WeekNumberContainer, { elTag: "a", elClasses: ['fc-daygrid-week-number'], elAttrs: buildNavLinkAttrs(context, date, 'week'), date: date, defaultFormat: DEFAULT_WEEK_NUM_FORMAT$1 })),
                Boolean(!renderProps.isDisabled &&
                    (props.showDayNumber || hasCustomDayCellContent(options) || props.forceDayTop)) && (h("div", { className: "fc-daygrid-day-top" },
                    h(InnerContent, { elTag: "a", elClasses: ['fc-daygrid-day-number'], elAttrs: Object.assign(Object.assign({}, buildNavLinkAttrs(context, date)), { id: state.dayNumberId }) }))),
                h("div", { className: "fc-daygrid-day-events", ref: props.fgContentElRef },
                    props.fgContent,
                    h("div", { className: "fc-daygrid-day-bottom", style: { marginTop: props.moreMarginTop } },
                        h(TableCellMoreLink, { allDayDate: date, singlePlacements: props.singlePlacements, moreCnt: props.moreCnt, alignmentElRef: rootElRef, alignGridTop: !props.showDayNumber, extraDateSpan: props.extraDateSpan, dateProfile: props.dateProfile, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, todayRange: props.todayRange }))),
                h("div", { className: "fc-daygrid-day-bg" }, props.bgContent)))));
        }
    }
    function renderTopInner(props) {
        return props.dayNumberText || h(p, null, "\u00A0");
    }

    function computeFgSegPlacement(segs, // assumed already sorted
    dayMaxEvents, dayMaxEventRows, strictOrder, eventInstanceHeights, maxContentHeight, cells) {
        let hierarchy = new DayGridSegHierarchy();
        hierarchy.allowReslicing = true;
        hierarchy.strictOrder = strictOrder;
        if (dayMaxEvents === true || dayMaxEventRows === true) {
            hierarchy.maxCoord = maxContentHeight;
            hierarchy.hiddenConsumes = true;
        }
        else if (typeof dayMaxEvents === 'number') {
            hierarchy.maxStackCnt = dayMaxEvents;
        }
        else if (typeof dayMaxEventRows === 'number') {
            hierarchy.maxStackCnt = dayMaxEventRows;
            hierarchy.hiddenConsumes = true;
        }
        // create segInputs only for segs with known heights
        let segInputs = [];
        let unknownHeightSegs = [];
        for (let i = 0; i < segs.length; i += 1) {
            let seg = segs[i];
            let { instanceId } = seg.eventRange.instance;
            let eventHeight = eventInstanceHeights[instanceId];
            if (eventHeight != null) {
                segInputs.push({
                    index: i,
                    thickness: eventHeight,
                    span: {
                        start: seg.firstCol,
                        end: seg.lastCol + 1,
                    },
                });
            }
            else {
                unknownHeightSegs.push(seg);
            }
        }
        let hiddenEntries = hierarchy.addSegs(segInputs);
        let segRects = hierarchy.toRects();
        let { singleColPlacements, multiColPlacements, leftoverMargins } = placeRects(segRects, segs, cells);
        let moreCnts = [];
        let moreMarginTops = [];
        // add segs with unknown heights
        for (let seg of unknownHeightSegs) {
            multiColPlacements[seg.firstCol].push({
                seg,
                isVisible: false,
                isAbsolute: true,
                absoluteTop: 0,
                marginTop: 0,
            });
            for (let col = seg.firstCol; col <= seg.lastCol; col += 1) {
                singleColPlacements[col].push({
                    seg: resliceSeg(seg, col, col + 1, cells),
                    isVisible: false,
                    isAbsolute: false,
                    absoluteTop: 0,
                    marginTop: 0,
                });
            }
        }
        // add the hidden entries
        for (let col = 0; col < cells.length; col += 1) {
            moreCnts.push(0);
        }
        for (let hiddenEntry of hiddenEntries) {
            let seg = segs[hiddenEntry.index];
            let hiddenSpan = hiddenEntry.span;
            multiColPlacements[hiddenSpan.start].push({
                seg: resliceSeg(seg, hiddenSpan.start, hiddenSpan.end, cells),
                isVisible: false,
                isAbsolute: true,
                absoluteTop: 0,
                marginTop: 0,
            });
            for (let col = hiddenSpan.start; col < hiddenSpan.end; col += 1) {
                moreCnts[col] += 1;
                singleColPlacements[col].push({
                    seg: resliceSeg(seg, col, col + 1, cells),
                    isVisible: false,
                    isAbsolute: false,
                    absoluteTop: 0,
                    marginTop: 0,
                });
            }
        }
        // deal with leftover margins
        for (let col = 0; col < cells.length; col += 1) {
            moreMarginTops.push(leftoverMargins[col]);
        }
        return { singleColPlacements, multiColPlacements, moreCnts, moreMarginTops };
    }
    // rects ordered by top coord, then left
    function placeRects(allRects, segs, cells) {
        let rectsByEachCol = groupRectsByEachCol(allRects, cells.length);
        let singleColPlacements = [];
        let multiColPlacements = [];
        let leftoverMargins = [];
        for (let col = 0; col < cells.length; col += 1) {
            let rects = rectsByEachCol[col];
            // compute all static segs in singlePlacements
            let singlePlacements = [];
            let currentHeight = 0;
            let currentMarginTop = 0;
            for (let rect of rects) {
                let seg = segs[rect.index];
                singlePlacements.push({
                    seg: resliceSeg(seg, col, col + 1, cells),
                    isVisible: true,
                    isAbsolute: false,
                    absoluteTop: rect.levelCoord,
                    marginTop: rect.levelCoord - currentHeight,
                });
                currentHeight = rect.levelCoord + rect.thickness;
            }
            // compute mixed static/absolute segs in multiPlacements
            let multiPlacements = [];
            currentHeight = 0;
            currentMarginTop = 0;
            for (let rect of rects) {
                let seg = segs[rect.index];
                let isAbsolute = rect.span.end - rect.span.start > 1; // multi-column?
                let isFirstCol = rect.span.start === col;
                currentMarginTop += rect.levelCoord - currentHeight; // amount of space since bottom of previous seg
                currentHeight = rect.levelCoord + rect.thickness; // height will now be bottom of current seg
                if (isAbsolute) {
                    currentMarginTop += rect.thickness;
                    if (isFirstCol) {
                        multiPlacements.push({
                            seg: resliceSeg(seg, rect.span.start, rect.span.end, cells),
                            isVisible: true,
                            isAbsolute: true,
                            absoluteTop: rect.levelCoord,
                            marginTop: 0,
                        });
                    }
                }
                else if (isFirstCol) {
                    multiPlacements.push({
                        seg: resliceSeg(seg, rect.span.start, rect.span.end, cells),
                        isVisible: true,
                        isAbsolute: false,
                        absoluteTop: rect.levelCoord,
                        marginTop: currentMarginTop, // claim the margin
                    });
                    currentMarginTop = 0;
                }
            }
            singleColPlacements.push(singlePlacements);
            multiColPlacements.push(multiPlacements);
            leftoverMargins.push(currentMarginTop);
        }
        return { singleColPlacements, multiColPlacements, leftoverMargins };
    }
    function groupRectsByEachCol(rects, colCnt) {
        let rectsByEachCol = [];
        for (let col = 0; col < colCnt; col += 1) {
            rectsByEachCol.push([]);
        }
        for (let rect of rects) {
            for (let col = rect.span.start; col < rect.span.end; col += 1) {
                rectsByEachCol[col].push(rect);
            }
        }
        return rectsByEachCol;
    }
    function resliceSeg(seg, spanStart, spanEnd, cells) {
        if (seg.firstCol === spanStart && seg.lastCol === spanEnd - 1) {
            return seg;
        }
        let eventRange = seg.eventRange;
        let origRange = eventRange.range;
        let slicedRange = intersectRanges(origRange, {
            start: cells[spanStart].date,
            end: addDays(cells[spanEnd - 1].date, 1),
        });
        return Object.assign(Object.assign({}, seg), { firstCol: spanStart, lastCol: spanEnd - 1, eventRange: {
                def: eventRange.def,
                ui: Object.assign(Object.assign({}, eventRange.ui), { durationEditable: false }),
                instance: eventRange.instance,
                range: slicedRange,
            }, isStart: seg.isStart && slicedRange.start.valueOf() === origRange.start.valueOf(), isEnd: seg.isEnd && slicedRange.end.valueOf() === origRange.end.valueOf() });
    }
    class DayGridSegHierarchy extends SegHierarchy {
        constructor() {
            super(...arguments);
            // config
            this.hiddenConsumes = false;
            // allows us to keep hidden entries in the hierarchy so they take up space
            this.forceHidden = {};
        }
        addSegs(segInputs) {
            const hiddenSegs = super.addSegs(segInputs);
            const { entriesByLevel } = this;
            const excludeHidden = (entry) => !this.forceHidden[buildEntryKey(entry)];
            // remove the forced-hidden segs
            for (let level = 0; level < entriesByLevel.length; level += 1) {
                entriesByLevel[level] = entriesByLevel[level].filter(excludeHidden);
            }
            return hiddenSegs;
        }
        handleInvalidInsertion(insertion, entry, hiddenEntries) {
            const { entriesByLevel, forceHidden } = this;
            const { touchingEntry, touchingLevel, touchingLateral } = insertion;
            if (this.hiddenConsumes && touchingEntry) {
                const touchingEntryId = buildEntryKey(touchingEntry);
                // if not already hidden
                if (!forceHidden[touchingEntryId]) {
                    if (this.allowReslicing) {
                        const placeholderEntry = Object.assign(Object.assign({}, touchingEntry), { span: intersectSpans(touchingEntry.span, entry.span) });
                        const placeholderEntryId = buildEntryKey(placeholderEntry);
                        forceHidden[placeholderEntryId] = true;
                        entriesByLevel[touchingLevel][touchingLateral] = placeholderEntry; // replace touchingEntry with our placeholder
                        this.splitEntry(touchingEntry, entry, hiddenEntries); // split up the touchingEntry, reinsert it
                    }
                    else {
                        forceHidden[touchingEntryId] = true;
                        hiddenEntries.push(touchingEntry);
                    }
                }
            }
            return super.handleInvalidInsertion(insertion, entry, hiddenEntries);
        }
    }

    class TableRow extends DateComponent {
        constructor() {
            super(...arguments);
            this.cellElRefs = new RefMap(); // the <td>
            this.frameElRefs = new RefMap(); // the fc-daygrid-day-frame
            this.fgElRefs = new RefMap(); // the fc-daygrid-day-events
            this.segHarnessRefs = new RefMap(); // indexed by "instanceId:firstCol"
            this.rootElRef = y();
            this.state = {
                framePositions: null,
                maxContentHeight: null,
                eventInstanceHeights: {},
            };
            this.handleResize = (isForced) => {
                if (isForced) {
                    this.updateSizing(true); // isExternal=true
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let { options } = context;
            let colCnt = props.cells.length;
            let businessHoursByCol = splitSegsByFirstCol(props.businessHourSegs, colCnt);
            let bgEventSegsByCol = splitSegsByFirstCol(props.bgEventSegs, colCnt);
            let highlightSegsByCol = splitSegsByFirstCol(this.getHighlightSegs(), colCnt);
            let mirrorSegsByCol = splitSegsByFirstCol(this.getMirrorSegs(), colCnt);
            let { singleColPlacements, multiColPlacements, moreCnts, moreMarginTops } = computeFgSegPlacement(sortEventSegs(props.fgEventSegs, options.eventOrder), props.dayMaxEvents, props.dayMaxEventRows, options.eventOrderStrict, state.eventInstanceHeights, state.maxContentHeight, props.cells);
            let isForcedInvisible = // TODO: messy way to compute this
             (props.eventDrag && props.eventDrag.affectedInstances) ||
                (props.eventResize && props.eventResize.affectedInstances) ||
                {};
            return (h("tr", { ref: this.rootElRef, role: "row" },
                props.renderIntro && props.renderIntro(),
                props.cells.map((cell, col) => {
                    let normalFgNodes = this.renderFgSegs(col, props.forPrint ? singleColPlacements[col] : multiColPlacements[col], props.todayRange, isForcedInvisible);
                    let mirrorFgNodes = this.renderFgSegs(col, buildMirrorPlacements$1(mirrorSegsByCol[col], multiColPlacements), props.todayRange, {}, Boolean(props.eventDrag), Boolean(props.eventResize), false);
                    return (h(TableCell, { key: cell.key, elRef: this.cellElRefs.createRef(cell.key), innerElRef: this.frameElRefs.createRef(cell.key) /* FF <td> problem, but okay to use for left/right. TODO: rename prop */, dateProfile: props.dateProfile, date: cell.date, showDayNumber: props.showDayNumbers, showWeekNumber: props.showWeekNumbers && col === 0, forceDayTop: props.showWeekNumbers /* even displaying weeknum for row, not necessarily day */, todayRange: props.todayRange, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, extraRenderProps: cell.extraRenderProps, extraDataAttrs: cell.extraDataAttrs, extraClassNames: cell.extraClassNames, extraDateSpan: cell.extraDateSpan, moreCnt: moreCnts[col], moreMarginTop: moreMarginTops[col], singlePlacements: singleColPlacements[col], fgContentElRef: this.fgElRefs.createRef(cell.key), fgContent: ( // Fragment scopes the keys
                        h(p, null,
                            h(p, null, normalFgNodes),
                            h(p, null, mirrorFgNodes))), bgContent: ( // Fragment scopes the keys
                        h(p, null,
                            this.renderFillSegs(highlightSegsByCol[col], 'highlight'),
                            this.renderFillSegs(businessHoursByCol[col], 'non-business'),
                            this.renderFillSegs(bgEventSegsByCol[col], 'bg-event'))) }));
                })));
        }
        componentDidMount() {
            this.updateSizing(true);
            this.context.addResizeHandler(this.handleResize);
        }
        componentDidUpdate(prevProps, prevState) {
            let currentProps = this.props;
            this.updateSizing(!isPropsEqual(prevProps, currentProps));
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleResize);
        }
        getHighlightSegs() {
            let { props } = this;
            if (props.eventDrag && props.eventDrag.segs.length) { // messy check
                return props.eventDrag.segs;
            }
            if (props.eventResize && props.eventResize.segs.length) { // messy check
                return props.eventResize.segs;
            }
            return props.dateSelectionSegs;
        }
        getMirrorSegs() {
            let { props } = this;
            if (props.eventResize && props.eventResize.segs.length) { // messy check
                return props.eventResize.segs;
            }
            return [];
        }
        renderFgSegs(col, segPlacements, todayRange, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
            let { context } = this;
            let { eventSelection } = this.props;
            let { framePositions } = this.state;
            let defaultDisplayEventEnd = this.props.cells.length === 1; // colCnt === 1
            let isMirror = isDragging || isResizing || isDateSelecting;
            let nodes = [];
            if (framePositions) {
                for (let placement of segPlacements) {
                    let { seg } = placement;
                    let { instanceId } = seg.eventRange.instance;
                    let key = instanceId + ':' + col;
                    let isVisible = placement.isVisible && !isForcedInvisible[instanceId];
                    let isAbsolute = placement.isAbsolute;
                    let left = '';
                    let right = '';
                    if (isAbsolute) {
                        if (context.isRtl) {
                            right = 0;
                            left = framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol];
                        }
                        else {
                            left = 0;
                            right = framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol];
                        }
                    }
                    /*
                    known bug: events that are force to be list-item but span multiple days still take up space in later columns
                    todo: in print view, for multi-day events, don't display title within non-start/end segs
                    */
                    nodes.push(h("div", { className: 'fc-daygrid-event-harness' + (isAbsolute ? ' fc-daygrid-event-harness-abs' : ''), key: key, ref: isMirror ? null : this.segHarnessRefs.createRef(key), style: {
                            visibility: isVisible ? '' : 'hidden',
                            marginTop: isAbsolute ? '' : placement.marginTop,
                            top: isAbsolute ? placement.absoluteTop : '',
                            left,
                            right,
                        } }, hasListItemDisplay(seg) ? (h(TableListItemEvent, Object.assign({ seg: seg, isDragging: isDragging, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange)))) : (h(TableBlockEvent, Object.assign({ seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === eventSelection, defaultDisplayEventEnd: defaultDisplayEventEnd }, getSegMeta(seg, todayRange))))));
                }
            }
            return nodes;
        }
        renderFillSegs(segs, fillType) {
            let { isRtl } = this.context;
            let { todayRange } = this.props;
            let { framePositions } = this.state;
            let nodes = [];
            if (framePositions) {
                for (let seg of segs) {
                    let leftRightCss = isRtl ? {
                        right: 0,
                        left: framePositions.lefts[seg.lastCol] - framePositions.lefts[seg.firstCol],
                    } : {
                        left: 0,
                        right: framePositions.rights[seg.firstCol] - framePositions.rights[seg.lastCol],
                    };
                    nodes.push(h("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-daygrid-bg-harness", style: leftRightCss }, fillType === 'bg-event' ?
                        h(BgEvent, Object.assign({ seg: seg }, getSegMeta(seg, todayRange))) :
                        renderFill(fillType)));
                }
            }
            return h(p, {}, ...nodes);
        }
        updateSizing(isExternalSizingChange) {
            let { props, frameElRefs } = this;
            if (!props.forPrint &&
                props.clientWidth !== null // positioning ready?
            ) {
                if (isExternalSizingChange) {
                    let frameEls = props.cells.map((cell) => frameElRefs.currentMap[cell.key]);
                    if (frameEls.length) {
                        let originEl = this.rootElRef.current;
                        this.setState({
                            framePositions: new PositionCache(originEl, frameEls, true, // isHorizontal
                            false),
                        });
                    }
                }
                const oldInstanceHeights = this.state.eventInstanceHeights;
                const newInstanceHeights = this.queryEventInstanceHeights();
                const limitByContentHeight = props.dayMaxEvents === true || props.dayMaxEventRows === true;
                this.safeSetState({
                    // HACK to prevent oscillations of events being shown/hidden from max-event-rows
                    // Essentially, once you compute an element's height, never null-out.
                    // TODO: always display all events, as visibility:hidden?
                    eventInstanceHeights: Object.assign(Object.assign({}, oldInstanceHeights), newInstanceHeights),
                    maxContentHeight: limitByContentHeight ? this.computeMaxContentHeight() : null,
                });
            }
        }
        queryEventInstanceHeights() {
            let segElMap = this.segHarnessRefs.currentMap;
            let eventInstanceHeights = {};
            // get the max height amongst instance segs
            for (let key in segElMap) {
                let height = Math.round(segElMap[key].getBoundingClientRect().height);
                let instanceId = key.split(':')[0]; // deconstruct how renderFgSegs makes the key
                eventInstanceHeights[instanceId] = Math.max(eventInstanceHeights[instanceId] || 0, height);
            }
            return eventInstanceHeights;
        }
        computeMaxContentHeight() {
            let firstKey = this.props.cells[0].key;
            let cellEl = this.cellElRefs.currentMap[firstKey];
            let fcContainerEl = this.fgElRefs.currentMap[firstKey];
            return cellEl.getBoundingClientRect().bottom - fcContainerEl.getBoundingClientRect().top;
        }
        getCellEls() {
            let elMap = this.cellElRefs.currentMap;
            return this.props.cells.map((cell) => elMap[cell.key]);
        }
    }
    TableRow.addStateEquality({
        eventInstanceHeights: isPropsEqual,
    });
    function buildMirrorPlacements$1(mirrorSegs, colPlacements) {
        if (!mirrorSegs.length) {
            return [];
        }
        let topsByInstanceId = buildAbsoluteTopHash$1(colPlacements); // TODO: cache this at first render?
        return mirrorSegs.map((seg) => ({
            seg,
            isVisible: true,
            isAbsolute: true,
            absoluteTop: topsByInstanceId[seg.eventRange.instance.instanceId],
            marginTop: 0,
        }));
    }
    function buildAbsoluteTopHash$1(colPlacements) {
        let topsByInstanceId = {};
        for (let placements of colPlacements) {
            for (let placement of placements) {
                topsByInstanceId[placement.seg.eventRange.instance.instanceId] = placement.absoluteTop;
            }
        }
        return topsByInstanceId;
    }

    class Table extends DateComponent {
        constructor() {
            super(...arguments);
            this.splitBusinessHourSegs = memoize(splitSegsByRow);
            this.splitBgEventSegs = memoize(splitSegsByRow);
            this.splitFgEventSegs = memoize(splitSegsByRow);
            this.splitDateSelectionSegs = memoize(splitSegsByRow);
            this.splitEventDrag = memoize(splitInteractionByRow);
            this.splitEventResize = memoize(splitInteractionByRow);
            this.rowRefs = new RefMap();
            this.handleRootEl = (rootEl) => {
                this.rootEl = rootEl;
                if (rootEl) {
                    this.context.registerInteractiveComponent(this, {
                        el: rootEl,
                        isHitComboAllowed: this.props.isHitComboAllowed,
                    });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
        }
        render() {
            let { props } = this;
            let { dateProfile, dayMaxEventRows, dayMaxEvents, expandRows } = props;
            let rowCnt = props.cells.length;
            let businessHourSegsByRow = this.splitBusinessHourSegs(props.businessHourSegs, rowCnt);
            let bgEventSegsByRow = this.splitBgEventSegs(props.bgEventSegs, rowCnt);
            let fgEventSegsByRow = this.splitFgEventSegs(props.fgEventSegs, rowCnt);
            let dateSelectionSegsByRow = this.splitDateSelectionSegs(props.dateSelectionSegs, rowCnt);
            let eventDragByRow = this.splitEventDrag(props.eventDrag, rowCnt);
            let eventResizeByRow = this.splitEventResize(props.eventResize, rowCnt);
            let limitViaBalanced = dayMaxEvents === true || dayMaxEventRows === true;
            // if rows can't expand to fill fixed height, can't do balanced-height event limit
            // TODO: best place to normalize these options?
            if (limitViaBalanced && !expandRows) {
                limitViaBalanced = false;
                dayMaxEventRows = null;
                dayMaxEvents = null;
            }
            let classNames = [
                'fc-daygrid-body',
                limitViaBalanced ? 'fc-daygrid-body-balanced' : 'fc-daygrid-body-unbalanced',
                expandRows ? '' : 'fc-daygrid-body-natural', // will height of one row depend on the others?
            ];
            return (h("div", { className: classNames.join(' '), ref: this.handleRootEl, style: {
                    // these props are important to give this wrapper correct dimensions for interactions
                    // TODO: if we set it here, can we avoid giving to inner tables?
                    width: props.clientWidth,
                    minWidth: props.tableMinWidth,
                } },
                h(NowTimer, { unit: "day" }, (nowDate, todayRange) => (h(p, null,
                    h("table", { role: "presentation", className: "fc-scrollgrid-sync-table", style: {
                            width: props.clientWidth,
                            minWidth: props.tableMinWidth,
                            height: expandRows ? props.clientHeight : '',
                        } },
                        props.colGroupNode,
                        h("tbody", { role: "presentation" }, props.cells.map((cells, row) => (h(TableRow, { ref: this.rowRefs.createRef(row), key: cells.length
                                ? cells[0].date.toISOString() /* best? or put key on cell? or use diff formatter? */
                                : row // in case there are no cells (like when resource view is loading)
                            , showDayNumbers: rowCnt > 1, showWeekNumbers: props.showWeekNumbers, todayRange: todayRange, dateProfile: dateProfile, cells: cells, renderIntro: props.renderRowIntro, businessHourSegs: businessHourSegsByRow[row], eventSelection: props.eventSelection, bgEventSegs: bgEventSegsByRow[row].filter(isSegAllDay) /* hack */, fgEventSegs: fgEventSegsByRow[row], dateSelectionSegs: dateSelectionSegsByRow[row], eventDrag: eventDragByRow[row], eventResize: eventResizeByRow[row], dayMaxEvents: dayMaxEvents, dayMaxEventRows: dayMaxEventRows, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint }))))))))));
        }
        // Hit System
        // ----------------------------------------------------------------------------------------------------
        prepareHits() {
            this.rowPositions = new PositionCache(this.rootEl, this.rowRefs.collect().map((rowObj) => rowObj.getCellEls()[0]), // first cell el in each row. TODO: not optimal
            false, true);
            this.colPositions = new PositionCache(this.rootEl, this.rowRefs.currentMap[0].getCellEls(), // cell els in first row
            true, // horizontal
            false);
        }
        queryHit(positionLeft, positionTop) {
            let { colPositions, rowPositions } = this;
            let col = colPositions.leftToIndex(positionLeft);
            let row = rowPositions.topToIndex(positionTop);
            if (row != null && col != null) {
                let cell = this.props.cells[row][col];
                return {
                    dateProfile: this.props.dateProfile,
                    dateSpan: Object.assign({ range: this.getCellRange(row, col), allDay: true }, cell.extraDateSpan),
                    dayEl: this.getCellEl(row, col),
                    rect: {
                        left: colPositions.lefts[col],
                        right: colPositions.rights[col],
                        top: rowPositions.tops[row],
                        bottom: rowPositions.bottoms[row],
                    },
                    layer: 0,
                };
            }
            return null;
        }
        getCellEl(row, col) {
            return this.rowRefs.currentMap[row].getCellEls()[col]; // TODO: not optimal
        }
        getCellRange(row, col) {
            let start = this.props.cells[row][col].date;
            let end = addDays(start, 1);
            return { start, end };
        }
    }
    function isSegAllDay(seg) {
        return seg.eventRange.def.allDay;
    }

    class DayTableSlicer extends Slicer {
        constructor() {
            super(...arguments);
            this.forceDayIfListItem = true;
        }
        sliceRange(dateRange, dayTableModel) {
            return dayTableModel.sliceRange(dateRange);
        }
    }

    class DayTable extends DateComponent {
        constructor() {
            super(...arguments);
            this.slicer = new DayTableSlicer();
            this.tableRef = y();
        }
        render() {
            let { props, context } = this;
            return (h(Table, Object.assign({ ref: this.tableRef }, this.slicer.sliceProps(props, props.dateProfile, props.nextDayThreshold, context, props.dayTableModel), { dateProfile: props.dateProfile, cells: props.dayTableModel.cells, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, forPrint: props.forPrint })));
        }
    }

    class DayTableView extends TableView {
        constructor() {
            super(...arguments);
            this.buildDayTableModel = memoize(buildDayTableModel);
            this.headerRef = y();
            this.tableRef = y();
        }
        render() {
            let { options, dateProfileGenerator } = this.context;
            let { props } = this;
            let dayTableModel = this.buildDayTableModel(props.dateProfile, dateProfileGenerator);
            let headerContent = options.dayHeaders && (h(DayHeader, { ref: this.headerRef, dateProfile: props.dateProfile, dates: dayTableModel.headerDates, datesRepDistinctDays: dayTableModel.rowCnt === 1 }));
            let bodyContent = (contentArg) => (h(DayTable, { ref: this.tableRef, dateProfile: props.dateProfile, dayTableModel: dayTableModel, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, colGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }));
            return options.dayMinWidth
                ? this.renderHScrollLayout(headerContent, bodyContent, dayTableModel.colCnt, options.dayMinWidth)
                : this.renderSimpleLayout(headerContent, bodyContent);
        }
    }
    function buildDayTableModel(dateProfile, dateProfileGenerator) {
        let daySeries = new DaySeriesModel(dateProfile.renderRange, dateProfileGenerator);
        return new DayTableModel(daySeries, /year|month|week/.test(dateProfile.currentRangeUnit));
    }

    class TableDateProfileGenerator extends DateProfileGenerator {
        // Computes the date range that will be rendered.
        buildRenderRange(currentRange, currentRangeUnit, isRangeAllDay) {
            let { dateEnv } = this.props;
            let renderRange = super.buildRenderRange(currentRange, currentRangeUnit, isRangeAllDay);
            let start = renderRange.start;
            let end = renderRange.end;
            let endOfWeek;
            // year and month views should be aligned with weeks. this is already done for week
            if (/^(year|month)$/.test(currentRangeUnit)) {
                start = dateEnv.startOfWeek(start);
                // make end-of-week if not already
                endOfWeek = dateEnv.startOfWeek(end);
                if (endOfWeek.valueOf() !== end.valueOf()) {
                    end = addWeeks(endOfWeek, 1);
                }
            }
            // ensure 6 weeks
            if (this.props.monthMode &&
                this.props.fixedWeekCount) {
                let rowCnt = Math.ceil(// could be partial weeks due to hiddenDays
                diffWeeks(start, end));
                end = addWeeks(end, 6 - rowCnt);
            }
            return { start, end };
        }
    }

    var css_248z$5 = ":root{--fc-daygrid-event-dot-width:8px}.fc-daygrid-day-events:after,.fc-daygrid-day-events:before,.fc-daygrid-day-frame:after,.fc-daygrid-day-frame:before,.fc-daygrid-event-harness:after,.fc-daygrid-event-harness:before{clear:both;content:\"\";display:table}.fc .fc-daygrid-body{position:relative;z-index:1}.fc .fc-daygrid-day.fc-day-today{background-color:var(--fc-today-bg-color)}.fc .fc-daygrid-day-frame{min-height:100%;position:relative}.fc .fc-daygrid-day-top{display:flex;flex-direction:row-reverse}.fc .fc-day-other .fc-daygrid-day-top{opacity:.3}.fc .fc-daygrid-day-number{padding:4px;position:relative;z-index:4}.fc .fc-daygrid-day-events{margin-top:1px}.fc .fc-daygrid-body-balanced .fc-daygrid-day-events{left:0;position:absolute;right:0}.fc .fc-daygrid-body-unbalanced .fc-daygrid-day-events{min-height:2em;position:relative}.fc .fc-daygrid-body-natural .fc-daygrid-day-events{margin-bottom:1em}.fc .fc-daygrid-event-harness{position:relative}.fc .fc-daygrid-event-harness-abs{left:0;position:absolute;right:0;top:0}.fc .fc-daygrid-bg-harness{bottom:0;position:absolute;top:0}.fc .fc-daygrid-day-bg .fc-non-business{z-index:1}.fc .fc-daygrid-day-bg .fc-bg-event{z-index:2}.fc .fc-daygrid-day-bg .fc-highlight{z-index:3}.fc .fc-daygrid-event{margin-top:1px;z-index:6}.fc .fc-daygrid-event.fc-event-mirror{z-index:7}.fc .fc-daygrid-day-bottom{font-size:.85em;padding:2px 3px 0}.fc .fc-daygrid-day-bottom:before{clear:both;content:\"\";display:table}.fc .fc-daygrid-more-link{cursor:pointer;position:relative;z-index:4}.fc .fc-daygrid-week-number{background-color:var(--fc-neutral-bg-color);color:var(--fc-neutral-text-color);min-width:1.5em;padding:2px;position:absolute;text-align:center;top:0;z-index:5}.fc .fc-more-popover .fc-popover-body{min-width:220px;padding:10px}.fc-direction-ltr .fc-daygrid-event.fc-event-start,.fc-direction-rtl .fc-daygrid-event.fc-event-end{margin-left:2px}.fc-direction-ltr .fc-daygrid-event.fc-event-end,.fc-direction-rtl .fc-daygrid-event.fc-event-start{margin-right:2px}.fc-direction-ltr .fc-daygrid-week-number{border-radius:0 0 3px 0;left:0}.fc-direction-rtl .fc-daygrid-week-number{border-radius:0 0 0 3px;right:0}.fc-liquid-hack .fc-daygrid-day-frame{position:static}.fc-daygrid-event{border-radius:3px;font-size:var(--fc-small-font-size);position:relative;white-space:nowrap}.fc-daygrid-block-event .fc-event-time{font-weight:700}.fc-daygrid-block-event .fc-event-time,.fc-daygrid-block-event .fc-event-title{padding:1px}.fc-daygrid-dot-event{align-items:center;display:flex;padding:2px 0}.fc-daygrid-dot-event .fc-event-title{flex-grow:1;flex-shrink:1;font-weight:700;min-width:0;overflow:hidden}.fc-daygrid-dot-event.fc-event-mirror,.fc-daygrid-dot-event:hover{background:rgba(0,0,0,.1)}.fc-daygrid-dot-event.fc-event-selected:before{bottom:-10px;top:-10px}.fc-daygrid-event-dot{border:calc(var(--fc-daygrid-event-dot-width)/2) solid var(--fc-event-border-color);border-radius:calc(var(--fc-daygrid-event-dot-width)/2);box-sizing:content-box;height:0;margin:0 4px;width:0}.fc-direction-ltr .fc-daygrid-event .fc-event-time{margin-right:3px}.fc-direction-rtl .fc-daygrid-event .fc-event-time{margin-left:3px}";
    injectStyles(css_248z$5);

    var index$a = createPlugin({
        name: '@fullcalendar/daygrid',
        initialView: 'dayGridMonth',
        views: {
            dayGrid: {
                component: DayTableView,
                dateProfileGeneratorClass: TableDateProfileGenerator,
            },
            dayGridDay: {
                type: 'dayGrid',
                duration: { days: 1 },
            },
            dayGridWeek: {
                type: 'dayGrid',
                duration: { weeks: 1 },
            },
            dayGridMonth: {
                type: 'dayGrid',
                duration: { months: 1 },
                monthMode: true,
                fixedWeekCount: true,
            },
        },
    });

    class AllDaySplitter extends Splitter {
        getKeyInfo() {
            return {
                allDay: {},
                timed: {},
            };
        }
        getKeysForDateSpan(dateSpan) {
            if (dateSpan.allDay) {
                return ['allDay'];
            }
            return ['timed'];
        }
        getKeysForEventDef(eventDef) {
            if (!eventDef.allDay) {
                return ['timed'];
            }
            if (hasBgRendering(eventDef)) {
                return ['timed', 'allDay'];
            }
            return ['allDay'];
        }
    }

    const DEFAULT_SLAT_LABEL_FORMAT = createFormatter({
        hour: 'numeric',
        minute: '2-digit',
        omitZeroMinute: true,
        meridiem: 'short',
    });
    function TimeColsAxisCell(props) {
        let classNames = [
            'fc-timegrid-slot',
            'fc-timegrid-slot-label',
            props.isLabeled ? 'fc-scrollgrid-shrink' : 'fc-timegrid-slot-minor',
        ];
        return (h(ViewContextType.Consumer, null, (context) => {
            if (!props.isLabeled) {
                return (h("td", { className: classNames.join(' '), "data-time": props.isoTimeStr }));
            }
            let { dateEnv, options, viewApi } = context;
            let labelFormat = // TODO: fully pre-parse
             options.slotLabelFormat == null ? DEFAULT_SLAT_LABEL_FORMAT :
                Array.isArray(options.slotLabelFormat) ? createFormatter(options.slotLabelFormat[0]) :
                    createFormatter(options.slotLabelFormat);
            let renderProps = {
                level: 0,
                time: props.time,
                date: dateEnv.toDate(props.date),
                view: viewApi,
                text: dateEnv.format(props.date, labelFormat),
            };
            return (h(ContentContainer, { elTag: "td", elClasses: classNames, elAttrs: {
                    'data-time': props.isoTimeStr,
                }, renderProps: renderProps, generatorName: "slotLabelContent", generator: options.slotLabelContent || renderInnerContent$3, classNameGenerator: options.slotLabelClassNames, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, (InnerContent) => (h("div", { className: "fc-timegrid-slot-label-frame fc-scrollgrid-shrink-frame" },
                h(InnerContent, { elTag: "div", elClasses: [
                        'fc-timegrid-slot-label-cushion',
                        'fc-scrollgrid-shrink-cushion',
                    ] })))));
        }));
    }
    function renderInnerContent$3(props) {
        return props.text;
    }

    class TimeBodyAxis extends BaseComponent {
        render() {
            return this.props.slatMetas.map((slatMeta) => (h("tr", { key: slatMeta.key },
                h(TimeColsAxisCell, Object.assign({}, slatMeta)))));
        }
    }

    const DEFAULT_WEEK_NUM_FORMAT = createFormatter({ week: 'short' });
    const AUTO_ALL_DAY_MAX_EVENT_ROWS = 5;
    class TimeColsView extends DateComponent {
        constructor() {
            super(...arguments);
            this.allDaySplitter = new AllDaySplitter(); // for use by subclasses
            this.headerElRef = y();
            this.rootElRef = y();
            this.scrollerElRef = y();
            this.state = {
                slatCoords: null,
            };
            this.handleScrollTopRequest = (scrollTop) => {
                let scrollerEl = this.scrollerElRef.current;
                if (scrollerEl) { // TODO: not sure how this could ever be null. weirdness with the reducer
                    scrollerEl.scrollTop = scrollTop;
                }
            };
            /* Header Render Methods
            ------------------------------------------------------------------------------------------------------------------*/
            this.renderHeadAxis = (rowKey, frameHeight = '') => {
                let { options } = this.context;
                let { dateProfile } = this.props;
                let range = dateProfile.renderRange;
                let dayCnt = diffDays(range.start, range.end);
                // only do in day views (to avoid doing in week views that dont need it)
                let navLinkAttrs = (dayCnt === 1)
                    ? buildNavLinkAttrs(this.context, range.start, 'week')
                    : {};
                if (options.weekNumbers && rowKey === 'day') {
                    return (h(WeekNumberContainer, { elTag: "th", elClasses: [
                            'fc-timegrid-axis',
                            'fc-scrollgrid-shrink',
                        ], elAttrs: {
                            'aria-hidden': true,
                        }, date: range.start, defaultFormat: DEFAULT_WEEK_NUM_FORMAT }, (InnerContent) => (h("div", { className: [
                            'fc-timegrid-axis-frame',
                            'fc-scrollgrid-shrink-frame',
                            'fc-timegrid-axis-frame-liquid',
                        ].join(' '), style: { height: frameHeight } },
                        h(InnerContent, { elTag: "a", elClasses: [
                                'fc-timegrid-axis-cushion',
                                'fc-scrollgrid-shrink-cushion',
                                'fc-scrollgrid-sync-inner',
                            ], elAttrs: navLinkAttrs })))));
                }
                return (h("th", { "aria-hidden": true, className: "fc-timegrid-axis" },
                    h("div", { className: "fc-timegrid-axis-frame", style: { height: frameHeight } })));
            };
            /* Table Component Render Methods
            ------------------------------------------------------------------------------------------------------------------*/
            // only a one-way height sync. we don't send the axis inner-content height to the DayGrid,
            // but DayGrid still needs to have classNames on inner elements in order to measure.
            this.renderTableRowAxis = (rowHeight) => {
                let { options, viewApi } = this.context;
                let renderProps = {
                    text: options.allDayText,
                    view: viewApi,
                };
                return (
                // TODO: make reusable hook. used in list view too
                h(ContentContainer, { elTag: "td", elClasses: [
                        'fc-timegrid-axis',
                        'fc-scrollgrid-shrink',
                    ], elAttrs: {
                        'aria-hidden': true,
                    }, renderProps: renderProps, generatorName: "allDayContent", generator: options.allDayContent || renderAllDayInner$1, classNameGenerator: options.allDayClassNames, didMount: options.allDayDidMount, willUnmount: options.allDayWillUnmount }, (InnerContent) => (h("div", { className: [
                        'fc-timegrid-axis-frame',
                        'fc-scrollgrid-shrink-frame',
                        rowHeight == null ? ' fc-timegrid-axis-frame-liquid' : '',
                    ].join(' '), style: { height: rowHeight } },
                    h(InnerContent, { elTag: "span", elClasses: [
                            'fc-timegrid-axis-cushion',
                            'fc-scrollgrid-shrink-cushion',
                            'fc-scrollgrid-sync-inner',
                        ] })))));
            };
            this.handleSlatCoords = (slatCoords) => {
                this.setState({ slatCoords });
            };
        }
        // rendering
        // ----------------------------------------------------------------------------------------------------
        renderSimpleLayout(headerRowContent, allDayContent, timeContent) {
            let { context, props } = this;
            let sections = [];
            let stickyHeaderDates = getStickyHeaderDates(context.options);
            if (headerRowContent) {
                sections.push({
                    type: 'header',
                    key: 'header',
                    isSticky: stickyHeaderDates,
                    chunk: {
                        elRef: this.headerElRef,
                        tableClassName: 'fc-col-header',
                        rowContent: headerRowContent,
                    },
                });
            }
            if (allDayContent) {
                sections.push({
                    type: 'body',
                    key: 'all-day',
                    chunk: { content: allDayContent },
                });
                sections.push({
                    type: 'body',
                    key: 'all-day-divider',
                    outerContent: ( // TODO: rename to cellContent so don't need to define <tr>?
                    h("tr", { role: "presentation", className: "fc-scrollgrid-section" },
                        h("td", { className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
                });
            }
            sections.push({
                type: 'body',
                key: 'body',
                liquid: true,
                expandRows: Boolean(context.options.expandRows),
                chunk: {
                    scrollerElRef: this.scrollerElRef,
                    content: timeContent,
                },
            });
            return (h(ViewContainer$1, { elRef: this.rootElRef, elClasses: ['fc-timegrid'], viewSpec: context.viewSpec },
                h(SimpleScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: props.forPrint, cols: [{ width: 'shrink' }], sections: sections })));
        }
        renderHScrollLayout(headerRowContent, allDayContent, timeContent, colCnt, dayMinWidth, slatMetas, slatCoords) {
            let ScrollGrid = this.context.pluginHooks.scrollGridImpl;
            if (!ScrollGrid) {
                throw new Error('No ScrollGrid implementation');
            }
            let { context, props } = this;
            let stickyHeaderDates = !props.forPrint && getStickyHeaderDates(context.options);
            let stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(context.options);
            let sections = [];
            if (headerRowContent) {
                sections.push({
                    type: 'header',
                    key: 'header',
                    isSticky: stickyHeaderDates,
                    syncRowHeights: true,
                    chunks: [
                        {
                            key: 'axis',
                            rowContent: (arg) => (h("tr", { role: "presentation" }, this.renderHeadAxis('day', arg.rowSyncHeights[0]))),
                        },
                        {
                            key: 'cols',
                            elRef: this.headerElRef,
                            tableClassName: 'fc-col-header',
                            rowContent: headerRowContent,
                        },
                    ],
                });
            }
            if (allDayContent) {
                sections.push({
                    type: 'body',
                    key: 'all-day',
                    syncRowHeights: true,
                    chunks: [
                        {
                            key: 'axis',
                            rowContent: (contentArg) => (h("tr", { role: "presentation" }, this.renderTableRowAxis(contentArg.rowSyncHeights[0]))),
                        },
                        {
                            key: 'cols',
                            content: allDayContent,
                        },
                    ],
                });
                sections.push({
                    key: 'all-day-divider',
                    type: 'body',
                    outerContent: ( // TODO: rename to cellContent so don't need to define <tr>?
                    h("tr", { role: "presentation", className: "fc-scrollgrid-section" },
                        h("td", { colSpan: 2, className: 'fc-timegrid-divider ' + context.theme.getClass('tableCellShaded') }))),
                });
            }
            let isNowIndicator = context.options.nowIndicator;
            sections.push({
                type: 'body',
                key: 'body',
                liquid: true,
                expandRows: Boolean(context.options.expandRows),
                chunks: [
                    {
                        key: 'axis',
                        content: (arg) => (
                        // TODO: make this now-indicator arrow more DRY with TimeColsContent
                        h("div", { className: "fc-timegrid-axis-chunk" },
                            h("table", { "aria-hidden": true, style: { height: arg.expandRows ? arg.clientHeight : '' } },
                                arg.tableColGroupNode,
                                h("tbody", null,
                                    h(TimeBodyAxis, { slatMetas: slatMetas }))),
                            h("div", { className: "fc-timegrid-now-indicator-container" },
                                h(NowTimer, { unit: isNowIndicator ? 'minute' : 'day' /* hacky */ }, (nowDate) => {
                                    let nowIndicatorTop = isNowIndicator &&
                                        slatCoords &&
                                        slatCoords.safeComputeTop(nowDate); // might return void
                                    if (typeof nowIndicatorTop === 'number') {
                                        return (h(NowIndicatorContainer, { elClasses: ['fc-timegrid-now-indicator-arrow'], elStyle: { top: nowIndicatorTop }, isAxis: true, date: nowDate }));
                                    }
                                    return null;
                                })))),
                    },
                    {
                        key: 'cols',
                        scrollerElRef: this.scrollerElRef,
                        content: timeContent,
                    },
                ],
            });
            if (stickyFooterScrollbar) {
                sections.push({
                    key: 'footer',
                    type: 'footer',
                    isSticky: true,
                    chunks: [
                        {
                            key: 'axis',
                            content: renderScrollShim,
                        },
                        {
                            key: 'cols',
                            content: renderScrollShim,
                        },
                    ],
                });
            }
            return (h(ViewContainer$1, { elRef: this.rootElRef, elClasses: ['fc-timegrid'], viewSpec: context.viewSpec },
                h(ScrollGrid, { liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
                        { width: 'shrink', cols: [{ width: 'shrink' }] },
                        { cols: [{ span: colCnt, minWidth: dayMinWidth }] },
                    ], sections: sections })));
        }
        /* Dimensions
        ------------------------------------------------------------------------------------------------------------------*/
        getAllDayMaxEventProps() {
            let { dayMaxEvents, dayMaxEventRows } = this.context.options;
            if (dayMaxEvents === true || dayMaxEventRows === true) { // is auto?
                dayMaxEvents = undefined;
                dayMaxEventRows = AUTO_ALL_DAY_MAX_EVENT_ROWS; // make sure "auto" goes to a real number
            }
            return { dayMaxEvents, dayMaxEventRows };
        }
    }
    function renderAllDayInner$1(renderProps) {
        return renderProps.text;
    }

    class TimeColsSlatsCoords {
        constructor(positions, dateProfile, slotDuration) {
            this.positions = positions;
            this.dateProfile = dateProfile;
            this.slotDuration = slotDuration;
        }
        safeComputeTop(date) {
            let { dateProfile } = this;
            if (rangeContainsMarker(dateProfile.currentRange, date)) {
                let startOfDayDate = startOfDay(date);
                let timeMs = date.valueOf() - startOfDayDate.valueOf();
                if (timeMs >= asRoughMs(dateProfile.slotMinTime) &&
                    timeMs < asRoughMs(dateProfile.slotMaxTime)) {
                    return this.computeTimeTop(createDuration(timeMs));
                }
            }
            return null;
        }
        // Computes the top coordinate, relative to the bounds of the grid, of the given date.
        // A `startOfDayDate` must be given for avoiding ambiguity over how to treat midnight.
        computeDateTop(when, startOfDayDate) {
            if (!startOfDayDate) {
                startOfDayDate = startOfDay(when);
            }
            return this.computeTimeTop(createDuration(when.valueOf() - startOfDayDate.valueOf()));
        }
        // Computes the top coordinate, relative to the bounds of the grid, of the given time (a Duration).
        // This is a makeshify way to compute the time-top. Assumes all slatMetas dates are uniform.
        // Eventually allow computation with arbirary slat dates.
        computeTimeTop(duration) {
            let { positions, dateProfile } = this;
            let len = positions.els.length;
            // floating-point value of # of slots covered
            let slatCoverage = (duration.milliseconds - asRoughMs(dateProfile.slotMinTime)) / asRoughMs(this.slotDuration);
            let slatIndex;
            let slatRemainder;
            // compute a floating-point number for how many slats should be progressed through.
            // from 0 to number of slats (inclusive)
            // constrained because slotMinTime/slotMaxTime might be customized.
            slatCoverage = Math.max(0, slatCoverage);
            slatCoverage = Math.min(len, slatCoverage);
            // an integer index of the furthest whole slat
            // from 0 to number slats (*exclusive*, so len-1)
            slatIndex = Math.floor(slatCoverage);
            slatIndex = Math.min(slatIndex, len - 1);
            // how much further through the slatIndex slat (from 0.0-1.0) must be covered in addition.
            // could be 1.0 if slatCoverage is covering *all* the slots
            slatRemainder = slatCoverage - slatIndex;
            return positions.tops[slatIndex] +
                positions.getHeight(slatIndex) * slatRemainder;
        }
    }

    class TimeColsSlatsBody extends BaseComponent {
        render() {
            let { props, context } = this;
            let { options } = context;
            let { slatElRefs } = props;
            return (h("tbody", null, props.slatMetas.map((slatMeta, i) => {
                let renderProps = {
                    time: slatMeta.time,
                    date: context.dateEnv.toDate(slatMeta.date),
                    view: context.viewApi,
                };
                return (h("tr", { key: slatMeta.key, ref: slatElRefs.createRef(slatMeta.key) },
                    props.axis && (h(TimeColsAxisCell, Object.assign({}, slatMeta))),
                    h(ContentContainer, { elTag: "td", elClasses: [
                            'fc-timegrid-slot',
                            'fc-timegrid-slot-lane',
                            !slatMeta.isLabeled && 'fc-timegrid-slot-minor',
                        ], elAttrs: {
                            'data-time': slatMeta.isoTimeStr,
                        }, renderProps: renderProps, generatorName: "slotLaneContent", generator: options.slotLaneContent, classNameGenerator: options.slotLaneClassNames, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount })));
            })));
        }
    }

    /*
    for the horizontal "slats" that run width-wise. Has a time axis on a side. Depends on RTL.
    */
    class TimeColsSlats extends BaseComponent {
        constructor() {
            super(...arguments);
            this.rootElRef = y();
            this.slatElRefs = new RefMap();
        }
        render() {
            let { props, context } = this;
            return (h("div", { ref: this.rootElRef, className: "fc-timegrid-slots" },
                h("table", { "aria-hidden": true, className: context.theme.getClass('table'), style: {
                        minWidth: props.tableMinWidth,
                        width: props.clientWidth,
                        height: props.minHeight,
                    } },
                    props.tableColGroupNode /* relies on there only being a single <col> for the axis */,
                    h(TimeColsSlatsBody, { slatElRefs: this.slatElRefs, axis: props.axis, slatMetas: props.slatMetas }))));
        }
        componentDidMount() {
            this.updateSizing();
        }
        componentDidUpdate() {
            this.updateSizing();
        }
        componentWillUnmount() {
            if (this.props.onCoords) {
                this.props.onCoords(null);
            }
        }
        updateSizing() {
            let { context, props } = this;
            if (props.onCoords &&
                props.clientWidth !== null // means sizing has stabilized
            ) {
                let rootEl = this.rootElRef.current;
                if (rootEl.offsetHeight) { // not hidden by css
                    props.onCoords(new TimeColsSlatsCoords(new PositionCache(this.rootElRef.current, collectSlatEls(this.slatElRefs.currentMap, props.slatMetas), false, true), this.props.dateProfile, context.options.slotDuration));
                }
            }
        }
    }
    function collectSlatEls(elMap, slatMetas) {
        return slatMetas.map((slatMeta) => elMap[slatMeta.key]);
    }

    function splitSegsByCol(segs, colCnt) {
        let segsByCol = [];
        let i;
        for (i = 0; i < colCnt; i += 1) {
            segsByCol.push([]);
        }
        if (segs) {
            for (i = 0; i < segs.length; i += 1) {
                segsByCol[segs[i].col].push(segs[i]);
            }
        }
        return segsByCol;
    }
    function splitInteractionByCol(ui, colCnt) {
        let byRow = [];
        if (!ui) {
            for (let i = 0; i < colCnt; i += 1) {
                byRow[i] = null;
            }
        }
        else {
            for (let i = 0; i < colCnt; i += 1) {
                byRow[i] = {
                    affectedInstances: ui.affectedInstances,
                    isEvent: ui.isEvent,
                    segs: [],
                };
            }
            for (let seg of ui.segs) {
                byRow[seg.col].segs.push(seg);
            }
        }
        return byRow;
    }

    class TimeColMoreLink extends BaseComponent {
        render() {
            let { props } = this;
            return (h(MoreLinkContainer, { elClasses: ['fc-timegrid-more-link'], elStyle: {
                    top: props.top,
                    bottom: props.bottom,
                }, allDayDate: null, moreCnt: props.hiddenSegs.length, allSegs: props.hiddenSegs, hiddenSegs: props.hiddenSegs, extraDateSpan: props.extraDateSpan, dateProfile: props.dateProfile, todayRange: props.todayRange, popoverContent: () => renderPlainFgSegs(props.hiddenSegs, props), defaultGenerator: renderMoreLinkInner }, (InnerContent) => (h(InnerContent, { elTag: "div", elClasses: ['fc-timegrid-more-link-inner', 'fc-sticky'] }))));
        }
    }
    function renderMoreLinkInner(props) {
        return props.shortText;
    }

    // segInputs assumed sorted
    function buildPositioning(segInputs, strictOrder, maxStackCnt) {
        let hierarchy = new SegHierarchy();
        if (strictOrder != null) {
            hierarchy.strictOrder = strictOrder;
        }
        if (maxStackCnt != null) {
            hierarchy.maxStackCnt = maxStackCnt;
        }
        let hiddenEntries = hierarchy.addSegs(segInputs);
        let hiddenGroups = groupIntersectingEntries(hiddenEntries);
        let web = buildWeb(hierarchy);
        web = stretchWeb(web, 1); // all levelCoords/thickness will have 0.0-1.0
        let segRects = webToRects(web);
        return { segRects, hiddenGroups };
    }
    function buildWeb(hierarchy) {
        const { entriesByLevel } = hierarchy;
        const buildNode = cacheable((level, lateral) => level + ':' + lateral, (level, lateral) => {
            let siblingRange = findNextLevelSegs(hierarchy, level, lateral);
            let nextLevelRes = buildNodes(siblingRange, buildNode);
            let entry = entriesByLevel[level][lateral];
            return [
                Object.assign(Object.assign({}, entry), { nextLevelNodes: nextLevelRes[0] }),
                entry.thickness + nextLevelRes[1], // the pressure builds
            ];
        });
        return buildNodes(entriesByLevel.length
            ? { level: 0, lateralStart: 0, lateralEnd: entriesByLevel[0].length }
            : null, buildNode)[0];
    }
    function buildNodes(siblingRange, buildNode) {
        if (!siblingRange) {
            return [[], 0];
        }
        let { level, lateralStart, lateralEnd } = siblingRange;
        let lateral = lateralStart;
        let pairs = [];
        while (lateral < lateralEnd) {
            pairs.push(buildNode(level, lateral));
            lateral += 1;
        }
        pairs.sort(cmpDescPressures);
        return [
            pairs.map(extractNode),
            pairs[0][1], // first item's pressure
        ];
    }
    function cmpDescPressures(a, b) {
        return b[1] - a[1];
    }
    function extractNode(a) {
        return a[0];
    }
    function findNextLevelSegs(hierarchy, subjectLevel, subjectLateral) {
        let { levelCoords, entriesByLevel } = hierarchy;
        let subjectEntry = entriesByLevel[subjectLevel][subjectLateral];
        let afterSubject = levelCoords[subjectLevel] + subjectEntry.thickness;
        let levelCnt = levelCoords.length;
        let level = subjectLevel;
        // skip past levels that are too high up
        for (; level < levelCnt && levelCoords[level] < afterSubject; level += 1)
            ; // do nothing
        for (; level < levelCnt; level += 1) {
            let entries = entriesByLevel[level];
            let entry;
            let searchIndex = binarySearch(entries, subjectEntry.span.start, getEntrySpanEnd);
            let lateralStart = searchIndex[0] + searchIndex[1]; // if exact match (which doesn't collide), go to next one
            let lateralEnd = lateralStart;
            while ( // loop through entries that horizontally intersect
            (entry = entries[lateralEnd]) && // but not past the whole seg list
                entry.span.start < subjectEntry.span.end) {
                lateralEnd += 1;
            }
            if (lateralStart < lateralEnd) {
                return { level, lateralStart, lateralEnd };
            }
        }
        return null;
    }
    function stretchWeb(topLevelNodes, totalThickness) {
        const stretchNode = cacheable((node, startCoord, prevThickness) => buildEntryKey(node), (node, startCoord, prevThickness) => {
            let { nextLevelNodes, thickness } = node;
            let allThickness = thickness + prevThickness;
            let thicknessFraction = thickness / allThickness;
            let endCoord;
            let newChildren = [];
            if (!nextLevelNodes.length) {
                endCoord = totalThickness;
            }
            else {
                for (let childNode of nextLevelNodes) {
                    if (endCoord === undefined) {
                        let res = stretchNode(childNode, startCoord, allThickness);
                        endCoord = res[0];
                        newChildren.push(res[1]);
                    }
                    else {
                        let res = stretchNode(childNode, endCoord, 0);
                        newChildren.push(res[1]);
                    }
                }
            }
            let newThickness = (endCoord - startCoord) * thicknessFraction;
            return [endCoord - newThickness, Object.assign(Object.assign({}, node), { thickness: newThickness, nextLevelNodes: newChildren })];
        });
        return topLevelNodes.map((node) => stretchNode(node, 0, 0)[1]);
    }
    // not sorted in any particular order
    function webToRects(topLevelNodes) {
        let rects = [];
        const processNode = cacheable((node, levelCoord, stackDepth) => buildEntryKey(node), (node, levelCoord, stackDepth) => {
            let rect = Object.assign(Object.assign({}, node), { levelCoord,
                stackDepth, stackForward: 0 });
            rects.push(rect);
            return (rect.stackForward = processNodes(node.nextLevelNodes, levelCoord + node.thickness, stackDepth + 1) + 1);
        });
        function processNodes(nodes, levelCoord, stackDepth) {
            let stackForward = 0;
            for (let node of nodes) {
                stackForward = Math.max(processNode(node, levelCoord, stackDepth), stackForward);
            }
            return stackForward;
        }
        processNodes(topLevelNodes, 0, 0);
        return rects; // TODO: sort rects by levelCoord to be consistent with toRects?
    }
    // TODO: move to general util
    function cacheable(keyFunc, workFunc) {
        const cache = {};
        return (...args) => {
            let key = keyFunc(...args);
            return (key in cache)
                ? cache[key]
                : (cache[key] = workFunc(...args));
        };
    }

    function computeSegVCoords(segs, colDate, slatCoords = null, eventMinHeight = 0) {
        let vcoords = [];
        if (slatCoords) {
            for (let i = 0; i < segs.length; i += 1) {
                let seg = segs[i];
                let spanStart = slatCoords.computeDateTop(seg.start, colDate);
                let spanEnd = Math.max(spanStart + (eventMinHeight || 0), // :(
                slatCoords.computeDateTop(seg.end, colDate));
                vcoords.push({
                    start: Math.round(spanStart),
                    end: Math.round(spanEnd), //
                });
            }
        }
        return vcoords;
    }
    function computeFgSegPlacements$1(segs, segVCoords, // might not have for every seg
    eventOrderStrict, eventMaxStack) {
        let segInputs = [];
        let dumbSegs = []; // segs without coords
        for (let i = 0; i < segs.length; i += 1) {
            let vcoords = segVCoords[i];
            if (vcoords) {
                segInputs.push({
                    index: i,
                    thickness: 1,
                    span: vcoords,
                });
            }
            else {
                dumbSegs.push(segs[i]);
            }
        }
        let { segRects, hiddenGroups } = buildPositioning(segInputs, eventOrderStrict, eventMaxStack);
        let segPlacements = [];
        for (let segRect of segRects) {
            segPlacements.push({
                seg: segs[segRect.index],
                rect: segRect,
            });
        }
        for (let dumbSeg of dumbSegs) {
            segPlacements.push({ seg: dumbSeg, rect: null });
        }
        return { segPlacements, hiddenGroups };
    }

    const DEFAULT_TIME_FORMAT$2 = createFormatter({
        hour: 'numeric',
        minute: '2-digit',
        meridiem: false,
    });
    class TimeColEvent extends BaseComponent {
        render() {
            return (h(StandardEvent, Object.assign({}, this.props, { elClasses: [
                    'fc-timegrid-event',
                    'fc-v-event',
                    this.props.isShort && 'fc-timegrid-event-short',
                ], defaultTimeFormat: DEFAULT_TIME_FORMAT$2 })));
        }
    }

    class TimeCol extends BaseComponent {
        constructor() {
            super(...arguments);
            this.sortEventSegs = memoize(sortEventSegs);
        }
        // TODO: memoize event-placement?
        render() {
            let { props, context } = this;
            let { options } = context;
            let isSelectMirror = options.selectMirror;
            let mirrorSegs = // yuck
             (props.eventDrag && props.eventDrag.segs) ||
                (props.eventResize && props.eventResize.segs) ||
                (isSelectMirror && props.dateSelectionSegs) ||
                [];
            let interactionAffectedInstances = // TODO: messy way to compute this
             (props.eventDrag && props.eventDrag.affectedInstances) ||
                (props.eventResize && props.eventResize.affectedInstances) ||
                {};
            let sortedFgSegs = this.sortEventSegs(props.fgEventSegs, options.eventOrder);
            return (h(DayCellContainer, { elTag: "td", elRef: props.elRef, elClasses: [
                    'fc-timegrid-col',
                    ...(props.extraClassNames || []),
                ], elAttrs: Object.assign({ role: 'gridcell' }, props.extraDataAttrs), date: props.date, dateProfile: props.dateProfile, todayRange: props.todayRange, extraRenderProps: props.extraRenderProps }, (InnerContent) => (h("div", { className: "fc-timegrid-col-frame" },
                h("div", { className: "fc-timegrid-col-bg" },
                    this.renderFillSegs(props.businessHourSegs, 'non-business'),
                    this.renderFillSegs(props.bgEventSegs, 'bg-event'),
                    this.renderFillSegs(props.dateSelectionSegs, 'highlight')),
                h("div", { className: "fc-timegrid-col-events" }, this.renderFgSegs(sortedFgSegs, interactionAffectedInstances, false, false, false)),
                h("div", { className: "fc-timegrid-col-events" }, this.renderFgSegs(mirrorSegs, {}, Boolean(props.eventDrag), Boolean(props.eventResize), Boolean(isSelectMirror))),
                h("div", { className: "fc-timegrid-now-indicator-container" }, this.renderNowIndicator(props.nowIndicatorSegs)),
                hasCustomDayCellContent(options) && (h(InnerContent, { elTag: "div", elClasses: ['fc-timegrid-col-misc'] }))))));
        }
        renderFgSegs(sortedFgSegs, segIsInvisible, isDragging, isResizing, isDateSelecting) {
            let { props } = this;
            if (props.forPrint) {
                return renderPlainFgSegs(sortedFgSegs, props);
            }
            return this.renderPositionedFgSegs(sortedFgSegs, segIsInvisible, isDragging, isResizing, isDateSelecting);
        }
        renderPositionedFgSegs(segs, // if not mirror, needs to be sorted
        segIsInvisible, isDragging, isResizing, isDateSelecting) {
            let { eventMaxStack, eventShortHeight, eventOrderStrict, eventMinHeight } = this.context.options;
            let { date, slatCoords, eventSelection, todayRange, nowDate } = this.props;
            let isMirror = isDragging || isResizing || isDateSelecting;
            let segVCoords = computeSegVCoords(segs, date, slatCoords, eventMinHeight);
            let { segPlacements, hiddenGroups } = computeFgSegPlacements$1(segs, segVCoords, eventOrderStrict, eventMaxStack);
            return (h(p, null,
                this.renderHiddenGroups(hiddenGroups, segs),
                segPlacements.map((segPlacement) => {
                    let { seg, rect } = segPlacement;
                    let instanceId = seg.eventRange.instance.instanceId;
                    let isVisible = isMirror || Boolean(!segIsInvisible[instanceId] && rect);
                    let vStyle = computeSegVStyle(rect && rect.span);
                    let hStyle = (!isMirror && rect) ? this.computeSegHStyle(rect) : { left: 0, right: 0 };
                    let isInset = Boolean(rect) && rect.stackForward > 0;
                    let isShort = Boolean(rect) && (rect.span.end - rect.span.start) < eventShortHeight; // look at other places for this problem
                    return (h("div", { className: 'fc-timegrid-event-harness' +
                            (isInset ? ' fc-timegrid-event-harness-inset' : ''), key: instanceId, style: Object.assign(Object.assign({ visibility: isVisible ? '' : 'hidden' }, vStyle), hStyle) },
                        h(TimeColEvent, Object.assign({ seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === eventSelection, isShort: isShort }, getSegMeta(seg, todayRange, nowDate)))));
                })));
        }
        // will already have eventMinHeight applied because segInputs already had it
        renderHiddenGroups(hiddenGroups, segs) {
            let { extraDateSpan, dateProfile, todayRange, nowDate, eventSelection, eventDrag, eventResize } = this.props;
            return (h(p, null, hiddenGroups.map((hiddenGroup) => {
                let positionCss = computeSegVStyle(hiddenGroup.span);
                let hiddenSegs = compileSegsFromEntries(hiddenGroup.entries, segs);
                return (h(TimeColMoreLink, { key: buildIsoString(computeEarliestSegStart(hiddenSegs)), hiddenSegs: hiddenSegs, top: positionCss.top, bottom: positionCss.bottom, extraDateSpan: extraDateSpan, dateProfile: dateProfile, todayRange: todayRange, nowDate: nowDate, eventSelection: eventSelection, eventDrag: eventDrag, eventResize: eventResize }));
            })));
        }
        renderFillSegs(segs, fillType) {
            let { props, context } = this;
            let segVCoords = computeSegVCoords(segs, props.date, props.slatCoords, context.options.eventMinHeight); // don't assume all populated
            let children = segVCoords.map((vcoords, i) => {
                let seg = segs[i];
                return (h("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-timegrid-bg-harness", style: computeSegVStyle(vcoords) }, fillType === 'bg-event' ?
                    h(BgEvent, Object.assign({ seg: seg }, getSegMeta(seg, props.todayRange, props.nowDate))) :
                    renderFill(fillType)));
            });
            return h(p, null, children);
        }
        renderNowIndicator(segs) {
            let { slatCoords, date } = this.props;
            if (!slatCoords) {
                return null;
            }
            return segs.map((seg, i) => (h(NowIndicatorContainer
            // key doesn't matter. will only ever be one
            , { 
                // key doesn't matter. will only ever be one
                key: i, elClasses: ['fc-timegrid-now-indicator-line'], elStyle: {
                    top: slatCoords.computeDateTop(seg.start, date),
                }, isAxis: false, date: date })));
        }
        computeSegHStyle(segHCoords) {
            let { isRtl, options } = this.context;
            let shouldOverlap = options.slotEventOverlap;
            let nearCoord = segHCoords.levelCoord; // the left side if LTR. the right side if RTL. floating-point
            let farCoord = segHCoords.levelCoord + segHCoords.thickness; // the right side if LTR. the left side if RTL. floating-point
            let left; // amount of space from left edge, a fraction of the total width
            let right; // amount of space from right edge, a fraction of the total width
            if (shouldOverlap) {
                // double the width, but don't go beyond the maximum forward coordinate (1.0)
                farCoord = Math.min(1, nearCoord + (farCoord - nearCoord) * 2);
            }
            if (isRtl) {
                left = 1 - farCoord;
                right = nearCoord;
            }
            else {
                left = nearCoord;
                right = 1 - farCoord;
            }
            let props = {
                zIndex: segHCoords.stackDepth + 1,
                left: left * 100 + '%',
                right: right * 100 + '%',
            };
            if (shouldOverlap && !segHCoords.stackForward) {
                // add padding to the edge so that forward stacked events don't cover the resizer's icon
                props[isRtl ? 'marginLeft' : 'marginRight'] = 10 * 2; // 10 is a guesstimate of the icon's width
            }
            return props;
        }
    }
    function renderPlainFgSegs(sortedFgSegs, { todayRange, nowDate, eventSelection, eventDrag, eventResize }) {
        let hiddenInstances = (eventDrag ? eventDrag.affectedInstances : null) ||
            (eventResize ? eventResize.affectedInstances : null) ||
            {};
        return (h(p, null, sortedFgSegs.map((seg) => {
            let instanceId = seg.eventRange.instance.instanceId;
            return (h("div", { key: instanceId, style: { visibility: hiddenInstances[instanceId] ? 'hidden' : '' } },
                h(TimeColEvent, Object.assign({ seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === eventSelection, isShort: false }, getSegMeta(seg, todayRange, nowDate)))));
        })));
    }
    function computeSegVStyle(segVCoords) {
        if (!segVCoords) {
            return { top: '', bottom: '' };
        }
        return {
            top: segVCoords.start,
            bottom: -segVCoords.end,
        };
    }
    function compileSegsFromEntries(segEntries, allSegs) {
        return segEntries.map((segEntry) => allSegs[segEntry.index]);
    }

    class TimeColsContent extends BaseComponent {
        constructor() {
            super(...arguments);
            this.splitFgEventSegs = memoize(splitSegsByCol);
            this.splitBgEventSegs = memoize(splitSegsByCol);
            this.splitBusinessHourSegs = memoize(splitSegsByCol);
            this.splitNowIndicatorSegs = memoize(splitSegsByCol);
            this.splitDateSelectionSegs = memoize(splitSegsByCol);
            this.splitEventDrag = memoize(splitInteractionByCol);
            this.splitEventResize = memoize(splitInteractionByCol);
            this.rootElRef = y();
            this.cellElRefs = new RefMap();
        }
        render() {
            let { props, context } = this;
            let nowIndicatorTop = context.options.nowIndicator &&
                props.slatCoords &&
                props.slatCoords.safeComputeTop(props.nowDate); // might return void
            let colCnt = props.cells.length;
            let fgEventSegsByRow = this.splitFgEventSegs(props.fgEventSegs, colCnt);
            let bgEventSegsByRow = this.splitBgEventSegs(props.bgEventSegs, colCnt);
            let businessHourSegsByRow = this.splitBusinessHourSegs(props.businessHourSegs, colCnt);
            let nowIndicatorSegsByRow = this.splitNowIndicatorSegs(props.nowIndicatorSegs, colCnt);
            let dateSelectionSegsByRow = this.splitDateSelectionSegs(props.dateSelectionSegs, colCnt);
            let eventDragByRow = this.splitEventDrag(props.eventDrag, colCnt);
            let eventResizeByRow = this.splitEventResize(props.eventResize, colCnt);
            return (h("div", { className: "fc-timegrid-cols", ref: this.rootElRef },
                h("table", { role: "presentation", style: {
                        minWidth: props.tableMinWidth,
                        width: props.clientWidth,
                    } },
                    props.tableColGroupNode,
                    h("tbody", { role: "presentation" },
                        h("tr", { role: "row" },
                            props.axis && (h("td", { "aria-hidden": true, className: "fc-timegrid-col fc-timegrid-axis" },
                                h("div", { className: "fc-timegrid-col-frame" },
                                    h("div", { className: "fc-timegrid-now-indicator-container" }, typeof nowIndicatorTop === 'number' && (h(NowIndicatorContainer, { elClasses: ['fc-timegrid-now-indicator-arrow'], elStyle: { top: nowIndicatorTop }, isAxis: true, date: props.nowDate })))))),
                            props.cells.map((cell, i) => (h(TimeCol, { key: cell.key, elRef: this.cellElRefs.createRef(cell.key), dateProfile: props.dateProfile, date: cell.date, nowDate: props.nowDate, todayRange: props.todayRange, extraRenderProps: cell.extraRenderProps, extraDataAttrs: cell.extraDataAttrs, extraClassNames: cell.extraClassNames, extraDateSpan: cell.extraDateSpan, fgEventSegs: fgEventSegsByRow[i], bgEventSegs: bgEventSegsByRow[i], businessHourSegs: businessHourSegsByRow[i], nowIndicatorSegs: nowIndicatorSegsByRow[i], dateSelectionSegs: dateSelectionSegsByRow[i], eventDrag: eventDragByRow[i], eventResize: eventResizeByRow[i], slatCoords: props.slatCoords, eventSelection: props.eventSelection, forPrint: props.forPrint }))))))));
        }
        componentDidMount() {
            this.updateCoords();
        }
        componentDidUpdate() {
            this.updateCoords();
        }
        updateCoords() {
            let { props } = this;
            if (props.onColCoords &&
                props.clientWidth !== null // means sizing has stabilized
            ) {
                props.onColCoords(new PositionCache(this.rootElRef.current, collectCellEls$1(this.cellElRefs.currentMap, props.cells), true, // horizontal
                false));
            }
        }
    }
    function collectCellEls$1(elMap, cells) {
        return cells.map((cell) => elMap[cell.key]);
    }

    /* A component that renders one or more columns of vertical time slots
    ----------------------------------------------------------------------------------------------------------------------*/
    class TimeCols extends DateComponent {
        constructor() {
            super(...arguments);
            this.processSlotOptions = memoize(processSlotOptions);
            this.state = {
                slatCoords: null,
            };
            this.handleRootEl = (el) => {
                if (el) {
                    this.context.registerInteractiveComponent(this, {
                        el,
                        isHitComboAllowed: this.props.isHitComboAllowed,
                    });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
            this.handleScrollRequest = (request) => {
                let { onScrollTopRequest } = this.props;
                let { slatCoords } = this.state;
                if (onScrollTopRequest && slatCoords) {
                    if (request.time) {
                        let top = slatCoords.computeTimeTop(request.time);
                        top = Math.ceil(top); // zoom can give weird floating-point values. rather scroll a little bit further
                        if (top) {
                            top += 1; // to overcome top border that slots beyond the first have. looks better
                        }
                        onScrollTopRequest(top);
                    }
                    return true;
                }
                return false;
            };
            this.handleColCoords = (colCoords) => {
                this.colCoords = colCoords;
            };
            this.handleSlatCoords = (slatCoords) => {
                this.setState({ slatCoords });
                if (this.props.onSlatCoords) {
                    this.props.onSlatCoords(slatCoords);
                }
            };
        }
        render() {
            let { props, state } = this;
            return (h("div", { className: "fc-timegrid-body", ref: this.handleRootEl, style: {
                    // these props are important to give this wrapper correct dimensions for interactions
                    // TODO: if we set it here, can we avoid giving to inner tables?
                    width: props.clientWidth,
                    minWidth: props.tableMinWidth,
                } },
                h(TimeColsSlats, { axis: props.axis, dateProfile: props.dateProfile, slatMetas: props.slatMetas, clientWidth: props.clientWidth, minHeight: props.expandRows ? props.clientHeight : '', tableMinWidth: props.tableMinWidth, tableColGroupNode: props.axis ? props.tableColGroupNode : null /* axis depends on the colgroup's shrinking */, onCoords: this.handleSlatCoords }),
                h(TimeColsContent, { cells: props.cells, axis: props.axis, dateProfile: props.dateProfile, businessHourSegs: props.businessHourSegs, bgEventSegs: props.bgEventSegs, fgEventSegs: props.fgEventSegs, dateSelectionSegs: props.dateSelectionSegs, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, todayRange: props.todayRange, nowDate: props.nowDate, nowIndicatorSegs: props.nowIndicatorSegs, clientWidth: props.clientWidth, tableMinWidth: props.tableMinWidth, tableColGroupNode: props.tableColGroupNode, slatCoords: state.slatCoords, onColCoords: this.handleColCoords, forPrint: props.forPrint })));
        }
        componentDidMount() {
            this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
        }
        componentDidUpdate(prevProps) {
            this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
        }
        componentWillUnmount() {
            this.scrollResponder.detach();
        }
        queryHit(positionLeft, positionTop) {
            let { dateEnv, options } = this.context;
            let { colCoords } = this;
            let { dateProfile } = this.props;
            let { slatCoords } = this.state;
            let { snapDuration, snapsPerSlot } = this.processSlotOptions(this.props.slotDuration, options.snapDuration);
            let colIndex = colCoords.leftToIndex(positionLeft);
            let slatIndex = slatCoords.positions.topToIndex(positionTop);
            if (colIndex != null && slatIndex != null) {
                let cell = this.props.cells[colIndex];
                let slatTop = slatCoords.positions.tops[slatIndex];
                let slatHeight = slatCoords.positions.getHeight(slatIndex);
                let partial = (positionTop - slatTop) / slatHeight; // floating point number between 0 and 1
                let localSnapIndex = Math.floor(partial * snapsPerSlot); // the snap # relative to start of slat
                let snapIndex = slatIndex * snapsPerSlot + localSnapIndex;
                let dayDate = this.props.cells[colIndex].date;
                let time = addDurations(dateProfile.slotMinTime, multiplyDuration(snapDuration, snapIndex));
                let start = dateEnv.add(dayDate, time);
                let end = dateEnv.add(start, snapDuration);
                return {
                    dateProfile,
                    dateSpan: Object.assign({ range: { start, end }, allDay: false }, cell.extraDateSpan),
                    dayEl: colCoords.els[colIndex],
                    rect: {
                        left: colCoords.lefts[colIndex],
                        right: colCoords.rights[colIndex],
                        top: slatTop,
                        bottom: slatTop + slatHeight,
                    },
                    layer: 0,
                };
            }
            return null;
        }
    }
    function processSlotOptions(slotDuration, snapDurationOverride) {
        let snapDuration = snapDurationOverride || slotDuration;
        let snapsPerSlot = wholeDivideDurations(slotDuration, snapDuration);
        if (snapsPerSlot === null) {
            snapDuration = slotDuration;
            snapsPerSlot = 1;
            // TODO: say warning?
        }
        return { snapDuration, snapsPerSlot };
    }

    class DayTimeColsSlicer extends Slicer {
        sliceRange(range, dayRanges) {
            let segs = [];
            for (let col = 0; col < dayRanges.length; col += 1) {
                let segRange = intersectRanges(range, dayRanges[col]);
                if (segRange) {
                    segs.push({
                        start: segRange.start,
                        end: segRange.end,
                        isStart: segRange.start.valueOf() === range.start.valueOf(),
                        isEnd: segRange.end.valueOf() === range.end.valueOf(),
                        col,
                    });
                }
            }
            return segs;
        }
    }

    class DayTimeCols extends DateComponent {
        constructor() {
            super(...arguments);
            this.buildDayRanges = memoize(buildDayRanges);
            this.slicer = new DayTimeColsSlicer();
            this.timeColsRef = y();
        }
        render() {
            let { props, context } = this;
            let { dateProfile, dayTableModel } = props;
            let isNowIndicator = context.options.nowIndicator;
            let dayRanges = this.buildDayRanges(dayTableModel, dateProfile, context.dateEnv);
            // give it the first row of cells
            // TODO: would move this further down hierarchy, but sliceNowDate needs it
            return (h(NowTimer, { unit: isNowIndicator ? 'minute' : 'day' }, (nowDate, todayRange) => (h(TimeCols, Object.assign({ ref: this.timeColsRef }, this.slicer.sliceProps(props, dateProfile, null, context, dayRanges), { forPrint: props.forPrint, axis: props.axis, dateProfile: dateProfile, slatMetas: props.slatMetas, slotDuration: props.slotDuration, cells: dayTableModel.cells[0], tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, clientWidth: props.clientWidth, clientHeight: props.clientHeight, expandRows: props.expandRows, nowDate: nowDate, nowIndicatorSegs: isNowIndicator && this.slicer.sliceNowDate(nowDate, context, dayRanges), todayRange: todayRange, onScrollTopRequest: props.onScrollTopRequest, onSlatCoords: props.onSlatCoords })))));
        }
    }
    function buildDayRanges(dayTableModel, dateProfile, dateEnv) {
        let ranges = [];
        for (let date of dayTableModel.headerDates) {
            ranges.push({
                start: dateEnv.add(date, dateProfile.slotMinTime),
                end: dateEnv.add(date, dateProfile.slotMaxTime),
            });
        }
        return ranges;
    }

    // potential nice values for the slot-duration and interval-duration
    // from largest to smallest
    const STOCK_SUB_DURATIONS$1 = [
        { hours: 1 },
        { minutes: 30 },
        { minutes: 15 },
        { seconds: 30 },
        { seconds: 15 },
    ];
    function buildSlatMetas(slotMinTime, slotMaxTime, explicitLabelInterval, slotDuration, dateEnv) {
        let dayStart = new Date(0);
        let slatTime = slotMinTime;
        let slatIterator = createDuration(0);
        let labelInterval = explicitLabelInterval || computeLabelInterval(slotDuration);
        let metas = [];
        while (asRoughMs(slatTime) < asRoughMs(slotMaxTime)) {
            let date = dateEnv.add(dayStart, slatTime);
            let isLabeled = wholeDivideDurations(slatIterator, labelInterval) !== null;
            metas.push({
                date,
                time: slatTime,
                key: date.toISOString(),
                isoTimeStr: formatIsoTimeString(date),
                isLabeled,
            });
            slatTime = addDurations(slatTime, slotDuration);
            slatIterator = addDurations(slatIterator, slotDuration);
        }
        return metas;
    }
    // Computes an automatic value for slotLabelInterval
    function computeLabelInterval(slotDuration) {
        let i;
        let labelInterval;
        let slotsPerLabel;
        // find the smallest stock label interval that results in more than one slots-per-label
        for (i = STOCK_SUB_DURATIONS$1.length - 1; i >= 0; i -= 1) {
            labelInterval = createDuration(STOCK_SUB_DURATIONS$1[i]);
            slotsPerLabel = wholeDivideDurations(labelInterval, slotDuration);
            if (slotsPerLabel !== null && slotsPerLabel > 1) {
                return labelInterval;
            }
        }
        return slotDuration; // fall back
    }

    class DayTimeColsView extends TimeColsView {
        constructor() {
            super(...arguments);
            this.buildTimeColsModel = memoize(buildTimeColsModel);
            this.buildSlatMetas = memoize(buildSlatMetas);
        }
        render() {
            let { options, dateEnv, dateProfileGenerator } = this.context;
            let { props } = this;
            let { dateProfile } = props;
            let dayTableModel = this.buildTimeColsModel(dateProfile, dateProfileGenerator);
            let splitProps = this.allDaySplitter.splitProps(props);
            let slatMetas = this.buildSlatMetas(dateProfile.slotMinTime, dateProfile.slotMaxTime, options.slotLabelInterval, options.slotDuration, dateEnv);
            let { dayMinWidth } = options;
            let hasAttachedAxis = !dayMinWidth;
            let hasDetachedAxis = dayMinWidth;
            let headerContent = options.dayHeaders && (h(DayHeader, { dates: dayTableModel.headerDates, dateProfile: dateProfile, datesRepDistinctDays: true, renderIntro: hasAttachedAxis ? this.renderHeadAxis : null }));
            let allDayContent = (options.allDaySlot !== false) && ((contentArg) => (h(DayTable, Object.assign({}, splitProps.allDay, { dateProfile: dateProfile, dayTableModel: dayTableModel, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, renderRowIntro: hasAttachedAxis ? this.renderTableRowAxis : null, showWeekNumbers: false, expandRows: false, headerAlignElRef: this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }, this.getAllDayMaxEventProps()))));
            let timeGridContent = (contentArg) => (h(DayTimeCols, Object.assign({}, splitProps.timed, { dayTableModel: dayTableModel, dateProfile: dateProfile, axis: hasAttachedAxis, slotDuration: options.slotDuration, slatMetas: slatMetas, forPrint: props.forPrint, tableColGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, onSlatCoords: this.handleSlatCoords, expandRows: contentArg.expandRows, onScrollTopRequest: this.handleScrollTopRequest })));
            return hasDetachedAxis
                ? this.renderHScrollLayout(headerContent, allDayContent, timeGridContent, dayTableModel.colCnt, dayMinWidth, slatMetas, this.state.slatCoords)
                : this.renderSimpleLayout(headerContent, allDayContent, timeGridContent);
        }
    }
    function buildTimeColsModel(dateProfile, dateProfileGenerator) {
        let daySeries = new DaySeriesModel(dateProfile.renderRange, dateProfileGenerator);
        return new DayTableModel(daySeries, false);
    }

    const OPTION_REFINERS$3 = {
        allDaySlot: Boolean,
    };

    var css_248z$4 = ".fc-v-event{background-color:var(--fc-event-bg-color);border:1px solid var(--fc-event-border-color);display:block}.fc-v-event .fc-event-main{color:var(--fc-event-text-color);height:100%}.fc-v-event .fc-event-main-frame{display:flex;flex-direction:column;height:100%}.fc-v-event .fc-event-time{flex-grow:0;flex-shrink:0;max-height:100%;overflow:hidden}.fc-v-event .fc-event-title-container{flex-grow:1;flex-shrink:1;min-height:0}.fc-v-event .fc-event-title{bottom:0;max-height:100%;overflow:hidden;top:0}.fc-v-event:not(.fc-event-start){border-top-left-radius:0;border-top-right-radius:0;border-top-width:0}.fc-v-event:not(.fc-event-end){border-bottom-left-radius:0;border-bottom-right-radius:0;border-bottom-width:0}.fc-v-event.fc-event-selected:before{left:-10px;right:-10px}.fc-v-event .fc-event-resizer-start{cursor:n-resize}.fc-v-event .fc-event-resizer-end{cursor:s-resize}.fc-v-event:not(.fc-event-selected) .fc-event-resizer{height:var(--fc-event-resizer-thickness);left:0;right:0}.fc-v-event:not(.fc-event-selected) .fc-event-resizer-start{top:calc(var(--fc-event-resizer-thickness)/-2)}.fc-v-event:not(.fc-event-selected) .fc-event-resizer-end{bottom:calc(var(--fc-event-resizer-thickness)/-2)}.fc-v-event.fc-event-selected .fc-event-resizer{left:50%;margin-left:calc(var(--fc-event-resizer-dot-total-width)/-2)}.fc-v-event.fc-event-selected .fc-event-resizer-start{top:calc(var(--fc-event-resizer-dot-total-width)/-2)}.fc-v-event.fc-event-selected .fc-event-resizer-end{bottom:calc(var(--fc-event-resizer-dot-total-width)/-2)}.fc .fc-timegrid .fc-daygrid-body{z-index:2}.fc .fc-timegrid-divider{padding:0 0 2px}.fc .fc-timegrid-body{min-height:100%;position:relative;z-index:1}.fc .fc-timegrid-axis-chunk{position:relative}.fc .fc-timegrid-axis-chunk>table,.fc .fc-timegrid-slots{position:relative;z-index:1}.fc .fc-timegrid-slot{border-bottom:0;height:1.5em}.fc .fc-timegrid-slot:empty:before{content:\"\\00a0\"}.fc .fc-timegrid-slot-minor{border-top-style:dotted}.fc .fc-timegrid-slot-label-cushion{display:inline-block;white-space:nowrap}.fc .fc-timegrid-slot-label{vertical-align:middle}.fc .fc-timegrid-axis-cushion,.fc .fc-timegrid-slot-label-cushion{padding:0 4px}.fc .fc-timegrid-axis-frame-liquid{height:100%}.fc .fc-timegrid-axis-frame{align-items:center;display:flex;justify-content:flex-end;overflow:hidden}.fc .fc-timegrid-axis-cushion{flex-shrink:0;max-width:60px}.fc-direction-ltr .fc-timegrid-slot-label-frame{text-align:right}.fc-direction-rtl .fc-timegrid-slot-label-frame{text-align:left}.fc-liquid-hack .fc-timegrid-axis-frame-liquid{bottom:0;height:auto;left:0;position:absolute;right:0;top:0}.fc .fc-timegrid-col.fc-day-today{background-color:var(--fc-today-bg-color)}.fc .fc-timegrid-col-frame{min-height:100%;position:relative}.fc-media-screen.fc-liquid-hack .fc-timegrid-col-frame{bottom:0;height:auto;left:0;position:absolute;right:0;top:0}.fc-media-screen .fc-timegrid-cols{bottom:0;left:0;position:absolute;right:0;top:0}.fc-media-screen .fc-timegrid-cols>table{height:100%}.fc-media-screen .fc-timegrid-col-bg,.fc-media-screen .fc-timegrid-col-events,.fc-media-screen .fc-timegrid-now-indicator-container{left:0;position:absolute;right:0;top:0}.fc .fc-timegrid-col-bg{z-index:2}.fc .fc-timegrid-col-bg .fc-non-business{z-index:1}.fc .fc-timegrid-col-bg .fc-bg-event{z-index:2}.fc .fc-timegrid-col-bg .fc-highlight{z-index:3}.fc .fc-timegrid-bg-harness{left:0;position:absolute;right:0}.fc .fc-timegrid-col-events{z-index:3}.fc .fc-timegrid-now-indicator-container{bottom:0;overflow:hidden}.fc-direction-ltr .fc-timegrid-col-events{margin:0 2.5% 0 2px}.fc-direction-rtl .fc-timegrid-col-events{margin:0 2px 0 2.5%}.fc-timegrid-event-harness{position:absolute}.fc-timegrid-event-harness>.fc-timegrid-event{bottom:0;left:0;position:absolute;right:0;top:0}.fc-timegrid-event-harness-inset .fc-timegrid-event,.fc-timegrid-event.fc-event-mirror,.fc-timegrid-more-link{box-shadow:0 0 0 1px var(--fc-page-bg-color)}.fc-timegrid-event,.fc-timegrid-more-link{border-radius:3px;font-size:var(--fc-small-font-size)}.fc-timegrid-event{margin-bottom:1px}.fc-timegrid-event .fc-event-main{padding:1px 1px 0}.fc-timegrid-event .fc-event-time{font-size:var(--fc-small-font-size);margin-bottom:1px;white-space:nowrap}.fc-timegrid-event-short .fc-event-main-frame{flex-direction:row;overflow:hidden}.fc-timegrid-event-short .fc-event-time:after{content:\"\\00a0-\\00a0\"}.fc-timegrid-event-short .fc-event-title{font-size:var(--fc-small-font-size)}.fc-timegrid-more-link{background:var(--fc-more-link-bg-color);color:var(--fc-more-link-text-color);cursor:pointer;margin-bottom:1px;position:absolute;z-index:9999}.fc-timegrid-more-link-inner{padding:3px 2px;top:0}.fc-direction-ltr .fc-timegrid-more-link{right:0}.fc-direction-rtl .fc-timegrid-more-link{left:0}.fc .fc-timegrid-now-indicator-line{border-color:var(--fc-now-indicator-color);border-style:solid;border-width:1px 0 0;left:0;position:absolute;right:0;z-index:4}.fc .fc-timegrid-now-indicator-arrow{border-color:var(--fc-now-indicator-color);border-style:solid;margin-top:-5px;position:absolute;z-index:4}.fc-direction-ltr .fc-timegrid-now-indicator-arrow{border-bottom-color:transparent;border-top-color:transparent;border-width:5px 0 5px 6px;left:0}.fc-direction-rtl .fc-timegrid-now-indicator-arrow{border-bottom-color:transparent;border-top-color:transparent;border-width:5px 6px 5px 0;right:0}";
    injectStyles(css_248z$4);

    var index$9 = createPlugin({
        name: '@fullcalendar/timegrid',
        initialView: 'timeGridWeek',
        optionRefiners: OPTION_REFINERS$3,
        views: {
            timeGrid: {
                component: DayTimeColsView,
                usesMinMaxTime: true,
                allDaySlot: true,
                slotDuration: '00:30:00',
                slotEventOverlap: true, // a bad name. confused with overlap/constraint system
            },
            timeGridDay: {
                type: 'timeGrid',
                duration: { days: 1 },
            },
            timeGridWeek: {
                type: 'timeGrid',
                duration: { weeks: 1 },
            },
        },
    });

    class ListViewHeaderRow extends BaseComponent {
        constructor() {
            super(...arguments);
            this.state = {
                textId: getUniqueDomId(),
            };
        }
        render() {
            let { theme, dateEnv, options, viewApi } = this.context;
            let { cellId, dayDate, todayRange } = this.props;
            let { textId } = this.state;
            let dayMeta = getDateMeta(dayDate, todayRange);
            // will ever be falsy?
            let text = options.listDayFormat ? dateEnv.format(dayDate, options.listDayFormat) : '';
            // will ever be falsy? also, BAD NAME "alt"
            let sideText = options.listDaySideFormat ? dateEnv.format(dayDate, options.listDaySideFormat) : '';
            let renderProps = Object.assign({ date: dateEnv.toDate(dayDate), view: viewApi, textId,
                text,
                sideText, navLinkAttrs: buildNavLinkAttrs(this.context, dayDate), sideNavLinkAttrs: buildNavLinkAttrs(this.context, dayDate, 'day', false) }, dayMeta);
            // TODO: make a reusable HOC for dayHeader (used in daygrid/timegrid too)
            return (h(ContentContainer, { elTag: "tr", elClasses: [
                    'fc-list-day',
                    ...getDayClassNames(dayMeta, theme),
                ], elAttrs: {
                    'data-date': formatDayString(dayDate),
                }, renderProps: renderProps, generatorName: "dayHeaderContent", generator: options.dayHeaderContent || renderInnerContent$2, classNameGenerator: options.dayHeaderClassNames, didMount: options.dayHeaderDidMount, willUnmount: options.dayHeaderWillUnmount }, (InnerContent) => ( // TODO: force-hide top border based on :first-child
            h("th", { scope: "colgroup", colSpan: 3, id: cellId, "aria-labelledby": textId },
                h(InnerContent, { elTag: "div", elClasses: [
                        'fc-list-day-cushion',
                        theme.getClass('tableCellShaded'),
                    ] })))));
        }
    }
    function renderInnerContent$2(props) {
        return (h(p, null,
            props.text && (h("a", Object.assign({ id: props.textId, className: "fc-list-day-text" }, props.navLinkAttrs), props.text)),
            props.sideText && ( /* not keyboard tabbable */h("a", Object.assign({ "aria-hidden": true, className: "fc-list-day-side-text" }, props.sideNavLinkAttrs), props.sideText))));
    }

    const DEFAULT_TIME_FORMAT$1 = createFormatter({
        hour: 'numeric',
        minute: '2-digit',
        meridiem: 'short',
    });
    class ListViewEventRow extends BaseComponent {
        render() {
            let { props, context } = this;
            let { options } = context;
            let { seg, timeHeaderId, eventHeaderId, dateHeaderId } = props;
            let timeFormat = options.eventTimeFormat || DEFAULT_TIME_FORMAT$1;
            return (h(EventContainer, Object.assign({}, props, { elTag: "tr", elClasses: [
                    'fc-list-event',
                    seg.eventRange.def.url && 'fc-event-forced-url',
                ], defaultGenerator: () => renderEventInnerContent(seg, context) /* weird */, seg: seg, timeText: "", disableDragging: true, disableResizing: true }), (InnerContent, eventContentArg) => (h(p, null,
                buildTimeContent(seg, timeFormat, context, timeHeaderId, dateHeaderId),
                h("td", { "aria-hidden": true, className: "fc-list-event-graphic" },
                    h("span", { className: "fc-list-event-dot", style: {
                            borderColor: eventContentArg.borderColor || eventContentArg.backgroundColor,
                        } })),
                h(InnerContent, { elTag: "td", elClasses: ['fc-list-event-title'], elAttrs: { headers: `${eventHeaderId} ${dateHeaderId}` } })))));
        }
    }
    function renderEventInnerContent(seg, context) {
        let interactiveAttrs = getSegAnchorAttrs(seg, context);
        return (h("a", Object.assign({}, interactiveAttrs), seg.eventRange.def.title));
    }
    function buildTimeContent(seg, timeFormat, context, timeHeaderId, dateHeaderId) {
        let { options } = context;
        if (options.displayEventTime !== false) {
            let eventDef = seg.eventRange.def;
            let eventInstance = seg.eventRange.instance;
            let doAllDay = false;
            let timeText;
            if (eventDef.allDay) {
                doAllDay = true;
            }
            else if (isMultiDayRange(seg.eventRange.range)) { // TODO: use (!isStart || !isEnd) instead?
                if (seg.isStart) {
                    timeText = buildSegTimeText(seg, timeFormat, context, null, null, eventInstance.range.start, seg.end);
                }
                else if (seg.isEnd) {
                    timeText = buildSegTimeText(seg, timeFormat, context, null, null, seg.start, eventInstance.range.end);
                }
                else {
                    doAllDay = true;
                }
            }
            else {
                timeText = buildSegTimeText(seg, timeFormat, context);
            }
            if (doAllDay) {
                let renderProps = {
                    text: context.options.allDayText,
                    view: context.viewApi,
                };
                return (h(ContentContainer, { elTag: "td", elClasses: ['fc-list-event-time'], elAttrs: {
                        headers: `${timeHeaderId} ${dateHeaderId}`,
                    }, renderProps: renderProps, generatorName: "allDayContent", generator: options.allDayContent || renderAllDayInner, classNameGenerator: options.allDayClassNames, didMount: options.allDayDidMount, willUnmount: options.allDayWillUnmount }));
            }
            return (h("td", { className: "fc-list-event-time" }, timeText));
        }
        return null;
    }
    function renderAllDayInner(renderProps) {
        return renderProps.text;
    }

    /*
    Responsible for the scroller, and forwarding event-related actions into the "grid".
    */
    class ListView extends DateComponent {
        constructor() {
            super(...arguments);
            this.computeDateVars = memoize(computeDateVars);
            this.eventStoreToSegs = memoize(this._eventStoreToSegs);
            this.state = {
                timeHeaderId: getUniqueDomId(),
                eventHeaderId: getUniqueDomId(),
                dateHeaderIdRoot: getUniqueDomId(),
            };
            this.setRootEl = (rootEl) => {
                if (rootEl) {
                    this.context.registerInteractiveComponent(this, {
                        el: rootEl,
                    });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
        }
        render() {
            let { props, context } = this;
            let { dayDates, dayRanges } = this.computeDateVars(props.dateProfile);
            let eventSegs = this.eventStoreToSegs(props.eventStore, props.eventUiBases, dayRanges);
            return (h(ViewContainer$1, { elRef: this.setRootEl, elClasses: [
                    'fc-list',
                    context.theme.getClass('table'),
                    context.options.stickyHeaderDates !== false ?
                        'fc-list-sticky' :
                        '',
                ], viewSpec: context.viewSpec },
                h(Scroller, { liquid: !props.isHeightAuto, overflowX: props.isHeightAuto ? 'visible' : 'hidden', overflowY: props.isHeightAuto ? 'visible' : 'auto' }, eventSegs.length > 0 ?
                    this.renderSegList(eventSegs, dayDates) :
                    this.renderEmptyMessage())));
        }
        renderEmptyMessage() {
            let { options, viewApi } = this.context;
            let renderProps = {
                text: options.noEventsText,
                view: viewApi,
            };
            return (h(ContentContainer, { elTag: "div", elClasses: ['fc-list-empty'], renderProps: renderProps, generatorName: "noEventsContent", generator: options.noEventsContent || renderNoEventsInner, classNameGenerator: options.noEventsClassNames, didMount: options.noEventsDidMount, willUnmount: options.noEventsWillUnmount }, (InnerContent) => (h(InnerContent, { elTag: "div", elClasses: ['fc-list-empty-cushion'] }))));
        }
        renderSegList(allSegs, dayDates) {
            let { theme, options } = this.context;
            let { timeHeaderId, eventHeaderId, dateHeaderIdRoot } = this.state;
            let segsByDay = groupSegsByDay(allSegs); // sparse array
            return (h(NowTimer, { unit: "day" }, (nowDate, todayRange) => {
                let innerNodes = [];
                for (let dayIndex = 0; dayIndex < segsByDay.length; dayIndex += 1) {
                    let daySegs = segsByDay[dayIndex];
                    if (daySegs) { // sparse array, so might be undefined
                        let dayStr = formatDayString(dayDates[dayIndex]);
                        let dateHeaderId = dateHeaderIdRoot + '-' + dayStr;
                        // append a day header
                        innerNodes.push(h(ListViewHeaderRow, { key: dayStr, cellId: dateHeaderId, dayDate: dayDates[dayIndex], todayRange: todayRange }));
                        daySegs = sortEventSegs(daySegs, options.eventOrder);
                        for (let seg of daySegs) {
                            innerNodes.push(h(ListViewEventRow, Object.assign({ key: dayStr + ':' + seg.eventRange.instance.instanceId /* are multiple segs for an instanceId */, seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: false, timeHeaderId: timeHeaderId, eventHeaderId: eventHeaderId, dateHeaderId: dateHeaderId }, getSegMeta(seg, todayRange, nowDate))));
                        }
                    }
                }
                return (h("table", { className: 'fc-list-table ' + theme.getClass('table') },
                    h("thead", null,
                        h("tr", null,
                            h("th", { scope: "col", id: timeHeaderId }, options.timeHint),
                            h("th", { scope: "col", "aria-hidden": true }),
                            h("th", { scope: "col", id: eventHeaderId }, options.eventHint))),
                    h("tbody", null, innerNodes)));
            }));
        }
        _eventStoreToSegs(eventStore, eventUiBases, dayRanges) {
            return this.eventRangesToSegs(sliceEventStore(eventStore, eventUiBases, this.props.dateProfile.activeRange, this.context.options.nextDayThreshold).fg, dayRanges);
        }
        eventRangesToSegs(eventRanges, dayRanges) {
            let segs = [];
            for (let eventRange of eventRanges) {
                segs.push(...this.eventRangeToSegs(eventRange, dayRanges));
            }
            return segs;
        }
        eventRangeToSegs(eventRange, dayRanges) {
            let { dateEnv } = this.context;
            let { nextDayThreshold } = this.context.options;
            let range = eventRange.range;
            let allDay = eventRange.def.allDay;
            let dayIndex;
            let segRange;
            let seg;
            let segs = [];
            for (dayIndex = 0; dayIndex < dayRanges.length; dayIndex += 1) {
                segRange = intersectRanges(range, dayRanges[dayIndex]);
                if (segRange) {
                    seg = {
                        component: this,
                        eventRange,
                        start: segRange.start,
                        end: segRange.end,
                        isStart: eventRange.isStart && segRange.start.valueOf() === range.start.valueOf(),
                        isEnd: eventRange.isEnd && segRange.end.valueOf() === range.end.valueOf(),
                        dayIndex,
                    };
                    segs.push(seg);
                    // detect when range won't go fully into the next day,
                    // and mutate the latest seg to the be the end.
                    if (!seg.isEnd && !allDay &&
                        dayIndex + 1 < dayRanges.length &&
                        range.end <
                            dateEnv.add(dayRanges[dayIndex + 1].start, nextDayThreshold)) {
                        seg.end = range.end;
                        seg.isEnd = true;
                        break;
                    }
                }
            }
            return segs;
        }
    }
    function renderNoEventsInner(renderProps) {
        return renderProps.text;
    }
    function computeDateVars(dateProfile) {
        let dayStart = startOfDay(dateProfile.renderRange.start);
        let viewEnd = dateProfile.renderRange.end;
        let dayDates = [];
        let dayRanges = [];
        while (dayStart < viewEnd) {
            dayDates.push(dayStart);
            dayRanges.push({
                start: dayStart,
                end: addDays(dayStart, 1),
            });
            dayStart = addDays(dayStart, 1);
        }
        return { dayDates, dayRanges };
    }
    // Returns a sparse array of arrays, segs grouped by their dayIndex
    function groupSegsByDay(segs) {
        let segsByDay = []; // sparse array
        let i;
        let seg;
        for (i = 0; i < segs.length; i += 1) {
            seg = segs[i];
            (segsByDay[seg.dayIndex] || (segsByDay[seg.dayIndex] = []))
                .push(seg);
        }
        return segsByDay;
    }

    const OPTION_REFINERS$2 = {
        listDayFormat: createFalsableFormatter,
        listDaySideFormat: createFalsableFormatter,
        noEventsClassNames: identity,
        noEventsContent: identity,
        noEventsDidMount: identity,
        noEventsWillUnmount: identity,
        // noEventsText is defined in base options
    };
    function createFalsableFormatter(input) {
        return input === false ? null : createFormatter(input);
    }

    var css_248z$3 = ":root{--fc-list-event-dot-width:10px;--fc-list-event-hover-bg-color:#f5f5f5}.fc-theme-standard .fc-list{border:1px solid var(--fc-border-color)}.fc .fc-list-empty{align-items:center;background-color:var(--fc-neutral-bg-color);display:flex;height:100%;justify-content:center}.fc .fc-list-empty-cushion{margin:5em 0}.fc .fc-list-table{border-style:hidden;width:100%}.fc .fc-list-table tr>*{border-left:0;border-right:0}.fc .fc-list-sticky .fc-list-day>*{background:var(--fc-page-bg-color);position:sticky;top:0}.fc .fc-list-table thead{left:-10000px;position:absolute}.fc .fc-list-table tbody>tr:first-child th{border-top:0}.fc .fc-list-table th{padding:0}.fc .fc-list-day-cushion,.fc .fc-list-table td{padding:8px 14px}.fc .fc-list-day-cushion:after{clear:both;content:\"\";display:table}.fc-theme-standard .fc-list-day-cushion{background-color:var(--fc-neutral-bg-color)}.fc-direction-ltr .fc-list-day-text,.fc-direction-rtl .fc-list-day-side-text{float:left}.fc-direction-ltr .fc-list-day-side-text,.fc-direction-rtl .fc-list-day-text{float:right}.fc-direction-ltr .fc-list-table .fc-list-event-graphic{padding-right:0}.fc-direction-rtl .fc-list-table .fc-list-event-graphic{padding-left:0}.fc .fc-list-event.fc-event-forced-url{cursor:pointer}.fc .fc-list-event:hover td{background-color:var(--fc-list-event-hover-bg-color)}.fc .fc-list-event-graphic,.fc .fc-list-event-time{white-space:nowrap;width:1px}.fc .fc-list-event-dot{border:calc(var(--fc-list-event-dot-width)/2) solid var(--fc-event-border-color);border-radius:calc(var(--fc-list-event-dot-width)/2);box-sizing:content-box;display:inline-block;height:0;width:0}.fc .fc-list-event-title a{color:inherit;text-decoration:none}.fc .fc-list-event.fc-event-forced-url:hover a{text-decoration:underline}";
    injectStyles(css_248z$3);

    var index$8 = createPlugin({
        name: '@fullcalendar/list',
        optionRefiners: OPTION_REFINERS$2,
        views: {
            list: {
                component: ListView,
                buttonTextKey: 'list',
                listDayFormat: { month: 'long', day: 'numeric', year: 'numeric' }, // like "January 1, 2016"
            },
            listDay: {
                type: 'list',
                duration: { days: 1 },
                listDayFormat: { weekday: 'long' }, // day-of-week is all we need. full date is probably in headerToolbar
            },
            listWeek: {
                type: 'list',
                duration: { weeks: 1 },
                listDayFormat: { weekday: 'long' },
                listDaySideFormat: { month: 'long', day: 'numeric', year: 'numeric' },
            },
            listMonth: {
                type: 'list',
                duration: { month: 1 },
                listDaySideFormat: { weekday: 'long' }, // day-of-week is nice-to-have
            },
            listYear: {
                type: 'list',
                duration: { year: 1 },
                listDaySideFormat: { weekday: 'long' }, // day-of-week is nice-to-have
            },
        },
    });

    const UPGRADE_WINDOW = 365 + 7; // days. 1 week leeway, for tz shift reasons too
    const INVALID_LICENSE_URL = 'https://fullcalendar.io/docs/schedulerLicenseKey#invalid';
    const OUTDATED_LICENSE_URL = 'https://fullcalendar.io/docs/schedulerLicenseKey#outdated';
    const PRESET_LICENSE_KEYS = [
        'GPL-My-Project-Is-Open-Source',
        'CC-Attribution-NonCommercial-NoDerivatives',
    ];
    const CSS = {
        position: 'absolute',
        zIndex: 99999,
        bottom: '1px',
        left: '1px',
        background: '#eee',
        borderColor: '#ddd',
        borderStyle: 'solid',
        borderWidth: '1px 1px 0 0',
        padding: '2px 4px',
        fontSize: '12px',
        borderTopRightRadius: '3px',
    };
    function buildLicenseWarning(context) {
        let key = context.options.schedulerLicenseKey;
        let currentUrl = typeof window !== 'undefined' ? window.location.href : '';
        if (!isImmuneUrl(currentUrl)) {
            let status = processLicenseKey(key, context.pluginHooks.premiumReleaseDate);
            if (status !== 'valid') {
                return (h("div", { className: "fc-license-message", style: CSS }, (status === 'outdated') ? (h(p, null,
                    'Your license key is too old to work with this version. ',
                    h("a", { href: OUTDATED_LICENSE_URL }, "More Info"))) : (h(p, null,
                    'Your license key is invalid. ',
                    h("a", { href: INVALID_LICENSE_URL }, "More Info")))));
            }
        }
        return null;
    }
    /*
    This decryption is not meant to be bulletproof. Just a way to remind about an upgrade.
    */
    function processLicenseKey(key, premiumReleaseDate) {
        if (PRESET_LICENSE_KEYS.indexOf(key) !== -1) {
            return 'valid';
        }
        const parts = (key || '').match(/^(\d+)-fcs-(\d+)$/);
        if (parts && (parts[1].length === 10)) {
            const purchaseDate = new Date(parseInt(parts[2], 10) * 1000);
            const releaseDate = config.mockSchedulerReleaseDate || premiumReleaseDate;
            if (isValidDate$1(releaseDate)) { // token won't be replaced in dev mode
                const minPurchaseDate = addDays(releaseDate, -UPGRADE_WINDOW);
                if (minPurchaseDate < purchaseDate) {
                    return 'valid';
                }
                return 'outdated';
            }
        }
        return 'invalid';
    }
    function isImmuneUrl(url) {
        return /\w+:\/\/fullcalendar\.io\/|\/examples\/[\w-]+\.html$/.test(url);
    }

    const OPTION_REFINERS$1 = {
        schedulerLicenseKey: String,
    };

    var index$7 = createPlugin({
        name: '@fullcalendar/premium-common',
        premiumReleaseDate: '2022-12-27',
        optionRefiners: OPTION_REFINERS$1,
        viewContainerAppends: [buildLicenseWarning],
    });

    // TODO: assume the el has no borders?
    function getScrollCanvasOrigin(scrollEl) {
        let rect = scrollEl.getBoundingClientRect();
        let edges = computeEdges(scrollEl); // TODO: pass in isRtl?
        return {
            left: rect.left + edges.borderLeft + edges.scrollbarLeft - getScrollFromLeftEdge(scrollEl),
            top: rect.top + edges.borderTop - scrollEl.scrollTop,
        };
    }
    function getScrollFromLeftEdge(el) {
        let scrollLeft = el.scrollLeft;
        let computedStyles = window.getComputedStyle(el); // TODO: pass in isRtl instead?
        if (computedStyles.direction === 'rtl') {
            switch (getRtlScrollSystem()) {
                case 'negative':
                    scrollLeft *= -1; // convert to 'reverse'. fall through...
                case 'reverse': // scrollLeft is distance between scrollframe's right edge scrollcanvas's right edge
                    scrollLeft = el.scrollWidth - scrollLeft - el.clientWidth;
            }
        }
        return scrollLeft;
    }
    function setScrollFromLeftEdge(el, scrollLeft) {
        let computedStyles = window.getComputedStyle(el); // TODO: pass in isRtl instead?
        if (computedStyles.direction === 'rtl') {
            switch (getRtlScrollSystem()) {
                case 'reverse':
                    scrollLeft = el.scrollWidth - scrollLeft;
                    break;
                case 'negative':
                    scrollLeft = -(el.scrollWidth - scrollLeft);
                    break;
            }
        }
        el.scrollLeft = scrollLeft;
    }
    // Horizontal Scroll System Detection
    // ----------------------------------------------------------------------------------------------
    let _rtlScrollSystem;
    function getRtlScrollSystem() {
        return _rtlScrollSystem || (_rtlScrollSystem = detectRtlScrollSystem());
    }
    function detectRtlScrollSystem() {
        let el = document.createElement('div');
        el.style.position = 'absolute';
        el.style.top = '-1000px';
        el.style.width = '1px';
        el.style.height = '1px';
        el.style.overflow = 'scroll';
        el.style.direction = 'rtl';
        el.style.fontSize = '100px';
        el.innerHTML = 'A';
        document.body.appendChild(el);
        let system;
        if (el.scrollLeft > 0) {
            system = 'positive'; // scroll is a positive number from the left edge
        }
        else {
            el.scrollLeft = 1;
            if (el.scrollLeft > 0) {
                system = 'reverse'; // scroll is a positive number from the right edge
            }
            else {
                system = 'negative'; // scroll is a negative number from the right edge
            }
        }
        removeElement(el);
        return system;
    }

    const STICKY_SELECTOR = '.fc-sticky';
    /*
    Goes beyond mere position:sticky, allows horizontal centering

    REQUIREMENT: fc-sticky elements, if the fc-sticky className is taken away, should NOT have relative or absolute positioning.
    This is because we attach the coords with JS, and the VDOM might take away the fc-sticky class but doesn't know kill the positioning.

    TODO: don't query text-align:center. isn't compatible with flexbox centering. instead, check natural X coord within parent container
    */
    class StickyScrolling {
        constructor(scrollEl, isRtl) {
            this.scrollEl = scrollEl;
            this.isRtl = isRtl;
            this.updateSize = () => {
                let { scrollEl } = this;
                let els = findElements(scrollEl, STICKY_SELECTOR);
                let elGeoms = this.queryElGeoms(els);
                let viewportWidth = scrollEl.clientWidth;
                assignStickyPositions(els, elGeoms, viewportWidth);
            };
        }
        queryElGeoms(els) {
            let { scrollEl, isRtl } = this;
            let canvasOrigin = getScrollCanvasOrigin(scrollEl);
            let elGeoms = [];
            for (let el of els) {
                let parentBound = translateRect(computeInnerRect(el.parentNode, true, true), // weird way to call this!!!
                -canvasOrigin.left, -canvasOrigin.top);
                let elRect = el.getBoundingClientRect();
                let computedStyles = window.getComputedStyle(el);
                let textAlign = window.getComputedStyle(el.parentNode).textAlign; // ask the parent
                let naturalBound = null;
                if (textAlign === 'start') {
                    textAlign = isRtl ? 'right' : 'left';
                }
                else if (textAlign === 'end') {
                    textAlign = isRtl ? 'left' : 'right';
                }
                if (computedStyles.position !== 'sticky') {
                    naturalBound = translateRect(elRect, -canvasOrigin.left - (parseFloat(computedStyles.left) || 0), // could be 'auto'
                    -canvasOrigin.top - (parseFloat(computedStyles.top) || 0));
                }
                elGeoms.push({
                    parentBound,
                    naturalBound,
                    elWidth: elRect.width,
                    elHeight: elRect.height,
                    textAlign,
                });
            }
            return elGeoms;
        }
    }
    function assignStickyPositions(els, elGeoms, viewportWidth) {
        els.forEach((el, i) => {
            let { textAlign, elWidth, parentBound } = elGeoms[i];
            let parentWidth = parentBound.right - parentBound.left;
            let left;
            if (textAlign === 'center' &&
                parentWidth > viewportWidth) {
                left = (viewportWidth - elWidth) / 2;
            }
            else { // if parent container can be completely in view, we don't need stickiness
                left = '';
            }
            applyStyle(el, {
                left,
                right: left,
                top: 0,
            });
        });
    }

    class ClippedScroller extends BaseComponent {
        constructor() {
            super(...arguments);
            this.elRef = y();
            this.state = {
                xScrollbarWidth: 0,
                yScrollbarWidth: 0,
            };
            this.handleScroller = (scroller) => {
                this.scroller = scroller;
                setRef(this.props.scrollerRef, scroller);
            };
            this.handleSizing = () => {
                let { props } = this;
                if (props.overflowY === 'scroll-hidden') {
                    this.setState({ yScrollbarWidth: this.scroller.getYScrollbarWidth() });
                }
                if (props.overflowX === 'scroll-hidden') {
                    this.setState({ xScrollbarWidth: this.scroller.getXScrollbarWidth() });
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let isScrollbarOnLeft = context.isRtl && getIsRtlScrollbarOnLeft();
            let overcomeLeft = 0;
            let overcomeRight = 0;
            let overcomeBottom = 0;
            if (props.overflowX === 'scroll-hidden') {
                overcomeBottom = state.xScrollbarWidth;
            }
            if (props.overflowY === 'scroll-hidden') {
                if (state.yScrollbarWidth != null) {
                    if (isScrollbarOnLeft) {
                        overcomeLeft = state.yScrollbarWidth;
                    }
                    else {
                        overcomeRight = state.yScrollbarWidth;
                    }
                }
            }
            return (h("div", { ref: this.elRef, className: 'fc-scroller-harness' + (props.liquid ? ' fc-scroller-harness-liquid' : '') },
                h(Scroller, { ref: this.handleScroller, elRef: this.props.scrollerElRef, overflowX: props.overflowX === 'scroll-hidden' ? 'scroll' : props.overflowX, overflowY: props.overflowY === 'scroll-hidden' ? 'scroll' : props.overflowY, overcomeLeft: overcomeLeft, overcomeRight: overcomeRight, overcomeBottom: overcomeBottom, maxHeight: typeof props.maxHeight === 'number'
                        ? (props.maxHeight + (props.overflowX === 'scroll-hidden' ? state.xScrollbarWidth : 0))
                        : '', liquid: props.liquid, liquidIsAbsolute: true }, props.children)));
        }
        componentDidMount() {
            this.handleSizing();
            this.context.addResizeHandler(this.handleSizing);
        }
        componentDidUpdate(prevProps) {
            if (!isPropsEqual(prevProps, this.props)) { // an external change?
                this.handleSizing();
            }
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleSizing);
        }
        needsXScrolling() {
            return this.scroller.needsXScrolling();
        }
        needsYScrolling() {
            return this.scroller.needsYScrolling();
        }
    }

    const WHEEL_EVENT_NAMES = 'wheel mousewheel DomMouseScroll MozMousePixelScroll'.split(' ');
    /*
    ALSO, with the ability to disable touch
    */
    class ScrollListener {
        constructor(el) {
            this.el = el;
            this.emitter = new Emitter();
            this.isScrolling = false;
            this.isTouching = false; // user currently has finger down?
            this.isRecentlyWheeled = false;
            this.isRecentlyScrolled = false;
            this.wheelWaiter = new DelayedRunner(this._handleWheelWaited.bind(this));
            this.scrollWaiter = new DelayedRunner(this._handleScrollWaited.bind(this));
            // Handlers
            // ----------------------------------------------------------------------------------------------
            this.handleScroll = () => {
                this.startScroll();
                this.emitter.trigger('scroll', this.isRecentlyWheeled, this.isTouching);
                this.isRecentlyScrolled = true;
                this.scrollWaiter.request(500);
            };
            // will fire *before* the scroll event is fired (might not cause a scroll)
            this.handleWheel = () => {
                this.isRecentlyWheeled = true;
                this.wheelWaiter.request(500);
            };
            // will fire *before* the scroll event is fired (might not cause a scroll)
            this.handleTouchStart = () => {
                this.isTouching = true;
            };
            this.handleTouchEnd = () => {
                this.isTouching = false;
                // if the user ended their touch, and the scroll area wasn't moving,
                // we consider this to be the end of the scroll.
                if (!this.isRecentlyScrolled) {
                    this.endScroll(); // won't fire if already ended
                }
            };
            el.addEventListener('scroll', this.handleScroll);
            el.addEventListener('touchstart', this.handleTouchStart, { passive: true });
            el.addEventListener('touchend', this.handleTouchEnd);
            for (let eventName of WHEEL_EVENT_NAMES) {
                el.addEventListener(eventName, this.handleWheel);
            }
        }
        destroy() {
            let { el } = this;
            el.removeEventListener('scroll', this.handleScroll);
            el.removeEventListener('touchstart', this.handleTouchStart, { passive: true });
            el.removeEventListener('touchend', this.handleTouchEnd);
            for (let eventName of WHEEL_EVENT_NAMES) {
                el.removeEventListener(eventName, this.handleWheel);
            }
        }
        // Start / Stop
        // ----------------------------------------------------------------------------------------------
        startScroll() {
            if (!this.isScrolling) {
                this.isScrolling = true;
                this.emitter.trigger('scrollStart', this.isRecentlyWheeled, this.isTouching);
            }
        }
        endScroll() {
            if (this.isScrolling) {
                this.emitter.trigger('scrollEnd');
                this.isScrolling = false;
                this.isRecentlyScrolled = true;
                this.isRecentlyWheeled = false;
                this.scrollWaiter.clear();
                this.wheelWaiter.clear();
            }
        }
        _handleScrollWaited() {
            this.isRecentlyScrolled = false;
            // only end the scroll if not currently touching.
            // if touching, the scrolling will end later, on touchend.
            if (!this.isTouching) {
                this.endScroll(); // won't fire if already ended
            }
        }
        _handleWheelWaited() {
            this.isRecentlyWheeled = false;
        }
    }

    class ScrollSyncer {
        constructor(isVertical, scrollEls) {
            this.isVertical = isVertical;
            this.scrollEls = scrollEls;
            this.isPaused = false;
            this.scrollListeners = scrollEls.map((el) => this.bindScroller(el));
        }
        destroy() {
            for (let scrollListener of this.scrollListeners) {
                scrollListener.destroy();
            }
        }
        bindScroller(el) {
            let { scrollEls, isVertical } = this;
            let scrollListener = new ScrollListener(el);
            const onScroll = (isWheel, isTouch) => {
                if (!this.isPaused) {
                    if (!this.masterEl || (this.masterEl !== el && (isWheel || isTouch))) {
                        this.assignMaster(el);
                    }
                    if (this.masterEl === el) { // dealing with current
                        for (let otherEl of scrollEls) {
                            if (otherEl !== el) {
                                if (isVertical) {
                                    otherEl.scrollTop = el.scrollTop;
                                }
                                else {
                                    otherEl.scrollLeft = el.scrollLeft;
                                }
                            }
                        }
                    }
                }
            };
            const onScrollEnd = () => {
                if (this.masterEl === el) {
                    this.masterEl = null;
                }
            };
            scrollListener.emitter.on('scroll', onScroll);
            scrollListener.emitter.on('scrollEnd', onScrollEnd);
            return scrollListener;
        }
        assignMaster(el) {
            this.masterEl = el;
            for (let scrollListener of this.scrollListeners) {
                if (scrollListener.el !== el) {
                    scrollListener.endScroll(); // to prevent residual scrolls from reclaiming master
                }
            }
        }
        /*
        will normalize the scrollLeft value
        */
        forceScrollLeft(scrollLeft) {
            this.isPaused = true;
            for (let listener of this.scrollListeners) {
                setScrollFromLeftEdge(listener.el, scrollLeft);
            }
            this.isPaused = false;
        }
        forceScrollTop(top) {
            this.isPaused = true;
            for (let listener of this.scrollListeners) {
                listener.el.scrollTop = top;
            }
            this.isPaused = false;
        }
    }

    config.SCROLLGRID_RESIZE_INTERVAL = 500;
    /*
    TODO: make <ScrollGridSection> subcomponent
    NOTE: doesn't support collapsibleWidth (which is sortof a hack anyway)
    */
    class ScrollGrid extends BaseComponent {
        constructor() {
            super(...arguments);
            this.compileColGroupStats = memoizeArraylike(compileColGroupStat, isColGroupStatsEqual);
            this.renderMicroColGroups = memoizeArraylike(renderMicroColGroup); // yucky to memoize VNodes, but much more efficient for consumers
            this.clippedScrollerRefs = new RefMap();
            // doesn't hold non-scrolling els used just for padding
            this.scrollerElRefs = new RefMap(this._handleScrollerEl.bind(this));
            this.chunkElRefs = new RefMap(this._handleChunkEl.bind(this));
            this.scrollSyncersBySection = {};
            this.scrollSyncersByColumn = {};
            // for row-height-syncing
            this.rowUnstableMap = new Map(); // no need to groom. always self-cancels
            this.rowInnerMaxHeightMap = new Map();
            this.anyRowHeightsChanged = false;
            this.recentSizingCnt = 0;
            this.state = {
                shrinkWidths: [],
                forceYScrollbars: false,
                forceXScrollbars: false,
                scrollerClientWidths: {},
                scrollerClientHeights: {},
                sectionRowMaxHeights: [],
            };
            this.handleSizing = (isForcedResize, sectionRowMaxHeightsChanged) => {
                if (!this.allowSizing()) {
                    return;
                }
                if (!sectionRowMaxHeightsChanged) { // something else changed, probably external
                    this.anyRowHeightsChanged = true;
                }
                let otherState = {};
                // if reacting to self-change of sectionRowMaxHeightsChanged, or not stable, don't do anything
                if (isForcedResize || (!sectionRowMaxHeightsChanged && !this.rowUnstableMap.size)) {
                    otherState.sectionRowMaxHeights = this.computeSectionRowMaxHeights();
                }
                this.setState(Object.assign(Object.assign({ shrinkWidths: this.computeShrinkWidths() }, this.computeScrollerDims()), otherState), () => {
                    if (!this.rowUnstableMap.size) {
                        this.updateStickyScrolling(); // needs to happen AFTER final positioning committed to DOM
                    }
                });
            };
            this.handleRowHeightChange = (rowEl, isStable) => {
                let { rowUnstableMap, rowInnerMaxHeightMap } = this;
                if (!isStable) {
                    rowUnstableMap.set(rowEl, true);
                }
                else {
                    rowUnstableMap.delete(rowEl);
                    let innerMaxHeight = getRowInnerMaxHeight(rowEl);
                    if (!rowInnerMaxHeightMap.has(rowEl) || rowInnerMaxHeightMap.get(rowEl) !== innerMaxHeight) {
                        rowInnerMaxHeightMap.set(rowEl, innerMaxHeight);
                        this.anyRowHeightsChanged = true;
                    }
                    if (!rowUnstableMap.size && this.anyRowHeightsChanged) {
                        this.anyRowHeightsChanged = false;
                        this.setState({
                            sectionRowMaxHeights: this.computeSectionRowMaxHeights(),
                        });
                    }
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let { shrinkWidths } = state;
            let colGroupStats = this.compileColGroupStats(props.colGroups.map((colGroup) => [colGroup]));
            let microColGroupNodes = this.renderMicroColGroups(colGroupStats.map((stat, i) => [stat.cols, shrinkWidths[i]]));
            let classNames = getScrollGridClassNames(props.liquid, context);
            this.getDims();
            // TODO: make DRY
            let sectionConfigs = props.sections;
            let configCnt = sectionConfigs.length;
            let configI = 0;
            let currentConfig;
            let headSectionNodes = [];
            let bodySectionNodes = [];
            let footSectionNodes = [];
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'header') {
                headSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, true));
                configI += 1;
            }
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'body') {
                bodySectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, false));
                configI += 1;
            }
            while (configI < configCnt && (currentConfig = sectionConfigs[configI]).type === 'footer') {
                footSectionNodes.push(this.renderSection(currentConfig, configI, colGroupStats, microColGroupNodes, state.sectionRowMaxHeights, true));
                configI += 1;
            }
            const isBuggy = !getCanVGrowWithinCell(); // see NOTE in SimpleScrollGrid
            const roleAttrs = { role: 'rowgroup' };
            return h('table', {
                ref: props.elRef,
                role: 'grid',
                className: classNames.join(' '),
            }, renderMacroColGroup(colGroupStats, shrinkWidths), Boolean(!isBuggy && headSectionNodes.length) && h('thead', roleAttrs, ...headSectionNodes), Boolean(!isBuggy && bodySectionNodes.length) && h('tbody', roleAttrs, ...bodySectionNodes), Boolean(!isBuggy && footSectionNodes.length) && h('tfoot', roleAttrs, ...footSectionNodes), isBuggy && h('tbody', roleAttrs, ...headSectionNodes, ...bodySectionNodes, ...footSectionNodes));
        }
        renderSection(sectionConfig, sectionIndex, colGroupStats, microColGroupNodes, sectionRowMaxHeights, isHeader) {
            if ('outerContent' in sectionConfig) {
                return (h(p, { key: sectionConfig.key }, sectionConfig.outerContent));
            }
            return (h("tr", { key: sectionConfig.key, role: "presentation", className: getSectionClassNames(sectionConfig, this.props.liquid).join(' ') }, sectionConfig.chunks.map((chunkConfig, i) => this.renderChunk(sectionConfig, sectionIndex, colGroupStats[i], microColGroupNodes[i], chunkConfig, i, (sectionRowMaxHeights[sectionIndex] || [])[i] || [], isHeader))));
        }
        renderChunk(sectionConfig, sectionIndex, colGroupStat, microColGroupNode, chunkConfig, chunkIndex, rowHeights, isHeader) {
            if ('outerContent' in chunkConfig) {
                return (h(p, { key: chunkConfig.key }, chunkConfig.outerContent));
            }
            let { state } = this;
            let { scrollerClientWidths, scrollerClientHeights } = state;
            let [sectionCnt, chunksPerSection] = this.getDims();
            let index = sectionIndex * chunksPerSection + chunkIndex;
            let sideScrollIndex = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
            let isVScrollSide = chunkIndex === sideScrollIndex;
            let isLastSection = sectionIndex === sectionCnt - 1;
            let forceXScrollbars = isLastSection && state.forceXScrollbars; // NOOOO can result in `null`
            let forceYScrollbars = isVScrollSide && state.forceYScrollbars; // NOOOO can result in `null`
            let allowXScrolling = colGroupStat && colGroupStat.allowXScrolling; // rename?
            let allowYScrolling = getAllowYScrolling(this.props, sectionConfig); // rename? do in section func?
            let chunkVGrow = getSectionHasLiquidHeight(this.props, sectionConfig); // do in section func?
            let expandRows = sectionConfig.expandRows && chunkVGrow;
            let tableMinWidth = (colGroupStat && colGroupStat.totalColMinWidth) || '';
            let content = renderChunkContent(sectionConfig, chunkConfig, {
                tableColGroupNode: microColGroupNode,
                tableMinWidth,
                clientWidth: scrollerClientWidths[index] !== undefined ? scrollerClientWidths[index] : null,
                clientHeight: scrollerClientHeights[index] !== undefined ? scrollerClientHeights[index] : null,
                expandRows,
                syncRowHeights: Boolean(sectionConfig.syncRowHeights),
                rowSyncHeights: rowHeights,
                reportRowHeightChange: this.handleRowHeightChange,
            }, isHeader);
            let overflowX = forceXScrollbars ? (isLastSection ? 'scroll' : 'scroll-hidden') :
                !allowXScrolling ? 'hidden' :
                    (isLastSection ? 'auto' : 'scroll-hidden');
            let overflowY = forceYScrollbars ? (isVScrollSide ? 'scroll' : 'scroll-hidden') :
                !allowYScrolling ? 'hidden' :
                    (isVScrollSide ? 'auto' : 'scroll-hidden');
            // it *could* be possible to reduce DOM wrappers by only doing a ClippedScroller when allowXScrolling or allowYScrolling,
            // but if these values were to change, the inner components would be unmounted/remounted because of the parent change.
            content = (h(ClippedScroller, { ref: this.clippedScrollerRefs.createRef(index), scrollerElRef: this.scrollerElRefs.createRef(index), overflowX: overflowX, overflowY: overflowY, liquid: chunkVGrow, maxHeight: sectionConfig.maxHeight }, content));
            return h(isHeader ? 'th' : 'td', {
                key: chunkConfig.key,
                ref: this.chunkElRefs.createRef(index),
                role: 'presentation',
            }, content);
        }
        componentDidMount() {
            this.getStickyScrolling = memoizeArraylike(initStickyScrolling);
            this.getScrollSyncersBySection = memoizeHashlike(initScrollSyncer.bind(this, true), null, destroyScrollSyncer);
            this.getScrollSyncersByColumn = memoizeHashlike(initScrollSyncer.bind(this, false), null, destroyScrollSyncer);
            this.updateScrollSyncers();
            this.handleSizing(false);
            this.context.addResizeHandler(this.handleSizing);
        }
        componentDidUpdate(prevProps, prevState) {
            this.updateScrollSyncers();
            // TODO: need better solution when state contains non-sizing things
            this.handleSizing(false, prevState.sectionRowMaxHeights !== this.state.sectionRowMaxHeights);
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleSizing);
            this.destroyScrollSyncers();
        }
        allowSizing() {
            let now = new Date();
            if (!this.lastSizingDate ||
                now.valueOf() > this.lastSizingDate.valueOf() + config.SCROLLGRID_RESIZE_INTERVAL) {
                this.lastSizingDate = now;
                this.recentSizingCnt = 0;
                return true;
            }
            return (this.recentSizingCnt += 1) <= 10;
        }
        computeShrinkWidths() {
            let colGroupStats = this.compileColGroupStats(this.props.colGroups.map((colGroup) => [colGroup]));
            let [sectionCnt, chunksPerSection] = this.getDims();
            let cnt = sectionCnt * chunksPerSection;
            let shrinkWidths = [];
            colGroupStats.forEach((colGroupStat, i) => {
                if (colGroupStat.hasShrinkCol) {
                    let chunkEls = this.chunkElRefs.collect(i, cnt, chunksPerSection); // in one col
                    shrinkWidths[i] = computeShrinkWidth(chunkEls);
                }
            });
            return shrinkWidths;
        }
        // has the side effect of grooming rowInnerMaxHeightMap
        // TODO: somehow short-circuit if there are no new height changes
        computeSectionRowMaxHeights() {
            let newHeightMap = new Map();
            let [sectionCnt, chunksPerSection] = this.getDims();
            let sectionRowMaxHeights = [];
            for (let sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
                let sectionConfig = this.props.sections[sectionI];
                let assignableHeights = []; // chunk, row
                if (sectionConfig && sectionConfig.syncRowHeights) {
                    let rowHeightsByChunk = [];
                    for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                        let index = sectionI * chunksPerSection + chunkI;
                        let rowHeights = [];
                        let chunkEl = this.chunkElRefs.currentMap[index];
                        if (chunkEl) {
                            rowHeights = findElements(chunkEl, '.fc-scrollgrid-sync-table tr').map((rowEl) => {
                                let max = getRowInnerMaxHeight(rowEl);
                                newHeightMap.set(rowEl, max);
                                return max;
                            });
                        }
                        else {
                            rowHeights = [];
                        }
                        rowHeightsByChunk.push(rowHeights);
                    }
                    let rowCnt = rowHeightsByChunk[0].length;
                    let isEqualRowCnt = true;
                    for (let chunkI = 1; chunkI < chunksPerSection; chunkI += 1) {
                        let isOuterContent = sectionConfig.chunks[chunkI] && sectionConfig.chunks[chunkI].outerContent !== undefined; // can be null
                        if (!isOuterContent && rowHeightsByChunk[chunkI].length !== rowCnt) { // skip outer content
                            isEqualRowCnt = false;
                            break;
                        }
                    }
                    if (!isEqualRowCnt) {
                        let chunkHeightSums = [];
                        for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                            chunkHeightSums.push(sumNumbers(rowHeightsByChunk[chunkI]) + rowHeightsByChunk[chunkI].length);
                        }
                        let maxTotalSum = Math.max(...chunkHeightSums);
                        for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                            let rowInChunkCnt = rowHeightsByChunk[chunkI].length;
                            let rowInChunkTotalHeight = maxTotalSum - rowInChunkCnt; // subtract border
                            // height of non-first row. we do this to avoid rounding, because it's unreliable within a table
                            let rowInChunkHeightOthers = Math.floor(rowInChunkTotalHeight / rowInChunkCnt);
                            // whatever is leftover goes to the first row
                            let rowInChunkHeightFirst = rowInChunkTotalHeight - rowInChunkHeightOthers * (rowInChunkCnt - 1);
                            let rowInChunkHeights = [];
                            let row = 0;
                            if (row < rowInChunkCnt) {
                                rowInChunkHeights.push(rowInChunkHeightFirst);
                                row += 1;
                            }
                            while (row < rowInChunkCnt) {
                                rowInChunkHeights.push(rowInChunkHeightOthers);
                                row += 1;
                            }
                            assignableHeights.push(rowInChunkHeights);
                        }
                    }
                    else {
                        for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                            assignableHeights.push([]);
                        }
                        for (let row = 0; row < rowCnt; row += 1) {
                            let rowHeightsAcrossChunks = [];
                            for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                                let h = rowHeightsByChunk[chunkI][row];
                                if (h != null) { // protect against outerContent
                                    rowHeightsAcrossChunks.push(h);
                                }
                            }
                            let maxHeight = Math.max(...rowHeightsAcrossChunks);
                            for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                                assignableHeights[chunkI].push(maxHeight);
                            }
                        }
                    }
                }
                sectionRowMaxHeights.push(assignableHeights);
            }
            this.rowInnerMaxHeightMap = newHeightMap;
            return sectionRowMaxHeights;
        }
        computeScrollerDims() {
            let scrollbarWidth = getScrollbarWidths();
            let [sectionCnt, chunksPerSection] = this.getDims();
            let sideScrollI = (!this.context.isRtl || getIsRtlScrollbarOnLeft()) ? chunksPerSection - 1 : 0;
            let lastSectionI = sectionCnt - 1;
            let currentScrollers = this.clippedScrollerRefs.currentMap;
            let scrollerEls = this.scrollerElRefs.currentMap;
            let forceYScrollbars = false;
            let forceXScrollbars = false;
            let scrollerClientWidths = {};
            let scrollerClientHeights = {};
            for (let sectionI = 0; sectionI < sectionCnt; sectionI += 1) { // along edge
                let index = sectionI * chunksPerSection + sideScrollI;
                let scroller = currentScrollers[index];
                if (scroller && scroller.needsYScrolling()) {
                    forceYScrollbars = true;
                    break;
                }
            }
            for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) { // along last row
                let index = lastSectionI * chunksPerSection + chunkI;
                let scroller = currentScrollers[index];
                if (scroller && scroller.needsXScrolling()) {
                    forceXScrollbars = true;
                    break;
                }
            }
            for (let sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
                for (let chunkI = 0; chunkI < chunksPerSection; chunkI += 1) {
                    let index = sectionI * chunksPerSection + chunkI;
                    let scrollerEl = scrollerEls[index];
                    if (scrollerEl) {
                        // TODO: weird way to get this. need harness b/c doesn't include table borders
                        let harnessEl = scrollerEl.parentNode;
                        scrollerClientWidths[index] = Math.floor(harnessEl.getBoundingClientRect().width - ((chunkI === sideScrollI && forceYScrollbars)
                            ? scrollbarWidth.y // use global because scroller might not have scrollbars yet but will need them in future
                            : 0));
                        scrollerClientHeights[index] = Math.floor(harnessEl.getBoundingClientRect().height - ((sectionI === lastSectionI && forceXScrollbars)
                            ? scrollbarWidth.x // use global because scroller might not have scrollbars yet but will need them in future
                            : 0));
                    }
                }
            }
            return { forceYScrollbars, forceXScrollbars, scrollerClientWidths, scrollerClientHeights };
        }
        updateStickyScrolling() {
            let { isRtl } = this.context;
            let argsByKey = this.scrollerElRefs.getAll().map((scrollEl) => [scrollEl, isRtl]);
            this.getStickyScrolling(argsByKey)
                .forEach((stickyScrolling) => stickyScrolling.updateSize());
        }
        updateScrollSyncers() {
            let [sectionCnt, chunksPerSection] = this.getDims();
            let cnt = sectionCnt * chunksPerSection;
            let scrollElsBySection = {};
            let scrollElsByColumn = {};
            let scrollElMap = this.scrollerElRefs.currentMap;
            for (let sectionI = 0; sectionI < sectionCnt; sectionI += 1) {
                let startIndex = sectionI * chunksPerSection;
                let endIndex = startIndex + chunksPerSection;
                scrollElsBySection[sectionI] = collectFromHash(scrollElMap, startIndex, endIndex, 1); // use the filtered
            }
            for (let col = 0; col < chunksPerSection; col += 1) {
                scrollElsByColumn[col] = this.scrollerElRefs.collect(col, cnt, chunksPerSection); // DON'T use the filtered
            }
            this.scrollSyncersBySection = this.getScrollSyncersBySection(scrollElsBySection);
            this.scrollSyncersByColumn = this.getScrollSyncersByColumn(scrollElsByColumn);
        }
        destroyScrollSyncers() {
            mapHash(this.scrollSyncersBySection, destroyScrollSyncer);
            mapHash(this.scrollSyncersByColumn, destroyScrollSyncer);
        }
        getChunkConfigByIndex(index) {
            let chunksPerSection = this.getDims()[1];
            let sectionI = Math.floor(index / chunksPerSection);
            let chunkI = index % chunksPerSection;
            let sectionConfig = this.props.sections[sectionI];
            return sectionConfig && sectionConfig.chunks[chunkI];
        }
        forceScrollLeft(col, scrollLeft) {
            let scrollSyncer = this.scrollSyncersByColumn[col];
            if (scrollSyncer) {
                scrollSyncer.forceScrollLeft(scrollLeft);
            }
        }
        forceScrollTop(sectionI, scrollTop) {
            let scrollSyncer = this.scrollSyncersBySection[sectionI];
            if (scrollSyncer) {
                scrollSyncer.forceScrollTop(scrollTop);
            }
        }
        _handleChunkEl(chunkEl, key) {
            let chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
            if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
                setRef(chunkConfig.elRef, chunkEl);
            }
        }
        _handleScrollerEl(scrollerEl, key) {
            let chunkConfig = this.getChunkConfigByIndex(parseInt(key, 10));
            if (chunkConfig) { // null if section disappeared. bad, b/c won't null-set the elRef
                setRef(chunkConfig.scrollerElRef, scrollerEl);
            }
        }
        getDims() {
            let sectionCnt = this.props.sections.length;
            let chunksPerSection = sectionCnt ? this.props.sections[0].chunks.length : 0;
            return [sectionCnt, chunksPerSection];
        }
    }
    ScrollGrid.addStateEquality({
        shrinkWidths: isArraysEqual,
        scrollerClientWidths: isPropsEqual,
        scrollerClientHeights: isPropsEqual,
    });
    function sumNumbers(numbers) {
        let sum = 0;
        for (let n of numbers) {
            sum += n;
        }
        return sum;
    }
    function getRowInnerMaxHeight(rowEl) {
        let innerHeights = findElements(rowEl, '.fc-scrollgrid-sync-inner').map(getElHeight);
        if (innerHeights.length) {
            return Math.max(...innerHeights);
        }
        return 0;
    }
    function getElHeight(el) {
        return el.offsetHeight; // better to deal with integers, for rounding, for PureComponent
    }
    function renderMacroColGroup(colGroupStats, shrinkWidths) {
        let children = colGroupStats.map((colGroupStat, i) => {
            let width = colGroupStat.width;
            if (width === 'shrink') {
                width = colGroupStat.totalColWidth + sanitizeShrinkWidth(shrinkWidths[i]) + 1; // +1 for border :(
            }
            return ( // eslint-disable-next-line react/jsx-key
            h("col", { style: { width } }));
        });
        return h('colgroup', {}, ...children);
    }
    function compileColGroupStat(colGroupConfig) {
        let totalColWidth = sumColProp(colGroupConfig.cols, 'width'); // excludes "shrink"
        let totalColMinWidth = sumColProp(colGroupConfig.cols, 'minWidth');
        let hasShrinkCol = hasShrinkWidth(colGroupConfig.cols);
        let allowXScrolling = colGroupConfig.width !== 'shrink' && Boolean(totalColWidth || totalColMinWidth || hasShrinkCol);
        return {
            hasShrinkCol,
            totalColWidth,
            totalColMinWidth,
            allowXScrolling,
            cols: colGroupConfig.cols,
            width: colGroupConfig.width,
        };
    }
    function sumColProp(cols, propName) {
        let total = 0;
        for (let col of cols) {
            let val = col[propName];
            if (typeof val === 'number') {
                total += val * (col.span || 1);
            }
        }
        return total;
    }
    const COL_GROUP_STAT_EQUALITY = {
        cols: isColPropsEqual,
    };
    function isColGroupStatsEqual(stat0, stat1) {
        return compareObjs(stat0, stat1, COL_GROUP_STAT_EQUALITY);
    }
    // for memoizers...
    function initScrollSyncer(isVertical, ...scrollEls) {
        return new ScrollSyncer(isVertical, scrollEls);
    }
    function destroyScrollSyncer(scrollSyncer) {
        scrollSyncer.destroy();
    }
    function initStickyScrolling(scrollEl, isRtl) {
        return new StickyScrolling(scrollEl, isRtl);
    }

    var index$6 = createPlugin({
        name: '@fullcalendar/scrollgrid',
        premiumReleaseDate: '2022-12-27',
        deps: [index$7],
        scrollGridImpl: ScrollGrid,
    });

    config.COLLAPSIBLE_WIDTH_THRESHOLD = 1200;
    let contexts = [];
    let undoFuncs = [];
    function contextInit(context) {
        if (!contexts.length) {
            attachGlobalHandlers();
        }
        contexts.push(context);
        context.calendarApi.on('_unmount', () => {
            removeExact(contexts, context);
            if (!contexts.length) {
                removeGlobalHandlers();
            }
        });
    }
    function attachGlobalHandlers() {
        window.addEventListener('beforeprint', handleBeforePrint);
        window.addEventListener('afterprint', handleAfterPrint);
        // // for testing
        // let forPrint = false
        // document.addEventListener('keypress', (ev) => {
        //   if (ev.key === 'p') {
        //     forPrint = !forPrint
        //     if (forPrint) {
        //       handleBeforePrint()
        //     } else {
        //       handleAfterPrint()
        //     }
        //   }
        // })
    }
    function removeGlobalHandlers() {
        window.removeEventListener('beforeprint', handleBeforePrint);
        window.removeEventListener('afterprint', handleAfterPrint);
    }
    function handleBeforePrint() {
        let scrollEls = queryScrollerEls();
        let scrollCoords = queryScrollerCoords(scrollEls);
        for (let context of contexts) {
            context.emitter.trigger('_beforeprint');
        }
        flushSync(() => {
            killHorizontalScrolling(scrollEls, scrollCoords);
            undoFuncs.push(() => restoreScrollerCoords(scrollEls, scrollCoords));
            undoFuncs.push(freezeScrollgridWidths());
        });
    }
    function handleAfterPrint() {
        for (let context of contexts) {
            context.emitter.trigger('_afterprint');
        }
        flushSync(() => {
            while (undoFuncs.length) {
                undoFuncs.shift()();
            }
        });
    }
    // scrollgrid widths
    function freezeScrollgridWidths() {
        let els = findElements(document.body, '.fc-scrollgrid');
        els.forEach(freezeScrollGridWidth);
        return () => els.forEach(unfreezeScrollGridWidth);
    }
    function freezeScrollGridWidth(el) {
        let elWidth = el.getBoundingClientRect().width;
        // along with collapsibleWidth, this is a hack for #5707
        if (!el.classList.contains('fc-scrollgrid-collapsible') || elWidth < config.COLLAPSIBLE_WIDTH_THRESHOLD) {
            el.style.width = elWidth + 'px';
        }
    }
    function unfreezeScrollGridWidth(el) {
        el.style.width = '';
    }
    // scrollers
    // TODO: use scroll normalization!? yes
    function queryScrollerEls() {
        return findElements(document.body, '.fc-scroller-harness > .fc-scroller');
    }
    function queryScrollerCoords(els) {
        return els.map((el) => {
            let computedStyle = window.getComputedStyle(el);
            return {
                scrollLeft: el.scrollLeft,
                scrollTop: el.scrollTop,
                overflowX: computedStyle.overflowX,
                overflowY: computedStyle.overflowY,
                marginBottom: computedStyle.marginBottom,
            };
        });
    }
    function killHorizontalScrolling(els, coords) {
        els.forEach((el, i) => {
            el.style.overflowX = 'visible'; // need to clear X/Y to get true overflow
            el.style.overflowY = 'visible'; // "
            el.style.marginBottom = ''; // for clipping away scrollbar. disable
            el.style.left = -coords[i].scrollLeft + 'px'; // simulate scrollLeft! will be position:relative
        });
    }
    function restoreScrollerCoords(els, coords) {
        els.forEach((el, i) => {
            let c = coords[i];
            el.style.overflowX = c.overflowX;
            el.style.overflowY = c.overflowY;
            el.style.marginBottom = c.marginBottom;
            el.style.left = '';
            el.scrollLeft = c.scrollLeft;
            el.scrollTop = c.scrollTop;
        });
    }

    var css_248z$2 = ".fc .fc-event,.fc .fc-scrollgrid table tr{-moz-column-break-inside:avoid;break-inside:avoid}.fc-media-print{display:block;max-width:100%}.fc-media-print .fc-bg-event,.fc-media-print .fc-non-business,.fc-media-print .fc-timegrid-axis-chunk,.fc-media-print .fc-timegrid-slots,.fc-media-print .fc-timeline-slots{display:none}.fc-media-print .fc-h-event,.fc-media-print .fc-toolbar button,.fc-media-print .fc-v-event{background:#fff!important;color:#000!important}.fc-media-print .fc-event,.fc-media-print .fc-event-main{color:#000!important}.fc-media-print .fc-timegrid-event{margin:.5em 0}";
    injectStyles(css_248z$2);

    var index$5 = createPlugin({
        name: '@fullcalendar/adaptive',
        premiumReleaseDate: '2022-12-27',
        deps: [index$7],
        contextInit,
    });

    const MIN_AUTO_LABELS = 18; // more than `12` months but less that `24` hours
    const MAX_AUTO_SLOTS_PER_LABEL = 6; // allows 6 10-min slots in an hour
    const MAX_AUTO_CELLS = 200; // allows 4-days to have a :30 slot duration
    config.MAX_TIMELINE_SLOTS = 1000;
    // potential nice values for slot-duration and interval-duration
    const STOCK_SUB_DURATIONS = [
        { years: 1 },
        { months: 1 },
        { days: 1 },
        { hours: 1 },
        { minutes: 30 },
        { minutes: 15 },
        { minutes: 10 },
        { minutes: 5 },
        { minutes: 1 },
        { seconds: 30 },
        { seconds: 15 },
        { seconds: 10 },
        { seconds: 5 },
        { seconds: 1 },
        { milliseconds: 500 },
        { milliseconds: 100 },
        { milliseconds: 10 },
        { milliseconds: 1 },
    ];
    function buildTimelineDateProfile(dateProfile, dateEnv, allOptions, dateProfileGenerator) {
        let tDateProfile = {
            labelInterval: allOptions.slotLabelInterval,
            slotDuration: allOptions.slotDuration,
        };
        validateLabelAndSlot(tDateProfile, dateProfile, dateEnv); // validate after computed grid duration
        ensureLabelInterval(tDateProfile, dateProfile, dateEnv);
        ensureSlotDuration(tDateProfile, dateProfile, dateEnv);
        let input = allOptions.slotLabelFormat;
        let rawFormats = Array.isArray(input) ? input :
            (input != null) ? [input] :
                computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions);
        tDateProfile.headerFormats = rawFormats.map((rawFormat) => createFormatter(rawFormat));
        tDateProfile.isTimeScale = Boolean(tDateProfile.slotDuration.milliseconds);
        let largeUnit = null;
        if (!tDateProfile.isTimeScale) {
            const slotUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
            if (/year|month|week/.test(slotUnit)) {
                largeUnit = slotUnit;
            }
        }
        tDateProfile.largeUnit = largeUnit;
        tDateProfile.emphasizeWeeks =
            asCleanDays(tDateProfile.slotDuration) === 1 &&
                currentRangeAs('weeks', dateProfile, dateEnv) >= 2 &&
                !allOptions.businessHours;
        /*
        console.log('label interval =', timelineView.labelInterval.humanize())
        console.log('slot duration =', timelineView.slotDuration.humanize())
        console.log('header formats =', timelineView.headerFormats)
        console.log('isTimeScale', timelineView.isTimeScale)
        console.log('largeUnit', timelineView.largeUnit)
        */
        let rawSnapDuration = allOptions.snapDuration;
        let snapDuration;
        let snapsPerSlot;
        if (rawSnapDuration) {
            snapDuration = createDuration(rawSnapDuration);
            snapsPerSlot = wholeDivideDurations(tDateProfile.slotDuration, snapDuration);
            // ^ TODO: warning if not whole?
        }
        if (snapsPerSlot == null) {
            snapDuration = tDateProfile.slotDuration;
            snapsPerSlot = 1;
        }
        tDateProfile.snapDuration = snapDuration;
        tDateProfile.snapsPerSlot = snapsPerSlot;
        // more...
        let timeWindowMs = asRoughMs(dateProfile.slotMaxTime) - asRoughMs(dateProfile.slotMinTime);
        // TODO: why not use normalizeRange!?
        let normalizedStart = normalizeDate(dateProfile.renderRange.start, tDateProfile, dateEnv);
        let normalizedEnd = normalizeDate(dateProfile.renderRange.end, tDateProfile, dateEnv);
        // apply slotMinTime/slotMaxTime
        // TODO: View should be responsible.
        if (tDateProfile.isTimeScale) {
            normalizedStart = dateEnv.add(normalizedStart, dateProfile.slotMinTime);
            normalizedEnd = dateEnv.add(addDays(normalizedEnd, -1), dateProfile.slotMaxTime);
        }
        tDateProfile.timeWindowMs = timeWindowMs;
        tDateProfile.normalizedRange = { start: normalizedStart, end: normalizedEnd };
        let slotDates = [];
        let date = normalizedStart;
        while (date < normalizedEnd) {
            if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
                slotDates.push(date);
            }
            date = dateEnv.add(date, tDateProfile.slotDuration);
        }
        tDateProfile.slotDates = slotDates;
        // more...
        let snapIndex = -1;
        let snapDiff = 0; // index of the diff :(
        const snapDiffToIndex = [];
        const snapIndexToDiff = [];
        date = normalizedStart;
        while (date < normalizedEnd) {
            if (isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator)) {
                snapIndex += 1;
                snapDiffToIndex.push(snapIndex);
                snapIndexToDiff.push(snapDiff);
            }
            else {
                snapDiffToIndex.push(snapIndex + 0.5);
            }
            date = dateEnv.add(date, tDateProfile.snapDuration);
            snapDiff += 1;
        }
        tDateProfile.snapDiffToIndex = snapDiffToIndex;
        tDateProfile.snapIndexToDiff = snapIndexToDiff;
        tDateProfile.snapCnt = snapIndex + 1; // is always one behind
        tDateProfile.slotCnt = tDateProfile.snapCnt / tDateProfile.snapsPerSlot;
        // more...
        tDateProfile.isWeekStarts = buildIsWeekStarts(tDateProfile, dateEnv);
        tDateProfile.cellRows = buildCellRows(tDateProfile, dateEnv);
        tDateProfile.slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
        return tDateProfile;
    }
    /*
    snaps to appropriate unit
    */
    function normalizeDate(date, tDateProfile, dateEnv) {
        let normalDate = date;
        if (!tDateProfile.isTimeScale) {
            normalDate = startOfDay(normalDate);
            if (tDateProfile.largeUnit) {
                normalDate = dateEnv.startOf(normalDate, tDateProfile.largeUnit);
            }
        }
        return normalDate;
    }
    /*
    snaps to appropriate unit
    */
    function normalizeRange(range, tDateProfile, dateEnv) {
        if (!tDateProfile.isTimeScale) {
            range = computeVisibleDayRange(range);
            if (tDateProfile.largeUnit) {
                let dayRange = range; // preserve original result
                range = {
                    start: dateEnv.startOf(range.start, tDateProfile.largeUnit),
                    end: dateEnv.startOf(range.end, tDateProfile.largeUnit),
                };
                // if date is partially through the interval, or is in the same interval as the start,
                // make the exclusive end be the *next* interval
                if (range.end.valueOf() !== dayRange.end.valueOf() || range.end <= range.start) {
                    range = {
                        start: range.start,
                        end: dateEnv.add(range.end, tDateProfile.slotDuration),
                    };
                }
            }
        }
        return range;
    }
    function isValidDate(date, tDateProfile, dateProfile, dateProfileGenerator) {
        if (dateProfileGenerator.isHiddenDay(date)) {
            return false;
        }
        if (tDateProfile.isTimeScale) {
            // determine if the time is within slotMinTime/slotMaxTime, which may have wacky values
            let day = startOfDay(date);
            let timeMs = date.valueOf() - day.valueOf();
            let ms = timeMs - asRoughMs(dateProfile.slotMinTime); // milliseconds since slotMinTime
            ms = ((ms % 86400000) + 86400000) % 86400000; // make negative values wrap to 24hr clock
            return ms < tDateProfile.timeWindowMs; // before the slotMaxTime?
        }
        return true;
    }
    function validateLabelAndSlot(tDateProfile, dateProfile, dateEnv) {
        const { currentRange } = dateProfile;
        // make sure labelInterval doesn't exceed the max number of cells
        if (tDateProfile.labelInterval) {
            const labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.labelInterval);
            if (labelCnt > config.MAX_TIMELINE_SLOTS) {
                console.warn('slotLabelInterval results in too many cells');
                tDateProfile.labelInterval = null;
            }
        }
        // make sure slotDuration doesn't exceed the maximum number of cells
        if (tDateProfile.slotDuration) {
            const slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, tDateProfile.slotDuration);
            if (slotCnt > config.MAX_TIMELINE_SLOTS) {
                console.warn('slotDuration results in too many cells');
                tDateProfile.slotDuration = null;
            }
        }
        // make sure labelInterval is a multiple of slotDuration
        if (tDateProfile.labelInterval && tDateProfile.slotDuration) {
            const slotsPerLabel = wholeDivideDurations(tDateProfile.labelInterval, tDateProfile.slotDuration);
            if (slotsPerLabel === null || slotsPerLabel < 1) {
                console.warn('slotLabelInterval must be a multiple of slotDuration');
                tDateProfile.slotDuration = null;
            }
        }
    }
    function ensureLabelInterval(tDateProfile, dateProfile, dateEnv) {
        const { currentRange } = dateProfile;
        let { labelInterval } = tDateProfile;
        if (!labelInterval) {
            // compute based off the slot duration
            // find the largest label interval with an acceptable slots-per-label
            let input;
            if (tDateProfile.slotDuration) {
                for (input of STOCK_SUB_DURATIONS) {
                    const tryLabelInterval = createDuration(input);
                    const slotsPerLabel = wholeDivideDurations(tryLabelInterval, tDateProfile.slotDuration);
                    if (slotsPerLabel !== null && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
                        labelInterval = tryLabelInterval;
                        break;
                    }
                }
                // use the slot duration as a last resort
                if (!labelInterval) {
                    labelInterval = tDateProfile.slotDuration;
                }
                // compute based off the view's duration
                // find the largest label interval that yields the minimum number of labels
            }
            else {
                for (input of STOCK_SUB_DURATIONS) {
                    labelInterval = createDuration(input);
                    const labelCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, labelInterval);
                    if (labelCnt >= MIN_AUTO_LABELS) {
                        break;
                    }
                }
            }
            tDateProfile.labelInterval = labelInterval;
        }
        return labelInterval;
    }
    function ensureSlotDuration(tDateProfile, dateProfile, dateEnv) {
        const { currentRange } = dateProfile;
        let { slotDuration } = tDateProfile;
        if (!slotDuration) {
            const labelInterval = ensureLabelInterval(tDateProfile, dateProfile, dateEnv); // will compute if necessary
            // compute based off the label interval
            // find the largest slot duration that is different from labelInterval, but still acceptable
            for (let input of STOCK_SUB_DURATIONS) {
                const trySlotDuration = createDuration(input);
                const slotsPerLabel = wholeDivideDurations(labelInterval, trySlotDuration);
                if (slotsPerLabel !== null && slotsPerLabel > 1 && slotsPerLabel <= MAX_AUTO_SLOTS_PER_LABEL) {
                    slotDuration = trySlotDuration;
                    break;
                }
            }
            // only allow the value if it won't exceed the view's # of slots limit
            if (slotDuration) {
                const slotCnt = dateEnv.countDurationsBetween(currentRange.start, currentRange.end, slotDuration);
                if (slotCnt > MAX_AUTO_CELLS) {
                    slotDuration = null;
                }
            }
            // use the label interval as a last resort
            if (!slotDuration) {
                slotDuration = labelInterval;
            }
            tDateProfile.slotDuration = slotDuration;
        }
        return slotDuration;
    }
    function computeHeaderFormats(tDateProfile, dateProfile, dateEnv, allOptions) {
        let format1;
        let format2;
        const { labelInterval } = tDateProfile;
        let unit = greatestDurationDenominator(labelInterval).unit;
        const weekNumbersVisible = allOptions.weekNumbers;
        let format0 = (format1 = (format2 = null));
        // NOTE: weekNumber computation function wont work
        if ((unit === 'week') && !weekNumbersVisible) {
            unit = 'day';
        }
        switch (unit) {
            case 'year':
                format0 = { year: 'numeric' }; // '2015'
                break;
            case 'month':
                if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
                    format0 = { year: 'numeric' }; // '2015'
                }
                format1 = { month: 'short' }; // 'Jan'
                break;
            case 'week':
                if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
                    format0 = { year: 'numeric' }; // '2015'
                }
                format1 = { week: 'narrow' }; // 'Wk4'
                break;
            case 'day':
                if (currentRangeAs('years', dateProfile, dateEnv) > 1) {
                    format0 = { year: 'numeric', month: 'long' }; // 'January 2014'
                }
                else if (currentRangeAs('months', dateProfile, dateEnv) > 1) {
                    format0 = { month: 'long' }; // 'January'
                }
                if (weekNumbersVisible) {
                    format1 = { week: 'short' }; // 'Wk 4'
                }
                format2 = { weekday: 'narrow', day: 'numeric' }; // 'Su 9'
                break;
            case 'hour':
                if (weekNumbersVisible) {
                    format0 = { week: 'short' }; // 'Wk 4'
                }
                if (currentRangeAs('days', dateProfile, dateEnv) > 1) {
                    format1 = { weekday: 'short', day: 'numeric', month: 'numeric', omitCommas: true }; // Sat 4/7
                }
                format2 = {
                    hour: 'numeric',
                    minute: '2-digit',
                    omitZeroMinute: true,
                    meridiem: 'short',
                };
                break;
            case 'minute':
                // sufficiently large number of different minute cells?
                if ((asRoughMinutes(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
                    format0 = {
                        hour: 'numeric',
                        meridiem: 'short',
                    };
                    format1 = (params) => (':' + padStart(params.date.minute, 2) // ':30'
                    );
                }
                else {
                    format0 = {
                        hour: 'numeric',
                        minute: 'numeric',
                        meridiem: 'short',
                    };
                }
                break;
            case 'second':
                // sufficiently large number of different second cells?
                if ((asRoughSeconds(labelInterval) / 60) >= MAX_AUTO_SLOTS_PER_LABEL) {
                    format0 = { hour: 'numeric', minute: '2-digit', meridiem: 'lowercase' }; // '8:30 PM'
                    format1 = (params) => (':' + padStart(params.date.second, 2) // ':30'
                    );
                }
                else {
                    format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
                }
                break;
            case 'millisecond':
                format0 = { hour: 'numeric', minute: '2-digit', second: '2-digit', meridiem: 'lowercase' }; // '8:30:45 PM'
                format1 = (params) => ('.' + padStart(params.millisecond, 3));
                break;
        }
        return [].concat(format0 || [], format1 || [], format2 || []);
    }
    // Compute the number of the give units in the "current" range.
    // Won't go more precise than days.
    // Will return `0` if there's not a clean whole interval.
    function currentRangeAs(unit, dateProfile, dateEnv) {
        let range = dateProfile.currentRange;
        let res = null;
        if (unit === 'years') {
            res = dateEnv.diffWholeYears(range.start, range.end);
        }
        else if (unit === 'months') {
            res = dateEnv.diffWholeMonths(range.start, range.end);
        }
        else if (unit === 'weeks') {
            res = dateEnv.diffWholeMonths(range.start, range.end);
        }
        else if (unit === 'days') {
            res = diffWholeDays(range.start, range.end);
        }
        return res || 0;
    }
    function buildIsWeekStarts(tDateProfile, dateEnv) {
        let { slotDates, emphasizeWeeks } = tDateProfile;
        let prevWeekNumber = null;
        let isWeekStarts = [];
        for (let slotDate of slotDates) {
            let weekNumber = dateEnv.computeWeekNumber(slotDate);
            let isWeekStart = emphasizeWeeks && (prevWeekNumber !== null) && (prevWeekNumber !== weekNumber);
            prevWeekNumber = weekNumber;
            isWeekStarts.push(isWeekStart);
        }
        return isWeekStarts;
    }
    function buildCellRows(tDateProfile, dateEnv) {
        let slotDates = tDateProfile.slotDates;
        let formats = tDateProfile.headerFormats;
        let cellRows = formats.map(() => []); // indexed by row,col
        let slotAsDays = asCleanDays(tDateProfile.slotDuration);
        let guessedSlotUnit = slotAsDays === 7 ? 'week' :
            slotAsDays === 1 ? 'day' :
                null;
        // specifically for navclicks
        let rowUnitsFromFormats = formats.map((format) => (format.getLargestUnit ? format.getLargestUnit() : null));
        // builds cellRows and slotCells
        for (let i = 0; i < slotDates.length; i += 1) {
            let date = slotDates[i];
            let isWeekStart = tDateProfile.isWeekStarts[i];
            for (let row = 0; row < formats.length; row += 1) {
                let format = formats[row];
                let rowCells = cellRows[row];
                let leadingCell = rowCells[rowCells.length - 1];
                let isLastRow = row === formats.length - 1;
                let isSuperRow = formats.length > 1 && !isLastRow; // more than one row and not the last
                let newCell = null;
                let rowUnit = rowUnitsFromFormats[row] || (isLastRow ? guessedSlotUnit : null);
                if (isSuperRow) {
                    let text = dateEnv.format(date, format);
                    if (!leadingCell || (leadingCell.text !== text)) {
                        newCell = buildCellObject(date, text, rowUnit);
                    }
                    else {
                        leadingCell.colspan += 1;
                    }
                }
                else if (!leadingCell ||
                    isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.labelInterval))) {
                    let text = dateEnv.format(date, format);
                    newCell = buildCellObject(date, text, rowUnit);
                }
                else {
                    leadingCell.colspan += 1;
                }
                if (newCell) {
                    newCell.weekStart = isWeekStart;
                    rowCells.push(newCell);
                }
            }
        }
        return cellRows;
    }
    function buildCellObject(date, text, rowUnit) {
        return { date, text, rowUnit, colspan: 1, isWeekStart: false };
    }

    class TimelineHeaderTh extends BaseComponent {
        constructor() {
            super(...arguments);
            this.refineRenderProps = memoizeObjArg(refineRenderProps$3);
            this.buildCellNavLinkAttrs = memoize(buildCellNavLinkAttrs);
        }
        render() {
            let { props, context } = this;
            let { dateEnv, options } = context;
            let { cell, dateProfile, tDateProfile } = props;
            // the cell.rowUnit is f'd
            // giving 'month' for a 3-day view
            // workaround: to infer day, do NOT time
            let dateMeta = getDateMeta(cell.date, props.todayRange, props.nowDate, dateProfile);
            let renderProps = this.refineRenderProps({
                level: props.rowLevel,
                dateMarker: cell.date,
                text: cell.text,
                dateEnv: context.dateEnv,
                viewApi: context.viewApi,
            });
            return (h(ContentContainer, { elTag: "th", elClasses: [
                    'fc-timeline-slot',
                    'fc-timeline-slot-label',
                    cell.isWeekStart && 'fc-timeline-slot-em',
                    ...( // TODO: so slot classnames for week/month/bigger. see note above about rowUnit
                    cell.rowUnit === 'time' ?
                        getSlotClassNames(dateMeta, context.theme) :
                        getDayClassNames(dateMeta, context.theme)),
                ], elAttrs: {
                    colSpan: cell.colspan,
                    'data-date': dateEnv.formatIso(cell.date, {
                        omitTime: !tDateProfile.isTimeScale,
                        omitTimeZoneOffset: true,
                    }),
                }, renderProps: renderProps, generatorName: "slotLabelContent", generator: options.slotLabelContent || renderInnerContent$1, classNameGenerator: options.slotLabelClassNames, didMount: options.slotLabelDidMount, willUnmount: options.slotLabelWillUnmount }, (InnerContent) => (h("div", { className: "fc-timeline-slot-frame", style: { height: props.rowInnerHeight } },
                h(InnerContent, { elTag: "a", elClasses: [
                        'fc-timeline-slot-cushion',
                        'fc-scrollgrid-sync-inner',
                        props.isSticky && 'fc-sticky',
                    ], elAttrs: this.buildCellNavLinkAttrs(context, cell.date, cell.rowUnit) })))));
        }
    }
    function buildCellNavLinkAttrs(context, cellDate, rowUnit) {
        return (rowUnit && rowUnit !== 'time')
            ? buildNavLinkAttrs(context, cellDate, rowUnit)
            : {};
    }
    function renderInnerContent$1(renderProps) {
        return renderProps.text;
    }
    function refineRenderProps$3(input) {
        return {
            level: input.level,
            date: input.dateEnv.toDate(input.dateMarker),
            view: input.viewApi,
            text: input.text,
        };
    }

    class TimelineHeaderRows extends BaseComponent {
        render() {
            let { dateProfile, tDateProfile, rowInnerHeights, todayRange, nowDate } = this.props;
            let { cellRows } = tDateProfile;
            return (h(p, null, cellRows.map((rowCells, rowLevel) => {
                let isLast = rowLevel === cellRows.length - 1;
                let isChrono = tDateProfile.isTimeScale && isLast; // the final row, with times?
                let classNames = [
                    'fc-timeline-header-row',
                    isChrono ? 'fc-timeline-header-row-chrono' : '',
                ];
                return ( // eslint-disable-next-line react/no-array-index-key
                h("tr", { key: rowLevel, className: classNames.join(' ') }, rowCells.map((cell) => (h(TimelineHeaderTh, { key: cell.date.toISOString(), cell: cell, rowLevel: rowLevel, dateProfile: dateProfile, tDateProfile: tDateProfile, todayRange: todayRange, nowDate: nowDate, rowInnerHeight: rowInnerHeights && rowInnerHeights[rowLevel], isSticky: !isLast })))));
            })));
        }
    }

    class TimelineCoords {
        constructor(slatRootEl, // okay to expose?
        slatEls, dateProfile, tDateProfile, dateEnv, isRtl) {
            this.slatRootEl = slatRootEl;
            this.dateProfile = dateProfile;
            this.tDateProfile = tDateProfile;
            this.dateEnv = dateEnv;
            this.isRtl = isRtl;
            this.outerCoordCache = new PositionCache(slatRootEl, slatEls, true, // isHorizontal
            false);
            // for the inner divs within the slats
            // used for event rendering and scrollTime, to disregard slat border
            this.innerCoordCache = new PositionCache(slatRootEl, findDirectChildren(slatEls, 'div'), true, // isHorizontal
            false);
        }
        isDateInRange(date) {
            return rangeContainsMarker(this.dateProfile.currentRange, date);
        }
        // results range from negative width of area to 0
        dateToCoord(date) {
            let { tDateProfile } = this;
            let snapCoverage = this.computeDateSnapCoverage(date);
            let slotCoverage = snapCoverage / tDateProfile.snapsPerSlot;
            let slotIndex = Math.floor(slotCoverage);
            slotIndex = Math.min(slotIndex, tDateProfile.slotCnt - 1);
            let partial = slotCoverage - slotIndex;
            let { innerCoordCache, outerCoordCache } = this;
            if (this.isRtl) {
                return outerCoordCache.originClientRect.width - (outerCoordCache.rights[slotIndex] -
                    (innerCoordCache.getWidth(slotIndex) * partial));
            }
            return (outerCoordCache.lefts[slotIndex] +
                (innerCoordCache.getWidth(slotIndex) * partial));
        }
        rangeToCoords(range) {
            return {
                start: this.dateToCoord(range.start),
                end: this.dateToCoord(range.end),
            };
        }
        durationToCoord(duration) {
            let { dateProfile, tDateProfile, dateEnv, isRtl } = this;
            let coord = 0;
            if (dateProfile) {
                let date = dateEnv.add(dateProfile.activeRange.start, duration);
                if (!tDateProfile.isTimeScale) {
                    date = startOfDay(date);
                }
                coord = this.dateToCoord(date);
                // hack to overcome the left borders of non-first slat
                if (!isRtl && coord) {
                    coord += 1;
                }
            }
            return coord;
        }
        coordFromLeft(coord) {
            if (this.isRtl) {
                return this.outerCoordCache.originClientRect.width - coord;
            }
            return coord;
        }
        // returned value is between 0 and the number of snaps
        computeDateSnapCoverage(date) {
            return computeDateSnapCoverage(date, this.tDateProfile, this.dateEnv);
        }
    }
    // returned value is between 0 and the number of snaps
    function computeDateSnapCoverage(date, tDateProfile, dateEnv) {
        let snapDiff = dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, date, tDateProfile.snapDuration);
        if (snapDiff < 0) {
            return 0;
        }
        if (snapDiff >= tDateProfile.snapDiffToIndex.length) {
            return tDateProfile.snapCnt;
        }
        let snapDiffInt = Math.floor(snapDiff);
        let snapCoverage = tDateProfile.snapDiffToIndex[snapDiffInt];
        if (isInt(snapCoverage)) { // not an in-between value
            snapCoverage += snapDiff - snapDiffInt; // add the remainder
        }
        else {
            // a fractional value, meaning the date is not visible
            // always round up in this case. works for start AND end dates in a range.
            snapCoverage = Math.ceil(snapCoverage);
        }
        return snapCoverage;
    }
    function coordToCss(hcoord, isRtl) {
        if (hcoord === null) {
            return { left: '', right: '' };
        }
        if (isRtl) {
            return { right: hcoord, left: '' };
        }
        return { left: hcoord, right: '' };
    }
    function coordsToCss(hcoords, isRtl) {
        if (!hcoords) {
            return { left: '', right: '' };
        }
        if (isRtl) {
            return { right: hcoords.start, left: -hcoords.end };
        }
        return { left: hcoords.start, right: -hcoords.end };
    }

    class TimelineHeader extends BaseComponent {
        constructor() {
            super(...arguments);
            this.rootElRef = y();
        }
        render() {
            let { props, context } = this;
            // TODO: very repetitive
            // TODO: make part of tDateProfile?
            let timerUnit = greatestDurationDenominator(props.tDateProfile.slotDuration).unit;
            // WORKAROUND: make ignore slatCoords when out of sync with dateProfile
            let slatCoords = props.slatCoords && props.slatCoords.dateProfile === props.dateProfile ? props.slatCoords : null;
            return (h(NowTimer, { unit: timerUnit }, (nowDate, todayRange) => (h("div", { className: "fc-timeline-header", ref: this.rootElRef },
                h("table", { "aria-hidden": true, className: "fc-scrollgrid-sync-table", style: { minWidth: props.tableMinWidth, width: props.clientWidth } },
                    props.tableColGroupNode,
                    h("tbody", null,
                        h(TimelineHeaderRows, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, rowInnerHeights: props.rowInnerHeights }))),
                context.options.nowIndicator && (
                // need to have a container regardless of whether the current view has a visible now indicator
                // because apparently removal of the element resets the scroll for some reasons (issue #5351).
                // this issue doesn't happen for the timeline body however (
                h("div", { className: "fc-timeline-now-indicator-container" }, (slatCoords && slatCoords.isDateInRange(nowDate)) && (h(NowIndicatorContainer, { elClasses: ['fc-timeline-now-indicator-arrow'], elStyle: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl), isAxis: true, date: nowDate }))))))));
        }
        componentDidMount() {
            this.updateSize();
        }
        componentDidUpdate() {
            this.updateSize();
        }
        updateSize() {
            if (this.props.onMaxCushionWidth) {
                this.props.onMaxCushionWidth(this.computeMaxCushionWidth());
            }
        }
        computeMaxCushionWidth() {
            return Math.max(...findElements(this.rootElRef.current, '.fc-timeline-header-row:last-child .fc-timeline-slot-cushion').map((el) => el.getBoundingClientRect().width));
        }
    }

    class TimelineSlatCell extends BaseComponent {
        render() {
            let { props, context } = this;
            let { dateEnv, options, theme } = context;
            let { date, tDateProfile, isEm } = props;
            let dateMeta = getDateMeta(props.date, props.todayRange, props.nowDate, props.dateProfile);
            let renderProps = Object.assign(Object.assign({ date: dateEnv.toDate(props.date) }, dateMeta), { view: context.viewApi });
            return (h(ContentContainer, { elTag: "td", elRef: props.elRef, elClasses: [
                    'fc-timeline-slot',
                    'fc-timeline-slot-lane',
                    isEm && 'fc-timeline-slot-em',
                    tDateProfile.isTimeScale ? (isInt(dateEnv.countDurationsBetween(tDateProfile.normalizedRange.start, props.date, tDateProfile.labelInterval)) ?
                        'fc-timeline-slot-major' :
                        'fc-timeline-slot-minor') : '',
                    ...(props.isDay ?
                        getDayClassNames(dateMeta, theme) :
                        getSlotClassNames(dateMeta, theme)),
                ], elAttrs: {
                    'data-date': dateEnv.formatIso(date, {
                        omitTimeZoneOffset: true,
                        omitTime: !tDateProfile.isTimeScale,
                    }),
                }, renderProps: renderProps, generatorName: "slotLaneContent", generator: options.slotLaneContent, classNameGenerator: options.slotLaneClassNames, didMount: options.slotLaneDidMount, willUnmount: options.slotLaneWillUnmount }, (InnerContent) => (h(InnerContent, { elTag: "div" }))));
        }
    }

    class TimelineSlatsBody extends BaseComponent {
        render() {
            let { props } = this;
            let { tDateProfile, cellElRefs } = props;
            let { slotDates, isWeekStarts } = tDateProfile;
            let isDay = !tDateProfile.isTimeScale && !tDateProfile.largeUnit;
            return (h("tbody", null,
                h("tr", null, slotDates.map((slotDate, i) => {
                    let key = slotDate.toISOString();
                    return (h(TimelineSlatCell, { key: key, elRef: cellElRefs.createRef(key), date: slotDate, dateProfile: props.dateProfile, tDateProfile: tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isEm: isWeekStarts[i], isDay: isDay }));
                }))));
        }
    }

    class TimelineSlats extends BaseComponent {
        constructor() {
            super(...arguments);
            this.rootElRef = y();
            this.cellElRefs = new RefMap();
            this.handleScrollRequest = (request) => {
                let { onScrollLeftRequest } = this.props;
                let { coords } = this;
                if (onScrollLeftRequest && coords) {
                    if (request.time) {
                        let scrollLeft = coords.coordFromLeft(coords.durationToCoord(request.time));
                        onScrollLeftRequest(scrollLeft);
                    }
                    return true;
                }
                return null; // best?
            };
        }
        render() {
            let { props, context } = this;
            return (h("div", { className: "fc-timeline-slots", ref: this.rootElRef },
                h("table", { "aria-hidden": true, className: context.theme.getClass('table'), style: {
                        minWidth: props.tableMinWidth,
                        width: props.clientWidth,
                    } },
                    props.tableColGroupNode,
                    h(TimelineSlatsBody, { cellElRefs: this.cellElRefs, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange }))));
        }
        componentDidMount() {
            this.updateSizing();
            this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
        }
        componentDidUpdate(prevProps) {
            this.updateSizing();
            this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
        }
        componentWillUnmount() {
            this.scrollResponder.detach();
            if (this.props.onCoords) {
                this.props.onCoords(null);
            }
        }
        updateSizing() {
            let { props, context } = this;
            if (props.clientWidth !== null && // is sizing stable?
                this.scrollResponder
            // ^it's possible to have clientWidth immediately after mount (when returning from print view), but w/o scrollResponder
            ) {
                let rootEl = this.rootElRef.current;
                if (rootEl.offsetWidth) { // not hidden by css
                    this.coords = new TimelineCoords(this.rootElRef.current, collectCellEls(this.cellElRefs.currentMap, props.tDateProfile.slotDates), props.dateProfile, props.tDateProfile, context.dateEnv, context.isRtl);
                    if (props.onCoords) {
                        props.onCoords(this.coords);
                    }
                    this.scrollResponder.update(false); // TODO: wouldn't have to do this if coords were in state
                }
            }
        }
        positionToHit(leftPosition) {
            let { outerCoordCache } = this.coords;
            let { dateEnv, isRtl } = this.context;
            let { tDateProfile } = this.props;
            let slatIndex = outerCoordCache.leftToIndex(leftPosition);
            if (slatIndex != null) {
                // somewhat similar to what TimeGrid does. consolidate?
                let slatWidth = outerCoordCache.getWidth(slatIndex);
                let partial = isRtl ?
                    (outerCoordCache.rights[slatIndex] - leftPosition) / slatWidth :
                    (leftPosition - outerCoordCache.lefts[slatIndex]) / slatWidth;
                let localSnapIndex = Math.floor(partial * tDateProfile.snapsPerSlot);
                let start = dateEnv.add(tDateProfile.slotDates[slatIndex], multiplyDuration(tDateProfile.snapDuration, localSnapIndex));
                let end = dateEnv.add(start, tDateProfile.snapDuration);
                return {
                    dateSpan: {
                        range: { start, end },
                        allDay: !this.props.tDateProfile.isTimeScale,
                    },
                    dayEl: this.cellElRefs.currentMap[slatIndex],
                    left: outerCoordCache.lefts[slatIndex],
                    right: outerCoordCache.rights[slatIndex],
                };
            }
            return null;
        }
    }
    function collectCellEls(elMap, slotDates) {
        return slotDates.map((slotDate) => {
            let key = slotDate.toISOString();
            return elMap[key];
        });
    }

    function computeSegHCoords(segs, minWidth, timelineCoords) {
        let hcoords = [];
        if (timelineCoords) {
            for (let seg of segs) {
                let res = timelineCoords.rangeToCoords(seg);
                let start = Math.round(res.start); // for barely-overlapping collisions
                let end = Math.round(res.end); //
                if (end - start < minWidth) {
                    end = start + minWidth;
                }
                hcoords.push({ start, end });
            }
        }
        return hcoords;
    }
    function computeFgSegPlacements(segs, segHCoords, // might not have for every seg
    eventInstanceHeights, // might not have for every seg
    moreLinkHeights, // might not have for every more-link
    strictOrder, maxStackCnt) {
        let segInputs = [];
        let crudePlacements = []; // when we don't know dims
        for (let i = 0; i < segs.length; i += 1) {
            let seg = segs[i];
            let instanceId = seg.eventRange.instance.instanceId;
            let height = eventInstanceHeights[instanceId];
            let hcoords = segHCoords[i];
            if (height && hcoords) {
                segInputs.push({
                    index: i,
                    span: hcoords,
                    thickness: height,
                });
            }
            else {
                crudePlacements.push({
                    seg,
                    hcoords,
                    top: null,
                });
            }
        }
        let hierarchy = new SegHierarchy();
        if (strictOrder != null) {
            hierarchy.strictOrder = strictOrder;
        }
        if (maxStackCnt != null) {
            hierarchy.maxStackCnt = maxStackCnt;
        }
        let hiddenEntries = hierarchy.addSegs(segInputs);
        let hiddenPlacements = hiddenEntries.map((entry) => ({
            seg: segs[entry.index],
            hcoords: entry.span,
            top: null,
        }));
        let hiddenGroups = groupIntersectingEntries(hiddenEntries);
        let moreLinkInputs = [];
        let moreLinkCrudePlacements = [];
        const extractSeg = (entry) => segs[entry.index];
        for (let i = 0; i < hiddenGroups.length; i += 1) {
            let hiddenGroup = hiddenGroups[i];
            let sortedSegs = hiddenGroup.entries.map(extractSeg);
            let height = moreLinkHeights[buildIsoString(computeEarliestSegStart(sortedSegs))]; // not optimal :(
            if (height != null) {
                // NOTE: the hiddenGroup's spanStart/spanEnd are already computed by rangeToCoords. computed during input.
                moreLinkInputs.push({
                    index: segs.length + i,
                    thickness: height,
                    span: hiddenGroup.span,
                });
            }
            else {
                moreLinkCrudePlacements.push({
                    seg: sortedSegs,
                    hcoords: hiddenGroup.span,
                    top: null,
                });
            }
        }
        // add more-links into the hierarchy, but don't limit
        hierarchy.maxStackCnt = -1;
        hierarchy.addSegs(moreLinkInputs);
        let visibleRects = hierarchy.toRects();
        let visiblePlacements = [];
        let maxHeight = 0;
        for (let rect of visibleRects) {
            let segIndex = rect.index;
            visiblePlacements.push({
                seg: segIndex < segs.length
                    ? segs[segIndex] // a real seg
                    : hiddenGroups[segIndex - segs.length].entries.map(extractSeg),
                hcoords: rect.span,
                top: rect.levelCoord,
            });
            maxHeight = Math.max(maxHeight, rect.levelCoord + rect.thickness);
        }
        return [
            visiblePlacements.concat(crudePlacements, hiddenPlacements, moreLinkCrudePlacements),
            maxHeight,
        ];
    }

    class TimelineLaneBg extends BaseComponent {
        render() {
            let { props } = this;
            let highlightSeg = [].concat(props.eventResizeSegs, props.dateSelectionSegs);
            return props.timelineCoords && (h("div", { className: "fc-timeline-bg" },
                this.renderSegs(props.businessHourSegs || [], props.timelineCoords, 'non-business'),
                this.renderSegs(props.bgEventSegs || [], props.timelineCoords, 'bg-event'),
                this.renderSegs(highlightSeg, props.timelineCoords, 'highlight')));
        }
        renderSegs(segs, timelineCoords, fillType) {
            let { todayRange, nowDate } = this.props;
            let { isRtl } = this.context;
            let segHCoords = computeSegHCoords(segs, 0, timelineCoords);
            let children = segs.map((seg, i) => {
                let hcoords = segHCoords[i];
                let hStyle = coordsToCss(hcoords, isRtl);
                return (h("div", { key: buildEventRangeKey(seg.eventRange), className: "fc-timeline-bg-harness", style: hStyle }, fillType === 'bg-event' ?
                    h(BgEvent, Object.assign({ seg: seg }, getSegMeta(seg, todayRange, nowDate))) :
                    renderFill(fillType)));
            });
            return h(p, null, children);
        }
    }

    class TimelineLaneSlicer extends Slicer {
        sliceRange(origRange, dateProfile, dateProfileGenerator, tDateProfile, dateEnv) {
            let normalRange = normalizeRange(origRange, tDateProfile, dateEnv);
            let segs = [];
            // protect against when the span is entirely in an invalid date region
            if (computeDateSnapCoverage(normalRange.start, tDateProfile, dateEnv)
                < computeDateSnapCoverage(normalRange.end, tDateProfile, dateEnv)) {
                // intersect the footprint's range with the grid's range
                let slicedRange = intersectRanges(normalRange, tDateProfile.normalizedRange);
                if (slicedRange) {
                    segs.push({
                        start: slicedRange.start,
                        end: slicedRange.end,
                        isStart: slicedRange.start.valueOf() === normalRange.start.valueOf()
                            && isValidDate(slicedRange.start, tDateProfile, dateProfile, dateProfileGenerator),
                        isEnd: slicedRange.end.valueOf() === normalRange.end.valueOf()
                            && isValidDate(addMs(slicedRange.end, -1), tDateProfile, dateProfile, dateProfileGenerator),
                    });
                }
            }
            return segs;
        }
    }

    const DEFAULT_TIME_FORMAT = createFormatter({
        hour: 'numeric',
        minute: '2-digit',
        omitZeroMinute: true,
        meridiem: 'narrow',
    });
    class TimelineEvent extends BaseComponent {
        render() {
            let { props } = this;
            return (h(StandardEvent, Object.assign({}, props, { elClasses: ['fc-timeline-event', 'fc-h-event'], defaultTimeFormat: DEFAULT_TIME_FORMAT, defaultDisplayEventTime: !props.isTimeScale })));
        }
    }

    class TimelineLaneMoreLink extends BaseComponent {
        render() {
            let { props, context } = this;
            let { hiddenSegs, placement, resourceId } = props;
            let { top, hcoords } = placement;
            let isVisible = hcoords && top !== null;
            let hStyle = coordsToCss(hcoords, context.isRtl);
            let extraDateSpan = resourceId ? { resourceId } : {};
            return (h(MoreLinkContainer, { elRef: props.elRef, elClasses: ['fc-timeline-more-link'], elStyle: Object.assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle), allDayDate: null, moreCnt: hiddenSegs.length, allSegs: hiddenSegs, hiddenSegs: hiddenSegs, dateProfile: props.dateProfile, todayRange: props.todayRange, extraDateSpan: extraDateSpan, popoverContent: () => (h(p, null, hiddenSegs.map((seg) => {
                    let instanceId = seg.eventRange.instance.instanceId;
                    return (h("div", { key: instanceId, style: { visibility: props.isForcedInvisible[instanceId] ? 'hidden' : '' } },
                        h(TimelineEvent, Object.assign({ isTimeScale: props.isTimeScale, seg: seg, isDragging: false, isResizing: false, isDateSelecting: false, isSelected: instanceId === props.eventSelection }, getSegMeta(seg, props.todayRange, props.nowDate)))));
                }))) }, (InnerContent) => (h(InnerContent, { elTag: "div", elClasses: ['fc-timeline-more-link-inner', 'fc-sticky'] }))));
        }
    }

    class TimelineLane extends BaseComponent {
        constructor() {
            super(...arguments);
            this.slicer = new TimelineLaneSlicer();
            this.sortEventSegs = memoize(sortEventSegs);
            this.harnessElRefs = new RefMap();
            this.moreElRefs = new RefMap();
            this.innerElRef = y();
            // TODO: memoize event positioning
            this.state = {
                eventInstanceHeights: {},
                moreLinkHeights: {},
            };
            this.handleResize = (isForced) => {
                if (isForced) {
                    this.updateSize();
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let { options } = context;
            let { dateProfile, tDateProfile } = props;
            let slicedProps = this.slicer.sliceProps(props, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't have to pass in the rest of the args...
            dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
            let mirrorSegs = (slicedProps.eventDrag ? slicedProps.eventDrag.segs : null) ||
                (slicedProps.eventResize ? slicedProps.eventResize.segs : null) ||
                [];
            let fgSegs = this.sortEventSegs(slicedProps.fgEventSegs, options.eventOrder);
            let fgSegHCoords = computeSegHCoords(fgSegs, options.eventMinWidth, props.timelineCoords);
            let [fgPlacements, fgHeight] = computeFgSegPlacements(fgSegs, fgSegHCoords, state.eventInstanceHeights, state.moreLinkHeights, options.eventOrderStrict, options.eventMaxStack);
            let isForcedInvisible = // TODO: more convenient
             (slicedProps.eventDrag ? slicedProps.eventDrag.affectedInstances : null) ||
                (slicedProps.eventResize ? slicedProps.eventResize.affectedInstances : null) ||
                {};
            return (h(p, null,
                h(TimelineLaneBg, { businessHourSegs: slicedProps.businessHourSegs, bgEventSegs: slicedProps.bgEventSegs, timelineCoords: props.timelineCoords, eventResizeSegs: slicedProps.eventResize ? slicedProps.eventResize.segs : [] /* bad new empty array? */, dateSelectionSegs: slicedProps.dateSelectionSegs, nowDate: props.nowDate, todayRange: props.todayRange }),
                h("div", { className: "fc-timeline-events fc-scrollgrid-sync-inner", ref: this.innerElRef, style: { height: fgHeight } },
                    this.renderFgSegs(fgPlacements, isForcedInvisible, false, false, false),
                    this.renderFgSegs(buildMirrorPlacements(mirrorSegs, props.timelineCoords, fgPlacements), {}, Boolean(slicedProps.eventDrag), Boolean(slicedProps.eventResize), false))));
        }
        componentDidMount() {
            this.updateSize();
            this.context.addResizeHandler(this.handleResize);
        }
        componentDidUpdate(prevProps, prevState) {
            if (prevProps.eventStore !== this.props.eventStore || // external thing changed?
                prevProps.timelineCoords !== this.props.timelineCoords || // external thing changed?
                prevState.moreLinkHeights !== this.state.moreLinkHeights // HACK. see addStateEquality
            ) {
                this.updateSize();
            }
        }
        componentWillUnmount() {
            this.context.removeResizeHandler(this.handleResize);
        }
        updateSize() {
            let { props } = this;
            let { timelineCoords } = props;
            const innerEl = this.innerElRef.current;
            if (props.onHeightChange) {
                props.onHeightChange(innerEl, false);
            }
            if (timelineCoords) {
                this.setState({
                    eventInstanceHeights: mapHash(this.harnessElRefs.currentMap, (harnessEl) => (Math.round(harnessEl.getBoundingClientRect().height))),
                    moreLinkHeights: mapHash(this.moreElRefs.currentMap, (moreEl) => (Math.round(moreEl.getBoundingClientRect().height))),
                }, () => {
                    if (props.onHeightChange) {
                        props.onHeightChange(innerEl, true);
                    }
                });
            }
            // hack
            if (props.syncParentMinHeight) {
                innerEl.parentElement.style.minHeight = innerEl.style.height;
            }
        }
        renderFgSegs(segPlacements, isForcedInvisible, isDragging, isResizing, isDateSelecting) {
            let { harnessElRefs, moreElRefs, props, context } = this;
            let isMirror = isDragging || isResizing || isDateSelecting;
            return (h(p, null, segPlacements.map((segPlacement) => {
                let { seg, hcoords, top } = segPlacement;
                if (Array.isArray(seg)) { // a more-link
                    let isoStr = buildIsoString(computeEarliestSegStart(seg));
                    return (h(TimelineLaneMoreLink, { key: 'm:' + isoStr /* "m" for "more" */, elRef: moreElRefs.createRef(isoStr), hiddenSegs: seg, placement: segPlacement, dateProfile: props.dateProfile, nowDate: props.nowDate, todayRange: props.todayRange, isTimeScale: props.tDateProfile.isTimeScale, eventSelection: props.eventSelection, resourceId: props.resourceId, isForcedInvisible: isForcedInvisible }));
                }
                let instanceId = seg.eventRange.instance.instanceId;
                let isVisible = isMirror || Boolean(!isForcedInvisible[instanceId] && hcoords && top !== null);
                let hStyle = coordsToCss(hcoords, context.isRtl);
                return (h("div", { key: 'e:' + instanceId /* "e" for "event" */, ref: isMirror ? null : harnessElRefs.createRef(instanceId), className: "fc-timeline-event-harness", style: Object.assign({ visibility: isVisible ? '' : 'hidden', top: top || 0 }, hStyle) },
                    h(TimelineEvent, Object.assign({ isTimeScale: props.tDateProfile.isTimeScale, seg: seg, isDragging: isDragging, isResizing: isResizing, isDateSelecting: isDateSelecting, isSelected: instanceId === props.eventSelection /* TODO: bad for mirror? */ }, getSegMeta(seg, props.todayRange, props.nowDate)))));
            })));
        }
    }
    TimelineLane.addStateEquality({
        eventInstanceHeights: isPropsEqual,
        moreLinkHeights: isPropsEqual,
    });
    function buildMirrorPlacements(mirrorSegs, timelineCoords, fgPlacements) {
        if (!mirrorSegs.length || !timelineCoords) {
            return [];
        }
        let topsByInstanceId = buildAbsoluteTopHash(fgPlacements); // TODO: cache this at first render?
        return mirrorSegs.map((seg) => ({
            seg,
            hcoords: timelineCoords.rangeToCoords(seg),
            top: topsByInstanceId[seg.eventRange.instance.instanceId],
        }));
    }
    function buildAbsoluteTopHash(placements) {
        let topsByInstanceId = {};
        for (let placement of placements) {
            let { seg } = placement;
            if (!Array.isArray(seg)) { // doesn't represent a more-link
                topsByInstanceId[seg.eventRange.instance.instanceId] = placement.top;
            }
        }
        return topsByInstanceId;
    }

    class TimelineGrid extends DateComponent {
        constructor() {
            super(...arguments);
            this.slatsRef = y();
            this.state = {
                coords: null,
            };
            this.handeEl = (el) => {
                if (el) {
                    this.context.registerInteractiveComponent(this, { el });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
            this.handleCoords = (coords) => {
                this.setState({ coords });
                if (this.props.onSlatCoords) {
                    this.props.onSlatCoords(coords);
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let { options } = context;
            let { dateProfile, tDateProfile } = props;
            let timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
            return (h("div", { className: "fc-timeline-body", ref: this.handeEl, style: {
                    minWidth: props.tableMinWidth,
                    height: props.clientHeight,
                    width: props.clientWidth,
                } },
                h(NowTimer, { unit: timerUnit }, (nowDate, todayRange) => (h(p, null,
                    h(TimelineSlats, { ref: this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: this.handleCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
                    h(TimelineLane, { dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, nextDayThreshold: options.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: state.coords, syncParentMinHeight: true }),
                    (options.nowIndicator && state.coords && state.coords.isDateInRange(nowDate)) && (h("div", { className: "fc-timeline-now-indicator-container" },
                        h(NowIndicatorContainer, { elClasses: ['fc-timeline-now-indicator-line'], elStyle: coordToCss(state.coords.dateToCoord(nowDate), context.isRtl), isAxis: false, date: nowDate }))))))));
        }
        // Hit System
        // ------------------------------------------------------------------------------------------
        queryHit(positionLeft, positionTop, elWidth, elHeight) {
            let slats = this.slatsRef.current;
            let slatHit = slats.positionToHit(positionLeft);
            if (slatHit) {
                return {
                    dateProfile: this.props.dateProfile,
                    dateSpan: slatHit.dateSpan,
                    rect: {
                        left: slatHit.left,
                        right: slatHit.right,
                        top: 0,
                        bottom: elHeight,
                    },
                    dayEl: slatHit.dayEl,
                    layer: 0,
                };
            }
            return null;
        }
    }

    class TimelineView extends DateComponent {
        constructor() {
            super(...arguments);
            this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
            this.scrollGridRef = y();
            this.state = {
                slatCoords: null,
                slotCushionMaxWidth: null,
            };
            this.handleSlatCoords = (slatCoords) => {
                this.setState({ slatCoords });
            };
            this.handleScrollLeftRequest = (scrollLeft) => {
                let scrollGrid = this.scrollGridRef.current;
                scrollGrid.forceScrollLeft(0, scrollLeft);
            };
            this.handleMaxCushionWidth = (slotCushionMaxWidth) => {
                this.setState({
                    slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
                });
            };
        }
        render() {
            let { props, state, context } = this;
            let { options } = context;
            let stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
            let stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
            let tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
            let { slotMinWidth } = options;
            let slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
            let sections = [
                {
                    type: 'header',
                    key: 'header',
                    isSticky: stickyHeaderDates,
                    chunks: [{
                            key: 'timeline',
                            content: (contentArg) => (h(TimelineHeader, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, slatCoords: state.slatCoords, onMaxCushionWidth: slotMinWidth ? null : this.handleMaxCushionWidth })),
                        }],
                },
                {
                    type: 'body',
                    key: 'body',
                    liquid: true,
                    chunks: [{
                            key: 'timeline',
                            content: (contentArg) => (h(TimelineGrid, Object.assign({}, props, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, tDateProfile: tDateProfile, onSlatCoords: this.handleSlatCoords, onScrollLeftRequest: this.handleScrollLeftRequest }))),
                        }],
                },
            ];
            if (stickyFooterScrollbar) {
                sections.push({
                    type: 'footer',
                    key: 'footer',
                    isSticky: true,
                    chunks: [{
                            key: 'timeline',
                            content: renderScrollShim,
                        }],
                });
            }
            return (h(ViewContainer$1, { elClasses: [
                    'fc-timeline',
                    options.eventOverlap === false ?
                        'fc-timeline-overlap-disabled' :
                        '',
                ], viewSpec: context.viewSpec },
                h(ScrollGrid, { ref: this.scrollGridRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
                        { cols: slatCols },
                    ], sections: sections })));
        }
        computeFallbackSlotMinWidth(tDateProfile) {
            return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
        }
    }
    function buildSlatCols(tDateProfile, slotMinWidth) {
        return [{
                span: tDateProfile.slotCnt,
                minWidth: slotMinWidth || 1, // needs to be a non-zero number to trigger horizontal scrollbars!??????
            }];
    }

    var css_248z$1 = ".fc .fc-timeline-body{min-height:100%;position:relative;z-index:1}.fc .fc-timeline-slots{bottom:0;position:absolute;top:0;z-index:1}.fc .fc-timeline-slots>table{height:100%}.fc .fc-timeline-slot-minor{border-style:dotted}.fc .fc-timeline-slot-frame{align-items:center;display:flex;justify-content:center}.fc .fc-timeline-header-row-chrono .fc-timeline-slot-frame{justify-content:flex-start}.fc .fc-timeline-header-row:last-child .fc-timeline-slot-frame{overflow:hidden}.fc .fc-timeline-slot-cushion{padding:4px 5px;white-space:nowrap}.fc-direction-ltr .fc-timeline-slot{border-right:0!important}.fc-direction-rtl .fc-timeline-slot{border-left:0!important}.fc .fc-timeline-now-indicator-container{bottom:0;left:0;position:absolute;right:0;top:0;width:0;z-index:4}.fc .fc-timeline-now-indicator-arrow,.fc .fc-timeline-now-indicator-line{border-color:var(--fc-now-indicator-color);border-style:solid;position:absolute;top:0}.fc .fc-timeline-now-indicator-arrow{border-left-color:transparent;border-right-color:transparent;border-width:6px 5px 0;margin:0 -6px}.fc .fc-timeline-now-indicator-line{border-width:0 0 0 1px;bottom:0;margin:0 -1px}.fc .fc-timeline-events{position:relative;width:0;z-index:3}.fc .fc-timeline-event-harness,.fc .fc-timeline-more-link{position:absolute;top:0}.fc-timeline-event{z-index:1}.fc-timeline-event.fc-event-mirror{z-index:2}.fc-timeline-event{align-items:center;border-radius:0;display:flex;font-size:var(--fc-small-font-size);margin-bottom:1px;padding:2px 1px;position:relative}.fc-timeline-event .fc-event-main{flex-grow:1;flex-shrink:1;min-width:0}.fc-timeline-event .fc-event-time{font-weight:700}.fc-timeline-event .fc-event-time,.fc-timeline-event .fc-event-title{padding:0 2px;white-space:nowrap}.fc-direction-ltr .fc-timeline-event.fc-event-end,.fc-direction-ltr .fc-timeline-more-link{margin-right:1px}.fc-direction-rtl .fc-timeline-event.fc-event-end,.fc-direction-rtl .fc-timeline-more-link{margin-left:1px}.fc-timeline-overlap-disabled .fc-timeline-event{margin-bottom:0;padding-bottom:5px;padding-top:5px}.fc-timeline-event:not(.fc-event-end):after,.fc-timeline-event:not(.fc-event-start):before{border-color:transparent #000;border-style:solid;border-width:5px;content:\"\";flex-grow:0;flex-shrink:0;height:0;margin:0 1px;opacity:.5;width:0}.fc-direction-ltr .fc-timeline-event:not(.fc-event-start):before,.fc-direction-rtl .fc-timeline-event:not(.fc-event-end):after{border-left:0}.fc-direction-ltr .fc-timeline-event:not(.fc-event-end):after,.fc-direction-rtl .fc-timeline-event:not(.fc-event-start):before{border-right:0}.fc-timeline-more-link{background:var(--fc-more-link-bg-color);color:var(--fc-more-link-text-color);cursor:pointer;font-size:var(--fc-small-font-size);padding:1px}.fc-timeline-more-link-inner{display:inline-block;left:0;padding:2px;right:0}.fc .fc-timeline-bg{bottom:0;left:0;position:absolute;right:0;top:0;width:0;z-index:2}.fc .fc-timeline-bg .fc-non-business{z-index:1}.fc .fc-timeline-bg .fc-bg-event{z-index:2}.fc .fc-timeline-bg .fc-highlight{z-index:3}.fc .fc-timeline-bg-harness{bottom:0;position:absolute;top:0}";
    injectStyles(css_248z$1);

    var index$4 = createPlugin({
        name: '@fullcalendar/timeline',
        premiumReleaseDate: '2022-12-27',
        deps: [index$7],
        initialView: 'timelineDay',
        views: {
            timeline: {
                component: TimelineView,
                usesMinMaxTime: true,
                eventResizableFromStart: true, // how is this consumed for TimelineView tho?
            },
            timelineDay: {
                type: 'timeline',
                duration: { days: 1 },
            },
            timelineWeek: {
                type: 'timeline',
                duration: { weeks: 1 },
            },
            timelineMonth: {
                type: 'timeline',
                duration: { months: 1 },
            },
            timelineYear: {
                type: 'timeline',
                duration: { years: 1 },
            },
        },
    });

    const PRIVATE_ID_PREFIX = '_fc:';
    const RESOURCE_REFINERS = {
        id: String,
        parentId: String,
        children: identity,
        title: String,
        businessHours: identity,
        extendedProps: identity,
        // event-ui
        eventEditable: Boolean,
        eventStartEditable: Boolean,
        eventDurationEditable: Boolean,
        eventConstraint: identity,
        eventOverlap: Boolean,
        eventAllow: identity,
        eventClassNames: parseClassNames,
        eventBackgroundColor: String,
        eventBorderColor: String,
        eventTextColor: String,
        eventColor: String,
    };
    /*
    needs a full store so that it can populate children too
    */
    function parseResource(raw, parentId = '', store, context) {
        let { refined, extra } = refineProps(raw, RESOURCE_REFINERS);
        let resource = {
            id: refined.id || (PRIVATE_ID_PREFIX + guid()),
            parentId: refined.parentId || parentId,
            title: refined.title || '',
            businessHours: refined.businessHours ? parseBusinessHours(refined.businessHours, context) : null,
            ui: createEventUi({
                editable: refined.eventEditable,
                startEditable: refined.eventStartEditable,
                durationEditable: refined.eventDurationEditable,
                constraint: refined.eventConstraint,
                overlap: refined.eventOverlap,
                allow: refined.eventAllow,
                classNames: refined.eventClassNames,
                backgroundColor: refined.eventBackgroundColor,
                borderColor: refined.eventBorderColor,
                textColor: refined.eventTextColor,
                color: refined.eventColor,
            }, context),
            extendedProps: Object.assign(Object.assign({}, extra), refined.extendedProps),
        };
        // help out ResourceApi from having user modify props
        Object.freeze(resource.ui.classNames);
        Object.freeze(resource.extendedProps);
        if (store[resource.id]) ;
        else {
            store[resource.id] = resource;
            if (refined.children) {
                for (let childInput of refined.children) {
                    parseResource(childInput, resource.id, store, context);
                }
            }
        }
        return resource;
    }
    /*
    TODO: use this in more places
    */
    function getPublicId(id) {
        if (id.indexOf(PRIVATE_ID_PREFIX) === 0) {
            return '';
        }
        return id;
    }

    class ResourceApi {
        constructor(_context, _resource) {
            this._context = _context;
            this._resource = _resource;
        }
        setProp(name, value) {
            let oldResource = this._resource;
            this._context.dispatch({
                type: 'SET_RESOURCE_PROP',
                resourceId: oldResource.id,
                propName: name,
                propValue: value,
            });
            this.sync(oldResource);
        }
        setExtendedProp(name, value) {
            let oldResource = this._resource;
            this._context.dispatch({
                type: 'SET_RESOURCE_EXTENDED_PROP',
                resourceId: oldResource.id,
                propName: name,
                propValue: value,
            });
            this.sync(oldResource);
        }
        sync(oldResource) {
            let context = this._context;
            let resourceId = oldResource.id;
            // TODO: what if dispatch didn't complete synchronously?
            this._resource = context.getCurrentData().resourceStore[resourceId];
            context.emitter.trigger('resourceChange', {
                oldResource: new ResourceApi(context, oldResource),
                resource: this,
                revert() {
                    context.dispatch({
                        type: 'ADD_RESOURCE',
                        resourceHash: {
                            [resourceId]: oldResource,
                        },
                    });
                },
            });
        }
        remove() {
            let context = this._context;
            let internalResource = this._resource;
            let resourceId = internalResource.id;
            context.dispatch({
                type: 'REMOVE_RESOURCE',
                resourceId,
            });
            context.emitter.trigger('resourceRemove', {
                resource: this,
                revert() {
                    context.dispatch({
                        type: 'ADD_RESOURCE',
                        resourceHash: {
                            [resourceId]: internalResource,
                        },
                    });
                },
            });
        }
        getParent() {
            let context = this._context;
            let parentId = this._resource.parentId;
            if (parentId) {
                return new ResourceApi(context, context.getCurrentData().resourceSource[parentId]);
            }
            return null;
        }
        getChildren() {
            let thisResourceId = this._resource.id;
            let context = this._context;
            let { resourceStore } = context.getCurrentData();
            let childApis = [];
            for (let resourceId in resourceStore) {
                if (resourceStore[resourceId].parentId === thisResourceId) {
                    childApis.push(new ResourceApi(context, resourceStore[resourceId]));
                }
            }
            return childApis;
        }
        /*
        this is really inefficient!
        TODO: make EventApi::resourceIds a hash or keep an index in the Calendar's state
        */
        getEvents() {
            let thisResourceId = this._resource.id;
            let context = this._context;
            let { defs, instances } = context.getCurrentData().eventStore;
            let eventApis = [];
            for (let instanceId in instances) {
                let instance = instances[instanceId];
                let def = defs[instance.defId];
                if (def.resourceIds.indexOf(thisResourceId) !== -1) { // inefficient!!!
                    eventApis.push(new EventImpl(context, def, instance));
                }
            }
            return eventApis;
        }
        get id() { return getPublicId(this._resource.id); }
        get title() { return this._resource.title; }
        get eventConstraint() { return this._resource.ui.constraints[0] || null; } // TODO: better type
        get eventOverlap() { return this._resource.ui.overlap; }
        get eventAllow() { return this._resource.ui.allows[0] || null; } // TODO: better type
        get eventBackgroundColor() { return this._resource.ui.backgroundColor; }
        get eventBorderColor() { return this._resource.ui.borderColor; }
        get eventTextColor() { return this._resource.ui.textColor; }
        // NOTE: user can't modify these because Object.freeze was called in event-def parsing
        get eventClassNames() { return this._resource.ui.classNames; }
        get extendedProps() { return this._resource.extendedProps; }
        toPlainObject(settings = {}) {
            let internal = this._resource;
            let { ui } = internal;
            let publicId = this.id;
            let res = {};
            if (publicId) {
                res.id = publicId;
            }
            if (internal.title) {
                res.title = internal.title;
            }
            if (settings.collapseEventColor && ui.backgroundColor && ui.backgroundColor === ui.borderColor) {
                res.eventColor = ui.backgroundColor;
            }
            else {
                if (ui.backgroundColor) {
                    res.eventBackgroundColor = ui.backgroundColor;
                }
                if (ui.borderColor) {
                    res.eventBorderColor = ui.borderColor;
                }
            }
            if (ui.textColor) {
                res.eventTextColor = ui.textColor;
            }
            if (ui.classNames.length) {
                res.eventClassNames = ui.classNames;
            }
            if (Object.keys(internal.extendedProps).length) {
                if (settings.collapseExtendedProps) {
                    Object.assign(res, internal.extendedProps);
                }
                else {
                    res.extendedProps = internal.extendedProps;
                }
            }
            return res;
        }
        toJSON() {
            return this.toPlainObject();
        }
    }
    function buildResourceApis(resourceStore, context) {
        let resourceApis = [];
        for (let resourceId in resourceStore) {
            resourceApis.push(new ResourceApi(context, resourceStore[resourceId]));
        }
        return resourceApis;
    }

    /*
    splits things BASED OFF OF which resources they are associated with.
    creates a '' entry which is when something has NO resource.
    */
    class ResourceSplitter extends Splitter {
        getKeyInfo(props) {
            return Object.assign({ '': {} }, props.resourceStore);
        }
        getKeysForDateSpan(dateSpan) {
            return [dateSpan.resourceId || ''];
        }
        getKeysForEventDef(eventDef) {
            let resourceIds = eventDef.resourceIds;
            if (!resourceIds.length) {
                return [''];
            }
            return resourceIds;
        }
    }

    const DEFAULT_RESOURCE_ORDER = parseFieldSpecs('id,title');
    function handleResourceStore(resourceStore, calendarData) {
        let { emitter } = calendarData;
        if (emitter.hasHandlers('resourcesSet')) {
            emitter.trigger('resourcesSet', buildResourceApis(resourceStore, calendarData));
        }
    }

    function refineRenderProps$1(input) {
        return {
            resource: new ResourceApi(input.context, input.resource),
        };
    }

    // TODO: not used for Spreadsheet. START USING. difficult because of col-specific rendering props
    class ResourceLabelContainer extends BaseComponent {
        constructor() {
            super(...arguments);
            this.refineRenderProps = memoizeObjArg(refineRenderProps$2);
        }
        render() {
            const { props } = this;
            return (h(ViewContextType.Consumer, null, (context) => {
                let { options } = context;
                let renderProps = this.refineRenderProps({
                    resource: props.resource,
                    date: props.date,
                    context,
                });
                return (h(ContentContainer, Object.assign({}, props, { elAttrs: Object.assign(Object.assign({}, props.elAttrs), { 'data-resource-id': props.resource.id, 'data-date': props.date ? formatDayString(props.date) : undefined }), renderProps: renderProps, generatorName: "resourceLabelContent", generator: options.resourceLabelContent || renderInnerContent, classNameGenerator: options.resourceLabelClassNames, didMount: options.resourceLabelDidMount, willUnmount: options.resourceLabelWillUnmount })));
            }));
        }
    }
    function renderInnerContent(props) {
        return props.resource.title || props.resource.id;
    }
    function refineRenderProps$2(input) {
        return {
            resource: new ResourceApi(input.context, input.resource),
            date: input.date ? input.context.dateEnv.toDate(input.date) : null,
            view: input.context.viewApi,
        };
    }

    class ResourceCell extends BaseComponent {
        render() {
            let { props } = this;
            return (h(ResourceLabelContainer, { elTag: "th", elClasses: ['fc-col-header-cell', 'fc-resource'], elAttrs: {
                    role: 'columnheader',
                    colSpan: props.colSpan,
                }, resource: props.resource, date: props.date }, (InnerContent) => (h("div", { className: "fc-scrollgrid-sync-inner" },
                h(InnerContent, { elTag: "span", elClasses: [
                        'fc-col-header-cell-cushion',
                        props.isSticky && 'fc-sticky',
                    ] })))));
        }
    }

    class ResourceDayHeader extends BaseComponent {
        constructor() {
            super(...arguments);
            this.buildDateFormat = memoize(buildDateFormat);
        }
        render() {
            let { props, context } = this;
            let dateFormat = this.buildDateFormat(context.options.dayHeaderFormat, props.datesRepDistinctDays, props.dates.length);
            return (h(NowTimer, { unit: "day" }, (nowDate, todayRange) => {
                if (props.dates.length === 1) {
                    return this.renderResourceRow(props.resources, props.dates[0]);
                }
                if (context.options.datesAboveResources) {
                    return this.renderDayAndResourceRows(props.dates, dateFormat, todayRange, props.resources);
                }
                return this.renderResourceAndDayRows(props.resources, props.dates, dateFormat, todayRange);
            }));
        }
        renderResourceRow(resources, date) {
            let resourceCells = resources.map((resource) => (h(ResourceCell, { key: resource.id, resource: resource, colSpan: 1, date: date })));
            return this.buildTr(resourceCells, 'resources');
        }
        renderDayAndResourceRows(dates, dateFormat, todayRange, resources) {
            let dateCells = [];
            let resourceCells = [];
            for (let date of dates) {
                dateCells.push(this.renderDateCell(date, dateFormat, todayRange, resources.length, null, true));
                for (let resource of resources) {
                    resourceCells.push(h(ResourceCell, { key: resource.id + ':' + date.toISOString(), resource: resource, colSpan: 1, date: date }));
                }
            }
            return (h(p, null,
                this.buildTr(dateCells, 'day'),
                this.buildTr(resourceCells, 'resources')));
        }
        renderResourceAndDayRows(resources, dates, dateFormat, todayRange) {
            let resourceCells = [];
            let dateCells = [];
            for (let resource of resources) {
                resourceCells.push(h(ResourceCell, { key: resource.id, resource: resource, colSpan: dates.length, isSticky: true }));
                for (let date of dates) {
                    dateCells.push(this.renderDateCell(date, dateFormat, todayRange, 1, resource));
                }
            }
            return (h(p, null,
                this.buildTr(resourceCells, 'resources'),
                this.buildTr(dateCells, 'day')));
        }
        // a cell with date text. might have a resource associated with it
        renderDateCell(date, dateFormat, todayRange, colSpan, resource, isSticky) {
            let { props } = this;
            let keyPostfix = resource ? `:${resource.id}` : '';
            let extraRenderProps = resource ? { resource: new ResourceApi(this.context, resource) } : {};
            let extraDataAttrs = resource ? { 'data-resource-id': resource.id } : {};
            return props.datesRepDistinctDays ? (h(TableDateCell, { key: date.toISOString() + keyPostfix, date: date, dateProfile: props.dateProfile, todayRange: todayRange, colCnt: props.dates.length * props.resources.length, dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraRenderProps: extraRenderProps, extraDataAttrs: extraDataAttrs })) : (h(TableDowCell // we can't leverage the pure-componentness becausae the extra* props are new every time :(
            , { key: date.getUTCDay() + keyPostfix, dow: date.getUTCDay(), dayHeaderFormat: dateFormat, colSpan: colSpan, isSticky: isSticky, extraRenderProps: extraRenderProps, extraDataAttrs: extraDataAttrs }));
        }
        buildTr(cells, key) {
            let { renderIntro } = this.props;
            if (!cells.length) {
                cells = [h("td", { key: 0 }, "\u00A0")];
            }
            return (h("tr", { key: key, role: "row" },
                renderIntro && renderIntro(key),
                cells));
        }
    }
    function buildDateFormat(dayHeaderFormat, datesRepDistinctDays, dayCnt) {
        return dayHeaderFormat || computeFallbackHeaderFormat(datesRepDistinctDays, dayCnt);
    }

    class ResourceIndex {
        constructor(resources) {
            let indicesById = {};
            let ids = [];
            for (let i = 0; i < resources.length; i += 1) {
                let id = resources[i].id;
                ids.push(id);
                indicesById[id] = i;
            }
            this.ids = ids;
            this.indicesById = indicesById;
            this.length = resources.length;
        }
    }

    class AbstractResourceDayTableModel {
        constructor(dayTableModel, resources, context) {
            this.dayTableModel = dayTableModel;
            this.resources = resources;
            this.context = context;
            this.resourceIndex = new ResourceIndex(resources);
            this.rowCnt = dayTableModel.rowCnt;
            this.colCnt = dayTableModel.colCnt * resources.length;
            this.cells = this.buildCells();
        }
        buildCells() {
            let { rowCnt, dayTableModel, resources } = this;
            let rows = [];
            for (let row = 0; row < rowCnt; row += 1) {
                let rowCells = [];
                for (let dateCol = 0; dateCol < dayTableModel.colCnt; dateCol += 1) {
                    for (let resourceCol = 0; resourceCol < resources.length; resourceCol += 1) {
                        let resource = resources[resourceCol];
                        let extraRenderProps = { resource: new ResourceApi(this.context, resource) };
                        let extraDataAttrs = { 'data-resource-id': resource.id };
                        let extraClassNames = ['fc-resource'];
                        let extraDateSpan = { resourceId: resource.id };
                        let date = dayTableModel.cells[row][dateCol].date;
                        rowCells[this.computeCol(dateCol, resourceCol)] = {
                            key: resource.id + ':' + date.toISOString(),
                            date,
                            extraRenderProps,
                            extraDataAttrs,
                            extraClassNames,
                            extraDateSpan,
                        };
                    }
                }
                rows.push(rowCells);
            }
            return rows;
        }
    }

    /*
    resources over dates
    */
    class ResourceDayTableModel extends AbstractResourceDayTableModel {
        computeCol(dateI, resourceI) {
            return resourceI * this.dayTableModel.colCnt + dateI;
        }
        /*
        all date ranges are intact
        */
        computeColRanges(dateStartI, dateEndI, resourceI) {
            return [
                {
                    firstCol: this.computeCol(dateStartI, resourceI),
                    lastCol: this.computeCol(dateEndI, resourceI),
                    isStart: true,
                    isEnd: true,
                },
            ];
        }
    }

    /*
    dates over resources
    */
    class DayResourceTableModel extends AbstractResourceDayTableModel {
        computeCol(dateI, resourceI) {
            return dateI * this.resources.length + resourceI;
        }
        /*
        every single day is broken up
        */
        computeColRanges(dateStartI, dateEndI, resourceI) {
            let segs = [];
            for (let i = dateStartI; i <= dateEndI; i += 1) {
                let col = this.computeCol(i, resourceI);
                segs.push({
                    firstCol: col,
                    lastCol: col,
                    isStart: i === dateStartI,
                    isEnd: i === dateEndI,
                });
            }
            return segs;
        }
    }

    const NO_SEGS = []; // for memoizing
    class VResourceJoiner {
        constructor() {
            this.joinDateSelection = memoize(this.joinSegs);
            this.joinBusinessHours = memoize(this.joinSegs);
            this.joinFgEvents = memoize(this.joinSegs);
            this.joinBgEvents = memoize(this.joinSegs);
            this.joinEventDrags = memoize(this.joinInteractions);
            this.joinEventResizes = memoize(this.joinInteractions);
        }
        /*
        propSets also has a '' key for things with no resource
        */
        joinProps(propSets, resourceDayTable) {
            let dateSelectionSets = [];
            let businessHoursSets = [];
            let fgEventSets = [];
            let bgEventSets = [];
            let eventDrags = [];
            let eventResizes = [];
            let eventSelection = '';
            let keys = resourceDayTable.resourceIndex.ids.concat(['']); // add in the all-resource key
            for (let key of keys) {
                let props = propSets[key];
                dateSelectionSets.push(props.dateSelectionSegs);
                businessHoursSets.push(key ? props.businessHourSegs : NO_SEGS); // don't include redundant all-resource businesshours
                fgEventSets.push(key ? props.fgEventSegs : NO_SEGS); // don't include fg all-resource segs
                bgEventSets.push(props.bgEventSegs);
                eventDrags.push(props.eventDrag);
                eventResizes.push(props.eventResize);
                eventSelection = eventSelection || props.eventSelection;
            }
            return {
                dateSelectionSegs: this.joinDateSelection(resourceDayTable, ...dateSelectionSets),
                businessHourSegs: this.joinBusinessHours(resourceDayTable, ...businessHoursSets),
                fgEventSegs: this.joinFgEvents(resourceDayTable, ...fgEventSets),
                bgEventSegs: this.joinBgEvents(resourceDayTable, ...bgEventSets),
                eventDrag: this.joinEventDrags(resourceDayTable, ...eventDrags),
                eventResize: this.joinEventResizes(resourceDayTable, ...eventResizes),
                eventSelection,
            };
        }
        joinSegs(resourceDayTable, ...segGroups) {
            let resourceCnt = resourceDayTable.resources.length;
            let transformedSegs = [];
            for (let i = 0; i < resourceCnt; i += 1) {
                for (let seg of segGroups[i]) {
                    transformedSegs.push(...this.transformSeg(seg, resourceDayTable, i));
                }
                for (let seg of segGroups[resourceCnt]) { // one beyond. the all-resource
                    transformedSegs.push(...this.transformSeg(seg, resourceDayTable, i));
                }
            }
            return transformedSegs;
        }
        /*
        for expanding non-resource segs to all resources.
        only for public use.
        no memoizing.
        */
        expandSegs(resourceDayTable, segs) {
            let resourceCnt = resourceDayTable.resources.length;
            let transformedSegs = [];
            for (let i = 0; i < resourceCnt; i += 1) {
                for (let seg of segs) {
                    transformedSegs.push(...this.transformSeg(seg, resourceDayTable, i));
                }
            }
            return transformedSegs;
        }
        joinInteractions(resourceDayTable, ...interactions) {
            let resourceCnt = resourceDayTable.resources.length;
            let affectedInstances = {};
            let transformedSegs = [];
            let anyInteractions = false;
            let isEvent = false;
            for (let i = 0; i < resourceCnt; i += 1) {
                let interaction = interactions[i];
                if (interaction) {
                    anyInteractions = true;
                    for (let seg of interaction.segs) {
                        transformedSegs.push(...this.transformSeg(seg, resourceDayTable, i));
                    }
                    Object.assign(affectedInstances, interaction.affectedInstances);
                    isEvent = isEvent || interaction.isEvent;
                }
                if (interactions[resourceCnt]) { // one beyond. the all-resource
                    for (let seg of interactions[resourceCnt].segs) {
                        transformedSegs.push(...this.transformSeg(seg, resourceDayTable, i));
                    }
                }
            }
            if (anyInteractions) {
                return {
                    affectedInstances,
                    segs: transformedSegs,
                    isEvent,
                };
            }
            return null;
        }
    }

    /*
    TODO: just use ResourceHash somehow? could then use the generic ResourceSplitter
    */
    class VResourceSplitter extends Splitter {
        getKeyInfo(props) {
            let { resourceDayTableModel } = props;
            let hash = mapHash(resourceDayTableModel.resourceIndex.indicesById, (i) => resourceDayTableModel.resources[i]); // :(
            hash[''] = {};
            return hash;
        }
        getKeysForDateSpan(dateSpan) {
            return [dateSpan.resourceId || ''];
        }
        getKeysForEventDef(eventDef) {
            let resourceIds = eventDef.resourceIds;
            if (!resourceIds.length) {
                return [''];
            }
            return resourceIds;
        }
    }

    /*
    doesn't accept grouping
    */
    function flattenResources(resourceStore, orderSpecs) {
        return buildRowNodes(resourceStore, [], orderSpecs, false, {}, true)
            .map((node) => node.resource);
    }
    function buildRowNodes(resourceStore, groupSpecs, orderSpecs, isVGrouping, expansions, expansionDefault) {
        let complexNodes = buildHierarchy(resourceStore, isVGrouping ? -1 : 1, groupSpecs, orderSpecs);
        let flatNodes = [];
        flattenNodes(complexNodes, flatNodes, isVGrouping, [], 0, expansions, expansionDefault);
        return flatNodes;
    }
    function flattenNodes(complexNodes, res, isVGrouping, rowSpans, depth, expansions, expansionDefault) {
        for (let i = 0; i < complexNodes.length; i += 1) {
            let complexNode = complexNodes[i];
            let group = complexNode.group;
            if (group) {
                if (isVGrouping) {
                    let firstRowIndex = res.length;
                    let rowSpanIndex = rowSpans.length;
                    flattenNodes(complexNode.children, res, isVGrouping, rowSpans.concat(0), depth, expansions, expansionDefault);
                    if (firstRowIndex < res.length) {
                        let firstRow = res[firstRowIndex];
                        let firstRowSpans = firstRow.rowSpans = firstRow.rowSpans.slice();
                        firstRowSpans[rowSpanIndex] = res.length - firstRowIndex;
                    }
                }
                else {
                    let id = group.spec.field + ':' + group.value;
                    let isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
                    res.push({ id, group, isExpanded });
                    if (isExpanded) {
                        flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
                    }
                }
            }
            else if (complexNode.resource) {
                let id = complexNode.resource.id;
                let isExpanded = expansions[id] != null ? expansions[id] : expansionDefault;
                res.push({
                    id,
                    rowSpans,
                    depth,
                    isExpanded,
                    hasChildren: Boolean(complexNode.children.length),
                    resource: complexNode.resource,
                    resourceFields: complexNode.resourceFields,
                });
                if (isExpanded) {
                    flattenNodes(complexNode.children, res, isVGrouping, rowSpans, depth + 1, expansions, expansionDefault);
                }
            }
        }
    }
    function buildHierarchy(resourceStore, maxDepth, groupSpecs, orderSpecs) {
        let resourceNodes = buildResourceNodes(resourceStore, orderSpecs);
        let builtNodes = [];
        for (let resourceId in resourceNodes) {
            let resourceNode = resourceNodes[resourceId];
            if (!resourceNode.resource.parentId) {
                insertResourceNode(resourceNode, builtNodes, groupSpecs, 0, maxDepth, orderSpecs);
            }
        }
        return builtNodes;
    }
    function buildResourceNodes(resourceStore, orderSpecs) {
        let nodeHash = {};
        for (let resourceId in resourceStore) {
            let resource = resourceStore[resourceId];
            nodeHash[resourceId] = {
                resource,
                resourceFields: buildResourceFields(resource),
                children: [],
            };
        }
        for (let resourceId in resourceStore) {
            let resource = resourceStore[resourceId];
            if (resource.parentId) {
                let parentNode = nodeHash[resource.parentId];
                if (parentNode) {
                    insertResourceNodeInSiblings(nodeHash[resourceId], parentNode.children, orderSpecs);
                }
            }
        }
        return nodeHash;
    }
    function insertResourceNode(resourceNode, nodes, groupSpecs, depth, maxDepth, orderSpecs) {
        if (groupSpecs.length && (maxDepth === -1 || depth <= maxDepth)) {
            let groupNode = ensureGroupNodes(resourceNode, nodes, groupSpecs[0]);
            insertResourceNode(resourceNode, groupNode.children, groupSpecs.slice(1), depth + 1, maxDepth, orderSpecs);
        }
        else {
            insertResourceNodeInSiblings(resourceNode, nodes, orderSpecs);
        }
    }
    function ensureGroupNodes(resourceNode, nodes, groupSpec) {
        let groupValue = resourceNode.resourceFields[groupSpec.field];
        let groupNode;
        let newGroupIndex;
        // find an existing group that matches, or determine the position for a new group
        if (groupSpec.order) {
            for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
                let node = nodes[newGroupIndex];
                if (node.group) {
                    let cmp = flexibleCompare(groupValue, node.group.value) * groupSpec.order;
                    if (cmp === 0) {
                        groupNode = node;
                        break;
                    }
                    else if (cmp < 0) {
                        break;
                    }
                }
            }
        }
        else { // the groups are unordered
            for (newGroupIndex = 0; newGroupIndex < nodes.length; newGroupIndex += 1) {
                let node = nodes[newGroupIndex];
                if (node.group && groupValue === node.group.value) {
                    groupNode = node;
                    break;
                }
            }
        }
        if (!groupNode) {
            groupNode = {
                group: {
                    value: groupValue,
                    spec: groupSpec,
                },
                children: [],
            };
            nodes.splice(newGroupIndex, 0, groupNode);
        }
        return groupNode;
    }
    function insertResourceNodeInSiblings(resourceNode, siblings, orderSpecs) {
        let i;
        for (i = 0; i < siblings.length; i += 1) {
            let cmp = compareByFieldSpecs(siblings[i].resourceFields, resourceNode.resourceFields, orderSpecs); // TODO: pass in ResourceApi?
            if (cmp > 0) { // went 1 past. insert at i
                break;
            }
        }
        siblings.splice(i, 0, resourceNode);
    }
    function buildResourceFields(resource) {
        let obj = Object.assign(Object.assign(Object.assign({}, resource.extendedProps), resource.ui), resource);
        delete obj.ui;
        delete obj.extendedProps;
        return obj;
    }
    function isGroupsEqual(group0, group1) {
        return group0.spec === group1.spec && group0.value === group1.value;
    }

    function massageEventDragMutation(eventMutation, hit0, hit1) {
        let resource0 = hit0.dateSpan.resourceId;
        let resource1 = hit1.dateSpan.resourceId;
        if (resource0 && resource1 &&
            resource0 !== resource1) {
            eventMutation.resourceMutation = {
                matchResourceId: resource0,
                setResourceId: resource1,
            };
        }
    }
    /*
    TODO: all this would be much easier if we were using a hash!
    */
    function applyEventDefMutation(eventDef, mutation, context) {
        let resourceMutation = mutation.resourceMutation;
        if (resourceMutation && computeResourceEditable(eventDef, context)) {
            let index = eventDef.resourceIds.indexOf(resourceMutation.matchResourceId);
            if (index !== -1) {
                let resourceIds = eventDef.resourceIds.slice(); // copy
                resourceIds.splice(index, 1); // remove
                if (resourceIds.indexOf(resourceMutation.setResourceId) === -1) { // not already in there
                    resourceIds.push(resourceMutation.setResourceId); // add
                }
                eventDef.resourceIds = resourceIds;
            }
        }
    }
    /*
    HACK
    TODO: use EventUi system instead of this
    */
    function computeResourceEditable(eventDef, context) {
        let { resourceEditable } = eventDef;
        if (resourceEditable == null) {
            let source = eventDef.sourceId && context.getCurrentData().eventSources[eventDef.sourceId];
            if (source) {
                resourceEditable = source.extendedProps.resourceEditable; // used the Source::extendedProps hack
            }
            if (resourceEditable == null) {
                resourceEditable = context.options.eventResourceEditable;
                if (resourceEditable == null) {
                    resourceEditable = context.options.editable; // TODO: use defaults system instead
                }
            }
        }
        return resourceEditable;
    }
    function transformEventDrop(mutation, context) {
        let { resourceMutation } = mutation;
        if (resourceMutation) {
            let { calendarApi } = context;
            return {
                oldResource: calendarApi.getResourceById(resourceMutation.matchResourceId),
                newResource: calendarApi.getResourceById(resourceMutation.setResourceId),
            };
        }
        return {
            oldResource: null,
            newResource: null,
        };
    }

    class ResourceDataAdder {
        constructor() {
            this.filterResources = memoize(filterResources);
        }
        transform(viewProps, calendarProps) {
            if (calendarProps.viewSpec.optionDefaults.needsResourceData) {
                return {
                    resourceStore: this.filterResources(calendarProps.resourceStore, calendarProps.options.filterResourcesWithEvents, calendarProps.eventStore, calendarProps.dateProfile.activeRange),
                    resourceEntityExpansions: calendarProps.resourceEntityExpansions,
                };
            }
            return null;
        }
    }
    function filterResources(resourceStore, doFilterResourcesWithEvents, eventStore, activeRange) {
        if (doFilterResourcesWithEvents) {
            let instancesInRange = filterEventInstancesInRange(eventStore.instances, activeRange);
            let hasEvents = computeHasEvents(instancesInRange, eventStore.defs);
            Object.assign(hasEvents, computeAncestorHasEvents(hasEvents, resourceStore));
            return filterHash(resourceStore, (resource, resourceId) => hasEvents[resourceId]);
        }
        return resourceStore;
    }
    function filterEventInstancesInRange(eventInstances, activeRange) {
        return filterHash(eventInstances, (eventInstance) => rangesIntersect(eventInstance.range, activeRange));
    }
    function computeHasEvents(eventInstances, eventDefs) {
        let hasEvents = {};
        for (let instanceId in eventInstances) {
            let instance = eventInstances[instanceId];
            for (let resourceId of eventDefs[instance.defId].resourceIds) {
                hasEvents[resourceId] = true;
            }
        }
        return hasEvents;
    }
    /*
    mark resources as having events if any of their ancestors have them
    NOTE: resourceStore might not have all the resources that hasEvents{} has keyed
    */
    function computeAncestorHasEvents(hasEvents, resourceStore) {
        let res = {};
        for (let resourceId in hasEvents) {
            let resource;
            while ((resource = resourceStore[resourceId])) {
                resourceId = resource.parentId; // now functioning as the parentId
                if (resourceId) {
                    res[resourceId] = true;
                }
                else {
                    break;
                }
            }
        }
        return res;
    }
    /*
    for making sure events that have editable resources are always draggable in resource views
    */
    function transformIsDraggable(val, eventDef, eventUi, context) {
        if (!val) {
            let state = context.getCurrentData();
            let viewSpec = state.viewSpecs[state.currentViewType];
            if (viewSpec.optionDefaults.needsResourceData) {
                if (computeResourceEditable(eventDef, context)) {
                    return true;
                }
            }
        }
        return val;
    }

    // for when non-resource view should be given EventUi info (for event coloring/constraints based off of resource data)
    class ResourceEventConfigAdder {
        constructor() {
            this.buildResourceEventUis = memoize(buildResourceEventUis, isPropsEqual);
            this.injectResourceEventUis = memoize(injectResourceEventUis);
        }
        transform(viewProps, calendarProps) {
            if (!calendarProps.viewSpec.optionDefaults.needsResourceData) {
                return {
                    eventUiBases: this.injectResourceEventUis(viewProps.eventUiBases, viewProps.eventStore.defs, this.buildResourceEventUis(calendarProps.resourceStore)),
                };
            }
            return null;
        }
    }
    function buildResourceEventUis(resourceStore) {
        return mapHash(resourceStore, (resource) => resource.ui);
    }
    function injectResourceEventUis(eventUiBases, eventDefs, resourceEventUis) {
        return mapHash(eventUiBases, (eventUi, defId) => {
            if (defId) { // not the '' key
                return injectResourceEventUi(eventUi, eventDefs[defId], resourceEventUis);
            }
            return eventUi;
        });
    }
    function injectResourceEventUi(origEventUi, eventDef, resourceEventUis) {
        let parts = [];
        // first resource takes precedence, which fights with the ordering of combineEventUis, thus the unshifts
        for (let resourceId of eventDef.resourceIds) {
            if (resourceEventUis[resourceId]) {
                parts.unshift(resourceEventUis[resourceId]);
            }
        }
        parts.unshift(origEventUi);
        return combineEventUis(parts);
    }

    let defs = []; // TODO: use plugin system
    function registerResourceSourceDef(def) {
        defs.push(def);
    }
    function getResourceSourceDef(id) {
        return defs[id];
    }
    function getResourceSourceDefs() {
        return defs;
    }

    // TODO: make this a plugin-able parser
    // TODO: success/failure
    const RESOURCE_SOURCE_REFINERS = {
        id: String,
        // for array. TODO: move to resource-array
        resources: identity,
        // for json feed. TODO: move to resource-json-feed
        url: String,
        method: String,
        startParam: String,
        endParam: String,
        timeZoneParam: String,
        extraParams: identity,
    };
    function parseResourceSource(input) {
        let inputObj;
        if (typeof input === 'string') {
            inputObj = { url: input };
        }
        else if (typeof input === 'function' || Array.isArray(input)) {
            inputObj = { resources: input };
        }
        else if (typeof input === 'object' && input) { // non-null object
            inputObj = input;
        }
        if (inputObj) {
            let { refined, extra } = refineProps(inputObj, RESOURCE_SOURCE_REFINERS);
            warnUnknownProps(extra);
            let metaRes = buildResourceSourceMeta(refined);
            if (metaRes) {
                return {
                    _raw: input,
                    sourceId: guid(),
                    sourceDefId: metaRes.sourceDefId,
                    meta: metaRes.meta,
                    publicId: refined.id || '',
                    isFetching: false,
                    latestFetchId: '',
                    fetchRange: null,
                };
            }
        }
        return null;
    }
    function buildResourceSourceMeta(refined) {
        let defs = getResourceSourceDefs();
        for (let i = defs.length - 1; i >= 0; i -= 1) { // later-added plugins take precedence
            let def = defs[i];
            let meta = def.parseMeta(refined);
            if (meta) {
                return { meta, sourceDefId: i };
            }
        }
        return null;
    }
    function warnUnknownProps(props) {
        for (let propName in props) {
            console.warn(`Unknown resource prop '${propName}'`);
        }
    }

    function reduceResourceSource(source, action, context) {
        let { options, dateProfile } = context;
        if (!source || !action) {
            return createSource(options.initialResources || options.resources, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
        }
        switch (action.type) {
            case 'RESET_RESOURCE_SOURCE':
                return createSource(action.resourceSourceInput, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
            case 'PREV': // TODO: how do we track all actions that affect dateProfile :(
            case 'NEXT':
            case 'CHANGE_DATE':
            case 'CHANGE_VIEW_TYPE':
                return handleRangeChange(source, dateProfile.activeRange, options.refetchResourcesOnNavigate, context);
            case 'RECEIVE_RESOURCES':
            case 'RECEIVE_RESOURCE_ERROR':
                return receiveResponse(source, action.fetchId, action.fetchRange);
            case 'REFETCH_RESOURCES':
                return fetchSource(source, dateProfile.activeRange, context);
            default:
                return source;
        }
    }
    function createSource(input, activeRange, refetchResourcesOnNavigate, context) {
        if (input) {
            let source = parseResourceSource(input);
            source = fetchSource(source, refetchResourcesOnNavigate ? activeRange : null, context);
            return source;
        }
        return null;
    }
    function handleRangeChange(source, activeRange, refetchResourcesOnNavigate, context) {
        if (refetchResourcesOnNavigate &&
            !doesSourceIgnoreRange(source) &&
            (!source.fetchRange || !rangesEqual(source.fetchRange, activeRange))) {
            return fetchSource(source, activeRange, context);
        }
        return source;
    }
    function doesSourceIgnoreRange(source) {
        return Boolean(getResourceSourceDef(source.sourceDefId).ignoreRange);
    }
    function fetchSource(source, fetchRange, context) {
        let sourceDef = getResourceSourceDef(source.sourceDefId);
        let fetchId = guid();
        sourceDef.fetch({
            resourceSource: source,
            range: fetchRange,
            context,
        }, (res) => {
            context.dispatch({
                type: 'RECEIVE_RESOURCES',
                fetchId,
                fetchRange,
                rawResources: res.rawResources,
            });
        }, (error) => {
            context.dispatch({
                type: 'RECEIVE_RESOURCE_ERROR',
                fetchId,
                fetchRange,
                error,
            });
        });
        return Object.assign(Object.assign({}, source), { isFetching: true, latestFetchId: fetchId });
    }
    function receiveResponse(source, fetchId, fetchRange) {
        if (fetchId === source.latestFetchId) {
            return Object.assign(Object.assign({}, source), { isFetching: false, fetchRange });
        }
        return source;
    }

    function reduceResourceStore(store, action, source, context) {
        if (!store || !action) {
            return {};
        }
        switch (action.type) {
            case 'RECEIVE_RESOURCES':
                return receiveRawResources(store, action.rawResources, action.fetchId, source, context);
            case 'ADD_RESOURCE':
                return addResource(store, action.resourceHash);
            case 'REMOVE_RESOURCE':
                return removeResource(store, action.resourceId);
            case 'SET_RESOURCE_PROP':
                return setResourceProp(store, action.resourceId, action.propName, action.propValue);
            case 'SET_RESOURCE_EXTENDED_PROP':
                return setResourceExtendedProp(store, action.resourceId, action.propName, action.propValue);
            default:
                return store;
        }
    }
    function receiveRawResources(existingStore, inputs, fetchId, source, context) {
        if (source.latestFetchId === fetchId) {
            let nextStore = {};
            for (let input of inputs) {
                parseResource(input, '', nextStore, context);
            }
            return nextStore;
        }
        return existingStore;
    }
    function addResource(existingStore, additions) {
        // TODO: warn about duplicate IDs
        return Object.assign(Object.assign({}, existingStore), additions);
    }
    function removeResource(existingStore, resourceId) {
        let newStore = Object.assign({}, existingStore);
        delete newStore[resourceId];
        // promote children
        for (let childResourceId in newStore) { // a child, *maybe* but probably not
            if (newStore[childResourceId].parentId === resourceId) {
                newStore[childResourceId] = Object.assign(Object.assign({}, newStore[childResourceId]), { parentId: '' });
            }
        }
        return newStore;
    }
    function setResourceProp(existingStore, resourceId, name, value) {
        let existingResource = existingStore[resourceId];
        // TODO: sanitization
        if (existingResource) {
            return Object.assign(Object.assign({}, existingStore), { [resourceId]: Object.assign(Object.assign({}, existingResource), { [name]: value }) });
        }
        return existingStore;
    }
    function setResourceExtendedProp(existingStore, resourceId, name, value) {
        let existingResource = existingStore[resourceId];
        if (existingResource) {
            return Object.assign(Object.assign({}, existingStore), { [resourceId]: Object.assign(Object.assign({}, existingResource), { extendedProps: Object.assign(Object.assign({}, existingResource.extendedProps), { [name]: value }) }) });
        }
        return existingStore;
    }

    function reduceResourceEntityExpansions(expansions, action) {
        if (!expansions || !action) {
            return {};
        }
        switch (action.type) {
            case 'SET_RESOURCE_ENTITY_EXPANDED':
                return Object.assign(Object.assign({}, expansions), { [action.id]: action.isExpanded });
            default:
                return expansions;
        }
    }

    function reduceResources(state, action, context) {
        let resourceSource = reduceResourceSource(state && state.resourceSource, action, context);
        let resourceStore = reduceResourceStore(state && state.resourceStore, action, resourceSource, context);
        let resourceEntityExpansions = reduceResourceEntityExpansions(state && state.resourceEntityExpansions, action);
        return {
            resourceSource,
            resourceStore,
            resourceEntityExpansions,
        };
    }

    const EVENT_REFINERS = {
        resourceId: String,
        resourceIds: identity,
        resourceEditable: Boolean,
    };
    function generateEventDefResourceMembers(refined) {
        return {
            resourceIds: ensureStringArray(refined.resourceIds)
                .concat(refined.resourceId ? [refined.resourceId] : []),
            resourceEditable: refined.resourceEditable,
        };
    }
    function ensureStringArray(items) {
        return (items || []).map((item) => String(item));
    }

    function transformDateSelectionJoin(hit0, hit1) {
        let resourceId0 = hit0.dateSpan.resourceId;
        let resourceId1 = hit1.dateSpan.resourceId;
        if (resourceId0 && resourceId1) {
            return { resourceId: resourceId0 };
        }
        return null;
    }

    CalendarImpl.prototype.addResource = function (input, scrollTo = true) {
        let currentState = this.getCurrentData();
        let resourceHash;
        let resource;
        if (input instanceof ResourceApi) {
            resource = input._resource;
            resourceHash = { [resource.id]: resource };
        }
        else {
            resourceHash = {};
            resource = parseResource(input, '', resourceHash, currentState);
        }
        this.dispatch({
            type: 'ADD_RESOURCE',
            resourceHash,
        });
        if (scrollTo) {
            // TODO: wait til dispatch completes somehow
            this.trigger('_scrollRequest', { resourceId: resource.id });
        }
        let resourceApi = new ResourceApi(currentState, resource);
        currentState.emitter.trigger('resourceAdd', {
            resource: resourceApi,
            revert: () => {
                this.dispatch({
                    type: 'REMOVE_RESOURCE',
                    resourceId: resource.id,
                });
            },
        });
        return resourceApi;
    };
    CalendarImpl.prototype.getResourceById = function (id) {
        id = String(id);
        let currentState = this.getCurrentData(); // eslint-disable-line react/no-this-in-sfc
        if (currentState.resourceStore) { // guard against calendar with no resource functionality
            let rawResource = currentState.resourceStore[id];
            if (rawResource) {
                return new ResourceApi(currentState, rawResource);
            }
        }
        return null;
    };
    CalendarImpl.prototype.getResources = function () {
        let currentState = this.getCurrentData();
        let { resourceStore } = currentState;
        let resourceApis = [];
        if (resourceStore) { // guard against calendar with no resource functionality
            for (let resourceId in resourceStore) {
                resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
            }
        }
        return resourceApis;
    };
    CalendarImpl.prototype.getTopLevelResources = function () {
        let currentState = this.getCurrentData();
        let { resourceStore } = currentState;
        let resourceApis = [];
        if (resourceStore) { // guard against calendar with no resource functionality
            for (let resourceId in resourceStore) {
                if (!resourceStore[resourceId].parentId) {
                    resourceApis.push(new ResourceApi(currentState, resourceStore[resourceId]));
                }
            }
        }
        return resourceApis;
    };
    CalendarImpl.prototype.refetchResources = function () {
        this.dispatch({
            type: 'REFETCH_RESOURCES',
        });
    };
    function transformDatePoint(dateSpan, context) {
        return dateSpan.resourceId ?
            { resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
            {};
    }
    function transformDateSpan(dateSpan, context) {
        return dateSpan.resourceId ?
            { resource: context.calendarApi.getResourceById(dateSpan.resourceId) } :
            {};
    }

    function isPropsValidWithResources(combinedProps, context) {
        let splitter = new ResourceSplitter();
        let sets = splitter.splitProps(Object.assign(Object.assign({}, combinedProps), { resourceStore: context.getCurrentData().resourceStore }));
        for (let resourceId in sets) {
            let props = sets[resourceId];
            // merge in event data from the non-resource segment
            if (resourceId && sets['']) { // current segment is not the non-resource one, and there IS a non-resource one
                props = Object.assign(Object.assign({}, props), { eventStore: mergeEventStores(sets[''].eventStore, props.eventStore), eventUiBases: Object.assign(Object.assign({}, sets[''].eventUiBases), props.eventUiBases) });
            }
            if (!isPropsValid(props, context, { resourceId }, filterConfig.bind(null, resourceId))) {
                return false;
            }
        }
        return true;
    }
    function filterConfig(resourceId, config) {
        return Object.assign(Object.assign({}, config), { constraints: filterConstraints(resourceId, config.constraints) });
    }
    function filterConstraints(resourceId, constraints) {
        return constraints.map((constraint) => {
            let defs = constraint.defs;
            if (defs) { // we are dealing with an EventStore
                // if any of the events define constraints to resources that are NOT this resource,
                // then this resource is unconditionally prohibited, which is what a `false` value does.
                for (let defId in defs) {
                    let resourceIds = defs[defId].resourceIds;
                    if (resourceIds.length && resourceIds.indexOf(resourceId) === -1) { // TODO: use a hash?!!! (for other reasons too)
                        return false;
                    }
                }
            }
            return constraint;
        });
    }

    function transformExternalDef(dateSpan) {
        return dateSpan.resourceId ?
            { resourceId: dateSpan.resourceId } :
            {};
    }

    const optionChangeHandlers = {
        resources: handleResources,
    };
    function handleResources(newSourceInput, context) {
        let oldSourceInput = context.getCurrentData().resourceSource._raw;
        if (oldSourceInput !== newSourceInput) {
            context.dispatch({
                type: 'RESET_RESOURCE_SOURCE',
                resourceSourceInput: newSourceInput,
            });
        }
    }

    const OPTION_REFINERS = {
        initialResources: identity,
        resources: identity,
        eventResourceEditable: Boolean,
        refetchResourcesOnNavigate: Boolean,
        resourceOrder: parseFieldSpecs,
        filterResourcesWithEvents: Boolean,
        resourceGroupField: String,
        resourceAreaWidth: identity,
        resourceAreaColumns: identity,
        resourcesInitiallyExpanded: Boolean,
        datesAboveResources: Boolean,
        needsResourceData: Boolean,
        resourceAreaHeaderClassNames: identity,
        resourceAreaHeaderContent: identity,
        resourceAreaHeaderDidMount: identity,
        resourceAreaHeaderWillUnmount: identity,
        resourceGroupLabelClassNames: identity,
        resourceGroupLabelContent: identity,
        resourceGroupLabelDidMount: identity,
        resourceGroupLabelWillUnmount: identity,
        resourceLabelClassNames: identity,
        resourceLabelContent: identity,
        resourceLabelDidMount: identity,
        resourceLabelWillUnmount: identity,
        resourceLaneClassNames: identity,
        resourceLaneContent: identity,
        resourceLaneDidMount: identity,
        resourceLaneWillUnmount: identity,
        resourceGroupLaneClassNames: identity,
        resourceGroupLaneContent: identity,
        resourceGroupLaneDidMount: identity,
        resourceGroupLaneWillUnmount: identity,
    };
    const LISTENER_REFINERS = {
        resourcesSet: identity,
        resourceAdd: identity,
        resourceChange: identity,
        resourceRemove: identity,
    };

    EventImpl.prototype.getResources = function () {
        let { calendarApi } = this._context;
        return this._def.resourceIds.map((resourceId) => calendarApi.getResourceById(resourceId));
    };
    EventImpl.prototype.setResources = function (resources) {
        let resourceIds = [];
        // massage resources -> resourceIds
        for (let resource of resources) {
            let resourceId = null;
            if (typeof resource === 'string') {
                resourceId = resource;
            }
            else if (typeof resource === 'number') {
                resourceId = String(resource);
            }
            else if (resource instanceof ResourceApi) {
                resourceId = resource.id; // guaranteed to always have an ID. hmmm
            }
            else {
                console.warn('unknown resource type: ' + resource);
            }
            if (resourceId) {
                resourceIds.push(resourceId);
            }
        }
        this.mutate({
            standardProps: {
                resourceIds,
            },
        });
    };

    registerResourceSourceDef({
        ignoreRange: true,
        parseMeta(refined) {
            if (Array.isArray(refined.resources)) {
                return refined.resources;
            }
            return null;
        },
        fetch(arg, successCallback) {
            successCallback({
                rawResources: arg.resourceSource.meta,
            });
        },
    });

    registerResourceSourceDef({
        parseMeta(refined) {
            if (typeof refined.resources === 'function') {
                return refined.resources;
            }
            return null;
        },
        fetch(arg, successCallback, errorCallback) {
            const dateEnv = arg.context.dateEnv;
            const func = arg.resourceSource.meta;
            const publicArg = arg.range ? {
                start: dateEnv.toDate(arg.range.start),
                end: dateEnv.toDate(arg.range.end),
                startStr: dateEnv.formatIso(arg.range.start),
                endStr: dateEnv.formatIso(arg.range.end),
                timeZone: dateEnv.timeZone,
            } : {};
            unpromisify(func.bind(null, publicArg), (rawResources) => successCallback({ rawResources }), errorCallback);
        },
    });

    registerResourceSourceDef({
        parseMeta(refined) {
            if (refined.url) {
                return {
                    url: refined.url,
                    method: (refined.method || 'GET').toUpperCase(),
                    extraParams: refined.extraParams,
                };
            }
            return null;
        },
        fetch(arg, successCallback, errorCallback) {
            const meta = arg.resourceSource.meta;
            const requestParams = buildRequestParams(meta, arg.range, arg.context);
            requestJson(meta.method, meta.url, requestParams).then(([rawResources, response]) => {
                successCallback({ rawResources, response });
            }, errorCallback);
        },
    });
    // TODO: somehow consolidate with event json feed
    function buildRequestParams(meta, range, context) {
        let { dateEnv, options } = context;
        let startParam;
        let endParam;
        let timeZoneParam;
        let customRequestParams;
        let params = {};
        if (range) {
            startParam = meta.startParam;
            if (startParam == null) {
                startParam = options.startParam;
            }
            endParam = meta.endParam;
            if (endParam == null) {
                endParam = options.endParam;
            }
            timeZoneParam = meta.timeZoneParam;
            if (timeZoneParam == null) {
                timeZoneParam = options.timeZoneParam;
            }
            params[startParam] = dateEnv.formatIso(range.start);
            params[endParam] = dateEnv.formatIso(range.end);
            if (dateEnv.timeZone !== 'local') {
                params[timeZoneParam] = dateEnv.timeZone;
            }
        }
        // retrieve any outbound GET/POST data from the options
        if (typeof meta.extraParams === 'function') {
            // supplied as a function that returns a key/value object
            customRequestParams = meta.extraParams();
        }
        else {
            // probably supplied as a straight key/value object
            customRequestParams = meta.extraParams || {};
        }
        Object.assign(params, customRequestParams);
        return params;
    }

    var index$3 = createPlugin({
        name: '@fullcalendar/resource',
        premiumReleaseDate: '2022-12-27',
        deps: [index$7],
        reducers: [reduceResources],
        isLoadingFuncs: [
            (state) => state.resourceSource && state.resourceSource.isFetching,
        ],
        eventRefiners: EVENT_REFINERS,
        eventDefMemberAdders: [generateEventDefResourceMembers],
        isDraggableTransformers: [transformIsDraggable],
        eventDragMutationMassagers: [massageEventDragMutation],
        eventDefMutationAppliers: [applyEventDefMutation],
        dateSelectionTransformers: [transformDateSelectionJoin],
        datePointTransforms: [transformDatePoint],
        dateSpanTransforms: [transformDateSpan],
        viewPropsTransformers: [ResourceDataAdder, ResourceEventConfigAdder],
        isPropsValid: isPropsValidWithResources,
        externalDefTransforms: [transformExternalDef],
        eventDropTransformers: [transformEventDrop],
        optionChangeHandlers,
        optionRefiners: OPTION_REFINERS,
        listenerRefiners: LISTENER_REFINERS,
        propSetHandlers: { resourceStore: handleResourceStore },
    });

    class ResourceDayTableJoiner extends VResourceJoiner {
        transformSeg(seg, resourceDayTableModel, resourceI) {
            let colRanges = resourceDayTableModel.computeColRanges(seg.firstCol, seg.lastCol, resourceI);
            return colRanges.map((colRange) => (Object.assign(Object.assign(Object.assign({}, seg), colRange), { isStart: seg.isStart && colRange.isStart, isEnd: seg.isEnd && colRange.isEnd })));
        }
    }

    class ResourceDayTable extends DateComponent {
        constructor() {
            super(...arguments);
            this.splitter = new VResourceSplitter();
            this.slicers = {};
            this.joiner = new ResourceDayTableJoiner();
            this.tableRef = y();
            this.isHitComboAllowed = (hit0, hit1) => {
                let allowAcrossResources = this.props.resourceDayTableModel.dayTableModel.colCnt === 1;
                return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
            };
        }
        render() {
            let { props, context } = this;
            let { resourceDayTableModel, nextDayThreshold, dateProfile } = props;
            let splitProps = this.splitter.splitProps(props);
            this.slicers = mapHash(splitProps, (split, resourceId) => this.slicers[resourceId] || new DayTableSlicer());
            let slicedProps = mapHash(this.slicers, (slicer, resourceId) => slicer.sliceProps(splitProps[resourceId], dateProfile, nextDayThreshold, context, resourceDayTableModel.dayTableModel));
            return (h(Table, Object.assign({ forPrint: props.forPrint, ref: this.tableRef }, this.joiner.joinProps(slicedProps, resourceDayTableModel), { cells: resourceDayTableModel.cells, dateProfile: dateProfile, colGroupNode: props.colGroupNode, tableMinWidth: props.tableMinWidth, renderRowIntro: props.renderRowIntro, dayMaxEvents: props.dayMaxEvents, dayMaxEventRows: props.dayMaxEventRows, showWeekNumbers: props.showWeekNumbers, expandRows: props.expandRows, headerAlignElRef: props.headerAlignElRef, clientWidth: props.clientWidth, clientHeight: props.clientHeight, isHitComboAllowed: this.isHitComboAllowed })));
        }
    }

    class ResourceDayTableView extends TableView {
        constructor() {
            super(...arguments);
            this.flattenResources = memoize(flattenResources);
            this.buildResourceDayTableModel = memoize(buildResourceDayTableModel);
            this.headerRef = y();
            this.tableRef = y();
        }
        render() {
            let { props, context } = this;
            let { options } = context;
            let resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
            let resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
            let resourceDayTableModel = this.buildResourceDayTableModel(props.dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
            let headerContent = options.dayHeaders && (h(ResourceDayHeader, { ref: this.headerRef, resources: resources, dateProfile: props.dateProfile, dates: resourceDayTableModel.dayTableModel.headerDates, datesRepDistinctDays: true }));
            let bodyContent = (contentArg) => (h(ResourceDayTable, { ref: this.tableRef, dateProfile: props.dateProfile, resourceDayTableModel: resourceDayTableModel, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, dayMaxEvents: options.dayMaxEvents, dayMaxEventRows: options.dayMaxEventRows, showWeekNumbers: options.weekNumbers, expandRows: !props.isHeightAuto, headerAlignElRef: this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }));
            return options.dayMinWidth
                ? this.renderHScrollLayout(headerContent, bodyContent, resourceDayTableModel.colCnt, options.dayMinWidth)
                : this.renderSimpleLayout(headerContent, bodyContent);
        }
    }
    function buildResourceDayTableModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
        let dayTable = buildDayTableModel(dateProfile, dateProfileGenerator);
        return datesAboveResources ?
            new DayResourceTableModel(dayTable, resources, context) :
            new ResourceDayTableModel(dayTable, resources, context);
    }

    var index$2 = createPlugin({
        name: '@fullcalendar/resource-daygrid',
        premiumReleaseDate: '2022-12-27',
        deps: [
            index$7,
            index$3,
            index$a,
        ],
        initialView: 'resourceDayGridDay',
        views: {
            resourceDayGrid: {
                type: 'dayGrid',
                component: ResourceDayTableView,
                needsResourceData: true,
            },
            resourceDayGridDay: {
                type: 'resourceDayGrid',
                duration: { days: 1 },
            },
            resourceDayGridWeek: {
                type: 'resourceDayGrid',
                duration: { weeks: 1 },
            },
            resourceDayGridMonth: {
                type: 'resourceDayGrid',
                duration: { months: 1 },
                // TODO: wish we didn't have to C&P from dayGrid's file
                monthMode: true,
                fixedWeekCount: true,
            },
        },
    });

    class ResourceDayTimeColsJoiner extends VResourceJoiner {
        transformSeg(seg, resourceDayTable, resourceI) {
            return [
                Object.assign(Object.assign({}, seg), { col: resourceDayTable.computeCol(seg.col, resourceI) }),
            ];
        }
    }

    class ResourceDayTimeCols extends DateComponent {
        constructor() {
            super(...arguments);
            this.buildDayRanges = memoize(buildDayRanges);
            this.splitter = new VResourceSplitter();
            this.slicers = {};
            this.joiner = new ResourceDayTimeColsJoiner();
            this.timeColsRef = y();
            this.isHitComboAllowed = (hit0, hit1) => {
                let allowAcrossResources = this.dayRanges.length === 1;
                return allowAcrossResources || hit0.dateSpan.resourceId === hit1.dateSpan.resourceId;
            };
        }
        render() {
            let { props, context } = this;
            let { dateEnv, options } = context;
            let { dateProfile, resourceDayTableModel } = props;
            let dayRanges = this.dayRanges = this.buildDayRanges(resourceDayTableModel.dayTableModel, dateProfile, dateEnv);
            let splitProps = this.splitter.splitProps(props);
            this.slicers = mapHash(splitProps, (split, resourceId) => this.slicers[resourceId] || new DayTimeColsSlicer());
            let slicedProps = mapHash(this.slicers, (slicer, resourceId) => slicer.sliceProps(splitProps[resourceId], dateProfile, null, context, dayRanges));
            return ( // TODO: would move this further down hierarchy, but sliceNowDate needs it
            h(NowTimer, { unit: options.nowIndicator ? 'minute' : 'day' }, (nowDate, todayRange) => (h(TimeCols, Object.assign({ ref: this.timeColsRef }, this.joiner.joinProps(slicedProps, resourceDayTableModel), { dateProfile: dateProfile, axis: props.axis, slotDuration: props.slotDuration, slatMetas: props.slatMetas, cells: resourceDayTableModel.cells[0], tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, clientWidth: props.clientWidth, clientHeight: props.clientHeight, expandRows: props.expandRows, nowDate: nowDate, nowIndicatorSegs: options.nowIndicator && this.buildNowIndicatorSegs(nowDate), todayRange: todayRange, onScrollTopRequest: props.onScrollTopRequest, forPrint: props.forPrint, onSlatCoords: props.onSlatCoords, isHitComboAllowed: this.isHitComboAllowed })))));
        }
        buildNowIndicatorSegs(date) {
            let nonResourceSegs = this.slicers[''].sliceNowDate(date, this.context, this.dayRanges);
            return this.joiner.expandSegs(this.props.resourceDayTableModel, nonResourceSegs);
        }
    }

    class ResourceDayTimeColsView extends TimeColsView {
        constructor() {
            super(...arguments);
            this.flattenResources = memoize(flattenResources);
            this.buildResourceTimeColsModel = memoize(buildResourceTimeColsModel);
            this.buildSlatMetas = memoize(buildSlatMetas);
        }
        render() {
            let { props, context } = this;
            let { options, dateEnv } = context;
            let { dateProfile } = props;
            let splitProps = this.allDaySplitter.splitProps(props);
            let resourceOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
            let resources = this.flattenResources(props.resourceStore, resourceOrderSpecs);
            let resourceDayTableModel = this.buildResourceTimeColsModel(dateProfile, context.dateProfileGenerator, resources, options.datesAboveResources, context);
            let slatMetas = this.buildSlatMetas(dateProfile.slotMinTime, dateProfile.slotMaxTime, options.slotLabelInterval, options.slotDuration, dateEnv);
            let { dayMinWidth } = options;
            let hasAttachedAxis = !dayMinWidth;
            let hasDetachedAxis = dayMinWidth;
            let headerContent = options.dayHeaders && (h(ResourceDayHeader, { resources: resources, dates: resourceDayTableModel.dayTableModel.headerDates, dateProfile: dateProfile, datesRepDistinctDays: true, renderIntro: hasAttachedAxis ? this.renderHeadAxis : null }));
            let allDayContent = (options.allDaySlot !== false) && ((contentArg) => (h(ResourceDayTable, Object.assign({}, splitProps.allDay, { dateProfile: dateProfile, resourceDayTableModel: resourceDayTableModel, nextDayThreshold: options.nextDayThreshold, tableMinWidth: contentArg.tableMinWidth, colGroupNode: contentArg.tableColGroupNode, renderRowIntro: hasAttachedAxis ? this.renderTableRowAxis : null, showWeekNumbers: false, expandRows: false, headerAlignElRef: this.headerElRef, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, forPrint: props.forPrint }, this.getAllDayMaxEventProps()))));
            let timeGridContent = (contentArg) => (h(ResourceDayTimeCols, Object.assign({}, splitProps.timed, { dateProfile: dateProfile, axis: hasAttachedAxis, slotDuration: options.slotDuration, slatMetas: slatMetas, resourceDayTableModel: resourceDayTableModel, tableColGroupNode: contentArg.tableColGroupNode, tableMinWidth: contentArg.tableMinWidth, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, onSlatCoords: this.handleSlatCoords, expandRows: contentArg.expandRows, forPrint: props.forPrint, onScrollTopRequest: this.handleScrollTopRequest })));
            return hasDetachedAxis
                ? this.renderHScrollLayout(headerContent, allDayContent, timeGridContent, resourceDayTableModel.colCnt, dayMinWidth, slatMetas, this.state.slatCoords)
                : this.renderSimpleLayout(headerContent, allDayContent, timeGridContent);
        }
    }
    function buildResourceTimeColsModel(dateProfile, dateProfileGenerator, resources, datesAboveResources, context) {
        let dayTable = buildTimeColsModel(dateProfile, dateProfileGenerator);
        return datesAboveResources ?
            new DayResourceTableModel(dayTable, resources, context) :
            new ResourceDayTableModel(dayTable, resources, context);
    }

    var index$1 = createPlugin({
        name: '@fullcalendar/resource-timegrid',
        premiumReleaseDate: '2022-12-27',
        deps: [
            index$7,
            index$3,
            index$9,
        ],
        initialView: 'resourceTimeGridDay',
        views: {
            resourceTimeGrid: {
                type: 'timeGrid',
                component: ResourceDayTimeColsView,
                needsResourceData: true,
            },
            resourceTimeGridDay: {
                type: 'resourceTimeGrid',
                duration: { days: 1 },
            },
            resourceTimeGridWeek: {
                type: 'resourceTimeGrid',
                duration: { weeks: 1 },
            },
        },
    });

    /*
    Renders the DOM responsible for the subrow expander area,
    as well as the space before it (used to align expanders of similar depths)
    */
    function ExpanderIcon({ depth, hasChildren, isExpanded, onExpanderClick }) {
        let nodes = [];
        for (let i = 0; i < depth; i += 1) {
            nodes.push(h("span", { className: "fc-icon" }));
        }
        let iconClassNames = ['fc-icon'];
        if (hasChildren) {
            if (isExpanded) {
                iconClassNames.push('fc-icon-minus-square');
            }
            else {
                iconClassNames.push('fc-icon-plus-square');
            }
        }
        nodes.push(h("span", { className: 'fc-datagrid-expander' + (hasChildren ? '' : ' fc-datagrid-expander-placeholder'), onClick: onExpanderClick },
            h("span", { className: iconClassNames.join(' ') })));
        return h(p, {}, ...nodes);
    }

    // worth making a PureComponent? (because of innerHeight)
    class SpreadsheetIndividualCell extends BaseComponent {
        constructor() {
            super(...arguments);
            this.refineRenderProps = memoizeObjArg(refineRenderProps);
            this.onExpanderClick = (ev) => {
                let { props } = this;
                if (props.hasChildren) {
                    this.context.dispatch({
                        type: 'SET_RESOURCE_ENTITY_EXPANDED',
                        id: props.resource.id,
                        isExpanded: !props.isExpanded,
                    });
                }
            };
        }
        render() {
            let { props, context } = this;
            let { colSpec } = props;
            let renderProps = this.refineRenderProps({
                resource: props.resource,
                fieldValue: props.fieldValue,
                context,
            });
            return (h(ContentContainer, { elTag: "td", elClasses: [
                    'fc-datagrid-cell',
                    'fc-resource',
                ], elAttrs: {
                    role: 'gridcell',
                    'data-resource-id': props.resource.id,
                }, renderProps: renderProps, generatorName: colSpec.isMain ? 'resourceLabelContent' : undefined, generator: colSpec.cellContent || renderResourceInner, classNameGenerator: colSpec.cellClassNames, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, (InnerContent) => (h("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
                h("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
                    colSpec.isMain && (h(ExpanderIcon, { depth: props.depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, onExpanderClick: this.onExpanderClick })),
                    h(InnerContent, { elTag: "span", elClasses: ['fc-datagrid-cell-main'] }))))));
        }
    }
    function renderResourceInner(renderProps) {
        return renderProps.fieldValue || h(p, null, "\u00A0");
    }
    function refineRenderProps(input) {
        return {
            resource: new ResourceApi(input.context, input.resource),
            fieldValue: input.fieldValue,
            view: input.context.viewApi,
        };
    }

    // for VERTICAL cell grouping, in spreadsheet area
    class SpreadsheetGroupCell extends BaseComponent {
        render() {
            let { props, context } = this;
            let { colSpec } = props;
            let renderProps = {
                groupValue: props.fieldValue,
                view: context.viewApi,
            };
            // a grouped cell. no data that is specific to this specific resource
            // `colSpec` is for the group. a GroupSpec :(
            return (h(ContentContainer, { elTag: "td", elClasses: [
                    'fc-datagrid-cell',
                    'fc-resource-group',
                ], elAttrs: {
                    role: 'gridcell',
                    rowSpan: props.rowSpan,
                }, renderProps: renderProps, generatorName: "resourceGroupLabelContent", generator: colSpec.cellContent || renderGroupInner, classNameGenerator: colSpec.cellClassNames, didMount: colSpec.cellDidMount, willUnmount: colSpec.cellWillUnmount }, (InnerContent) => (h("div", { className: "fc-datagrid-cell-frame fc-datagrid-cell-frame-liquid" },
                h(InnerContent, { elTag: "div", elClasses: ['fc-datagrid-cell-cushion', 'fc-sticky'] })))));
        }
    }
    function renderGroupInner(renderProps) {
        return renderProps.groupValue || h(p, null, "\u00A0");
    }

    class SpreadsheetRow extends BaseComponent {
        render() {
            let { props } = this;
            let { resource, rowSpans, depth } = props;
            let resourceFields = buildResourceFields(resource); // slightly inefficient. already done up the call stack
            return (h("tr", { role: "row" }, props.colSpecs.map((colSpec, i) => {
                let rowSpan = rowSpans[i];
                if (rowSpan === 0) { // not responsible for group-based rows. VRowGroup is
                    return null;
                }
                if (rowSpan == null) {
                    rowSpan = 1;
                }
                let fieldValue = colSpec.field ? resourceFields[colSpec.field] :
                    (resource.title || getPublicId(resource.id));
                if (rowSpan > 1) {
                    return (h(SpreadsheetGroupCell, { key: i, colSpec: colSpec, fieldValue: fieldValue, rowSpan: rowSpan }));
                }
                return (h(SpreadsheetIndividualCell, { key: i, colSpec: colSpec, resource: resource, fieldValue: fieldValue, depth: depth, hasChildren: props.hasChildren, isExpanded: props.isExpanded, innerHeight: props.innerHeight }));
            })));
        }
    }
    SpreadsheetRow.addPropsEquality({
        rowSpans: isArraysEqual,
    });

    // for HORIZONTAL cell grouping, in spreadsheet area
    class SpreadsheetGroupRow extends BaseComponent {
        constructor() {
            super(...arguments);
            this.innerInnerRef = y();
            this.onExpanderClick = () => {
                let { props } = this;
                this.context.dispatch({
                    type: 'SET_RESOURCE_ENTITY_EXPANDED',
                    id: props.id,
                    isExpanded: !props.isExpanded,
                });
            };
        }
        render() {
            let { props, context } = this;
            let renderProps = { groupValue: props.group.value, view: context.viewApi };
            let spec = props.group.spec;
            return (h("tr", { role: "row" },
                h(ContentContainer, { elTag: "th", elClasses: [
                        'fc-datagrid-cell',
                        'fc-resource-group',
                        context.theme.getClass('tableCellShaded'),
                    ], elAttrs: {
                        // ARIA TODO: not really a columnheader
                        // extremely tedious to make this aria-compliant,
                        // to assign multiple headers to each cell
                        // https://www.w3.org/WAI/tutorials/tables/multi-level/
                        role: 'columnheader',
                        scope: 'colgroup',
                        colSpan: props.spreadsheetColCnt,
                    }, renderProps: renderProps, generatorName: "resourceGroupLabelContent", generator: spec.labelContent || renderCellInner, classNameGenerator: spec.labelClassNames, didMount: spec.labelDidMount, willUnmount: spec.labelWillUnmount }, (InnerContent) => (h("div", { className: "fc-datagrid-cell-frame", style: { height: props.innerHeight } },
                    h("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner", ref: this.innerInnerRef },
                        h(ExpanderIcon, { depth: 0, hasChildren: true, isExpanded: props.isExpanded, onExpanderClick: this.onExpanderClick }),
                        h(InnerContent, { elTag: "span", elClasses: ['fc-datagrid-cell-main'] })))))));
        }
    }
    SpreadsheetGroupRow.addPropsEquality({
        group: isGroupsEqual,
    });
    function renderCellInner(renderProps) {
        return renderProps.groupValue || h(p, null, "\u00A0");
    }

    const SPREADSHEET_COL_MIN_WIDTH = 20;
    class SpreadsheetHeader extends BaseComponent {
        constructor() {
            super(...arguments);
            this.resizerElRefs = new RefMap(this._handleColResizerEl.bind(this));
            this.colDraggings = {};
        }
        render() {
            let { colSpecs, superHeaderRendering, rowInnerHeights } = this.props;
            let renderProps = { view: this.context.viewApi };
            let rowNodes = [];
            rowInnerHeights = rowInnerHeights.slice(); // copy, because we're gonna pop
            if (superHeaderRendering) {
                let rowInnerHeight = rowInnerHeights.shift();
                rowNodes.push(h("tr", { key: "row-super", role: "row" },
                    h(ContentContainer, { elTag: "th", elClasses: [
                            'fc-datagrid-cell',
                            'fc-datagrid-cell-super',
                        ], elAttrs: {
                            role: 'columnheader',
                            scope: 'colgroup',
                            colSpan: colSpecs.length,
                        }, renderProps: renderProps, generatorName: "resourceAreaHeaderContent", generator: superHeaderRendering.headerContent, classNameGenerator: superHeaderRendering.headerClassNames, didMount: superHeaderRendering.headerDidMount, willUnmount: superHeaderRendering.headerWillUnmount }, (InnerContent) => (h("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight } },
                        h(InnerContent, { elTag: "div", elClasses: ['fc-datagrid-cell-cushion', 'fc-scrollgrid-sync-inner'] }))))));
            }
            let rowInnerHeight = rowInnerHeights.shift();
            rowNodes.push(h("tr", { key: "row", role: "row" }, colSpecs.map((colSpec, i) => {
                let isLastCol = i === (colSpecs.length - 1);
                // need empty inner div for abs positioning for resizer
                return (h(ContentContainer, { key: i, elTag: "th", elClasses: ['fc-datagrid-cell'], elAttrs: { role: 'columnheader' }, renderProps: renderProps, generatorName: "resourceAreaHeaderContent", generator: colSpec.headerContent, classNameGenerator: colSpec.headerClassNames, didMount: colSpec.headerDidMount, willUnmount: colSpec.headerWillUnmount }, (InnerContent) => (h("div", { className: "fc-datagrid-cell-frame", style: { height: rowInnerHeight } },
                    h("div", { className: "fc-datagrid-cell-cushion fc-scrollgrid-sync-inner" },
                        colSpec.isMain && (h("span", { className: "fc-datagrid-expander fc-datagrid-expander-placeholder" },
                            h("span", { className: "fc-icon" }))),
                        h(InnerContent, { elTag: "span", elClasses: ['fc-datagrid-cell-main'] })),
                    !isLastCol && (h("div", { className: "fc-datagrid-cell-resizer", ref: this.resizerElRefs.createRef(i) }))))));
            })));
            return (h(p, null, rowNodes));
        }
        _handleColResizerEl(resizerEl, index) {
            let { colDraggings } = this;
            if (!resizerEl) {
                let dragging = colDraggings[index];
                if (dragging) {
                    dragging.destroy();
                    delete colDraggings[index];
                }
            }
            else {
                let dragging = this.initColResizing(resizerEl, parseInt(index, 10));
                if (dragging) {
                    colDraggings[index] = dragging;
                }
            }
        }
        initColResizing(resizerEl, index) {
            let { pluginHooks, isRtl } = this.context;
            let { onColWidthChange } = this.props;
            let ElementDraggingImpl = pluginHooks.elementDraggingImpl;
            if (ElementDraggingImpl) {
                let dragging = new ElementDraggingImpl(resizerEl);
                let startWidth; // of just the single column
                let currentWidths; // of all columns
                dragging.emitter.on('dragstart', () => {
                    let allCells = findElements(elementClosest(resizerEl, 'tr'), 'th');
                    currentWidths = allCells.map((cellEl) => (cellEl.getBoundingClientRect().width));
                    startWidth = currentWidths[index];
                });
                dragging.emitter.on('dragmove', (pev) => {
                    currentWidths[index] = Math.max(startWidth + pev.deltaX * (isRtl ? -1 : 1), SPREADSHEET_COL_MIN_WIDTH);
                    if (onColWidthChange) {
                        onColWidthChange(currentWidths.slice()); // send a copy since currentWidths continues to be mutated
                    }
                });
                dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
                return dragging;
            }
            return null;
        }
    }

    class ResourceTimelineLane extends BaseComponent {
        constructor() {
            super(...arguments);
            this.refineRenderProps = memoizeObjArg(refineRenderProps$1);
            this.handleHeightChange = (innerEl, isStable) => {
                if (this.props.onHeightChange) {
                    this.props.onHeightChange(
                    // would want to use own <tr> ref, but not guaranteed to be ready when this fires
                    elementClosest(innerEl, 'tr'), isStable);
                }
            };
        }
        render() {
            let { props, context } = this;
            let { options } = context;
            let renderProps = this.refineRenderProps({ resource: props.resource, context });
            return (h("tr", { ref: props.elRef },
                h(ContentContainer, { elTag: "td", elClasses: [
                        'fc-timeline-lane',
                        'fc-resource',
                    ], elAttrs: {
                        'data-resource-id': props.resource.id,
                    }, renderProps: renderProps, generatorName: "resourceLaneContent", generator: options.resourceLaneContent, classNameGenerator: options.resourceLaneClassNames, didMount: options.resourceLaneDidMount, willUnmount: options.resourceLaneWillUnmount }, (InnerContent) => (h("div", { className: "fc-timeline-lane-frame", style: { height: props.innerHeight } },
                    h(InnerContent, { elTag: "div", elClasses: ['fc-timeline-lane-misc'] }),
                    h(TimelineLane, { dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: props.nextDayThreshold, businessHours: props.businessHours, eventStore: props.eventStore, eventUiBases: props.eventUiBases, dateSelection: props.dateSelection, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, timelineCoords: props.timelineCoords, onHeightChange: this.handleHeightChange, resourceId: props.resource.id })))))); // important NOT to do liquid-height. dont want to shrink height smaller than content
        }
    }

    /*
    parallels the SpreadsheetGroupRow
    */
    class DividerRow extends BaseComponent {
        render() {
            let { props, context } = this;
            let { renderHooks } = props;
            let renderProps = {
                groupValue: props.groupValue,
                view: context.viewApi,
            };
            return (h("tr", { ref: props.elRef },
                h(ContentContainer, { elTag: "td", elRef: props.elRef, elClasses: [
                        'fc-timeline-lane',
                        'fc-resource-group',
                        context.theme.getClass('tableCellShaded'),
                    ], renderProps: renderProps, generatorName: "resourceGroupLaneContent", generator: renderHooks.laneContent, classNameGenerator: renderHooks.laneClassNames, didMount: renderHooks.laneDidMount, willUnmount: renderHooks.laneWillUnmount }, (InnerContainer) => (h(InnerContainer, { elTag: "div", elStyle: { height: props.innerHeight } })))));
        }
    }

    class ResourceTimelineLanesBody extends BaseComponent {
        render() {
            let { props, context } = this;
            let { rowElRefs, innerHeights } = props;
            return (h("tbody", null, props.rowNodes.map((node, index) => {
                if (node.group) {
                    return (h(DividerRow, { key: node.id, elRef: rowElRefs.createRef(node.id), groupValue: node.group.value, renderHooks: node.group.spec, innerHeight: innerHeights[index] || '' }));
                }
                if (node.resource) {
                    let resource = node.resource;
                    return (h(ResourceTimelineLane, Object.assign({ key: node.id, elRef: rowElRefs.createRef(node.id) }, props.splitProps[resource.id], { resource: resource, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, nextDayThreshold: context.options.nextDayThreshold, businessHours: resource.businessHours || props.fallbackBusinessHours, innerHeight: innerHeights[index] || '', timelineCoords: props.slatCoords, onHeightChange: props.onRowHeightChange })));
                }
                return null;
            })));
        }
    }

    class ResourceTimelineLanes extends BaseComponent {
        constructor() {
            super(...arguments);
            this.rootElRef = y();
            this.rowElRefs = new RefMap();
        }
        render() {
            let { props, context } = this;
            return (h("table", { ref: this.rootElRef, "aria-hidden": true, className: 'fc-scrollgrid-sync-table ' + context.theme.getClass('table'), style: {
                    minWidth: props.tableMinWidth,
                    width: props.clientWidth,
                    height: props.minHeight,
                } },
                h(ResourceTimelineLanesBody, { rowElRefs: this.rowElRefs, rowNodes: props.rowNodes, dateProfile: props.dateProfile, tDateProfile: props.tDateProfile, nowDate: props.nowDate, todayRange: props.todayRange, splitProps: props.splitProps, fallbackBusinessHours: props.fallbackBusinessHours, slatCoords: props.slatCoords, innerHeights: props.innerHeights, onRowHeightChange: props.onRowHeightChange })));
        }
        componentDidMount() {
            this.updateCoords();
        }
        componentDidUpdate() {
            this.updateCoords();
        }
        componentWillUnmount() {
            if (this.props.onRowCoords) {
                this.props.onRowCoords(null);
            }
        }
        updateCoords() {
            let { props } = this;
            if (props.onRowCoords && props.clientWidth !== null) { // a populated clientWidth means sizing has stabilized
                this.props.onRowCoords(new PositionCache(this.rootElRef.current, collectRowEls(this.rowElRefs.currentMap, props.rowNodes), false, true));
            }
        }
    }
    function collectRowEls(elMap, rowNodes) {
        return rowNodes.map((rowNode) => elMap[rowNode.id]);
    }

    class ResourceTimelineGrid extends DateComponent {
        constructor() {
            super(...arguments);
            this.computeHasResourceBusinessHours = memoize(computeHasResourceBusinessHours);
            this.resourceSplitter = new ResourceSplitter(); // doesn't let it do businessHours tho
            this.bgSlicer = new TimelineLaneSlicer();
            this.slatsRef = y(); // needed for Hit creation :(
            this.state = {
                slatCoords: null,
            };
            this.handleEl = (el) => {
                if (el) {
                    this.context.registerInteractiveComponent(this, { el });
                }
                else {
                    this.context.unregisterInteractiveComponent(this);
                }
            };
            this.handleSlatCoords = (slatCoords) => {
                this.setState({ slatCoords });
                if (this.props.onSlatCoords) {
                    this.props.onSlatCoords(slatCoords);
                }
            };
            this.handleRowCoords = (rowCoords) => {
                this.rowCoords = rowCoords;
                if (this.props.onRowCoords) {
                    this.props.onRowCoords(rowCoords);
                }
            };
        }
        render() {
            let { props, state, context } = this;
            let { dateProfile, tDateProfile } = props;
            let timerUnit = greatestDurationDenominator(tDateProfile.slotDuration).unit;
            let hasResourceBusinessHours = this.computeHasResourceBusinessHours(props.rowNodes);
            let splitProps = this.resourceSplitter.splitProps(props);
            let bgLaneProps = splitProps[''];
            let bgSlicedProps = this.bgSlicer.sliceProps(bgLaneProps, dateProfile, tDateProfile.isTimeScale ? null : props.nextDayThreshold, context, // wish we didn't need to pass in the rest of these args...
            dateProfile, context.dateProfileGenerator, tDateProfile, context.dateEnv);
            // WORKAROUND: make ignore slatCoords when out of sync with dateProfile
            let slatCoords = state.slatCoords && state.slatCoords.dateProfile === props.dateProfile ? state.slatCoords : null;
            return (h("div", { ref: this.handleEl, className: [
                    'fc-timeline-body',
                    props.expandRows ? 'fc-timeline-body-expandrows' : '',
                ].join(' '), style: { minWidth: props.tableMinWidth } },
                h(NowTimer, { unit: timerUnit }, (nowDate, todayRange) => (h(p, null,
                    h(TimelineSlats, { ref: this.slatsRef, dateProfile: dateProfile, tDateProfile: tDateProfile, nowDate: nowDate, todayRange: todayRange, clientWidth: props.clientWidth, tableColGroupNode: props.tableColGroupNode, tableMinWidth: props.tableMinWidth, onCoords: this.handleSlatCoords, onScrollLeftRequest: props.onScrollLeftRequest }),
                    h(TimelineLaneBg, { businessHourSegs: hasResourceBusinessHours ? null : bgSlicedProps.businessHourSegs, bgEventSegs: bgSlicedProps.bgEventSegs, timelineCoords: slatCoords, 
                        // empty array will result in unnecessary rerenders?
                        eventResizeSegs: (bgSlicedProps.eventResize ? bgSlicedProps.eventResize.segs : []), dateSelectionSegs: bgSlicedProps.dateSelectionSegs, nowDate: nowDate, todayRange: todayRange }),
                    h(ResourceTimelineLanes, { rowNodes: props.rowNodes, dateProfile: dateProfile, tDateProfile: props.tDateProfile, nowDate: nowDate, todayRange: todayRange, splitProps: splitProps, fallbackBusinessHours: hasResourceBusinessHours ? props.businessHours : null, clientWidth: props.clientWidth, minHeight: props.expandRows ? props.clientHeight : '', tableMinWidth: props.tableMinWidth, innerHeights: props.rowInnerHeights, slatCoords: slatCoords, onRowCoords: this.handleRowCoords, onRowHeightChange: props.onRowHeightChange }),
                    (context.options.nowIndicator && slatCoords && slatCoords.isDateInRange(nowDate)) && (h("div", { className: "fc-timeline-now-indicator-container" },
                        h(NowIndicatorContainer, { elClasses: ['fc-timeline-now-indicator-line'], elStyle: coordToCss(slatCoords.dateToCoord(nowDate), context.isRtl), isAxis: false, date: nowDate }))))))));
        }
        // Hit System
        // ------------------------------------------------------------------------------------------
        queryHit(positionLeft, positionTop) {
            let rowCoords = this.rowCoords;
            let rowIndex = rowCoords.topToIndex(positionTop);
            if (rowIndex != null) {
                let resource = this.props.rowNodes[rowIndex].resource;
                if (resource) { // not a group
                    let slatHit = this.slatsRef.current.positionToHit(positionLeft);
                    if (slatHit) {
                        return {
                            dateProfile: this.props.dateProfile,
                            dateSpan: {
                                range: slatHit.dateSpan.range,
                                allDay: slatHit.dateSpan.allDay,
                                resourceId: resource.id,
                            },
                            rect: {
                                left: slatHit.left,
                                right: slatHit.right,
                                top: rowCoords.tops[rowIndex],
                                bottom: rowCoords.bottoms[rowIndex],
                            },
                            dayEl: slatHit.dayEl,
                            layer: 0,
                        };
                    }
                }
            }
            return null;
        }
    }
    function computeHasResourceBusinessHours(rowNodes) {
        for (let node of rowNodes) {
            let resource = node.resource;
            if (resource && resource.businessHours) {
                return true;
            }
        }
        return false;
    }

    const MIN_RESOURCE_AREA_WIDTH = 30; // definitely bigger than scrollbars
    // RENAME?
    class ResourceTimelineViewLayout extends BaseComponent {
        constructor() {
            super(...arguments);
            this.scrollGridRef = y();
            this.timeBodyScrollerElRef = y();
            this.spreadsheetHeaderChunkElRef = y();
            this.rootElRef = y();
            this.ensureScrollGridResizeId = 0;
            this.state = {
                resourceAreaWidthOverride: null,
            };
            /*
            ghetto debounce. don't race with ScrollGrid's resizing delay. solves #6140
            */
            this.ensureScrollGridResize = () => {
                if (this.ensureScrollGridResizeId) {
                    clearTimeout(this.ensureScrollGridResizeId);
                }
                this.ensureScrollGridResizeId = setTimeout(() => {
                    this.scrollGridRef.current.handleSizing(false);
                }, config.SCROLLGRID_RESIZE_INTERVAL + 1);
            };
        }
        render() {
            let { props, state, context } = this;
            let { options } = context;
            let stickyHeaderDates = !props.forPrint && getStickyHeaderDates(options);
            let stickyFooterScrollbar = !props.forPrint && getStickyFooterScrollbar(options);
            let sections = [
                {
                    type: 'header',
                    key: 'header',
                    syncRowHeights: true,
                    isSticky: stickyHeaderDates,
                    chunks: [
                        {
                            key: 'datagrid',
                            elRef: this.spreadsheetHeaderChunkElRef,
                            // TODO: allow the content to specify this. have general-purpose 'content' with obj with keys
                            tableClassName: 'fc-datagrid-header',
                            rowContent: props.spreadsheetHeaderRows,
                        },
                        {
                            key: 'divider',
                            outerContent: (h("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
                        },
                        {
                            key: 'timeline',
                            content: props.timeHeaderContent,
                        },
                    ],
                },
                {
                    type: 'body',
                    key: 'body',
                    syncRowHeights: true,
                    liquid: true,
                    expandRows: Boolean(options.expandRows),
                    chunks: [
                        {
                            key: 'datagrid',
                            tableClassName: 'fc-datagrid-body',
                            rowContent: props.spreadsheetBodyRows,
                        },
                        {
                            key: 'divider',
                            outerContent: (h("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
                        },
                        {
                            key: 'timeline',
                            scrollerElRef: this.timeBodyScrollerElRef,
                            content: props.timeBodyContent,
                        },
                    ],
                },
            ];
            if (stickyFooterScrollbar) {
                sections.push({
                    type: 'footer',
                    key: 'footer',
                    isSticky: true,
                    chunks: [
                        {
                            key: 'datagrid',
                            content: renderScrollShim,
                        },
                        {
                            key: 'divider',
                            outerContent: (h("td", { role: "presentation", className: 'fc-resource-timeline-divider ' + context.theme.getClass('tableCellShaded') })),
                        },
                        {
                            key: 'timeline',
                            content: renderScrollShim,
                        },
                    ],
                });
            }
            let resourceAreaWidth = state.resourceAreaWidthOverride != null
                ? state.resourceAreaWidthOverride
                : options.resourceAreaWidth;
            return (h(ScrollGrid, { ref: this.scrollGridRef, elRef: this.rootElRef, liquid: !props.isHeightAuto && !props.forPrint, collapsibleWidth: false, colGroups: [
                    { cols: props.spreadsheetCols, width: resourceAreaWidth },
                    { cols: [] },
                    { cols: props.timeCols },
                ], sections: sections }));
        }
        forceTimeScroll(left) {
            let scrollGrid = this.scrollGridRef.current;
            scrollGrid.forceScrollLeft(2, left); // 2 = the time area
        }
        forceResourceScroll(top) {
            let scrollGrid = this.scrollGridRef.current;
            scrollGrid.forceScrollTop(1, top); // 1 = the body
        }
        getResourceScroll() {
            let timeBodyScrollerEl = this.timeBodyScrollerElRef.current;
            return timeBodyScrollerEl.scrollTop;
        }
        // Resource Area Resizing
        // ------------------------------------------------------------------------------------------
        // NOTE: a callback Ref for the resizer was firing multiple times with same elements (Preact)
        // that's why we use spreadsheetResizerElRef instead
        componentDidMount() {
            this.initSpreadsheetResizing();
        }
        componentWillUnmount() {
            this.destroySpreadsheetResizing();
        }
        initSpreadsheetResizing() {
            let { isRtl, pluginHooks } = this.context;
            let ElementDraggingImpl = pluginHooks.elementDraggingImpl;
            let spreadsheetHeadEl = this.spreadsheetHeaderChunkElRef.current;
            if (ElementDraggingImpl) {
                let rootEl = this.rootElRef.current;
                let dragging = this.spreadsheetResizerDragging = new ElementDraggingImpl(rootEl, '.fc-resource-timeline-divider');
                let dragStartWidth;
                let viewWidth;
                dragging.emitter.on('dragstart', () => {
                    dragStartWidth = spreadsheetHeadEl.getBoundingClientRect().width;
                    viewWidth = rootEl.getBoundingClientRect().width;
                });
                dragging.emitter.on('dragmove', (pev) => {
                    let newWidth = dragStartWidth + pev.deltaX * (isRtl ? -1 : 1);
                    newWidth = Math.max(newWidth, MIN_RESOURCE_AREA_WIDTH);
                    newWidth = Math.min(newWidth, viewWidth - MIN_RESOURCE_AREA_WIDTH);
                    // scrollgrid will ignore resize requests if there are too many :|
                    this.setState({
                        resourceAreaWidthOverride: newWidth,
                    }, this.ensureScrollGridResize);
                });
                dragging.setAutoScrollEnabled(false); // because gets weird with auto-scrolling time area
            }
        }
        destroySpreadsheetResizing() {
            if (this.spreadsheetResizerDragging) {
                this.spreadsheetResizerDragging.destroy();
            }
        }
    }

    class ResourceTimelineView extends BaseComponent {
        constructor(props, context) {
            super(props, context);
            this.processColOptions = memoize(processColOptions);
            this.buildTimelineDateProfile = memoize(buildTimelineDateProfile);
            this.hasNesting = memoize(hasNesting);
            this.buildRowNodes = memoize(buildRowNodes);
            this.layoutRef = y();
            this.rowNodes = [];
            this.renderedRowNodes = [];
            this.buildRowIndex = memoize(buildRowIndex);
            this.handleSlatCoords = (slatCoords) => {
                this.setState({ slatCoords });
            };
            this.handleRowCoords = (rowCoords) => {
                this.rowCoords = rowCoords;
                this.scrollResponder.update(false); // TODO: could eliminate this if rowCoords lived in state
            };
            this.handleMaxCushionWidth = (slotCushionMaxWidth) => {
                this.setState({
                    slotCushionMaxWidth: Math.ceil(slotCushionMaxWidth), // for less rerendering TODO: DRY
                });
            };
            // Scrolling
            // ------------------------------------------------------------------------------------------------------------------
            // this is useful for scrolling prev/next dates while resource is scrolled down
            this.handleScrollLeftRequest = (scrollLeft) => {
                let layout = this.layoutRef.current;
                layout.forceTimeScroll(scrollLeft);
            };
            this.handleScrollRequest = (request) => {
                let { rowCoords } = this;
                let layout = this.layoutRef.current;
                let rowId = request.rowId || request.resourceId;
                if (rowCoords) {
                    if (rowId) {
                        let rowIdToIndex = this.buildRowIndex(this.renderedRowNodes);
                        let index = rowIdToIndex[rowId];
                        if (index != null) {
                            let scrollTop = (request.fromBottom != null ?
                                rowCoords.bottoms[index] - request.fromBottom : // pixels from bottom edge
                                rowCoords.tops[index] // just use top edge
                            );
                            layout.forceResourceScroll(scrollTop);
                        }
                    }
                    return true;
                }
                return null;
            };
            // Resource INDIVIDUAL-Column Area Resizing
            // ------------------------------------------------------------------------------------------
            this.handleColWidthChange = (colWidths) => {
                this.setState({
                    spreadsheetColWidths: colWidths,
                });
            };
            this.state = {
                resourceAreaWidth: context.options.resourceAreaWidth,
                spreadsheetColWidths: [],
            };
        }
        render() {
            let { props, state, context } = this;
            let { options, viewSpec } = context;
            let { superHeaderRendering, groupSpecs, orderSpecs, isVGrouping, colSpecs } = this.processColOptions(context.options);
            let tDateProfile = this.buildTimelineDateProfile(props.dateProfile, context.dateEnv, options, context.dateProfileGenerator);
            let rowNodes = this.rowNodes = this.buildRowNodes(props.resourceStore, groupSpecs, orderSpecs, isVGrouping, props.resourceEntityExpansions, options.resourcesInitiallyExpanded);
            let { slotMinWidth } = options;
            let slatCols = buildSlatCols(tDateProfile, slotMinWidth || this.computeFallbackSlotMinWidth(tDateProfile));
            return (h(ViewContainer$1, { elClasses: [
                    'fc-resource-timeline',
                    !this.hasNesting(rowNodes) && 'fc-resource-timeline-flat',
                    'fc-timeline',
                    options.eventOverlap === false ?
                        'fc-timeline-overlap-disabled' :
                        'fc-timeline-overlap-enabled',
                ], viewSpec: viewSpec },
                h(ResourceTimelineViewLayout, { ref: this.layoutRef, forPrint: props.forPrint, isHeightAuto: props.isHeightAuto, spreadsheetCols: buildSpreadsheetCols(colSpecs, state.spreadsheetColWidths, ''), spreadsheetHeaderRows: (contentArg) => (h(SpreadsheetHeader // TODO: rename to SpreadsheetHeaderRows
                    , { superHeaderRendering: superHeaderRendering, colSpecs: colSpecs, onColWidthChange: this.handleColWidthChange, rowInnerHeights: contentArg.rowSyncHeights })), spreadsheetBodyRows: (contentArg) => (h(p, null, this.renderSpreadsheetRows(rowNodes, colSpecs, contentArg.rowSyncHeights))), timeCols: slatCols, timeHeaderContent: (contentArg) => (h(TimelineHeader, { clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, dateProfile: props.dateProfile, tDateProfile: tDateProfile, slatCoords: state.slatCoords, rowInnerHeights: contentArg.rowSyncHeights, onMaxCushionWidth: slotMinWidth ? null : this.handleMaxCushionWidth })), timeBodyContent: (contentArg) => (h(ResourceTimelineGrid, { dateProfile: props.dateProfile, clientWidth: contentArg.clientWidth, clientHeight: contentArg.clientHeight, tableMinWidth: contentArg.tableMinWidth, tableColGroupNode: contentArg.tableColGroupNode, expandRows: contentArg.expandRows, tDateProfile: tDateProfile, rowNodes: rowNodes, businessHours: props.businessHours, dateSelection: props.dateSelection, eventStore: props.eventStore, eventUiBases: props.eventUiBases, eventSelection: props.eventSelection, eventDrag: props.eventDrag, eventResize: props.eventResize, resourceStore: props.resourceStore, nextDayThreshold: context.options.nextDayThreshold, rowInnerHeights: contentArg.rowSyncHeights, onSlatCoords: this.handleSlatCoords, onRowCoords: this.handleRowCoords, onScrollLeftRequest: this.handleScrollLeftRequest, onRowHeightChange: contentArg.reportRowHeightChange })) })));
        }
        renderSpreadsheetRows(nodes, colSpecs, rowSyncHeights) {
            return nodes.map((node, index) => {
                if (node.group) {
                    return (h(SpreadsheetGroupRow, { key: node.id, id: node.id, spreadsheetColCnt: colSpecs.length, isExpanded: node.isExpanded, group: node.group, innerHeight: rowSyncHeights[index] || '' }));
                }
                if (node.resource) {
                    return (h(SpreadsheetRow, { key: node.id, colSpecs: colSpecs, rowSpans: node.rowSpans, depth: node.depth, isExpanded: node.isExpanded, hasChildren: node.hasChildren, resource: node.resource, innerHeight: rowSyncHeights[index] || '' }));
                }
                return null;
            });
        }
        componentDidMount() {
            this.renderedRowNodes = this.rowNodes;
            this.scrollResponder = this.context.createScrollResponder(this.handleScrollRequest);
        }
        getSnapshotBeforeUpdate() {
            if (!this.props.forPrint) { // because print-view is always zero?
                return { resourceScroll: this.queryResourceScroll() };
            }
            return {};
        }
        componentDidUpdate(prevProps, prevState, snapshot) {
            this.renderedRowNodes = this.rowNodes;
            this.scrollResponder.update(prevProps.dateProfile !== this.props.dateProfile);
            if (snapshot.resourceScroll) {
                this.handleScrollRequest(snapshot.resourceScroll); // TODO: this gets triggered too often
            }
        }
        componentWillUnmount() {
            this.scrollResponder.detach();
        }
        computeFallbackSlotMinWidth(tDateProfile) {
            return Math.max(30, ((this.state.slotCushionMaxWidth || 0) / tDateProfile.slotsPerLabel));
        }
        queryResourceScroll() {
            let { rowCoords, renderedRowNodes } = this;
            if (rowCoords) {
                let layout = this.layoutRef.current;
                let trBottoms = rowCoords.bottoms;
                let scrollTop = layout.getResourceScroll();
                let scroll = {};
                for (let i = 0; i < trBottoms.length; i += 1) {
                    let rowNode = renderedRowNodes[i];
                    let elBottom = trBottoms[i] - scrollTop; // from the top of the scroller
                    if (elBottom > 0) {
                        scroll.rowId = rowNode.id;
                        scroll.fromBottom = elBottom;
                        break;
                    }
                }
                return scroll;
            }
            return null;
        }
    }
    ResourceTimelineView.addStateEquality({
        spreadsheetColWidths: isArraysEqual,
    });
    function buildRowIndex(rowNodes) {
        let rowIdToIndex = {};
        for (let i = 0; i < rowNodes.length; i += 1) {
            rowIdToIndex[rowNodes[i].id] = i;
        }
        return rowIdToIndex;
    }
    function buildSpreadsheetCols(colSpecs, forcedWidths, fallbackWidth = '') {
        return colSpecs.map((colSpec, i) => ({
            className: colSpec.isMain ? 'fc-main-col' : '',
            width: forcedWidths[i] || colSpec.width || fallbackWidth,
        }));
    }
    function hasNesting(nodes) {
        for (let node of nodes) {
            if (node.group) {
                return true;
            }
            if (node.resource) {
                if (node.hasChildren) {
                    return true;
                }
            }
        }
        return false;
    }
    function processColOptions(options) {
        let allColSpecs = options.resourceAreaColumns || [];
        let superHeaderRendering = null;
        if (!allColSpecs.length) {
            allColSpecs.push({
                headerClassNames: options.resourceAreaHeaderClassNames,
                headerContent: options.resourceAreaHeaderContent || 'Resources',
                headerDidMount: options.resourceAreaHeaderDidMount,
                headerWillUnmount: options.resourceAreaHeaderWillUnmount,
            });
        }
        else if (options.resourceAreaHeaderContent) { // weird way to determine if content
            superHeaderRendering = {
                headerClassNames: options.resourceAreaHeaderClassNames,
                headerContent: options.resourceAreaHeaderContent,
                headerDidMount: options.resourceAreaHeaderDidMount,
                headerWillUnmount: options.resourceAreaHeaderWillUnmount,
            };
        }
        let plainColSpecs = [];
        let groupColSpecs = []; // part of the colSpecs, but filtered out in order to put first
        let groupSpecs = [];
        let isVGrouping = false;
        for (let colSpec of allColSpecs) {
            if (colSpec.group) {
                groupColSpecs.push(Object.assign(Object.assign({}, colSpec), { cellClassNames: colSpec.cellClassNames || options.resourceGroupLabelClassNames, cellContent: colSpec.cellContent || options.resourceGroupLabelContent, cellDidMount: colSpec.cellDidMount || options.resourceGroupLabelDidMount, cellWillUnmount: colSpec.cellWillUnmount || options.resourceGroupLaneWillUnmount }));
            }
            else {
                plainColSpecs.push(colSpec);
            }
        }
        // BAD: mutates a user-supplied option
        let mainColSpec = plainColSpecs[0];
        mainColSpec.isMain = true;
        mainColSpec.cellClassNames = mainColSpec.cellClassNames || options.resourceLabelClassNames;
        mainColSpec.cellContent = mainColSpec.cellContent || options.resourceLabelContent;
        mainColSpec.cellDidMount = mainColSpec.cellDidMount || options.resourceLabelDidMount;
        mainColSpec.cellWillUnmount = mainColSpec.cellWillUnmount || options.resourceLabelWillUnmount;
        if (groupColSpecs.length) {
            groupSpecs = groupColSpecs;
            isVGrouping = true;
        }
        else {
            let hGroupField = options.resourceGroupField;
            if (hGroupField) {
                groupSpecs.push({
                    field: hGroupField,
                    labelClassNames: options.resourceGroupLabelClassNames,
                    labelContent: options.resourceGroupLabelContent,
                    labelDidMount: options.resourceGroupLabelDidMount,
                    labelWillUnmount: options.resourceGroupLabelWillUnmount,
                    laneClassNames: options.resourceGroupLaneClassNames,
                    laneContent: options.resourceGroupLaneContent,
                    laneDidMount: options.resourceGroupLaneDidMount,
                    laneWillUnmount: options.resourceGroupLaneWillUnmount,
                });
            }
        }
        let allOrderSpecs = options.resourceOrder || DEFAULT_RESOURCE_ORDER;
        let plainOrderSpecs = [];
        for (let orderSpec of allOrderSpecs) {
            let isGroup = false;
            for (let groupSpec of groupSpecs) {
                if (groupSpec.field === orderSpec.field) {
                    groupSpec.order = orderSpec.order; // -1, 0, 1
                    isGroup = true;
                    break;
                }
            }
            if (!isGroup) {
                plainOrderSpecs.push(orderSpec);
            }
        }
        return {
            superHeaderRendering,
            isVGrouping,
            groupSpecs,
            colSpecs: groupColSpecs.concat(plainColSpecs),
            orderSpecs: plainOrderSpecs,
        };
    }

    var css_248z = ".fc .fc-resource-timeline-divider{cursor:col-resize;width:3px}.fc .fc-resource-group{font-weight:inherit;text-align:inherit}.fc .fc-resource-timeline .fc-resource-group:not([rowspan]){background:var(--fc-neutral-bg-color)}.fc .fc-timeline-lane-frame{position:relative}.fc .fc-timeline-overlap-enabled .fc-timeline-lane-frame .fc-timeline-events{box-sizing:content-box;padding-bottom:10px}.fc-timeline-body-expandrows td.fc-timeline-lane{position:relative}.fc-timeline-body-expandrows .fc-timeline-lane-frame{position:static}.fc-datagrid-cell-frame-liquid{height:100%}.fc-liquid-hack .fc-datagrid-cell-frame-liquid{bottom:0;height:auto;left:0;position:absolute;right:0;top:0}.fc .fc-datagrid-header .fc-datagrid-cell-frame{align-items:center;display:flex;justify-content:flex-start;position:relative}.fc .fc-datagrid-cell-resizer{bottom:0;cursor:col-resize;position:absolute;top:0;width:5px;z-index:1}.fc .fc-datagrid-cell-cushion{overflow:hidden;padding:8px;white-space:nowrap}.fc .fc-datagrid-expander{cursor:pointer;opacity:.65}.fc .fc-datagrid-expander .fc-icon{display:inline-block;width:1em}.fc .fc-datagrid-expander-placeholder{cursor:auto}.fc .fc-resource-timeline-flat .fc-datagrid-expander-placeholder{display:none}.fc-direction-ltr .fc-datagrid-cell-resizer{right:-3px}.fc-direction-rtl .fc-datagrid-cell-resizer{left:-3px}.fc-direction-ltr .fc-datagrid-expander{margin-right:3px}.fc-direction-rtl .fc-datagrid-expander{margin-left:3px}";
    injectStyles(css_248z);

    var index = createPlugin({
        name: '@fullcalendar/resource-timeline',
        premiumReleaseDate: '2022-12-27',
        deps: [
            index$7,
            index$3,
            index$4,
        ],
        initialView: 'resourceTimelineDay',
        views: {
            resourceTimeline: {
                type: 'timeline',
                component: ResourceTimelineView,
                needsResourceData: true,
                resourceAreaWidth: '30%',
                resourcesInitiallyExpanded: true,
                eventResizableFromStart: true, // TODO: not DRY with this same setting in the main timeline config
            },
            resourceTimelineDay: {
                type: 'resourceTimeline',
                duration: { days: 1 },
            },
            resourceTimelineWeek: {
                type: 'resourceTimeline',
                duration: { weeks: 1 },
            },
            resourceTimelineMonth: {
                type: 'resourceTimeline',
                duration: { months: 1 },
            },
            resourceTimelineYear: {
                type: 'resourceTimeline',
                duration: { years: 1 },
            },
        },
    });

    globalPlugins.push(index$b, index$a, index$9, index$8, index$6, index$5, index$4, index$3, index$2, index$1, index);

    exports.Calendar = Calendar;
    exports.Draggable = ExternalDraggable;
    exports.Internal = internal;
    exports.JsonRequestError = JsonRequestError;
    exports.ThirdPartyDraggable = ThirdPartyDraggable;
    exports.createPlugin = createPlugin;
    exports.formatDate = formatDate;
    exports.formatRange = formatRange;
    exports.globalLocales = globalLocales;
    exports.globalPlugins = globalPlugins;
    exports.sliceEvents = sliceEvents;
    exports.version = version;

    Object.defineProperty(exports, '__esModule', { value: true });

    return exports;

})({});